Tapentadol
(ZELFLGGRLLOERW-YECZQDJWSA-N)
Structure
- SMILES
- CC[C@@H](c1cccc(c1)O)[C@H](CN(C)C)C.Cl
- Molecular Formula:
- C14H24ClNO
- Molecular Weight:
- 257.799
- Log P:
- 3.8855
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 2
- TPSA:
- 23.47
- CAS Number(s):
- 175591-09-0
Synonym(s)
1.
Tapentadol
2.
3-((1R,2R)-3-(dimethylamino)-1-ethyl-2-methylpropyl)phenol
3.
Nucynta
4.
Tapentadol Hydrochloride
External Link(s)
| MeSH | D000077432 |
| PubChem Compound | 118387917 139064694 9838021 |
| CHEMBL | CHEMBL1201777 |
| KEGG | dr:D10199 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug dose omission | FAERS: 64 | US FAERS | |
| 3 | Adverse event | FAERS: 49 | US FAERS | |
| 4 | Somnolence | FAERS: 49 | US FAERS | |
| 5 | Nausea | FAERS: 45 | US FAERS | |
| 6 | Pain | FAERS: 41 | US FAERS | |
| 7 | Headache | FAERS: 37 | US FAERS | |
| 8 | Dizziness | FAERS: 35 | US FAERS | |
| 9 | Overdose | FAERS: 25 | US FAERS | |
| 10 | Delirium | FAERS: 24 | US FAERS | |
| 11 | Drug withdrawal syndrome | FAERS: 24 | US FAERS | |
| 12 | Suicide attempt | FAERS: 24 | US FAERS | |
| 13 | Serotonin Syndrome | FAERS: 23 | US FAERS | |
| 14 | Urinary Retention | FAERS: 21 | US FAERS | |
| 15 | Malaise | FAERS: 20 | US FAERS | |
| 16 | Product distribution issue | FAERS: 20 | US FAERS | |
| 17 | Accidental exposure to product by child | FAERS: 19 | US FAERS | |
| 18 | Drug dose titration not performed | FAERS: 19 | US FAERS | |
| 19 | Product use in unapproved indication | FAERS: 19 | US FAERS | |
| 20 | Anxiety | FAERS: 17 | US FAERS | |
| 21 | Drug prescribing error | FAERS: 17 | US FAERS | |
| 22 | Pruritus | FAERS: 17 | US FAERS | |
| 23 | Tachycardia | FAERS: 17 | US FAERS | |
| 24 | Product quality issue | FAERS: 16 | US FAERS | |
| 25 | Vomiting | FAERS: 16 | US FAERS | |
| 26 | Feeling abnormal | FAERS: 15 | US FAERS | |
| 27 | Fatigue | FAERS: 14 | US FAERS | |
| 28 | Palpitations | FAERS: 14 | US FAERS | |
| 29 | Tremor | FAERS: 14 | US FAERS | |
| 30 | Chest Pain | FAERS: 13 | US FAERS | |
| 31 | Constipation | FAERS: 13 | US FAERS | |
| 32 | Malignant neoplasm progression | FAERS: 13 | US FAERS | |
| 33 | Product dose omission | FAERS: 13 | US FAERS | |
| 34 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 35 | Agitation | FAERS: 10 | US FAERS | |
| 36 | Drug screen positive | FAERS: 10 | US FAERS | |
| 37 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 38 | Hypotension | FAERS: 10 | US FAERS | |
| 39 | Abdominal Pain | FAERS: 9 | US FAERS | |
| 40 | Amnesia | FAERS: 9 | US FAERS | |
| 41 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 42 | Drug abuse | FAERS: 8 | US FAERS | |
| 43 | Ileus | FAERS: 8 | US FAERS | |
| 44 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 45 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 46 | Lethargy | FAERS: 8 | US FAERS | |
| 47 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 48 | Chest discomfort | FAERS: 7 | US FAERS | |
| 49 | Disorientation | FAERS: 7 | US FAERS | |
| 50 | Drug administration error | FAERS: 7 | US FAERS | |
| 51 | Restlessness | FAERS: 7 | US FAERS | |
| 52 | Syncope | FAERS: 7 | US FAERS | |
| 53 | Unevaluable event | FAERS: 7 | US FAERS | |
| 54 | Asthma | FAERS: 6 | US FAERS | |
| 55 | Breakthrough Pain | FAERS: 6 | US FAERS | |
| 56 | Crying | FAERS: 6 | US FAERS | |
| 57 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 58 | Drug effect incomplete | FAERS: 6 | US FAERS | |
| 59 | Flushing | FAERS: 6 | US FAERS | |
| 60 | Hypophagia | FAERS: 6 | US FAERS | |
| 61 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 62 | Product use issue | FAERS: 6 | US FAERS | |
| 63 | Respiratory Depression | FAERS: 6 | US FAERS | |
| 64 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 65 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 66 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 67 | Drug Dependence | FAERS: 5 | US FAERS | |
| 68 | Drug diversion | FAERS: 5 | US FAERS | |
| 69 | Drug screen false positive | FAERS: 5 | US FAERS | |
| 70 | Medication Error | FAERS: 5 | US FAERS | |
| 71 | No adverse event | FAERS: 5 | US FAERS | |
| 72 | Unresponsive to stimuli | FAERS: 5 | US FAERS | |
| 73 | Urticaria | FAERS: 5 | US FAERS | |
| 74 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 75 | Burning sensation | FAERS: 4 | US FAERS | |
| 76 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 77 | Dysarthria | FAERS: 4 | US FAERS | |
| 78 | Euphoric mood | FAERS: 4 | US FAERS | |
| 79 | Feeling jittery | FAERS: 4 | US FAERS | |
| 80 | Hypersomnia | FAERS: 4 | US FAERS | |
| 81 | Memory impairment | FAERS: 4 | US FAERS | |
| 82 | Mood swings | FAERS: 4 | US FAERS | |
| 83 | Nervousness | FAERS: 4 | US FAERS | |
| 84 | Neuralgia | FAERS: 4 | US FAERS | |
| 85 | Pancreatitis | FAERS: 4 | US FAERS | |
| 86 | Pneumonia | FAERS: 4 | US FAERS | |
| 87 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 88 | Visual Impairment | FAERS: 4 | US FAERS | |
| 89 | Alopecia | FAERS: 3 | US FAERS | |
| 90 | Asthenia | FAERS: 3 | US FAERS | |
| 91 | Bedridden | FAERS: 3 | US FAERS | |
| 92 | Bradyphrenia | FAERS: 3 | US FAERS | |
| 93 | Bronchospasm | FAERS: 3 | US FAERS | |
| 94 | Depressed mood | FAERS: 3 | US FAERS | |
| 95 | Disease Progression | FAERS: 3 | US FAERS | |
| 96 | Drug screen negative | FAERS: 3 | US FAERS | |
| 97 | Dysphonia | FAERS: 3 | US FAERS | |
| 98 | Emotional distress | FAERS: 3 | US FAERS | |
| 99 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 100 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 101 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 102 | Head discomfort | FAERS: 3 | US FAERS | |
| 103 | Impaired work ability | FAERS: 3 | US FAERS | |
| 104 | Mental impairment | FAERS: 3 | US FAERS | |
| 105 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 106 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 107 | Transaminases increased | FAERS: 3 | US FAERS | |
| 108 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 109 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 110 | Akathisia | FAERS: 2 | US FAERS | |
| 111 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 112 | Back Pain | FAERS: 2 | US FAERS | |
| 113 | Blindness | FAERS: 2 | US FAERS | |
| 114 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 115 | Bradycardia | FAERS: 2 | US FAERS | |
| 116 | Burning feet syndrome | FAERS: 2 | US FAERS | |
| 117 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 118 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 119 | Chills | FAERS: 2 | US FAERS | |
| 120 | Cyanosis | FAERS: 2 | US FAERS | |
| 121 | Dehydration | FAERS: 2 | US FAERS | |
| 122 | Dementia | FAERS: 2 | US FAERS | |
| 123 | Discomfort | FAERS: 2 | US FAERS | |
| 124 | Diverticulitis | FAERS: 2 | US FAERS | |
| 125 | Dreamy state | FAERS: 2 | US FAERS | |
| 126 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 127 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 128 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 129 | Dyspepsia | FAERS: 2 | US FAERS | |
| 130 | Erythema | FAERS: 2 | US FAERS | |
| 131 | Facial Pain | FAERS: 2 | US FAERS | |
| 132 | Formication | FAERS: 2 | US FAERS | |
| 133 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 134 | Hypokinesia | FAERS: 2 | US FAERS | |
| 135 | Immobile | FAERS: 2 | US FAERS | |
| 136 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 137 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 138 | Incoherent | FAERS: 2 | US FAERS | |
| 139 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 140 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 141 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 142 | Medication residue present | FAERS: 2 | US FAERS | |
| 143 | Middle insomnia | FAERS: 2 | US FAERS | |
| 144 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 145 | Myoclonus | FAERS: 2 | US FAERS | |
| 146 | Nerve injury | FAERS: 2 | US FAERS | |
| 147 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 148 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 149 | Presyncope | FAERS: 2 | US FAERS | |
| 150 | Product contamination | FAERS: 2 | US FAERS | |
| 151 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 152 | Tension | FAERS: 2 | US FAERS | |
| 153 | Therapy change | FAERS: 2 | US FAERS | |
| 154 | Tinnitus | FAERS: 2 | US FAERS | |
| 155 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 156 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 157 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 158 | Accidental exposure | FAERS: 1 | US FAERS | |
| 159 | Accidental overdose | FAERS: 1 | US FAERS | |
| 160 | Agoraphobia | FAERS: 1 | US FAERS | |
| 161 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 162 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 163 | Anger | FAERS: 1 | US FAERS | |
| 164 | Angioedema | FAERS: 1 | US FAERS | |
| 165 | Anorgasmia | FAERS: 1 | US FAERS | |
| 166 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 167 | Anticoagulation drug level decreased | FAERS: 1 | US FAERS | |
| 168 | Arthritis | FAERS: 1 | US FAERS | |
| 169 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 170 | Asphyxia | FAERS: 1 | US FAERS | |
| 171 | Ataxia | FAERS: 1 | US FAERS | |
| 172 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 173 | Back disorder | FAERS: 1 | US FAERS | |
| 174 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 175 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 176 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 177 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 178 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 179 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 180 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 181 | Breath Holding | FAERS: 1 | US FAERS | |
| 182 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 183 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 184 | Chondrosarcoma | FAERS: 1 | US FAERS | |
| 185 | Cold sweat | FAERS: 1 | US FAERS | |
| 186 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 187 | Completed Suicide | FAERS: 1 | US FAERS | |
| 188 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 189 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 190 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 191 | Dental caries | FAERS: 1 | US FAERS | |
| 192 | Dependence | FAERS: 1 | US FAERS | |
| 193 | Dermatitis | FAERS: 1 | US FAERS | |
| 194 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 195 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 196 | Diplegia | FAERS: 1 | US FAERS | |
| 197 | Disability | FAERS: 1 | US FAERS | |
| 198 | Dysuria | FAERS: 1 | US FAERS | |
| 199 | Embolism | FAERS: 1 | US FAERS | |
| 200 | Emotional disorder | FAERS: 1 | US FAERS | |
| 201 | Extra dose administered | FAERS: 1 | US FAERS | |
| 202 | Eye opacity | FAERS: 1 | US FAERS | |
| 203 | Feeling Cold | FAERS: 1 | US FAERS | |
| 204 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 205 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 206 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 207 | Flatulence | FAERS: 1 | US FAERS | |
| 208 | Fracture | FAERS: 1 | US FAERS | |
| 209 | Frustration | FAERS: 1 | US FAERS | |
| 210 | Gastrectomy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 212 | Gout | FAERS: 1 | US FAERS | |
| 213 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 214 | Heat Stroke | FAERS: 1 | US FAERS | |
| 215 | Hepatitis | FAERS: 1 | US FAERS | |
| 216 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 217 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 218 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 219 | Hyperventilation | FAERS: 1 | US FAERS | |
| 220 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 221 | Hypoxia | FAERS: 1 | US FAERS | |
| 222 | Immunosuppression | FAERS: 1 | US FAERS | |
| 223 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 224 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 225 | Infarction | FAERS: 1 | US FAERS | |
| 226 | Infection | FAERS: 1 | US FAERS | |
| 227 | Influenza | FAERS: 1 | US FAERS | |
| 228 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 229 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 230 | Limb injury | FAERS: 1 | US FAERS | |
| 231 | Lip swelling | FAERS: 1 | US FAERS | |
| 232 | Living in residential institution | FAERS: 1 | US FAERS | |
| 233 | Loose tooth | FAERS: 1 | US FAERS | |
| 234 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 235 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 236 | Malabsorption | FAERS: 1 | US FAERS | |
| 237 | Malignant genitourinary tract neoplasm | FAERS: 1 | US FAERS | |
| 238 | Medical device implantation | FAERS: 1 | US FAERS | |
| 239 | Meningitis | FAERS: 1 | US FAERS | |
| 240 | Mental status changes | FAERS: 1 | US FAERS | |
| 241 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 242 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 243 | Mydriasis | FAERS: 1 | US FAERS | |
| 244 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 245 | Neutropenia | FAERS: 1 | US FAERS | |
| 246 | Oliguria | FAERS: 1 | US FAERS | |
| 247 | Opiates negative | FAERS: 1 | US FAERS | |
| 248 | Oral pain | FAERS: 1 | US FAERS | |
| 249 | Oral pruritus | FAERS: 1 | US FAERS | |
| 250 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 251 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 252 | Pallor | FAERS: 1 | US FAERS | |
| 253 | Panic Disorder | FAERS: 1 | US FAERS | |
| 254 | Paranoia | FAERS: 1 | US FAERS | |
| 255 | Paresis | FAERS: 1 | US FAERS | |
| 256 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 257 | Pneumothorax | FAERS: 1 | US FAERS | |
| 258 | Poisoning | FAERS: 1 | US FAERS | |
| 259 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 260 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 261 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 262 | Postoperative delirium | FAERS: 1 | US FAERS | |
| 263 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 264 | Product packaging issue | FAERS: 1 | US FAERS | |
| 265 | Product physical issue | FAERS: 1 | US FAERS | |
| 266 | Product residue present | FAERS: 1 | US FAERS | |
| 267 | Product shape issue | FAERS: 1 | US FAERS | |
| 268 | Product storage error | FAERS: 1 | US FAERS | |
| 269 | Product use complaint | FAERS: 1 | US FAERS | |
| 270 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 271 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 272 | Rash erythematous | FAERS: 1 | US FAERS | |
| 273 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 274 | Retching | FAERS: 1 | US FAERS | |
| 275 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 276 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 277 | Sepsis | FAERS: 1 | US FAERS | |
| 278 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 279 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 280 | Sneezing | FAERS: 1 | US FAERS | |
| 281 | Somnambulism | FAERS: 1 | US FAERS | |
| 282 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 283 | Stomatitis | FAERS: 1 | US FAERS | |
| 284 | Stridor | FAERS: 1 | US FAERS | |
| 285 | Stupor | FAERS: 1 | US FAERS | |
| 286 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 287 | Therapeutic agent urine negative | FAERS: 1 | US FAERS | |
| 288 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 289 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 290 | Therapy cessation | FAERS: 1 | US FAERS | |
| 291 | Thirst | FAERS: 1 | US FAERS | |
| 292 | Tongue biting | FAERS: 1 | US FAERS | |
| 293 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 294 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 295 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 296 | Weight decreased | FAERS: 1 | US FAERS | |
| 297 | Yawning | FAERS: 1 | US FAERS | |
| 298 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.