Itraconazole
(VHVPQPYKVGDNFY-AVQIMAJZSA-N)
Structure
- SMILES
- CCC(n1ncn(c1=O)c1ccc(cc1)N1CCN(CC1)c1ccc(cc1)OC[C@@H]1CO[C@@](O1)(Cn1cncn1)c1ccc(cc1Cl)Cl)C
- Molecular Formula:
- C35H38Cl2N8O4
- Molecular Weight:
- 705.633
- Log P:
- 5.7073
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 0
- TPSA:
- 104.7
- CAS Number(s):
- 84625-61-6
Synonym(s)
1.
Itraconazole
2.
Orungal
3.
R-51211
4.
Sporanox
5.
R 51211
6.
R51211
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood creatine phosphokinase increased | FAERS: 24 | US FAERS | |
| 2 | Erythema Multiforme | FAERS: 14 | US FAERS | |
| 3 | Pneumonia | FAERS: 13 | US FAERS | |
| 4 | Alanine Aminotransferase Increased | FAERS: 10 | US FAERS | |
| 5 | Aspartate Aminotransferase Increased | FAERS: 10 | US FAERS | |
| 6 | Malaise | FAERS: 10 | US FAERS | |
| 7 | Stevens-Johnson Syndrome | FAERS: 10 | US FAERS | |
| 8 | Blood lactate dehydrogenase increased | FAERS: 9 | US FAERS | |
| 9 | Pruritus | FAERS: 7 | US FAERS | |
| 10 | jaundice | FAERS: 7 | US FAERS | |
| 11 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 12 | Atrioventricular Block | FAERS: 6 | US FAERS | |
| 13 | Blood creatinine increased | FAERS: 6 | US FAERS | |
| 14 | Erythema | FAERS: 6 | US FAERS | |
| 15 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 16 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 17 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 18 | Headache | FAERS: 5 | US FAERS | |
| 19 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 20 | Respiratory distress | FAERS: 5 | US FAERS | |
| 21 | Thrombocytopenia | FAERS: 5 | US FAERS | |
| 22 | Tinnitus | FAERS: 5 | US FAERS | |
| 23 | Choking | FAERS: 4 | US FAERS | |
| 24 | Cholecystitis | FAERS: 4 | US FAERS | |
| 25 | Dizziness | FAERS: 4 | US FAERS | |
| 26 | Drug ineffective | FAERS: 4 | US FAERS | |
| 27 | Eosinophilia | FAERS: 4 | US FAERS | |
| 28 | Leukopenia | FAERS: 4 | US FAERS | |
| 29 | Myalgia | FAERS: 4 | US FAERS | |
| 30 | Tremor | FAERS: 4 | US FAERS | |
| 31 | Weight decreased | FAERS: 4 | US FAERS | |
| 32 | Azoospermia | FAERS: 3 | US FAERS | |
| 33 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 34 | Bradycardia | FAERS: 3 | US FAERS | |
| 35 | Chest Pain | FAERS: 3 | US FAERS | |
| 36 | Fatigue | FAERS: 3 | US FAERS | |
| 37 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 38 | Hypotension | FAERS: 3 | US FAERS | |
| 39 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 40 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 41 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 42 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 43 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 44 | Pancreatitis | FAERS: 3 | US FAERS | |
| 45 | Pancytopenia | FAERS: 3 | US FAERS | |
| 46 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 47 | Purpura | FAERS: 3 | US FAERS | |
| 48 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 49 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 50 | Amnesia | FAERS: 2 | US FAERS | |
| 51 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 52 | Anxiety | FAERS: 2 | US FAERS | |
| 53 | Arthralgia | FAERS: 2 | US FAERS | |
| 54 | Asthenia | FAERS: 2 | US FAERS | |
| 55 | Back Pain | FAERS: 2 | US FAERS | |
| 56 | Beta 2 microglobulin increased | FAERS: 2 | US FAERS | |
| 57 | Beta-N-acetyl-D-glucosaminidase increased | FAERS: 2 | US FAERS | |
| 58 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 59 | Blood urea increased | FAERS: 2 | US FAERS | |
| 60 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 61 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 62 | Choking sensation | FAERS: 2 | US FAERS | |
| 63 | Colitis | FAERS: 2 | US FAERS | |
| 64 | Cystitis-like symptom | FAERS: 2 | US FAERS | |
| 65 | Deafness | FAERS: 2 | US FAERS | |
| 66 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 67 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 68 | Drug level decreased | FAERS: 2 | US FAERS | |
| 69 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 70 | Epistaxis | FAERS: 2 | US FAERS | |
| 71 | Eye pain | FAERS: 2 | US FAERS | |
| 72 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 73 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 74 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 75 | Leukoderma | FAERS: 2 | US FAERS | |
| 76 | Medication Error | FAERS: 2 | US FAERS | |
| 77 | Myoglobin blood increased | FAERS: 2 | US FAERS | |
| 78 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 79 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 80 | Osteoporosis | FAERS: 2 | US FAERS | |
| 81 | Palpitations | FAERS: 2 | US FAERS | |
| 82 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 83 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 84 | Pneumothorax | FAERS: 2 | US FAERS | |
| 85 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 86 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 87 | Sepsis | FAERS: 2 | US FAERS | |
| 88 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 89 | Somnolence | FAERS: 2 | US FAERS | |
| 90 | Stomatitis | FAERS: 2 | US FAERS | |
| 91 | Ulcer | FAERS: 2 | US FAERS | |
| 92 | Urinary Retention | FAERS: 2 | US FAERS | |
| 93 | Vertigo | FAERS: 2 | US FAERS | |
| 94 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 95 | Adverse event | FAERS: 1 | US FAERS | |
| 96 | Ammonia increased | FAERS: 1 | US FAERS | |
| 97 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 98 | Anuria | FAERS: 1 | US FAERS | |
| 99 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 100 | Appendicitis | FAERS: 1 | US FAERS | |
| 101 | Aspergilloma | FAERS: 1 | US FAERS | |
| 102 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 103 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 104 | Bursitis | FAERS: 1 | US FAERS | |
| 105 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 106 | Candidiasis | FAERS: 1 | US FAERS | |
| 107 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 108 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 109 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 110 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 111 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 112 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 113 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 114 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 115 | Cold sweat | FAERS: 1 | US FAERS | |
| 116 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 117 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 118 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 119 | Cyst | FAERS: 1 | US FAERS | |
| 120 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 121 | Dementia | FAERS: 1 | US FAERS | |
| 122 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 123 | Device related infection | FAERS: 1 | US FAERS | |
| 124 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 125 | Double ureter | FAERS: 1 | US FAERS | |
| 126 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 127 | Drug administration error | FAERS: 1 | US FAERS | |
| 128 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 129 | Dysarthria | FAERS: 1 | US FAERS | |
| 130 | Dysgeusia | FAERS: 1 | US FAERS | |
| 131 | Eczema | FAERS: 1 | US FAERS | |
| 132 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 133 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 134 | Eye opacity | FAERS: 1 | US FAERS | |
| 135 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 136 | Flatulence | FAERS: 1 | US FAERS | |
| 137 | Flushing | FAERS: 1 | US FAERS | |
| 138 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 139 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 140 | Gout | FAERS: 1 | US FAERS | |
| 141 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 142 | Hepatitis | FAERS: 1 | US FAERS | |
| 143 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 144 | Hypophagia | FAERS: 1 | US FAERS | |
| 145 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 146 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 147 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 148 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 149 | Infusion site pain | FAERS: 1 | US FAERS | |
| 150 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 151 | Injection site movement impairment | FAERS: 1 | US FAERS | |
| 152 | Joint swelling | FAERS: 1 | US FAERS | |
| 153 | Laceration | FAERS: 1 | US FAERS | |
| 154 | Lichen Planus | FAERS: 1 | US FAERS | |
| 155 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 156 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 157 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 158 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 159 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 160 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 161 | Myocarditis | FAERS: 1 | US FAERS | |
| 162 | Myoclonus | FAERS: 1 | US FAERS | |
| 163 | Myopathy | FAERS: 1 | US FAERS | |
| 164 | Nausea | FAERS: 1 | US FAERS | |
| 165 | Necrosis | FAERS: 1 | US FAERS | |
| 166 | Negative cardiac inotropic effect | FAERS: 1 | US FAERS | |
| 167 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 168 | No adverse event | FAERS: 1 | US FAERS | |
| 169 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 170 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 171 | Paresis | FAERS: 1 | US FAERS | |
| 172 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 173 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 174 | Peritonsillitis | FAERS: 1 | US FAERS | |
| 175 | Petechiae | FAERS: 1 | US FAERS | |
| 176 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 177 | Product administration error | FAERS: 1 | US FAERS | |
| 178 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 179 | Product dose omission | FAERS: 1 | US FAERS | |
| 180 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 181 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 182 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 183 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 184 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 185 | Renal pain | FAERS: 1 | US FAERS | |
| 186 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 187 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 188 | Scab | FAERS: 1 | US FAERS | |
| 189 | Semen volume decreased | FAERS: 1 | US FAERS | |
| 190 | Senile dementia | FAERS: 1 | US FAERS | |
| 191 | Septic Shock | FAERS: 1 | US FAERS | |
| 192 | Shock | FAERS: 1 | US FAERS | |
| 193 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 194 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 195 | Sluggishness | FAERS: 1 | US FAERS | |
| 196 | Stress ulcer | FAERS: 1 | US FAERS | |
| 197 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 198 | Thrombosis | FAERS: 1 | US FAERS | |
| 199 | Thyroiditis | FAERS: 1 | US FAERS | |
| 200 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 201 | Trichosporon infection | FAERS: 1 | US FAERS | |
| 202 | Urethral stricture | FAERS: 1 | US FAERS | |
| 203 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 204 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 205 | Vomiting | FAERS: 1 | US FAERS | |
| 206 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 207 | liposarcoma | FAERS: 1 | US FAERS | |
| 208 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 209 | skin abrasion | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.