acetaminophen, codeine drug combination
(ZCZQDTUCMRSEAS-DHDLBFDBSA-N)
Structure
- SMILES
- OP(=O)(O)O.CC(=O)Nc1ccc(cc1)O.COc1ccc2c3c1O[C@@H]1[C@@]43CCN(C(C2)[C@@H]4C=C[C@@H]1O)C
- Molecular Formula:
- C26H33N2O9P
- Molecular Weight:
- 548.522
- Log P:
- 1.9340
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 6
- TPSA:
- 178.83
- CAS Number(s):
- 67889-72-9
Synonym(s)
1.
acetaminophen, codeine drug combination
2.
Citodon
3.
Efferalgan-codeine
4.
Panadeine Forte
5.
Panadiene
6.
Paralgin
7.
Taluosil
8.
acetaminophen - codeine
9.
co-codamol
10.
cocodamol
11.
migraeflux-green
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 34 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 32 | US FAERS | |
| 3 | Vomiting | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Malaise | FAERS: 24 | US FAERS | |
| 5 | Medication Error | FAERS: 18 | US FAERS | |
| 6 | Drug Dependence | FAERS: 16 | US FAERS | |
| 7 | Overdose | FAERS: 16 | US FAERS | |
| 8 | Somnolence | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 15 | US FAERS | |
| 10 | Chest Pain | FAERS: 14 | US FAERS | |
| 11 | Drug ineffective | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Fatigue | FAERS: 13 | US FAERS | |
| 13 | Lethargy | FAERS: 13 | US FAERS | |
| 14 | Drug exposure via breast milk | FAERS: 12 | US FAERS | |
| 15 | Pruritus | FAERS: 12 | US FAERS | |
| 16 | Constipation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Depressed Level of Consciousness | FAERS: 11 | US FAERS | |
| 18 | Completed Suicide | FAERS: 10 | US FAERS | |
| 19 | Intentional drug misuse | FAERS: 10 | US FAERS | |
| 20 | Suicide attempt | FAERS: 10 | US FAERS | |
| 21 | Drug abuse | FAERS: 9 | US FAERS | |
| 22 | Drug toxicity | FAERS: 9 | US FAERS | |
| 23 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 24 | Syncope | FAERS: 9 | US FAERS | |
| 25 | Asthenia | FAERS: 8 | US FAERS | |
| 26 | Dyspepsia | FAERS: 8 | US FAERS | |
| 27 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 28 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 29 | Abdominal Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Back Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 32 | Unresponsive to stimuli | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Breast Feeding | FAERS: 6 | US FAERS | |
| 34 | Epistaxis | FAERS: 6 | US FAERS | |
| 35 | Palpitations | FAERS: 6 | US FAERS | |
| 36 | Pancreatitis | FAERS: 6 | US FAERS | |
| 37 | Respiratory distress | FAERS: 6 | US FAERS | |
| 38 | Accidental overdose | FAERS: 5 | US FAERS | |
| 39 | Chills | FAERS: 5 | US FAERS | |
| 40 | Cyanosis | FAERS: 5 | US FAERS | |
| 41 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 42 | Hepatitis | FAERS: 5 | US FAERS | |
| 43 | Pneumonia | FAERS: 5 | US FAERS | |
| 44 | Product substitution issue | FAERS: 5 | US FAERS | |
| 45 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 46 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 47 | Swelling | FAERS: 5 | US FAERS | |
| 48 | Tremor | FAERS: 5 | US FAERS | |
| 49 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 50 | Adverse event | FAERS: 4 | US FAERS | |
| 51 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 52 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 53 | Blood urine present | FAERS: 4 | US FAERS | |
| 54 | Deafness Neurosensory | FAERS: 4 | US FAERS | |
| 55 | Dehydration | FAERS: 4 | US FAERS | |
| 56 | Drug abuser | FAERS: 4 | US FAERS | |
| 57 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 58 | Euphoric mood | FAERS: 4 | US FAERS | |
| 59 | Hypotension | FAERS: 4 | US FAERS | |
| 60 | Macrocytosis | FAERS: 4 | US FAERS | |
| 61 | Product quality issue | FAERS: 4 | US FAERS | |
| 62 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 63 | Tinnitus | FAERS: 4 | US FAERS | |
| 64 | Urticaria | FAERS: 4 | US FAERS | |
| 65 | Abdominal discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Alcohol interaction | FAERS: 3 | US FAERS | |
| 67 | Amnesia | FAERS: 3 | US FAERS | |
| 68 | Anxiety | FAERS: 3 | US FAERS | |
| 69 | Apathy | FAERS: 3 | US FAERS | |
| 70 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 71 | Dependence | FAERS: 3 | US FAERS | |
| 72 | Diplopia | FAERS: 3 | US FAERS | |
| 73 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 74 | Drug screen positive | FAERS: 3 | US FAERS | |
| 75 | Dysuria | FAERS: 3 | US FAERS | |
| 76 | Feeding disorder neonatal | FAERS: 3 | US FAERS | |
| 77 | Feeling Cold | FAERS: 3 | US FAERS | |
| 78 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 79 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 80 | Incoherent | FAERS: 3 | US FAERS | |
| 81 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 82 | Intentional misuse | FAERS: 3 | US FAERS | |
| 83 | Mental impairment | FAERS: 3 | US FAERS | |
| 84 | Mental status changes | FAERS: 3 | US FAERS | |
| 85 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 86 | Multiple drug overdose | FAERS: 3 | US FAERS | |
| 87 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 88 | Neonatal disorder | FAERS: 3 | US FAERS | |
| 89 | Paresis | FAERS: 3 | US FAERS | |
| 90 | Poisoning | FAERS: 3 | US FAERS | |
| 91 | Respiratory tract irritation | FAERS: 3 | US FAERS | |
| 92 | Stridor | FAERS: 3 | US FAERS | |
| 93 | Weight decreased | FAERS: 3 | US FAERS | |
| 94 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 95 | Agitation | FAERS: 2 | US FAERS | |
| 96 | Ascites | FAERS: 2 | US FAERS | |
| 97 | Crying | FAERS: 2 | US FAERS | |
| 98 | Dysphonia | FAERS: 2 | US FAERS | |
| 99 | Emotional disorder | FAERS: 2 | US FAERS | |
| 100 | Eructation | FAERS: 2 | US FAERS | |
| 101 | Erythema | FAERS: 2 | US FAERS | |
| 102 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 103 | Ileus | FAERS: 2 | US FAERS | |
| 104 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 105 | Intussusception | FAERS: 2 | US FAERS | |
| 106 | Multiple drug overdose intentional | FAERS: 2 | US FAERS | |
| 107 | Narcotic intoxication | FAERS: 2 | US FAERS | |
| 108 | Pain | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 109 | Restlessness | FAERS: 2 | US FAERS | |
| 110 | Skin reaction | FAERS: 2 | US FAERS | |
| 111 | Sphincter of Oddi Dysfunction | FAERS: 2 | US FAERS | |
| 112 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 113 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 114 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 115 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 116 | Wheezing | FAERS: 2 | US FAERS | |
| 117 | jaundice | FAERS: 2 | US FAERS | |
| 118 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 119 | Accidental death | FAERS: 1 | US FAERS | |
| 120 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 121 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 122 | Amino acid level increased | FAERS: 1 | US FAERS | |
| 123 | Ammonia increased | FAERS: 1 | US FAERS | |
| 124 | Amylase increased | FAERS: 1 | US FAERS | |
| 125 | Analgesic drug level above therapeutic | FAERS: 1 | US FAERS | |
| 126 | Angioedema | FAERS: 1 | US FAERS | |
| 127 | Aphasia | FAERS: 1 | US FAERS | |
| 128 | Arthralgia | FAERS: 1 | US FAERS | |
| 129 | Arthritis | FAERS: 1 | US FAERS | |
| 130 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 131 | Asphyxia | FAERS: 1 | US FAERS | |
| 132 | Blindness | FAERS: 1 | US FAERS | |
| 133 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 134 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 135 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 136 | Bradycardia | FAERS: 1 | US FAERS | |
| 137 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 138 | CYP2C19 polymorphism | FAERS: 1 | US FAERS | |
| 139 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 140 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 141 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 142 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 143 | Choking | FAERS: 1 | US FAERS | |
| 144 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 145 | Coagulation factor VII level decreased | FAERS: 1 | US FAERS | |
| 146 | Coagulation factor X level decreased | FAERS: 1 | US FAERS | |
| 147 | Delirium | FAERS: 1 | US FAERS | |
| 148 | Device malfunction | FAERS: 1 | US FAERS | |
| 149 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 150 | Disorientation | FAERS: 1 | US FAERS | |
| 151 | Dissociation | FAERS: 1 | US FAERS | |
| 152 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 153 | Drug level increased | FAERS: 1 | US FAERS | |
| 154 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 155 | Drug therapeutic incompatibility | FAERS: 1 | US FAERS | |
| 156 | Dysarthria | FAERS: 1 | US FAERS | |
| 157 | Economic problem | FAERS: 1 | US FAERS | |
| 158 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 159 | Eye irritation | FAERS: 1 | US FAERS | |
| 160 | Eye pain | FAERS: 1 | US FAERS | |
| 161 | Feeling jittery | FAERS: 1 | US FAERS | |
| 162 | Fixed bowel loop | FAERS: 1 | US FAERS | |
| 163 | Flatulence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Fluid overload | FAERS: 1 | US FAERS | |
| 165 | Flushing | FAERS: 1 | US FAERS | |
| 166 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 167 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 168 | Gastritis | FAERS: 1 | US FAERS | |
| 169 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 170 | Haemorrhagic Necrotic Pancreatitis | FAERS: 1 | US FAERS | |
| 171 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 172 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 173 | Hypoventilation | FAERS: 1 | US FAERS | |
| 174 | Impaired work ability | FAERS: 1 | US FAERS | |
| 175 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 176 | Initial insomnia | FAERS: 1 | US FAERS | |
| 177 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 178 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 179 | Intoxication by breast feeding | FAERS: 1 | US FAERS | |
| 180 | Joint swelling | FAERS: 1 | US FAERS | |
| 181 | Leukocytosis | FAERS: 1 | US FAERS | |
| 182 | Lip swelling | FAERS: 1 | US FAERS | |
| 183 | Lipase increased | FAERS: 1 | US FAERS | |
| 184 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 185 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 186 | Mood swings | FAERS: 1 | US FAERS | |
| 187 | Murder | FAERS: 1 | US FAERS | |
| 188 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 189 | Mydriasis | FAERS: 1 | US FAERS | |
| 190 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 191 | Neck Pain | FAERS: 1 | US FAERS | |
| 192 | Neonatal aspiration | FAERS: 1 | US FAERS | |
| 193 | Neonatal respiratory arrest | FAERS: 1 | US FAERS | |
| 194 | No adverse event | FAERS: 1 | US FAERS | |
| 195 | Open wound | FAERS: 1 | US FAERS | |
| 196 | Opiates positive | FAERS: 1 | US FAERS | |
| 197 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 198 | Photophobia | FAERS: 1 | US FAERS | |
| 199 | Polydipsia | FAERS: 1 | US FAERS | |
| 200 | Polysubstance dependence | FAERS: 1 | US FAERS | |
| 201 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 202 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 203 | Presyncope | FAERS: 1 | US FAERS | |
| 204 | Product label issue | FAERS: 1 | US FAERS | |
| 205 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 206 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 207 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 208 | Purpura | FAERS: 1 | US FAERS | |
| 209 | Rash erythematous | FAERS: 1 | US FAERS | |
| 210 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 211 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 212 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 213 | Tachycardia | FAERS: 1 | US FAERS | |
| 214 | Theft | FAERS: 1 | US FAERS | |
| 215 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 216 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 217 | Transaminases increased | FAERS: 1 | US FAERS | |
| 218 | Transplant | FAERS: 1 | US FAERS | |
| 219 | Ulcer | FAERS: 1 | US FAERS | |
| 220 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 221 | Urinary Retention | FAERS: 1 | US FAERS | |
| 222 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 223 | Visual Impairment | FAERS: 1 | US FAERS | |
| 224 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 225 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 226 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 227 | nervous system disorder | FAERS: 1 | US FAERS | |
| 228 | Blood glucose increased | Canada Vigilance: 1 | Canada Vigilance | |
| 229 | Myalgia | Canada Vigilance: 1 | Canada Vigilance | |
| 230 | Reversal of opiate activity | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.