Praziquantel
(FSVJFNAIGNNGKK-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(N1CC(=O)N2C(C1)c1ccccc1CC2)C1CCCCC1
- Type(s)
- Approved; Investigational; Vet_approved
- ATC code(s)
- P02BA01
- Molecular Formula:
- C19H24N2O2
- Molecular Weight:
- 312.406
- Log P:
- 2.4107
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 40.62
- CAS Number(s):
- 55268-74-1; 135526-78-2
Synonym(s)
1.
Praziquantel
2.
Biltricide
3.
Cesol
4.
Cisticid
5.
Cysticide
6.
Droncit
7.
Drontsit
8.
EMBAY 8440
9.
Prasiquantel
10.
Praziquantel, (+-)-Isomer
11.
Praziquantel, (R)-Isomer
12.
Praziquantel, (S)-Isomer
13.
Pyquiton
14.
Traziquantel
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Schistosomiasis | FAERS: 8 | 3897559 | CTD US FAERS |
| 2 | Drug ineffective | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 6 | SIDER US FAERS | |
| 4 | Urticaria | FAERS: 6 | SIDER US FAERS | |
| 5 | Dizziness | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Eosinophilia | FAERS: 4 | SIDER US FAERS | |
| 7 | Red blood cell schistocytes present | FAERS: 4 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 3 | CTD SIDER US FAERS | |
| 9 | Cerebral Infarction | FAERS: 3 | 3407004 | CTD US FAERS |
| 10 | Fatigue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | No adverse event | FAERS: 3 | US FAERS | |
| 12 | Portal Hypertension | FAERS: 3 | US FAERS | |
| 13 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 14 | Pruritus | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 15 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 16 | Angioedema | FAERS: 2 | US FAERS | |
| 17 | Anosognosia | FAERS: 2 | US FAERS | |
| 18 | Ascites | FAERS: 2 | US FAERS | |
| 19 | Chest Pain | FAERS: 2 | US FAERS | |
| 20 | Constipation | FAERS: 2 | US FAERS | |
| 21 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 22 | Headache | FAERS: 2 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 23 | Hypersensitivity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 25 | Mental impairment | FAERS: 2 | US FAERS | |
| 26 | Nausea | FAERS: 2 Canada Vigilance: 2 | CTD SIDER Canada Vigilance US FAERS | |
| 27 | Neurological decompensation | FAERS: 2 | US FAERS | |
| 28 | Pain | FAERS: 2 | 7330947 | CTD US FAERS |
| 29 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 30 | Portal fibrosis | FAERS: 2 | US FAERS | |
| 31 | Splenomegaly | FAERS: 2 | US FAERS | |
| 32 | Syncope | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 34 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 35 | Adverse event | FAERS: 1 | US FAERS | |
| 36 | Application site discharge | FAERS: 1 | US FAERS | |
| 37 | Arthropod bite | FAERS: 1 | US FAERS | |
| 38 | Asthenia | FAERS: 1 | SIDER US FAERS | |
| 39 | Bedridden | FAERS: 1 | US FAERS | |
| 40 | Bronchospasm | FAERS: 1 | US FAERS | |
| 41 | Chest discomfort | FAERS: 1 | US FAERS | |
| 42 | Cholestasis | FAERS: 1 | US FAERS | |
| 43 | Chromaturia | FAERS: 1 | US FAERS | |
| 44 | Conversion disorder | FAERS: 1 | US FAERS | |
| 45 | Crying | FAERS: 1 | US FAERS | |
| 46 | Cyst | FAERS: 1 | US FAERS | |
| 47 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 48 | Delirium | FAERS: 1 | US FAERS | |
| 49 | Disease recurrence | FAERS: 1 | US FAERS | |
| 50 | Dry skin | FAERS: 1 | US FAERS | |
| 51 | Erythema | FAERS: 1 | US FAERS | |
| 52 | Escherichia infection | FAERS: 1 | US FAERS | |
| 53 | Eyelash thickening | FAERS: 1 | US FAERS | |
| 54 | Feeling abnormal | FAERS: 1 | SIDER US FAERS | |
| 55 | Formication | FAERS: 1 | US FAERS | |
| 56 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 57 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 58 | Hymenolepiasis | FAERS: 1 | 3054764 | CTD US FAERS |
| 59 | Hypotension | FAERS: 1 | US FAERS | |
| 60 | Incoherent | FAERS: 1 | US FAERS | |
| 61 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 62 | Intention tremor | FAERS: 1 | US FAERS | |
| 63 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 64 | Lyme Disease | FAERS: 1 | US FAERS | |
| 65 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 66 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 67 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 68 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 69 | Oral discharge | FAERS: 1 | US FAERS | |
| 70 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 71 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 72 | Palpitations | FAERS: 1 | US FAERS | |
| 73 | Pancytopenia | FAERS: 1 | US FAERS | |
| 74 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 75 | Plague | FAERS: 1 | US FAERS | |
| 76 | Polyserositis | FAERS: 1 | SIDER US FAERS | |
| 77 | Product quality issue | FAERS: 1 | US FAERS | |
| 78 | Product use issue | FAERS: 1 | US FAERS | |
| 79 | Pterygium | FAERS: 1 | US FAERS | |
| 80 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 81 | Respiratory distress | FAERS: 1 | US FAERS | |
| 82 | Salmonella test positive | FAERS: 1 | US FAERS | |
| 83 | Scab | FAERS: 1 | US FAERS | |
| 84 | Skin lesion | FAERS: 1 | US FAERS | |
| 85 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 86 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 87 | Tremor | FAERS: 1 | US FAERS | |
| 88 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 89 | Visual disturbance | FAERS: 1 | US FAERS | |
| 90 | Vomiting | FAERS: 1 Canada Vigilance: 1 | 3897559 7330947 | CTD SIDER Canada Vigilance US FAERS |
| 91 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 92 | Wheezing | FAERS: 1 | US FAERS | |
| 93 | Abdominal discomfort | SIDER | ||
| 94 | Anorexia | SIDER | ||
| 95 | Arthralgia | Canada Vigilance: 1 | Canada Vigilance | |
| 96 | Atrioventricular Block | SIDER | ||
| 97 | Bradycardia | SIDER | ||
| 98 | Cardiovascular Diseases | 6673126 | CTD | |
| 99 | Cestode Infections | 17184919 17695802 21234239 | CTD | |
| 100 | Chemical and Drug Induced Liver Injury | 6673126 | CTD | |
| 101 | Cysticercosis | 9886213 | CTD | |
| 102 | Dermatitis | SIDER | ||
| 103 | Diarrhea | 3054764 3897559 | CTD | |
| 104 | Diphyllobothriasis | 7330947 | CTD | |
| 105 | Dirofilariasis | 25936435 | CTD | |
| 106 | Discomfort | SIDER | ||
| 107 | Dog Diseases | 17184919 18661153 19575233 | CTD | |
| 108 | Drowsiness | SIDER | ||
| 109 | Gastritis | 7330947 | CTD | |
| 110 | Gastrointestinal Pain | SIDER | ||
| 111 | Giardiasis | 18661153 19575233 | CTD | |
| 112 | Helminthiasis | 12886816 | CTD | |
| 113 | Intestinal Diseases, Parasitic | 17695802 | CTD | |
| 114 | Intracranial Hypertension | 11565520 | CTD | |
| 115 | Liver Cirrhosis, Experimental | 24818384 | CTD | |
| 116 | Liver Cirrhosis | 18473419 | CTD | |
| 117 | Mental disorders | 6673126 | CTD | |
| 118 | Myalgia | SIDER | ||
| 119 | Nematode infections | 17184919 21234239 | CTD | |
| 120 | Neurocysticercosis | CTD | ||
| 121 | Opisthorchiasis | 8896890 21256849 | CTD | |
| 122 | Paresthesia | 7330947 | CTD | |
| 123 | Schistosomiasis japonica | 6673126 24818384 | CTD | |
| 124 | Schistosomiasis mansoni | 8898462 29054683 | CTD | |
| 125 | Seizures | CTD | ||
| 126 | Somnolence | SIDER | ||
| 127 | Tachycardia | 7330947 | CTD | |
| 128 | Trematode Infections | 21234239 | CTD | |
| 129 | Ventricular Fibrillation | SIDER | ||
| 130 | Vertigo | SIDER | ||
| 131 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.