AN2728
(USZAGAREISWJDP-UHFFFAOYSA-N)
Structure
- SMILES
- N#Cc1ccc(cc1)Oc1ccc2c(c1)COB2O
- Type(s)
- Approved; Investigational
- ATC code(s)
- D11AH06
- Molecular Formula:
- C14H10BNO3
- Molecular Weight:
- 251.045
- Log P:
- 1.5683
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 62.48
- CAS Number(s):
- 906673-24-3
Synonym(s)
1.
AN2728
2.
5-(4-cyanophenoxy)-2,3-dihydro-1-hydroxy-2,1-benzoxaborole
3.
AN-2728
4.
crisaborole
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Application site pain | FAERS: 1049 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 908 Canada Vigilance: 32 | Canada Vigilance US FAERS | |
| 3 | Burning sensation | FAERS: 743 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Pain | FAERS: 357 | US FAERS | |
| 5 | Pruritus | FAERS: 178 | US FAERS | |
| 6 | Erythema | FAERS: 174 | US FAERS | |
| 7 | Application site erythema | FAERS: 162 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Product use in unapproved indication | FAERS: 152 | US FAERS | |
| 9 | Application site pruritus | FAERS: 97 | US FAERS | |
| 10 | Drug ineffective for unapproved indication | FAERS: 96 | US FAERS | |
| 11 | Product use issue | FAERS: 95 | US FAERS | |
| 12 | Urticaria | FAERS: 85 | US FAERS | |
| 13 | Hypersensitivity | FAERS: 73 | US FAERS | |
| 14 | Drug effect incomplete | FAERS: 65 | US FAERS | |
| 15 | Eczema | FAERS: 64 | US FAERS | |
| 16 | Drug effective for unapproved indication | FAERS: 62 | US FAERS | |
| 17 | Skin irritation | FAERS: 61 | US FAERS | |
| 18 | Application site swelling | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Dry skin | FAERS: 52 | US FAERS | |
| 20 | Drug administered to patient of inappropriate age | FAERS: 46 | US FAERS | |
| 21 | Application site irritation | FAERS: 42 | US FAERS | |
| 22 | Eyelid irritation | FAERS: 39 | US FAERS | |
| 23 | Application site burn | FAERS: 38 | US FAERS | |
| 24 | Swelling | FAERS: 37 | US FAERS | |
| 25 | Intentional product misuse | FAERS: 32 | US FAERS | |
| 26 | Application site rash | FAERS: 28 | US FAERS | |
| 27 | Eye irritation | FAERS: 28 | US FAERS | |
| 28 | Crying | FAERS: 25 | US FAERS | |
| 29 | Therapeutic product effect incomplete | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Application site inflammation | FAERS: 23 | US FAERS | |
| 31 | Acne | FAERS: 22 | US FAERS | |
| 32 | Dermatitis | FAERS: 21 | US FAERS | |
| 33 | Facial Pain | FAERS: 21 | US FAERS | |
| 34 | Application site vesicles | FAERS: 20 | US FAERS | |
| 35 | Eyelid pain | FAERS: 20 | US FAERS | |
| 36 | Inflammation | FAERS: 19 | US FAERS | |
| 37 | Pain of skin | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Thermal burn | FAERS: 17 | US FAERS | |
| 39 | Therapeutic response unexpected | FAERS: 16 | US FAERS | |
| 40 | Application site urticaria | FAERS: 15 | US FAERS | |
| 41 | Application site warmth | FAERS: 14 | US FAERS | |
| 42 | Skin lesion | FAERS: 14 | US FAERS | |
| 43 | Application site dryness | FAERS: 12 | US FAERS | |
| 44 | Product administered at inappropriate site | FAERS: 12 | US FAERS | |
| 45 | Application site exfoliation | FAERS: 11 | US FAERS | |
| 46 | Peripheral swelling | FAERS: 11 | US FAERS | |
| 47 | Eye pain | FAERS: 10 | US FAERS | |
| 48 | Pre-existing condition improved | FAERS: 10 | US FAERS | |
| 49 | Scab | FAERS: 9 | US FAERS | |
| 50 | Discomfort | FAERS: 8 | US FAERS | |
| 51 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 52 | Prescription drug used without a prescription | FAERS: 8 | US FAERS | |
| 53 | Screaming | FAERS: 8 | US FAERS | |
| 54 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 55 | Drug administered at inappropriate site | FAERS: 7 | US FAERS | |
| 56 | Infection | FAERS: 7 | US FAERS | |
| 57 | Product quality issue | FAERS: 7 | US FAERS | |
| 58 | Rash erythematous | FAERS: 7 | US FAERS | |
| 59 | Therapeutic product effect decreased | FAERS: 7 | US FAERS | |
| 60 | Application site reaction | FAERS: 6 | US FAERS | |
| 61 | Blepharitis | FAERS: 6 | US FAERS | |
| 62 | Dizziness | FAERS: 6 | US FAERS | |
| 63 | Lip swelling | FAERS: 6 | US FAERS | |
| 64 | Papule | FAERS: 6 | US FAERS | |
| 65 | Poor quality drug administered | FAERS: 6 | US FAERS | |
| 66 | Skin reaction | FAERS: 6 | US FAERS | |
| 67 | Allergic reaction to excipient | FAERS: 5 | US FAERS | |
| 68 | Application site discomfort | FAERS: 5 | US FAERS | |
| 69 | Cheilitis | FAERS: 5 | US FAERS | |
| 70 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 71 | Rosacea | FAERS: 5 | US FAERS | |
| 72 | Skin Erosion | FAERS: 5 | US FAERS | |
| 73 | Poor quality product administered | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Product storage error | FAERS: 4 | US FAERS | |
| 75 | Skin discomfort | FAERS: 4 | US FAERS | |
| 76 | Tremor | FAERS: 4 | US FAERS | |
| 77 | skin abrasion | FAERS: 4 | US FAERS | |
| 78 | Application site discharge | FAERS: 3 | US FAERS | |
| 79 | Application site fissure | FAERS: 3 | US FAERS | |
| 80 | Application site hypersensitivity | FAERS: 3 | US FAERS | |
| 81 | Application site induration | FAERS: 3 | US FAERS | |
| 82 | Application site infection | FAERS: 3 | US FAERS | |
| 83 | Application site laceration | FAERS: 3 | US FAERS | |
| 84 | Application site pustules | FAERS: 3 | US FAERS | |
| 85 | Disease recurrence | FAERS: 3 | US FAERS | |
| 86 | Drug dose omission | FAERS: 3 | US FAERS | |
| 87 | Dysgeusia | FAERS: 3 | US FAERS | |
| 88 | Ear discomfort | FAERS: 3 | US FAERS | |
| 89 | Exposure via eye contact | FAERS: 3 | US FAERS | |
| 90 | Eye inflammation | FAERS: 3 | US FAERS | |
| 91 | Headache | FAERS: 3 | US FAERS | |
| 92 | Impetigo | FAERS: 3 | US FAERS | |
| 93 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 94 | Molluscum Contagiosum | FAERS: 3 | US FAERS | |
| 95 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 96 | Palpitations | FAERS: 3 | US FAERS | |
| 97 | Product complaint | FAERS: 3 | US FAERS | |
| 98 | Product dose omission | FAERS: 3 | US FAERS | |
| 99 | Product physical issue | FAERS: 3 | US FAERS | |
| 100 | Product use complaint | FAERS: 3 | US FAERS | |
| 101 | Sneezing | FAERS: 3 | US FAERS | |
| 102 | treatment failure | FAERS: 3 | US FAERS | |
| 103 | Alopecia | FAERS: 2 | US FAERS | |
| 104 | Angioedema | FAERS: 2 | US FAERS | |
| 105 | Anxiety | FAERS: 2 | US FAERS | |
| 106 | Application site papules | FAERS: 2 | US FAERS | |
| 107 | Application site scar | FAERS: 2 | US FAERS | |
| 108 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 109 | Chills | FAERS: 2 | US FAERS | |
| 110 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 111 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 112 | Excoriation | FAERS: 2 | US FAERS | |
| 113 | Feeling jittery | FAERS: 2 | US FAERS | |
| 114 | Flushing | FAERS: 2 | US FAERS | |
| 115 | Folliculitis | FAERS: 2 | US FAERS | |
| 116 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 117 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 118 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 119 | Lip pruritus | FAERS: 2 | US FAERS | |
| 120 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 121 | Nausea | FAERS: 2 | US FAERS | |
| 122 | No adverse event | FAERS: 2 | US FAERS | |
| 123 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 124 | Product administration error | FAERS: 2 | US FAERS | |
| 125 | Product formulation issue | FAERS: 2 | US FAERS | |
| 126 | Product physical consistency issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Psoriasis | FAERS: 2 | US FAERS | |
| 128 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 129 | Secretion discharge | FAERS: 2 | US FAERS | |
| 130 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 131 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 132 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 133 | Skin tightness | FAERS: 2 | US FAERS | |
| 134 | Stress | FAERS: 2 | US FAERS | |
| 135 | Therapeutic product effect delayed | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Tinea Pedis | FAERS: 2 | US FAERS | |
| 137 | Vomiting | FAERS: 2 | US FAERS | |
| 138 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 139 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 140 | Administration site swelling | FAERS: 1 | US FAERS | |
| 141 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 142 | Application site acne | FAERS: 1 | US FAERS | |
| 143 | Application site erosion | FAERS: 1 | US FAERS | |
| 144 | Application site joint swelling | FAERS: 1 | US FAERS | |
| 145 | Application site nodule | FAERS: 1 | US FAERS | |
| 146 | Asthma | FAERS: 1 | US FAERS | |
| 147 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 148 | Choking | FAERS: 1 | US FAERS | |
| 149 | Chromaturia | FAERS: 1 | US FAERS | |
| 150 | Constipation | FAERS: 1 | US FAERS | |
| 151 | Corneal Endothelial Cell Loss | FAERS: 1 | US FAERS | |
| 152 | Deafness | FAERS: 1 | US FAERS | |
| 153 | Dehydration | FAERS: 1 | US FAERS | |
| 154 | Depressed mood | FAERS: 1 | US FAERS | |
| 155 | Drug administration error | FAERS: 1 | US FAERS | |
| 156 | Drug effect variable | FAERS: 1 | US FAERS | |
| 157 | Dysuria | FAERS: 1 | US FAERS | |
| 158 | Economic problem | FAERS: 1 | US FAERS | |
| 159 | Eczema weeping | FAERS: 1 | US FAERS | |
| 160 | Emotional disorder | FAERS: 1 | US FAERS | |
| 161 | Erythrasma | FAERS: 1 | US FAERS | |
| 162 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 163 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 164 | Feeling Cold | FAERS: 1 | US FAERS | |
| 165 | Food Allergy | FAERS: 1 | US FAERS | |
| 166 | Formication | FAERS: 1 | US FAERS | |
| 167 | Frostbite | FAERS: 1 | US FAERS | |
| 168 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 169 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 170 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 171 | Influenza | FAERS: 1 | US FAERS | |
| 172 | Laceration | FAERS: 1 | US FAERS | |
| 173 | Lethargy | FAERS: 1 | US FAERS | |
| 174 | Macule | FAERS: 1 | US FAERS | |
| 175 | Malaise | FAERS: 1 | US FAERS | |
| 176 | Mastocytosis | FAERS: 1 | US FAERS | |
| 177 | Miliaria | FAERS: 1 | US FAERS | |
| 178 | Myalgia | FAERS: 1 | US FAERS | |
| 179 | Neck Pain | FAERS: 1 | US FAERS | |
| 180 | Nerve injury | FAERS: 1 | US FAERS | |
| 181 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 182 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 183 | Onychoclasis | FAERS: 1 | US FAERS | |
| 184 | Onychomycosis | FAERS: 1 | US FAERS | |
| 185 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 186 | Oral pain | FAERS: 1 | US FAERS | |
| 187 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 188 | Otitis Externa | FAERS: 1 | US FAERS | |
| 189 | Pallor | FAERS: 1 | US FAERS | |
| 190 | Penile swelling | FAERS: 1 | US FAERS | |
| 191 | Perioral Dermatitis | FAERS: 1 | US FAERS | |
| 192 | Physical product label issue | FAERS: 1 | US FAERS | |
| 193 | Product name confusion | FAERS: 1 | US FAERS | |
| 194 | Product prescribing error | FAERS: 1 | US FAERS | |
| 195 | Promotion of wound healing | FAERS: 1 | US FAERS | |
| 196 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 197 | Rebound eczema | FAERS: 1 | US FAERS | |
| 198 | Rebound effect | FAERS: 1 | US FAERS | |
| 199 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 200 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 201 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 202 | Skin laceration | FAERS: 1 | US FAERS | |
| 203 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 204 | Somnolence | FAERS: 1 | US FAERS | |
| 205 | Stomatitis | FAERS: 1 | US FAERS | |
| 206 | Sunburn | FAERS: 1 | US FAERS | |
| 207 | Superinfection bacterial | FAERS: 1 | US FAERS | |
| 208 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 209 | Syncope | FAERS: 1 | US FAERS | |
| 210 | Ulcer | FAERS: 1 | US FAERS | |
| 211 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 212 | Viral myositis | FAERS: 1 | US FAERS | |
| 213 | Visual Impairment | FAERS: 1 | US FAERS | |
| 214 | Vitiligo | FAERS: 1 | US FAERS | |
| 215 | Wound Complication | FAERS: 1 | US FAERS | |
| 216 | Wrong product administered | FAERS: 1 | US FAERS | |
| 217 | Product shape issue | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.