Aprotinin
(ZPNFWUPYTFPOJU-LPYSRVMUSA-N)
Structure
- SMILES
- NCCCC[C@@H]1NC(=O)[C@@H]2CSSC[C@@H]3NC(=O)CNC(=O)CNC(=O)[C@H](Cc4ccc(cc4)O)NC(=O)[C@@H](NC(=O)[C@H](Cc4ccccc4)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC3=O)CCCNC(=N)N)C)CCCCN)CCCNC(=N)N)CC(=O)N)CC(=O)N)Cc3ccccc3)CCCCN)CO)C)CCC(=O)O)C(=O)N[C@@H](CCSC)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N3[C@H](C(=O)N4[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N5[C@H](C(=O)N2)CCC5)[C@H](O)C)Cc2ccc(cc2)O)CCC4)CCC3)CCC(=O)O)CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]2CCCN2C(=O)[C@H](CCCNC(=N)N)N)CC(=O)O)Cc2ccccc2)C(=O)NCC(=O)NCC(=O)N[C@H](C(=O)O)C)[C@H](O)C)CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC1=O)C)CCCNC(=N)N)[C@H](CC)C)[C@H](CC)C)CCCNC(=N)N)Cc1ccc(cc1)O)Cc1ccccc1)Cc1ccc(cc1)O)CC(=O)N)C)CCCCN)C)[C@H](O)C)C(C)C
- Molecular Formula:
- C284H432N84O79S7
- Molecular Weight:
- 6511.440
- Log P:
- 4.3069
- Hydrogen Bond Acceptor:
- 170
- Hydrogen Bond Donor:
- 93
- TPSA:
- 2822.84
- CAS Number(s):
- 9087-70-1
Synonym(s)
1.
Aprotinin
2.
BPTI, Basic Pancreatic Trypsin Inhibitor
3.
Basic Pancreatic Trypsin Inhibitor
4.
Bovine Kunitz Pancreatic Trypsin Inhibitor
5.
Kallikrein-Trypsin Inactivator
6.
Kunitz Pancreatic Trypsin Inhibitor
7.
Trypsin Inhibitor, Basic, Pancreatic
8.
Trypsin Inhibitor, Kunitz, Pancreatic
9.
Antilysin
10.
Bovine Pancreatic Trypsin Inhibitor
11.
Contrical
12.
Contrykal
13.
Dilmintal
14.
Iniprol
15.
Kontrikal
16.
Kontrykal
17.
Pulmin
18.
Traskolan
19.
Trasylol
20.
Zymofren
21.
Inactivator, Kallikrein-Trypsin
22.
Kallikrein Trypsin Inactivator
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 5282 | US FAERS | |
| 2 | Unevaluable event | FAERS: 4811 | US FAERS | |
| 3 | Anxiety | FAERS: 4751 | US FAERS | |
| 4 | Emotional distress | FAERS: 3652 | US FAERS | |
| 5 | Anhedonia | FAERS: 3529 | US FAERS | |
| 6 | Stress | FAERS: 3112 | US FAERS | |
| 7 | Cerebrovascular accident | FAERS: 793 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Disability | FAERS: 361 | US FAERS | |
| 9 | Nervousness | FAERS: 338 | US FAERS | |
| 10 | Myocardial Infarction | FAERS: 258 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Post procedural complication | FAERS: 62 | US FAERS | |
| 12 | Adverse event | FAERS: 50 | US FAERS | |
| 13 | Cardiac Arrest | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Activities of daily living impaired | FAERS: 35 | US FAERS | |
| 15 | Emotional disorder | FAERS: 35 | US FAERS | |
| 16 | Hypotension | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | General physical health deterioration | FAERS: 33 | US FAERS | |
| 18 | Respiratory Failure | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Procedural complication | FAERS: 21 | US FAERS | |
| 20 | Hypersensitivity | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Thrombosis | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | Postoperative renal failure | FAERS: 18 | US FAERS | |
| 23 | Pulmonary Embolism | FAERS: 18 | US FAERS | |
| 24 | Blood creatinine increased | FAERS: 17 | US FAERS | |
| 25 | Graft thrombosis | FAERS: 17 | US FAERS | |
| 26 | Anaphylactic shock | FAERS: 16 | US FAERS | |
| 27 | Asthenia | FAERS: 13 | US FAERS | |
| 28 | Sepsis | FAERS: 13 | US FAERS | |
| 29 | Bradycardia | FAERS: 11 | US FAERS | |
| 30 | Coronary Artery Disease | FAERS: 11 | US FAERS | |
| 31 | Drug ineffective | FAERS: 11 | US FAERS | |
| 32 | Deformity | FAERS: 10 | US FAERS | |
| 33 | Disseminated Intravascular Coagulation | FAERS: 10 | US FAERS | |
| 34 | Pharmaceutical product complaint | FAERS: 10 | US FAERS | |
| 35 | Septic Shock | FAERS: 9 | US FAERS | |
| 36 | Embolic stroke | FAERS: 8 | US FAERS | |
| 37 | Wound Infection | FAERS: 8 | US FAERS | |
| 38 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 39 | Feeding tube complication | FAERS: 7 | US FAERS | |
| 40 | Hypoxia | FAERS: 7 | US FAERS | |
| 41 | Mental impairment | FAERS: 7 | US FAERS | |
| 42 | Wound decomposition | FAERS: 7 | US FAERS | |
| 43 | Cardiac procedure complication | FAERS: 6 | US FAERS | |
| 44 | Hemiparesis | FAERS: 6 | US FAERS | |
| 45 | Pneumonia | FAERS: 6 | US FAERS | |
| 46 | Amnesia | FAERS: 5 | US FAERS | |
| 47 | Arterial thrombosis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Arteriosclerosis | FAERS: 5 | US FAERS | |
| 49 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 50 | General physical condition abnormal | FAERS: 5 | US FAERS | |
| 51 | Infection | FAERS: 5 | US FAERS | |
| 52 | Metabolic acidosis | FAERS: 5 | US FAERS | |
| 53 | Tachycardia | FAERS: 5 | US FAERS | |
| 54 | Tension | FAERS: 5 | US FAERS | |
| 55 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 56 | Angioplasty | FAERS: 4 | US FAERS | |
| 57 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 58 | Erythema | FAERS: 4 | US FAERS | |
| 59 | Gangrene | FAERS: 4 | US FAERS | |
| 60 | Life expectancy shortened | FAERS: 4 | US FAERS | |
| 61 | No adverse event | FAERS: 4 | US FAERS | |
| 62 | Physical disability | FAERS: 4 | US FAERS | |
| 63 | Renal Artery Stenosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 65 | nervous system disorder | FAERS: 4 | US FAERS | |
| 66 | Acidosis | FAERS: 3 | US FAERS | |
| 67 | Amputation | FAERS: 3 | US FAERS | |
| 68 | Blindness | FAERS: 3 | US FAERS | |
| 69 | Bronchospasm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Cardiopulmonary Bypass | FAERS: 3 | US FAERS | |
| 71 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 72 | Depressed mood | FAERS: 3 | US FAERS | |
| 73 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 74 | Ototoxicity | FAERS: 3 | US FAERS | |
| 75 | Post procedural infection | FAERS: 3 | US FAERS | |
| 76 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 77 | Septic embolus | FAERS: 3 | US FAERS | |
| 78 | Shock | FAERS: 3 | US FAERS | |
| 79 | Swelling | FAERS: 3 | US FAERS | |
| 80 | Thrombophlebitis | FAERS: 3 | US FAERS | |
| 81 | Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 82 | Weight decreased | FAERS: 3 | US FAERS | |
| 83 | Ageusia | FAERS: 2 | US FAERS | |
| 84 | Albumin globulin ratio abnormal | FAERS: 2 | US FAERS | |
| 85 | Antibody test positive | FAERS: 2 | US FAERS | |
| 86 | Atrial thrombosis | FAERS: 2 | US FAERS | |
| 87 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 88 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 89 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 90 | Cardiac valve replacement complication | FAERS: 2 | US FAERS | |
| 91 | Chest Pain | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 92 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 93 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 94 | Coronary artery reocclusion | FAERS: 2 | US FAERS | |
| 95 | Dementia | FAERS: 2 | US FAERS | |
| 96 | Difficult to wean from ventilator | FAERS: 2 | US FAERS | |
| 97 | Disease recurrence | FAERS: 2 | US FAERS | |
| 98 | Dysgeusia | FAERS: 2 | US FAERS | |
| 99 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 100 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 101 | Embolism | FAERS: 2 | US FAERS | |
| 102 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 103 | Globulin abnormal | FAERS: 2 | US FAERS | |
| 104 | Heparin-induced thrombocytopenia | FAERS: 2 | US FAERS | |
| 105 | Incontinence | FAERS: 2 | US FAERS | |
| 106 | Infarction | FAERS: 2 | US FAERS | |
| 107 | Influenza | FAERS: 2 | US FAERS | |
| 108 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 109 | Medical device complication | FAERS: 2 | US FAERS | |
| 110 | Memory impairment | FAERS: 2 | US FAERS | |
| 111 | Mumps | FAERS: 2 | US FAERS | |
| 112 | Myoglobinaemia | FAERS: 2 | US FAERS | |
| 113 | Phlebitis | FAERS: 2 | US FAERS | |
| 114 | Procedural hypertension | FAERS: 2 | US FAERS | |
| 115 | Protein total abnormal | FAERS: 2 | US FAERS | |
| 116 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 117 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 118 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 119 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 120 | Tracheobronchitis | FAERS: 2 | US FAERS | |
| 121 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 122 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 123 | Abdominal Pain | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 124 | Accidental exposure | FAERS: 1 | US FAERS | |
| 125 | Activated partial thromboplastin time abnormal | FAERS: 1 | US FAERS | |
| 126 | Agitation | FAERS: 1 | US FAERS | |
| 127 | Anorexia | FAERS: 1 | US FAERS | |
| 128 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 129 | Aortic surgery | FAERS: 1 | US FAERS | |
| 130 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 131 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 132 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 133 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 134 | Blood urea increased | FAERS: 1 | US FAERS | |
| 135 | Brain Death | FAERS: 1 | US FAERS | |
| 136 | Cardiac Death | FAERS: 1 | US FAERS | |
| 137 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 138 | Catheter related complication | FAERS: 1 | US FAERS | |
| 139 | Cellulitis | FAERS: 1 | US FAERS | |
| 140 | Clumsiness | FAERS: 1 | US FAERS | |
| 141 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 142 | Coronary bypass thrombosis | FAERS: 1 | US FAERS | |
| 143 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 144 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 145 | Dependence on enabling machine or device | FAERS: 1 | US FAERS | |
| 146 | Diplopia | FAERS: 1 | US FAERS | |
| 147 | Dizziness | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 148 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 149 | Dysarthria | FAERS: 1 | US FAERS | |
| 150 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 151 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 152 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 153 | Gout | FAERS: 1 | US FAERS | |
| 154 | Headache | FAERS: 1 | US FAERS | |
| 155 | Hemiplegia | FAERS: 1 | US FAERS | |
| 156 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 157 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 158 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 159 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 160 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 161 | Injection site erythema | FAERS: 1 | US FAERS | |
| 162 | Injection site pain | FAERS: 1 | US FAERS | |
| 163 | Joint stiffness | FAERS: 1 | US FAERS | |
| 164 | Medication Error | FAERS: 1 | US FAERS | |
| 165 | Mental status changes | FAERS: 1 | US FAERS | |
| 166 | Mydriasis | FAERS: 1 | US FAERS | |
| 167 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 168 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 169 | PCO2 abnormal | FAERS: 1 | US FAERS | |
| 170 | Pericarditis | FAERS: 1 | US FAERS | |
| 171 | Polyserositis | FAERS: 1 | US FAERS | |
| 172 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 173 | Postpericardiotomy Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Presyncope | FAERS: 1 | US FAERS | |
| 175 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 176 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 177 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 178 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 179 | Purulent discharge | FAERS: 1 | US FAERS | |
| 180 | Renal aneurysm | FAERS: 1 | US FAERS | |
| 181 | Renal cyst | FAERS: 1 | US FAERS | |
| 182 | Respiratory distress | FAERS: 1 | US FAERS | |
| 183 | Somnolence | FAERS: 1 | US FAERS | |
| 184 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 185 | Syncope | FAERS: 1 | US FAERS | |
| 186 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 187 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 188 | Tremor | FAERS: 1 | US FAERS | |
| 189 | Vascular resistance systemic decreased | FAERS: 1 | US FAERS | |
| 190 | Vasodilation procedure | FAERS: 1 | US FAERS | |
| 191 | Vein pain | FAERS: 1 | US FAERS | |
| 192 | Venous occlusion | FAERS: 1 | US FAERS | |
| 193 | Visual disturbance | FAERS: 1 | US FAERS | |
| 194 | Fatigue | Canada Vigilance: 1 | Canada Vigilance | |
| 195 | Flushing | Canada Vigilance: 1 | Canada Vigilance | |
| 196 | Laryngospasm | Canada Vigilance: 1 | Canada Vigilance | |
| 197 | Pericardial effusion | Canada Vigilance: 1 | Canada Vigilance | |
| 198 | Pruritus | Canada Vigilance: 2 | Canada Vigilance | |
| 199 | Urticaria | Canada Vigilance: 1 | Canada Vigilance | |
| 200 | Vomiting | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.