Promethazine
(XXPDBLUZJRXNNZ-UHFFFAOYSA-N)
Structure
- SMILES
- CN(C(CN1c2ccccc2Sc2c1cccc2)C)C.Cl
- Molecular Formula:
- C17H21ClN2S
- Molecular Weight:
- 320.880
- Log P:
- 5.1064
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 31.78
- CAS Number(s):
- 58-33-3
Synonym(s)
1.
Promethazine
2.
Proazamine
3.
Atosil
4.
Diphergan
5.
Diprazin
6.
Isopromethazine
7.
Phenargan
8.
Phenergan
9.
Phensedyl
10.
Pipolfen
11.
Pipolphen
12.
Promet
13.
Prometazin
14.
Promethazine Hydrochloride
15.
Prothazin
16.
Pyrethia
17.
Remsed
18.
Rumergan
19.
Hydrochloride, Promethazine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Anxiety | FAERS: 18 | US FAERS | |
| 2 | Pain | FAERS: 16 | US FAERS | |
| 3 | Drug ineffective | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Injection site pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Medication Error | FAERS: 13 | US FAERS | |
| 6 | Agitation | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Burning sensation | FAERS: 12 | US FAERS | |
| 8 | Drug exposure during pregnancy | FAERS: 12 | US FAERS | |
| 9 | Somnolence | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Vomiting | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Dystonia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Incorrect route of drug administration | FAERS: 9 | US FAERS | |
| 13 | Tremor | FAERS: 8 | US FAERS | |
| 14 | Erythema | FAERS: 7 | US FAERS | |
| 15 | Infusion site pain | FAERS: 7 | US FAERS | |
| 16 | Injection site irritation | FAERS: 7 | US FAERS | |
| 17 | Wrong technique in drug usage process | FAERS: 7 | US FAERS | |
| 18 | Extravasation | FAERS: 6 | US FAERS | |
| 19 | Intentional misuse | FAERS: 6 | US FAERS | |
| 20 | Malaise | FAERS: 6 | US FAERS | |
| 21 | Nausea | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Overdose | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Accidental overdose | FAERS: 5 | US FAERS | |
| 24 | Amnesia | FAERS: 5 | US FAERS | |
| 25 | Asthenia | FAERS: 5 | US FAERS | |
| 26 | Expired product administered | FAERS: 5 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 28 | Gangrene | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Nerve injury | FAERS: 5 | US FAERS | |
| 30 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 31 | Restlessness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Screaming | FAERS: 5 | US FAERS | |
| 33 | Cellulitis | FAERS: 4 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 35 | Cyanosis | FAERS: 4 | US FAERS | |
| 36 | Dependence | FAERS: 4 | US FAERS | |
| 37 | Disorientation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Fatigue | FAERS: 4 | US FAERS | |
| 39 | Headache | FAERS: 4 | US FAERS | |
| 40 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 41 | Incorrect drug administration rate | FAERS: 4 | US FAERS | |
| 42 | Mydriasis | FAERS: 4 | US FAERS | |
| 43 | Pruritus | FAERS: 4 | US FAERS | |
| 44 | Swelling | FAERS: 4 | US FAERS | |
| 45 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 46 | Urticaria | FAERS: 4 | US FAERS | |
| 47 | Aphasia | FAERS: 3 | US FAERS | |
| 48 | Constipation | FAERS: 3 | US FAERS | |
| 49 | Crying | FAERS: 3 | US FAERS | |
| 50 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 51 | Delirium | FAERS: 3 | US FAERS | |
| 52 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 53 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 54 | Hypotension | FAERS: 3 | US FAERS | |
| 55 | Incoherent | FAERS: 3 | US FAERS | |
| 56 | Infusion Site Extravasation | FAERS: 3 | US FAERS | |
| 57 | Injection site erythema | FAERS: 3 | US FAERS | |
| 58 | Necrosis | FAERS: 3 | US FAERS | |
| 59 | Neuroleptic Malignant Syndrome | FAERS: 3 | US FAERS | |
| 60 | Phlebitis | FAERS: 3 | US FAERS | |
| 61 | Poor feeding infant | FAERS: 3 | US FAERS | |
| 62 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 63 | Tinnitus | FAERS: 3 | US FAERS | |
| 64 | Unevaluable event | FAERS: 3 | US FAERS | |
| 65 | Visual Impairment | FAERS: 3 | US FAERS | |
| 66 | Wrong patient received product | FAERS: 3 | US FAERS | |
| 67 | treatment failure | FAERS: 3 | US FAERS | |
| 68 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 69 | Anger | FAERS: 2 | US FAERS | |
| 70 | Angioedema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Catatonia | FAERS: 2 | US FAERS | |
| 72 | Caustic injury | FAERS: 2 | US FAERS | |
| 73 | Dehydration | FAERS: 2 | US FAERS | |
| 74 | Dizziness | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Drug administration error | FAERS: 2 | US FAERS | |
| 76 | Drug screen positive | FAERS: 2 | US FAERS | |
| 77 | Emotional distress | FAERS: 2 | US FAERS | |
| 78 | Extremity necrosis | FAERS: 2 | US FAERS | |
| 79 | Eye pain | FAERS: 2 | US FAERS | |
| 80 | Glaucoma | FAERS: 2 | US FAERS | |
| 81 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 82 | Impaired work ability | FAERS: 2 | US FAERS | |
| 83 | Infection | FAERS: 2 | US FAERS | |
| 84 | Infertility | FAERS: 2 | US FAERS | |
| 85 | Infusion site swelling | FAERS: 2 | US FAERS | |
| 86 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 87 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 88 | Injection site mass | FAERS: 2 | US FAERS | |
| 89 | Injection site thrombosis | FAERS: 2 | US FAERS | |
| 90 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 91 | Limb injury | FAERS: 2 | US FAERS | |
| 92 | Mental status changes | FAERS: 2 | US FAERS | |
| 93 | Moaning | FAERS: 2 | US FAERS | |
| 94 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 95 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 96 | Neuralgia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 98 | Pregnancy | FAERS: 2 | US FAERS | |
| 99 | Respiratory distress | FAERS: 2 | US FAERS | |
| 100 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 101 | Suicide attempt | FAERS: 2 | US FAERS | |
| 102 | Syncope | FAERS: 2 | US FAERS | |
| 103 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 104 | Thrombosis | FAERS: 2 | US FAERS | |
| 105 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 106 | nervous system disorder | FAERS: 2 | US FAERS | |
| 107 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 108 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 109 | Apathy | FAERS: 1 | US FAERS | |
| 110 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 111 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 112 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 113 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 114 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 115 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 116 | Bradycardia | FAERS: 1 | US FAERS | |
| 117 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 118 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 119 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 120 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 121 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 122 | Chemical injury | FAERS: 1 | US FAERS | |
| 123 | Chest Pain | FAERS: 1 | US FAERS | |
| 124 | Choking | FAERS: 1 | US FAERS | |
| 125 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 126 | Cleft Palate | FAERS: 1 | US FAERS | |
| 127 | Clumsiness | FAERS: 1 | US FAERS | |
| 128 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 129 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 130 | Conversion disorder | FAERS: 1 | US FAERS | |
| 131 | Cyst | FAERS: 1 | US FAERS | |
| 132 | Deformity | FAERS: 1 | US FAERS | |
| 133 | Dementia | FAERS: 1 | US FAERS | |
| 134 | Depressed mood | FAERS: 1 | US FAERS | |
| 135 | Device Failure | FAERS: 1 | US FAERS | |
| 136 | Discomfort | FAERS: 1 | US FAERS | |
| 137 | Drug Dependence | FAERS: 1 | US FAERS | |
| 138 | Drug abuser | FAERS: 1 | US FAERS | |
| 139 | Drug abuse | FAERS: 1 | US FAERS | |
| 140 | Drug diversion | FAERS: 1 | US FAERS | |
| 141 | Drug dose omission | FAERS: 1 | US FAERS | |
| 142 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 143 | Dry gangrene | FAERS: 1 | US FAERS | |
| 144 | Dysarthria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Ecchymosis | FAERS: 1 | US FAERS | |
| 146 | Eye irritation | FAERS: 1 | US FAERS | |
| 147 | Feeling Cold | FAERS: 1 | US FAERS | |
| 148 | Flushing | FAERS: 1 | US FAERS | |
| 149 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 150 | Gastrointestinal disorder congenital | FAERS: 1 | US FAERS | |
| 151 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 152 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 153 | Hoarseness | FAERS: 1 | US FAERS | |
| 154 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 155 | Hypoventilation | FAERS: 1 | US FAERS | |
| 156 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 157 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 158 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 159 | Inflammation | FAERS: 1 | US FAERS | |
| 160 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 161 | Injection site bruising | FAERS: 1 | US FAERS | |
| 162 | Injection site necrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 164 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 165 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 166 | Laceration | FAERS: 1 | US FAERS | |
| 167 | Lethargy | FAERS: 1 | US FAERS | |
| 168 | Limb discomfort | FAERS: 1 | US FAERS | |
| 169 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 170 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 171 | Mental retardation severity unspecified | FAERS: 1 | US FAERS | |
| 172 | Monoplegia | FAERS: 1 | US FAERS | |
| 173 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 174 | Muscle tightness | FAERS: 1 | US FAERS | |
| 175 | Myoclonus | FAERS: 1 | US FAERS | |
| 176 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 177 | Nervousness | FAERS: 1 | US FAERS | |
| 178 | Neuritis | FAERS: 1 | US FAERS | |
| 179 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 180 | Otitis Externa | FAERS: 1 | US FAERS | |
| 181 | Pallor | FAERS: 1 | US FAERS | |
| 182 | Palpitations | FAERS: 1 | US FAERS | |
| 183 | Paranoia | FAERS: 1 | US FAERS | |
| 184 | Peripheral occlusive disease | FAERS: 1 | US FAERS | |
| 185 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 186 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 187 | Post procedural complication | FAERS: 1 | US FAERS | |
| 188 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 189 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 190 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 191 | Product quality issue | FAERS: 1 | US FAERS | |
| 192 | Product tampering | FAERS: 1 | US FAERS | |
| 193 | Product use issue | FAERS: 1 | US FAERS | |
| 194 | Reflex Sympathetic Dystrophy | FAERS: 1 | US FAERS | |
| 195 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 196 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 197 | Sepsis | FAERS: 1 | US FAERS | |
| 198 | Shock | FAERS: 1 | US FAERS | |
| 199 | Somnambulism | FAERS: 1 | US FAERS | |
| 200 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 201 | Sudden death | FAERS: 1 | US FAERS | |
| 202 | Tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 204 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 205 | Urinary Retention | FAERS: 1 | US FAERS | |
| 206 | Vein pain | FAERS: 1 | US FAERS | |
| 207 | Venous Injury | FAERS: 1 | US FAERS | |
| 208 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 209 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 210 | Vertigo | FAERS: 1 | US FAERS | |
| 211 | Visual disturbance | FAERS: 1 | US FAERS | |
| 212 | jaundice | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | Abdominal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 214 | Acute kidney injury | Canada Vigilance: 1 | Canada Vigilance | |
| 215 | Athetosis | Canada Vigilance: 1 | Canada Vigilance | |
| 216 | Cachexia | Canada Vigilance: 1 | Canada Vigilance | |
| 217 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance | |
| 218 | Dysphonia | Canada Vigilance: 1 | Canada Vigilance | |
| 219 | Electroencephalogram abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 220 | Erythema Multiforme | Canada Vigilance: 1 | Canada Vigilance | |
| 221 | Product administration error | Canada Vigilance: 1 | Canada Vigilance | |
| 222 | Stupor | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.