3-ingenyl angelate
(VDJHFHXMUKFKET-WDUFCVPESA-N)
Structure
- SMILES
- C/C=C(\C(=O)O[C@H]1C(=C[C@]23[C@]1(O)[C@H](O)C(=C[C@H](C3=O)[C@H]1[C@@H](C[C@H]2C)C1(C)C)CO)C)/C
- Type(s)
- Approved
- ATC code(s)
- D06BX02
- Molecular Formula:
- C25H34O6
- Molecular Weight:
- 430.534
- Log P:
- 2.3323
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 104.06
- CAS Number(s):
- 75567-37-2
Synonym(s)
1.
3-ingenyl angelate
2.
3-ingenol angelate
3.
PEP 005
4.
PEP-005
5.
PEP005
6.
ingenol mebutate
7.
picato
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Application site erythema | FAERS: 1662 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 2 | Application site pain | FAERS: 1166 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 3 | Application site vesicles | FAERS: 1013 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 4 | Drug administered at inappropriate site | FAERS: 739 | US FAERS | |
| 5 | Application site exfoliation | FAERS: 728 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Application site swelling | FAERS: 567 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 7 | Application site scab | FAERS: 484 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Application site dryness | FAERS: 414 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Incorrect drug administration duration | FAERS: 408 | US FAERS | |
| 10 | Application site pruritus | FAERS: 357 | SIDER US FAERS | |
| 11 | Drug administration error | FAERS: 313 | US FAERS | |
| 12 | Inappropriate schedule of drug administration | FAERS: 281 | US FAERS | |
| 13 | Incorrect dose administered | FAERS: 275 | US FAERS | |
| 14 | Application site discharge | FAERS: 186 | SIDER US FAERS | |
| 15 | Application site reaction | FAERS: 183 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Drug ineffective | FAERS: 171 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 17 | Application site burn | FAERS: 139 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Erythema | FAERS: 130 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 19 | Application site erosion | FAERS: 119 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Application site pustules | FAERS: 107 | SIDER US FAERS | |
| 21 | Accidental exposure to product | FAERS: 103 | US FAERS | |
| 22 | Headache | FAERS: 97 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Eye irritation | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Product use issue | FAERS: 83 | US FAERS | |
| 25 | Application site discomfort | FAERS: 75 | US FAERS | |
| 26 | Application site warmth | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Incorrect product storage | FAERS: 72 | US FAERS | |
| 28 | Application site irritation | FAERS: 68 | SIDER US FAERS | |
| 29 | Product use in unapproved indication | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | No adverse event | FAERS: 56 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 31 | Product packaging quantity issue | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Application site inflammation | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Swelling | FAERS: 51 | SIDER US FAERS | |
| 34 | Pain | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Burning sensation | FAERS: 46 | US FAERS | |
| 36 | Eye pain | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 37 | Wrong technique in product usage process | FAERS: 40 | US FAERS | |
| 38 | Application site papules | FAERS: 34 | US FAERS | |
| 39 | Application site scar | FAERS: 32 | US FAERS | |
| 40 | Application site rash | FAERS: 31 | US FAERS | |
| 41 | Application site ulcer | FAERS: 31 | SIDER US FAERS | |
| 42 | Incorrect product administration duration | FAERS: 31 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 43 | Medication Error | FAERS: 30 | US FAERS | |
| 44 | Product storage error | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Hypersensitivity | FAERS: 27 | US FAERS | |
| 46 | Multiple use of single-use product | FAERS: 27 | US FAERS | |
| 47 | Pruritus | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Nausea | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Drug dispensing error | FAERS: 24 | US FAERS | |
| 50 | Lip swelling | FAERS: 24 | US FAERS | |
| 51 | Scab | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 52 | Squamous cell carcinoma | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Visual Impairment | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 54 | Squamous cell carcinoma of skin | FAERS: 21 | US FAERS | |
| 55 | Inappropriate schedule of product administration | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Wrong technique in drug usage process | FAERS: 20 | US FAERS | |
| 57 | Disease recurrence | FAERS: 19 | US FAERS | |
| 58 | Dizziness | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Drug prescribing error | FAERS: 18 | US FAERS | |
| 60 | Application site infection | FAERS: 17 | SIDER US FAERS | |
| 61 | Skin reaction | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Discomfort | FAERS: 16 | US FAERS | |
| 63 | Oropharyngeal pain | FAERS: 16 | US FAERS | |
| 64 | Dry skin | FAERS: 15 | US FAERS | |
| 65 | Product quality issue | FAERS: 15 | US FAERS | |
| 66 | Application site induration | FAERS: 14 | US FAERS | |
| 67 | Skin tightness | FAERS: 14 | US FAERS | |
| 68 | Actinic keratosis | FAERS: 13 | US FAERS | |
| 69 | Periorbital swelling | FAERS: 11 | US FAERS | |
| 70 | Product administration error | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 71 | Throat irritation | FAERS: 11 | US FAERS | |
| 72 | Application site hypersensitivity | FAERS: 10 | US FAERS | |
| 73 | Fatigue | FAERS: 10 | US FAERS | |
| 74 | Basal cell carcinoma | FAERS: 9 | US FAERS | |
| 75 | Accidental overdose | FAERS: 8 | US FAERS | |
| 76 | Application site urticaria | FAERS: 8 | US FAERS | |
| 77 | Asthenia | FAERS: 8 | US FAERS | |
| 78 | Disease Progression | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 79 | Product container issue | FAERS: 8 | US FAERS | |
| 80 | Skin lesion | FAERS: 8 | US FAERS | |
| 81 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 82 | Vomiting | FAERS: 8 | US FAERS | |
| 83 | Angioedema | FAERS: 7 | US FAERS | |
| 84 | Blister rupture | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Drug dose omission | FAERS: 7 | US FAERS | |
| 86 | Inflammation | FAERS: 7 | US FAERS | |
| 87 | Skin Ulcer | FAERS: 7 | US FAERS | |
| 88 | Tongue discomfort | FAERS: 7 | US FAERS | |
| 89 | Anxiety | FAERS: 6 | US FAERS | |
| 90 | Chills | FAERS: 6 | US FAERS | |
| 91 | Dysgeusia | FAERS: 6 | US FAERS | |
| 92 | Oral pain | FAERS: 6 | US FAERS | |
| 93 | Overdose | FAERS: 6 | US FAERS | |
| 94 | Product packaging issue | FAERS: 6 | US FAERS | |
| 95 | Unevaluable event | FAERS: 6 | US FAERS | |
| 96 | Urticaria | FAERS: 6 | US FAERS | |
| 97 | Application site acne | FAERS: 5 | US FAERS | |
| 98 | Conjunctivitis | FAERS: 5 | SIDER US FAERS | |
| 99 | Infection | FAERS: 5 | SIDER US FAERS | |
| 100 | Malaise | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Myalgia | FAERS: 5 | US FAERS | |
| 102 | Palpitations | FAERS: 5 | US FAERS | |
| 103 | Papule | FAERS: 5 | US FAERS | |
| 104 | Photophobia | FAERS: 5 | US FAERS | |
| 105 | Rash erythematous | FAERS: 5 | US FAERS | |
| 106 | Sunburn | FAERS: 5 | US FAERS | |
| 107 | Adverse event | FAERS: 4 | US FAERS | |
| 108 | Application site fissure | FAERS: 4 | US FAERS | |
| 109 | Application site wound | FAERS: 4 | US FAERS | |
| 110 | Chest Pain | FAERS: 4 | US FAERS | |
| 111 | Chest discomfort | FAERS: 4 | US FAERS | |
| 112 | Dermatitis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 113 | Expired product administered | FAERS: 4 | US FAERS | |
| 114 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 115 | Post inflammatory pigmentation change | FAERS: 4 | US FAERS | |
| 116 | Product physical consistency issue | FAERS: 4 | US FAERS | |
| 117 | Sepsis | FAERS: 4 | US FAERS | |
| 118 | Tremor | FAERS: 4 | US FAERS | |
| 119 | Acne | FAERS: 3 | US FAERS | |
| 120 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 121 | Alopecia | FAERS: 3 | US FAERS | |
| 122 | Chemical burn of skin | FAERS: 3 | US FAERS | |
| 123 | Eye Burns | FAERS: 3 | US FAERS | |
| 124 | Eye inflammation | FAERS: 3 | US FAERS | |
| 125 | Eyelid irritation | FAERS: 3 | US FAERS | |
| 126 | Eyelid pain | FAERS: 3 | US FAERS | |
| 127 | Facial Pain | FAERS: 3 | US FAERS | |
| 128 | Hyperkeratosis | FAERS: 3 | US FAERS | |
| 129 | Impaired work ability | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Impetigo | FAERS: 3 | US FAERS | |
| 131 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 132 | Nasopharyngitis | FAERS: 3 | SIDER US FAERS | |
| 133 | Product label confusion | FAERS: 3 | US FAERS | |
| 134 | Product label issue | FAERS: 3 | US FAERS | |
| 135 | Skin Erosion | FAERS: 3 | US FAERS | |
| 136 | Skin irritation | FAERS: 3 | US FAERS | |
| 137 | Ulcer | FAERS: 3 | SIDER US FAERS | |
| 138 | VIIth nerve paralysis | FAERS: 3 | US FAERS | |
| 139 | skin abrasion | FAERS: 3 | US FAERS | |
| 140 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 141 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 142 | Administration site scar | FAERS: 2 | US FAERS | |
| 143 | Ageusia | FAERS: 2 | US FAERS | |
| 144 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 145 | Anosmia | FAERS: 2 | US FAERS | |
| 146 | Application site folliculitis | FAERS: 2 | US FAERS | |
| 147 | Application site mass | FAERS: 2 | US FAERS | |
| 148 | Application site necrosis | FAERS: 2 | US FAERS | |
| 149 | Application site nodule | FAERS: 2 | US FAERS | |
| 150 | Application site telangiectasia | FAERS: 2 | US FAERS | |
| 151 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 152 | Blindness | FAERS: 2 | US FAERS | |
| 153 | Bowen's Disease | FAERS: 2 | US FAERS | |
| 154 | Cellulitis | FAERS: 2 | US FAERS | |
| 155 | Chemical eye injury | FAERS: 2 | US FAERS | |
| 156 | Deformity | FAERS: 2 | US FAERS | |
| 157 | Diplopia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Drug ineffective for unapproved indication | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Eczema | FAERS: 2 | US FAERS | |
| 160 | Excoriation | FAERS: 2 | US FAERS | |
| 161 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 162 | Genital cyst | FAERS: 2 | US FAERS | |
| 163 | Hordeolum | FAERS: 2 | US FAERS | |
| 164 | Hypokinesia | FAERS: 2 | US FAERS | |
| 165 | Infected cyst | FAERS: 2 | US FAERS | |
| 166 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 167 | Keratosis pilaris | FAERS: 2 | US FAERS | |
| 168 | Lacrimation decreased | FAERS: 2 | US FAERS | |
| 169 | Lethargy | FAERS: 2 | US FAERS | |
| 170 | Leukopenia | FAERS: 2 | US FAERS | |
| 171 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 172 | Miliaria | FAERS: 2 | US FAERS | |
| 173 | Muscle tightness | FAERS: 2 | US FAERS | |
| 174 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 175 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 176 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 177 | Oral mucosal exfoliation | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 178 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 179 | Product container seal issue | FAERS: 2 | US FAERS | |
| 180 | Product prescribing error | FAERS: 2 | US FAERS | |
| 181 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 182 | Purulence | FAERS: 2 | US FAERS | |
| 183 | Rebound effect | FAERS: 2 | US FAERS | |
| 184 | Rosacea | FAERS: 2 | US FAERS | |
| 185 | Sinus pain | FAERS: 2 | US FAERS | |
| 186 | Sneezing | FAERS: 2 | US FAERS | |
| 187 | Solar lentigo | FAERS: 2 | US FAERS | |
| 188 | Somnolence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Stress | FAERS: 2 | US FAERS | |
| 190 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 191 | Trigeminal Nerve Disorder | FAERS: 2 | US FAERS | |
| 192 | keratoacanthoma | FAERS: 2 | US FAERS | |
| 193 | Administration site indentation | FAERS: 1 | US FAERS | |
| 194 | Anger | FAERS: 1 | US FAERS | |
| 195 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 196 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 197 | Application site abscess | FAERS: 1 | US FAERS | |
| 198 | Application site cellulitis | FAERS: 1 | US FAERS | |
| 199 | Application site perspiration | FAERS: 1 | US FAERS | |
| 200 | Arthralgia | FAERS: 1 | US FAERS | |
| 201 | Asthma | FAERS: 1 | US FAERS | |
| 202 | Bed rest | FAERS: 1 | US FAERS | |
| 203 | Blepharospasm | FAERS: 1 | US FAERS | |
| 204 | Blood blister | FAERS: 1 | US FAERS | |
| 205 | Bone pain | FAERS: 1 | US FAERS | |
| 206 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 207 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 208 | Cheilitis | FAERS: 1 | US FAERS | |
| 209 | Chemical injury | FAERS: 1 | US FAERS | |
| 210 | Chloasma | FAERS: 1 | US FAERS | |
| 211 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 212 | Cold sweat | FAERS: 1 | US FAERS | |
| 213 | Constipation | FAERS: 1 | US FAERS | |
| 214 | Corneal Infection | FAERS: 1 | US FAERS | |
| 215 | Corneal graft rejection | FAERS: 1 | US FAERS | |
| 216 | Crying | FAERS: 1 | US FAERS | |
| 217 | Deafness | FAERS: 1 | US FAERS | |
| 218 | Dental discomfort | FAERS: 1 | US FAERS | |
| 219 | Depressed mood | FAERS: 1 | US FAERS | |
| 220 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 221 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 222 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 223 | Dyspepsia | FAERS: 1 | US FAERS | |
| 224 | Ear discomfort | FAERS: 1 | US FAERS | |
| 225 | Economic problem | FAERS: 1 | US FAERS | |
| 226 | Entropion | FAERS: 1 | US FAERS | |
| 227 | Epistaxis | FAERS: 1 | US FAERS | |
| 228 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 229 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 230 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 231 | Extra dose administered | FAERS: 1 | US FAERS | |
| 232 | Eye Infection | FAERS: 1 | US FAERS | |
| 233 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 234 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 235 | Facial paralysis | FAERS: 1 | US FAERS | |
| 236 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 237 | Flushing | FAERS: 1 | US FAERS | |
| 238 | Genital Herpes | FAERS: 1 | US FAERS | |
| 239 | Genital pain | FAERS: 1 | US FAERS | |
| 240 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 241 | Glossitis | FAERS: 1 | US FAERS | |
| 242 | Head discomfort | FAERS: 1 | US FAERS | |
| 243 | Herpes zoster cutaneous disseminated | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 245 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 246 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 247 | Induration | FAERS: 1 | US FAERS | |
| 248 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 249 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 250 | Keratitis | FAERS: 1 | US FAERS | |
| 251 | Laceration | FAERS: 1 | US FAERS | |
| 252 | Limb discomfort | FAERS: 1 | US FAERS | |
| 253 | Lip erythema | FAERS: 1 | US FAERS | |
| 254 | Macular degeneration | FAERS: 1 | US FAERS | |
| 255 | Medication residue present | FAERS: 1 | US FAERS | |
| 256 | Middle insomnia | FAERS: 1 | US FAERS | |
| 257 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 258 | Nervousness | FAERS: 1 | US FAERS | |
| 259 | Neuralgia | FAERS: 1 | US FAERS | |
| 260 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 261 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 262 | Oral pruritus | FAERS: 1 | US FAERS | |
| 263 | Pain of skin | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Pallor | FAERS: 1 | US FAERS | |
| 265 | Penile necrosis | FAERS: 1 | US FAERS | |
| 266 | Periorbital Infection | FAERS: 1 | US FAERS | |
| 267 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 268 | Periorbital inflammation | FAERS: 1 | US FAERS | |
| 269 | Physical disability | FAERS: 1 | US FAERS | |
| 270 | Pneumonia | FAERS: 1 | US FAERS | |
| 271 | Porokeratosis | FAERS: 1 | US FAERS | |
| 272 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 273 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 274 | Product adhesion issue | FAERS: 1 | US FAERS | |
| 275 | Product formulation issue | FAERS: 1 | US FAERS | |
| 276 | Product lot number issue | FAERS: 1 | US FAERS | |
| 277 | Product size issue | FAERS: 1 | US FAERS | |
| 278 | Psoriasis | FAERS: 1 | US FAERS | |
| 279 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 280 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 281 | Purulent discharge | FAERS: 1 | US FAERS | |
| 282 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 283 | Restlessness | FAERS: 1 | US FAERS | |
| 284 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 285 | Rhinalgia | FAERS: 1 | US FAERS | |
| 286 | Saliva altered | FAERS: 1 | US FAERS | |
| 287 | Sarcoma of skin | FAERS: 1 | US FAERS | |
| 288 | Sinusitis | FAERS: 1 | US FAERS | |
| 289 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 290 | Skin discomfort | FAERS: 1 | US FAERS | |
| 291 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 292 | Stomatitis | FAERS: 1 | US FAERS | |
| 293 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 294 | Superinfection bacterial | FAERS: 1 | US FAERS | |
| 295 | Swelling of eyelid | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Tachycardia | FAERS: 1 | US FAERS | |
| 297 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 298 | Tension | FAERS: 1 | US FAERS | |
| 299 | Therapy cessation | FAERS: 1 | US FAERS | |
| 300 | Thermal burn | FAERS: 1 | US FAERS | |
| 301 | Thirst | FAERS: 1 | US FAERS | |
| 302 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 303 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 304 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 305 | Urinary Retention | FAERS: 1 | US FAERS | |
| 306 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 307 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 308 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 309 | Weight decreased | FAERS: 1 | US FAERS | |
| 310 | furuncle | FAERS: 1 | US FAERS | |
| 311 | Infestation | SIDER | ||
| 312 | Instillation site pain | SIDER | ||
| 313 | Product administered at inappropriate site | Canada Vigilance: 3 | Canada Vigilance | |
| 314 | Product dispensing error | Canada Vigilance: 1 | Canada Vigilance | |
| 315 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.