Glycopyrrolate
(VPNYRYCIDCJBOM-UHFFFAOYSA-M)
Structure
- SMILES
- O=C(C(c1ccccc1)(C1CCCC1)O)OC1CC[N+](C1)(C)C.[Br-]
- Molecular Formula:
- C19H28BrNO3
- Molecular Weight:
- 398.335
- Log P:
- -0.5809
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.53
- CAS Number(s):
- 596-51-0; 51186-83-5; 475468-09-8
Synonym(s)
1.
Glycopyrrolate
2.
Glycopyrronium Bromide
3.
NVA 237
4.
NVA-237
5.
NVA237
6.
Pyrrolidinium, 3-((cyclopentylhydroxyphenylacetyl)oxy)-1,1-dimethyl-, bromide
7.
Bromide, Glycopyrronium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 47 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 2 | Throat irritation | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Malaise | FAERS: 24 | US FAERS | |
| 4 | Chest discomfort | FAERS: 21 | US FAERS | |
| 5 | Pneumonia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Choking sensation | FAERS: 16 | OFFSIDES US FAERS | |
| 8 | Dizziness | FAERS: 16 | SIDER US FAERS | |
| 9 | Headache | FAERS: 16 Canada Vigilance: 1 | 12950111 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Chest Pain | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 11 | Choking | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Asthenia | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 13 | Tachycardia | FAERS: 11 | 6498577 6696128 11668046 | CTD SIDER US FAERS |
| 14 | Cardiac Arrest | FAERS: 9 | SIDER US FAERS | |
| 15 | Drug administration error | FAERS: 9 | US FAERS | |
| 16 | Nausea | FAERS: 9 | 6711256 | CTD OFFSIDES SIDER US FAERS |
| 17 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 18 | Retching | FAERS: 9 | SIDER US FAERS | |
| 19 | Fatigue | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 20 | Feeling abnormal | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 21 | Urinary Retention | FAERS: 8 Canada Vigilance: 4 | 16911300 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Asthma | FAERS: 7 | 3392363 | CTD US FAERS |
| 23 | Constipation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Dysgeusia | FAERS: 7 | SIDER US FAERS | |
| 25 | Dysuria | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 26 | Pain | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Palpitations | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Wheezing | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Anticholinergic Syndrome | FAERS: 6 | US FAERS | |
| 30 | Bronchospasm | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Drug dose omission | FAERS: 6 | US FAERS | |
| 32 | Hypersensitivity | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 33 | Incorrect dose administered | FAERS: 6 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 34 | Product dose omission | FAERS: 6 | US FAERS | |
| 35 | Pruritus | FAERS: 6 | SIDER US FAERS | |
| 36 | Respiratory Failure | FAERS: 6 | OFFSIDES US FAERS | |
| 37 | Urinary tract infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Urticaria | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 39 | Visual Impairment | FAERS: 6 | US FAERS | |
| 40 | Anxiety | FAERS: 5 | OFFSIDES US FAERS | |
| 41 | Dementia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 43 | Disease Progression | FAERS: 5 | OFFSIDES US FAERS | |
| 44 | Disorientation | FAERS: 5 | US FAERS | |
| 45 | Drug ineffective for unapproved indication | FAERS: 5 | US FAERS | |
| 46 | Infection | FAERS: 5 | SIDER US FAERS | |
| 47 | Medication Error | FAERS: 5 | US FAERS | |
| 48 | Myalgia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Myocardial Infarction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Productive Cough | FAERS: 5 | SIDER US FAERS | |
| 51 | Swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Tremor | FAERS: 5 | US FAERS | |
| 53 | Bronchitis | FAERS: 4 | OFFSIDES US FAERS | |
| 54 | Device malfunction | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 55 | Lip swelling | FAERS: 4 | US FAERS | |
| 56 | Memory impairment | FAERS: 4 | US FAERS | |
| 57 | Nervousness | FAERS: 4 | SIDER US FAERS | |
| 58 | Product quality issue | FAERS: 4 | US FAERS | |
| 59 | Product use issue | FAERS: 4 | US FAERS | |
| 60 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 61 | Vomiting | FAERS: 4 Canada Vigilance: 1 | 6711256 | CTD SIDER Canada Vigilance US FAERS |
| 62 | Weight decreased | FAERS: 4 | US FAERS | |
| 63 | Abasia | FAERS: 3 | US FAERS | |
| 64 | Abdominal discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 65 | Arthralgia | FAERS: 3 | US FAERS | |
| 66 | Arthritis | FAERS: 3 | OFFSIDES US FAERS | |
| 67 | Asphyxia | FAERS: 3 | US FAERS | |
| 68 | Atrial Fibrillation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 69 | Burning sensation | FAERS: 3 | US FAERS | |
| 70 | Cerebrovascular accident | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Dysphonia | FAERS: 3 | US FAERS | |
| 72 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 73 | Flushing | FAERS: 3 | SIDER US FAERS | |
| 74 | Gait inability | FAERS: 3 | US FAERS | |
| 75 | Influenza | FAERS: 3 | US FAERS | |
| 76 | Nasopharyngitis | FAERS: 3 | SIDER US FAERS | |
| 77 | No adverse event | FAERS: 3 | US FAERS | |
| 78 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 79 | Pulmonary function test decreased | FAERS: 3 | US FAERS | |
| 80 | Respiratory arrest | FAERS: 3 | SIDER US FAERS | |
| 81 | Respiratory tract irritation | FAERS: 3 | US FAERS | |
| 82 | Secretion discharge | FAERS: 3 | US FAERS | |
| 83 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 84 | Sneezing | FAERS: 3 | US FAERS | |
| 85 | Somnolence | FAERS: 3 | SIDER US FAERS | |
| 86 | Wrong technique in product usage process | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Agitation | FAERS: 2 | SIDER US FAERS | |
| 88 | Apparent death | FAERS: 2 | US FAERS | |
| 89 | Blindness | FAERS: 2 | US FAERS | |
| 90 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 91 | Circumstance or information capable of leading to medication error | FAERS: 2 | OFFSIDES US FAERS | |
| 92 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 93 | Dehydration | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 94 | Depressed mood | FAERS: 2 | OFFSIDES US FAERS | |
| 95 | Device difficult to use | FAERS: 2 | US FAERS | |
| 96 | Discomfort | FAERS: 2 | US FAERS | |
| 97 | Erythema | FAERS: 2 | 3698061 | CTD SIDER US FAERS |
| 98 | Expired product administered | FAERS: 2 | US FAERS | |
| 99 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 100 | Incorrect dose administered by device | FAERS: 2 | US FAERS | |
| 101 | Incorrect product administration duration | FAERS: 2 | US FAERS | |
| 102 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 103 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 104 | Joint swelling | FAERS: 2 | US FAERS | |
| 105 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 106 | Metastasis | FAERS: 2 | US FAERS | |
| 107 | Neck Pain | FAERS: 2 | US FAERS | |
| 108 | Overdose | FAERS: 2 | US FAERS | |
| 109 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 110 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 111 | Renal pain | FAERS: 2 | US FAERS | |
| 112 | Thirst | FAERS: 2 | US FAERS | |
| 113 | Urinary tract obstruction | FAERS: 2 | US FAERS | |
| 114 | Abdominal Pain | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 115 | Accidental death | FAERS: 1 | US FAERS | |
| 116 | Ageusia | FAERS: 1 | SIDER US FAERS | |
| 117 | Airway burns | FAERS: 1 | US FAERS | |
| 118 | Alopecia | FAERS: 1 | US FAERS | |
| 119 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 120 | Anaphylactoid Reaction | FAERS: 1 | SIDER US FAERS | |
| 121 | Aneurysm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Anger | FAERS: 1 | US FAERS | |
| 123 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 124 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 125 | Anuria | FAERS: 1 | US FAERS | |
| 126 | Aphonia | FAERS: 1 | US FAERS | |
| 127 | Asthma-Chronic Obstructive Pulmonary Disease Overlap Syndrome | FAERS: 1 | US FAERS | |
| 128 | Bacillus test positive | FAERS: 1 | US FAERS | |
| 129 | Blister rupture | FAERS: 1 | US FAERS | |
| 130 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 131 | Blood pressure fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 132 | Bradycardia | FAERS: 1 | CTD OFFSIDES US FAERS | |
| 133 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 134 | Cataract | FAERS: 1 | OFFSIDES US FAERS | |
| 135 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 136 | Chromaturia | FAERS: 1 | US FAERS | |
| 137 | Cyanosis | FAERS: 1 | US FAERS | |
| 138 | Cystitis | FAERS: 1 | SIDER US FAERS | |
| 139 | Deafness | FAERS: 1 | OFFSIDES US FAERS | |
| 140 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 141 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 142 | Drug dispensing error | FAERS: 1 | OFFSIDES US FAERS | |
| 143 | Drug dose omission by device | FAERS: 1 | US FAERS | |
| 144 | Drug level increased | FAERS: 1 | US FAERS | |
| 145 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 146 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 147 | Epilepsy | FAERS: 1 | US FAERS | |
| 148 | Eye pain | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Feeling jittery | FAERS: 1 | US FAERS | |
| 150 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 151 | Foaming at mouth | FAERS: 1 | OFFSIDES US FAERS | |
| 152 | Forced expiratory flow decreased | FAERS: 1 | US FAERS | |
| 153 | Fracture | FAERS: 1 | US FAERS | |
| 154 | Gallbladder necrosis | FAERS: 1 | US FAERS | |
| 155 | Gastritis | FAERS: 1 | US FAERS | |
| 156 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 157 | General physical health deterioration | FAERS: 1 | OFFSIDES US FAERS | |
| 158 | Genital Herpes | FAERS: 1 | US FAERS | |
| 159 | Glaucoma | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 160 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 161 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 162 | Hypercapnia | FAERS: 1 | US FAERS | |
| 163 | Hyperventilation | FAERS: 1 | US FAERS | |
| 164 | Hypoxia | FAERS: 1 | OFFSIDES US FAERS | |
| 165 | Impaired work ability | FAERS: 1 | US FAERS | |
| 166 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 167 | Increased steroid activity | FAERS: 1 | US FAERS | |
| 168 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 169 | Joint injury | FAERS: 1 | US FAERS | |
| 170 | Keratoconus | FAERS: 1 | US FAERS | |
| 171 | Limb injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 173 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 174 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 175 | Lung cyst | FAERS: 1 | US FAERS | |
| 176 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 177 | Mechanical ventilation | FAERS: 1 | OFFSIDES US FAERS | |
| 178 | Mouth swelling | FAERS: 1 | US FAERS | |
| 179 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 180 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 181 | Mydriasis | FAERS: 1 | SIDER US FAERS | |
| 182 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 183 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 184 | Obesity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 186 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 187 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 188 | Pancreatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 189 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 190 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 191 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 192 | Poisoning | FAERS: 1 | US FAERS | |
| 193 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 194 | Presyncope | FAERS: 1 | US FAERS | |
| 195 | Procedural hypertension | FAERS: 1 | US FAERS | |
| 196 | Product administration error | FAERS: 1 | US FAERS | |
| 197 | Product barcode issue | FAERS: 1 | US FAERS | |
| 198 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 199 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 200 | Product label confusion | FAERS: 1 | US FAERS | |
| 201 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 202 | Product physical issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Product substitution issue | FAERS: 1 | US FAERS | |
| 204 | Product supply issue | FAERS: 1 | US FAERS | |
| 205 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 206 | Rash erythematous | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 207 | Respiratory distress | FAERS: 1 | US FAERS | |
| 208 | Restlessness | FAERS: 1 | US FAERS | |
| 209 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 210 | Sepsis | FAERS: 1 | US FAERS | |
| 211 | Septic Shock | FAERS: 1 | US FAERS | |
| 212 | Sputum retention | FAERS: 1 | US FAERS | |
| 213 | Stomatitis | FAERS: 1 | US FAERS | |
| 214 | Stress | FAERS: 1 | US FAERS | |
| 215 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 216 | Syncope | FAERS: 1 | US FAERS | |
| 217 | Therapeutic product effect increased | FAERS: 1 | US FAERS | |
| 218 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 219 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 220 | Thermal burn | FAERS: 1 | US FAERS | |
| 221 | Tongue biting | FAERS: 1 | US FAERS | |
| 222 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 223 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 224 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 225 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 226 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 227 | Abdominal tenderness | OFFSIDES | ||
| 228 | Acid reflux | OFFSIDES | ||
| 229 | Acidosis | OFFSIDES | ||
| 230 | Actinic keratosis | OFFSIDES | ||
| 231 | Acute myocardial infarction | Canada Vigilance: 1 | Canada Vigilance | |
| 232 | Adenocarcinoma | OFFSIDES | ||
| 233 | Adenoma | OFFSIDES | ||
| 234 | Adnexa uteri mass | OFFSIDES | ||
| 235 | Adnexitis | OFFSIDES | ||
| 236 | Adrenal mass | OFFSIDES | ||
| 237 | Agraphia | OFFSIDES | ||
| 238 | Alveolitis | OFFSIDES | ||
| 239 | Angioedema | Canada Vigilance: 1 | Canada Vigilance | |
| 240 | Anhedonia | OFFSIDES | ||
| 241 | Aortic bruit | OFFSIDES | ||
| 242 | Apallic syndrome | OFFSIDES | ||
| 243 | Aphthous Stomatitis | OFFSIDES | ||
| 244 | Arteriosclerosis | OFFSIDES | ||
| 245 | Aspergillosis | OFFSIDES | ||
| 246 | Atelectasis | OFFSIDES | ||
| 247 | Atrial tachycardia | OFFSIDES | ||
| 248 | Atrioventricular Block | SIDER | ||
| 249 | Automatism | OFFSIDES | ||
| 250 | Basal cell carcinoma | OFFSIDES | ||
| 251 | Bedridden | OFFSIDES | ||
| 252 | Biliary dilatation | OFFSIDES | ||
| 253 | Bladder pain | SIDER | ||
| 254 | Bloated feeling | SIDER | ||
| 255 | Blood Glucose | OFFSIDES | ||
| 256 | Blood albumin decreased | OFFSIDES | ||
| 257 | Blood glucose abnormal | OFFSIDES | ||
| 258 | Blood glucose decreased | OFFSIDES | ||
| 259 | Blood magnesium decreased | OFFSIDES | ||
| 260 | Blood phosphorus decreased | OFFSIDES | ||
| 261 | Blood urea increased | OFFSIDES | ||
| 262 | Blurred vision | OFFSIDES | ||
| 263 | Body Temperature | OFFSIDES | ||
| 264 | Bone lesion | OFFSIDES | ||
| 265 | Bone pain | OFFSIDES | ||
| 266 | Breast tenderness | OFFSIDES | ||
| 267 | Bronchomalacia | Canada Vigilance: 1 | Canada Vigilance | |
| 268 | Calcinosis | OFFSIDES | ||
| 269 | Cardioactive drug level below therapeutic | OFFSIDES | ||
| 270 | Cardioactive drug level increased | OFFSIDES | ||
| 271 | Carotid bruit | OFFSIDES | ||
| 272 | Cellulitis | OFFSIDES | ||
| 273 | Cerebral atrophy | OFFSIDES | ||
| 274 | Chills | Canada Vigilance: 1 | Canada Vigilance | |
| 275 | Cholecystitis | OFFSIDES | ||
| 276 | Choroidal Detachment | OFFSIDES | ||
| 277 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 278 | Chronic ulcerative colitis | OFFSIDES | ||
| 279 | Cirrhosis | OFFSIDES | ||
| 280 | Clonus | OFFSIDES | ||
| 281 | Colitis | OFFSIDES | ||
| 282 | Compression fracture | OFFSIDES | ||
| 283 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 284 | Contact Dermatitis | OFFSIDES | ||
| 285 | Cycloplegia | SIDER | ||
| 286 | Debridement | OFFSIDES | ||
| 287 | Demyelination | OFFSIDES | ||
| 288 | Dental abscess | OFFSIDES | ||
| 289 | Dental caries | SIDER | ||
| 290 | Dental prosthesis placement | OFFSIDES | ||
| 291 | Dermatitis | SIDER | ||
| 292 | Device Failure | OFFSIDES | ||
| 293 | Diabetes | OFFSIDES | ||
| 294 | Diarrhea | OFFSIDES | ||
| 295 | Diplopia | OFFSIDES | ||
| 296 | Diverticulosis | OFFSIDES | ||
| 297 | Diverticulum | OFFSIDES | ||
| 298 | Drowsiness | OFFSIDES SIDER | ||
| 299 | Drug toxicity | OFFSIDES | ||
| 300 | Drug withdrawal headache | OFFSIDES | ||
| 301 | Dry skin | SIDER | ||
| 302 | Ectropion | OFFSIDES | ||
| 303 | Eczema | Canada Vigilance: 1 | Canada Vigilance | |
| 304 | Edema | 3698061 | CTD | |
| 305 | Ejection Fraction Decreased | OFFSIDES | ||
| 306 | Electrocardiogram ST-T change | OFFSIDES | ||
| 307 | Empyema | OFFSIDES | ||
| 308 | End-tidal CO2 decreased | OFFSIDES | ||
| 309 | Endodontic procedure | OFFSIDES | ||
| 310 | Erectile dysfunction | OFFSIDES SIDER | ||
| 311 | Erythema Multiforme | OFFSIDES | ||
| 312 | Esophageal Stenosis | OFFSIDES | ||
| 313 | Excoriation | OFFSIDES | ||
| 314 | Flank Pain | OFFSIDES | ||
| 315 | Flatulence | SIDER | ||
| 316 | Gastric Dilatation | Canada Vigilance: 1 | Canada Vigilance | |
| 317 | Gastric ulcer | OFFSIDES | ||
| 318 | Gastrinoma | OFFSIDES | ||
| 319 | Gastroenteritis | OFFSIDES SIDER | ||
| 320 | Gastrointestinal Pain | SIDER | ||
| 321 | Gastrointestinal hypomotility | SIDER | ||
| 322 | Gastrointestinal mucosal necrosis | OFFSIDES | ||
| 323 | Gout | OFFSIDES | ||
| 324 | Granulocytosis | OFFSIDES | ||
| 325 | Heart Block | 2742112 | CTD | |
| 326 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 327 | Hepatic necrosis | OFFSIDES | ||
| 328 | Hepatosplenomegaly | OFFSIDES | ||
| 329 | Hyperpyrexia | SIDER | ||
| 330 | Hypohidrosis | SIDER | ||
| 331 | Hypotension | 26026369 | CTD SIDER | |
| 332 | Hysterectomy | OFFSIDES | ||
| 333 | Iliac artery occlusion | OFFSIDES | ||
| 334 | Incontinence | OFFSIDES | ||
| 335 | Increased viscosity of bronchial secretion | SIDER | ||
| 336 | Infestation | SIDER | ||
| 337 | Injection Site Reaction | SIDER | ||
| 338 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 339 | Intestinal Obstruction | OFFSIDES SIDER | ||
| 340 | Intestinal Pseudo-Obstruction | SIDER | ||
| 341 | Joint sprain | OFFSIDES | ||
| 342 | Keratitis sicca | OFFSIDES | ||
| 343 | Kidney Failure | OFFSIDES | ||
| 344 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 345 | Left atrial dilatation | OFFSIDES | ||
| 346 | Lethargy | OFFSIDES | ||
| 347 | Leukoencephalopathy | OFFSIDES | ||
| 348 | Locked-In Syndrome | OFFSIDES | ||
| 349 | Lower respiratory tract infection viral | OFFSIDES | ||
| 350 | Lymphoma | OFFSIDES | ||
| 351 | Malnutrition | SIDER | ||
| 352 | Mediastinoscopy | OFFSIDES | ||
| 353 | Mental status changes | OFFSIDES | ||
| 354 | Metastases to adrenals | OFFSIDES | ||
| 355 | Micrographic skin surgery | OFFSIDES | ||
| 356 | Migraine with Aura | OFFSIDES | ||
| 357 | Moaning | SIDER | ||
| 358 | Monoplegia | OFFSIDES | ||
| 359 | Mood disorder due to a general medical condition | OFFSIDES | ||
| 360 | Mood swings | SIDER | ||
| 361 | Multiple Sclerosis | OFFSIDES | ||
| 362 | Muscle Weakness | OFFSIDES | ||
| 363 | Muscle necrosis | OFFSIDES | ||
| 364 | Musculoskeletal chest pain | SIDER | ||
| 365 | Myopia | OFFSIDES | ||
| 366 | Nephrolithiasis | OFFSIDES | ||
| 367 | Neuralgia | OFFSIDES | ||
| 368 | Nystagmus | SIDER | ||
| 369 | Open reduction of fracture | OFFSIDES | ||
| 370 | Optic Disc Edema | OFFSIDES | ||
| 371 | Oral mucosal erythema | OFFSIDES | ||
| 372 | Oral mucosal hypertrophy | OFFSIDES | ||
| 373 | Oral polypectomy | OFFSIDES | ||
| 374 | Oroantral Fistula | OFFSIDES | ||
| 375 | Osteomyelitis | OFFSIDES | ||
| 376 | Osteoporosis | OFFSIDES | ||
| 377 | Palliative Care | OFFSIDES | ||
| 378 | Pallor | SIDER | ||
| 379 | Panic Disorder | OFFSIDES | ||
| 380 | Paradoxical drug reaction | OFFSIDES | ||
| 381 | Pelvic mass | OFFSIDES | ||
| 382 | Periarthritis | OFFSIDES | ||
| 383 | Pericardial effusion | OFFSIDES | ||
| 384 | Peripheral venous disease | Canada Vigilance: 1 | Canada Vigilance | |
| 385 | Pharyngitis | 12950111 | CTD | |
| 386 | Photophobia | SIDER | ||
| 387 | Pneumothorax | OFFSIDES | ||
| 388 | Post procedural complication | OFFSIDES | ||
| 389 | Post procedural hypothyroidism | OFFSIDES | ||
| 390 | Pregnancy | SIDER | ||
| 391 | Primary sequestrum | OFFSIDES | ||
| 392 | Procedural complication | OFFSIDES | ||
| 393 | Prolapse repair | OFFSIDES | ||
| 394 | Protein total increased | OFFSIDES | ||
| 395 | Psychiatric decompensation | OFFSIDES | ||
| 396 | Pulmonary congestion | OFFSIDES | ||
| 397 | Pupillary deformity | OFFSIDES | ||
| 398 | Purpura | Canada Vigilance: 1 | Canada Vigilance | |
| 399 | QRS axis abnormal | OFFSIDES | ||
| 400 | Rectal Prolapse | OFFSIDES | ||
| 401 | Rectal polyp | OFFSIDES | ||
| 402 | Renal artery occlusion | OFFSIDES | ||
| 403 | Renal cyst | OFFSIDES | ||
| 404 | Residual urine | OFFSIDES | ||
| 405 | Respiratory Paralysis | 2573388 | CTD | |
| 406 | Respiratory tract congestion | OFFSIDES | ||
| 407 | Retinal Artery Occlusion | OFFSIDES | ||
| 408 | Rhinitis | SIDER | ||
| 409 | Right atrial dilatation | OFFSIDES | ||
| 410 | Sarcoidosis | OFFSIDES | ||
| 411 | Schizophrenia | OFFSIDES | ||
| 412 | Sialorrhea | 2606156 | CTD | |
| 413 | Sinus bradycardia | OFFSIDES | ||
| 414 | Sinus operation | OFFSIDES | ||
| 415 | Sinus rhythm | OFFSIDES | ||
| 416 | Sinusitis | OFFSIDES SIDER | ||
| 417 | Skin Induration | OFFSIDES | ||
| 418 | Skin laceration | OFFSIDES | ||
| 419 | Skin neoplasm excision | OFFSIDES | ||
| 420 | Splenic Infarction | OFFSIDES | ||
| 421 | Spondylolisthesis | OFFSIDES | ||
| 422 | Stridor | OFFSIDES | ||
| 423 | Subacute endocarditis | OFFSIDES | ||
| 424 | Subileus | OFFSIDES | ||
| 425 | Suprapubic pain | OFFSIDES | ||
| 426 | Sweating, Gustatory | 12950111 | CTD | |
| 427 | Sweating | SIDER | ||
| 428 | Tendinitis | OFFSIDES | ||
| 429 | Tension | SIDER | ||
| 430 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 431 | Thoracotomy | OFFSIDES | ||
| 432 | Thymoma | OFFSIDES | ||
| 433 | Tinea cruris | OFFSIDES | ||
| 434 | Tinnitus | OFFSIDES | ||
| 435 | Tooth Extraction | OFFSIDES | ||
| 436 | Tracheostomy infection | SIDER | ||
| 437 | Trismus | 15096252 | CTD | |
| 438 | Unresponsive to stimuli | OFFSIDES | ||
| 439 | Upset stomach | SIDER | ||
| 440 | Urinary hesitation | SIDER | ||
| 441 | Urination Disorders | 6711256 | CTD | |
| 442 | Uterine atrophy | OFFSIDES | ||
| 443 | Venous Insufficiency | OFFSIDES | ||
| 444 | Ventricular Fibrillation | OFFSIDES SIDER | ||
| 445 | Ventricular hypokinesia | OFFSIDES | ||
| 446 | Vitreous Detachment | OFFSIDES | ||
| 447 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.