Phenytoin
(FJPYVLNWWICYDW-UHFFFAOYSA-M)
Structure
- SMILES
- O=C1[N-]C(=O)NC1(c1ccccc1)c1ccccc1.[Na+]
- Molecular Formula:
- C15H11N2NaO2
- Molecular Weight:
- 274.250
- Log P:
- 2.2130
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.17
- CAS Number(s):
- 630-93-3
Synonym(s)
1.
Phenytoin
2.
Diphenylhydantoin
3.
Fenitoin
4.
5,5-Diphenylhydantoin
5.
5,5-diphenylimidazolidine-2,4-dione
6.
Antisacer
7.
Difenin
8.
Dihydan
9.
Dilantin
10.
Epamin
11.
Epanutin
12.
Hydantol
13.
Phenytoin Sodium
14.
Sodium Diphenylhydantoinate
15.
Diphenylhydantoinate, Sodium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Pharmaceutical product complaint | FAERS: 32 | US FAERS | |
| 3 | Stevens-Johnson Syndrome | FAERS: 30 | US FAERS | |
| 4 | Toxicity to various agents | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Anticonvulsant drug level decreased | FAERS: 24 | US FAERS | |
| 6 | Anticonvulsant drug level increased | FAERS: 23 | US FAERS | |
| 7 | Drug level decreased | FAERS: 21 | US FAERS | |
| 8 | Dizziness | FAERS: 18 | US FAERS | |
| 9 | Toxic Epidermal Necrolysis | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Anticonvulsant drug level above therapeutic | FAERS: 17 | US FAERS | |
| 11 | Ataxia | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Malaise | FAERS: 15 | US FAERS | |
| 13 | Drug toxicity | FAERS: 14 | US FAERS | |
| 14 | Anticonvulsant drug level below therapeutic | FAERS: 13 | US FAERS | |
| 15 | Dysarthria | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Product substitution issue | FAERS: 12 | US FAERS | |
| 17 | Somnolence | FAERS: 12 | US FAERS | |
| 18 | Hypotension | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Bradycardia | FAERS: 10 | US FAERS | |
| 20 | Drug level increased | FAERS: 10 | US FAERS | |
| 21 | Erythema Multiforme | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Headache | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Nystagmus | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Nausea | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Overdose | FAERS: 8 | US FAERS | |
| 26 | Epilepsy | FAERS: 7 | US FAERS | |
| 27 | Erythema | FAERS: 7 | US FAERS | |
| 28 | Fatigue | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 30 | Lethargy | FAERS: 7 | US FAERS | |
| 31 | Lymphadenopathy | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Ophthalmoplegia | FAERS: 7 | US FAERS | |
| 33 | Vomiting | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 35 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 36 | Extravasation | FAERS: 6 | US FAERS | |
| 37 | Gingival Hypertrophy | FAERS: 6 | US FAERS | |
| 38 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 39 | Medication Error | FAERS: 6 | US FAERS | |
| 40 | Status Epilepticus | FAERS: 6 | US FAERS | |
| 41 | Tachycardia | FAERS: 6 | US FAERS | |
| 42 | Therapeutic response unexpected with drug substitution | FAERS: 6 | US FAERS | |
| 43 | Tremor | FAERS: 6 | US FAERS | |
| 44 | Asthenia | FAERS: 5 | US FAERS | |
| 45 | Drug level below therapeutic | FAERS: 5 | US FAERS | |
| 46 | Eosinophilia | FAERS: 5 | US FAERS | |
| 47 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 48 | Pain | FAERS: 5 | US FAERS | |
| 49 | Pruritus | FAERS: 5 | US FAERS | |
| 50 | Sinoatrial Block | FAERS: 5 | US FAERS | |
| 51 | Skin reaction | FAERS: 5 | US FAERS | |
| 52 | Urticaria | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 54 | Drug level fluctuating | FAERS: 4 | US FAERS | |
| 55 | Histiocytosis haematophagic | FAERS: 4 | US FAERS | |
| 56 | Hypoxia | FAERS: 4 | US FAERS | |
| 57 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 58 | Memory impairment | FAERS: 4 | US FAERS | |
| 59 | Mental impairment | FAERS: 4 | US FAERS | |
| 60 | Pulmonary vasculitis | FAERS: 4 | US FAERS | |
| 61 | Purple glove syndrome | FAERS: 4 | US FAERS | |
| 62 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 63 | Swelling | FAERS: 4 | US FAERS | |
| 64 | Syncope | FAERS: 4 | US FAERS | |
| 65 | Aura | FAERS: 3 | US FAERS | |
| 66 | Barbiturates positive | FAERS: 3 | US FAERS | |
| 67 | Blindness | FAERS: 3 | US FAERS | |
| 68 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 69 | Impaired work ability | FAERS: 3 | US FAERS | |
| 70 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 71 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 72 | Malabsorption | FAERS: 3 | US FAERS | |
| 73 | Mental status changes | FAERS: 3 | US FAERS | |
| 74 | Palpitations | FAERS: 3 | US FAERS | |
| 75 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 76 | Restlessness | FAERS: 3 | US FAERS | |
| 77 | Sudden death | FAERS: 3 | US FAERS | |
| 78 | Weight decreased | FAERS: 3 | US FAERS | |
| 79 | nervous system disorder | FAERS: 3 | US FAERS | |
| 80 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 81 | Agitation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Agranulocytosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Alopecia | FAERS: 2 | US FAERS | |
| 84 | Aphasia | FAERS: 2 | US FAERS | |
| 85 | Appendicitis | FAERS: 2 | US FAERS | |
| 86 | Arthropathy | FAERS: 2 | US FAERS | |
| 87 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 88 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 89 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 90 | Chemical injury | FAERS: 2 | US FAERS | |
| 91 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 92 | Disorientation | FAERS: 2 | US FAERS | |
| 93 | Drug dose omission | FAERS: 2 | US FAERS | |
| 94 | Drug level changed | FAERS: 2 | US FAERS | |
| 95 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 96 | Gangrene | FAERS: 2 | US FAERS | |
| 97 | Gingival Hyperplasia | FAERS: 2 | US FAERS | |
| 98 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 99 | Incontinence | FAERS: 2 | US FAERS | |
| 100 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 101 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 102 | Medication residue present | FAERS: 2 | US FAERS | |
| 103 | Mydriasis | FAERS: 2 | US FAERS | |
| 104 | Neutropenia | FAERS: 2 | US FAERS | |
| 105 | Occupational exposure to drug | FAERS: 2 | US FAERS | |
| 106 | Optic Atrophy | FAERS: 2 | US FAERS | |
| 107 | Pancytopenia | FAERS: 2 | US FAERS | |
| 108 | Panniculitis | FAERS: 2 | US FAERS | |
| 109 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 110 | Pneumonitis | FAERS: 2 | US FAERS | |
| 111 | Product quality issue | FAERS: 2 | US FAERS | |
| 112 | Product use issue | FAERS: 2 | US FAERS | |
| 113 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 114 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 115 | Sepsis | FAERS: 2 | US FAERS | |
| 116 | Stupor | FAERS: 2 | US FAERS | |
| 117 | Tinnitus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Tooth Loss | FAERS: 2 | US FAERS | |
| 119 | Unevaluable event | FAERS: 2 | US FAERS | |
| 120 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 121 | Vertigo | FAERS: 2 | US FAERS | |
| 122 | jaundice | FAERS: 2 | US FAERS | |
| 123 | Abasia | FAERS: 1 | US FAERS | |
| 124 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 125 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 126 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 127 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 128 | Accidental exposure | FAERS: 1 | US FAERS | |
| 129 | Accidental overdose | FAERS: 1 | US FAERS | |
| 130 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 131 | Adverse event | FAERS: 1 | US FAERS | |
| 132 | Albuminuria | FAERS: 1 | US FAERS | |
| 133 | Amputation | FAERS: 1 | US FAERS | |
| 134 | Anorexia | FAERS: 1 | US FAERS | |
| 135 | Anticonvulsant drug level abnormal | FAERS: 1 | US FAERS | |
| 136 | Anuria | FAERS: 1 | US FAERS | |
| 137 | Anxiety | FAERS: 1 | US FAERS | |
| 138 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 139 | Arthralgia | FAERS: 1 | US FAERS | |
| 140 | Arthropod bite | FAERS: 1 | US FAERS | |
| 141 | Atelectasis | FAERS: 1 | US FAERS | |
| 142 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 143 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 144 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 145 | Back Pain | FAERS: 1 | US FAERS | |
| 146 | Bladder cancer stage IV | FAERS: 1 | US FAERS | |
| 147 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 148 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 149 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 150 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 151 | Bone pain | FAERS: 1 | US FAERS | |
| 152 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 153 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 154 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 155 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 156 | Chest discomfort | FAERS: 1 | US FAERS | |
| 157 | Cholestasis | FAERS: 1 | US FAERS | |
| 158 | Chorea | FAERS: 1 | US FAERS | |
| 159 | Chorioamnionitis | FAERS: 1 | US FAERS | |
| 160 | Cold sweat | FAERS: 1 | US FAERS | |
| 161 | Conjunctivitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Constipation | FAERS: 1 | US FAERS | |
| 163 | Corneal epithelium defect | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Corrective lens user | FAERS: 1 | US FAERS | |
| 165 | Cyanosis | FAERS: 1 | US FAERS | |
| 166 | Deafness | FAERS: 1 | US FAERS | |
| 167 | Dermatitis | FAERS: 1 | US FAERS | |
| 168 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 169 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 170 | Drug screen positive | FAERS: 1 | US FAERS | |
| 171 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 172 | Dysmorphism | FAERS: 1 | US FAERS | |
| 173 | Dyspepsia | FAERS: 1 | US FAERS | |
| 174 | Economic problem | FAERS: 1 | US FAERS | |
| 175 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 176 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 177 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 178 | Epistaxis | FAERS: 1 | US FAERS | |
| 179 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 180 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 181 | Eye inflammation | FAERS: 1 | US FAERS | |
| 182 | Eye pain | FAERS: 1 | US FAERS | |
| 183 | Facial Pain | FAERS: 1 | US FAERS | |
| 184 | Feeling jittery | FAERS: 1 | US FAERS | |
| 185 | Flushing | FAERS: 1 | US FAERS | |
| 186 | Fungal cystitis | FAERS: 1 | US FAERS | |
| 187 | Gastrostomy | FAERS: 1 | US FAERS | |
| 188 | Glucocorticoids decreased | FAERS: 1 | US FAERS | |
| 189 | Hepatitis | FAERS: 1 | US FAERS | |
| 190 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 191 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 192 | Herbal interaction | FAERS: 1 | US FAERS | |
| 193 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 194 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 195 | Hypersomnia | FAERS: 1 | US FAERS | |
| 196 | Hypodontia | FAERS: 1 | US FAERS | |
| 197 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 198 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 199 | Impaired insulin secretion | FAERS: 1 | US FAERS | |
| 200 | Incoherent | FAERS: 1 | US FAERS | |
| 201 | Infection | FAERS: 1 | US FAERS | |
| 202 | Inflammation | FAERS: 1 | US FAERS | |
| 203 | Influenza | FAERS: 1 | US FAERS | |
| 204 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 205 | Infusion site warmth | FAERS: 1 | US FAERS | |
| 206 | Injection site erythema | FAERS: 1 | US FAERS | |
| 207 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 208 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 209 | Laceration | FAERS: 1 | US FAERS | |
| 210 | Leukocytosis | FAERS: 1 | US FAERS | |
| 211 | Loss of proprioception | FAERS: 1 | US FAERS | |
| 212 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 213 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 214 | Lymphopenia | FAERS: 1 | US FAERS | |
| 215 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 216 | Medication residue | FAERS: 1 | US FAERS | |
| 217 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 218 | Metastasis | FAERS: 1 | US FAERS | |
| 219 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 220 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 221 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 222 | Nasopharyngeal reflux | FAERS: 1 | US FAERS | |
| 223 | Necrosis | FAERS: 1 | US FAERS | |
| 224 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 225 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 226 | Neuropathic pain | FAERS: 1 | US FAERS | |
| 227 | Obesity | FAERS: 1 | US FAERS | |
| 228 | Osteomalacia | FAERS: 1 | US FAERS | |
| 229 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 230 | Osteoporosis | FAERS: 1 | US FAERS | |
| 231 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 232 | Papule | FAERS: 1 | US FAERS | |
| 233 | Pelvic kidney | FAERS: 1 | US FAERS | |
| 234 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 235 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 236 | Pneumonia | FAERS: 1 | US FAERS | |
| 237 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 238 | Procedural complication | FAERS: 1 | US FAERS | |
| 239 | Product physical issue | FAERS: 1 | US FAERS | |
| 240 | Product prescribing error | FAERS: 1 | US FAERS | |
| 241 | Product substitution | FAERS: 1 | US FAERS | |
| 242 | Productive Cough | FAERS: 1 | US FAERS | |
| 243 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 244 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 245 | Respiratory distress | FAERS: 1 | US FAERS | |
| 246 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 247 | Retching | FAERS: 1 | US FAERS | |
| 248 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 249 | Screaming | FAERS: 1 | US FAERS | |
| 250 | Septic Shock | FAERS: 1 | US FAERS | |
| 251 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 252 | Sinusitis | FAERS: 1 | US FAERS | |
| 253 | Skin laceration | FAERS: 1 | US FAERS | |
| 254 | Somnambulism | FAERS: 1 | US FAERS | |
| 255 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 256 | Staring | FAERS: 1 | US FAERS | |
| 257 | Stillbirth | FAERS: 1 | US FAERS | |
| 258 | Stridor | FAERS: 1 | US FAERS | |
| 259 | Subcorneal pustular dermatosis | FAERS: 1 | US FAERS | |
| 260 | Suicide attempt | FAERS: 1 | US FAERS | |
| 261 | Symblepharon | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 262 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 263 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 264 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 265 | Thrombosis | FAERS: 1 | US FAERS | |
| 266 | Tongue biting | FAERS: 1 | US FAERS | |
| 267 | Tracheitis | FAERS: 1 | US FAERS | |
| 268 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 269 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 270 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 271 | Urinary Retention | FAERS: 1 | US FAERS | |
| 272 | Vasculitis | FAERS: 1 | US FAERS | |
| 273 | Vasospasm | FAERS: 1 | US FAERS | |
| 274 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 275 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 276 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 277 | Walking aid user | FAERS: 1 | US FAERS | |
| 278 | Wheelchair user | FAERS: 1 | US FAERS | |
| 279 | Wheezing | FAERS: 1 | US FAERS | |
| 280 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 281 | Alanine Aminotransferase Increased | Canada Vigilance: 1 | Canada Vigilance | |
| 282 | Aspartate Aminotransferase Increased | Canada Vigilance: 1 | Canada Vigilance | |
| 283 | Asthma | Canada Vigilance: 1 | Canada Vigilance | |
| 284 | Burning sensation | Canada Vigilance: 1 | Canada Vigilance | |
| 285 | Delirium | Canada Vigilance: 1 | Canada Vigilance | |
| 286 | Diplopia | Canada Vigilance: 1 | Canada Vigilance | |
| 287 | Hypertrichosis | Canada Vigilance: 1 | Canada Vigilance | |
| 288 | Hyporesponsive to stimuli | Canada Vigilance: 1 | Canada Vigilance | |
| 289 | Leukopenia | Canada Vigilance: 1 | Canada Vigilance | |
| 290 | Limb discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 291 | Serum Sickness | Canada Vigilance: 1 | Canada Vigilance | |
| 292 | Stomatitis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.