N-(4-bromo-2-fluorophenyl)-6-methoxy-7-((1-methylpiperidin-4-yl)methoxy)quinazolin-4-amine
(UHTHHESEBZOYNR-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc2c(ncnc2cc1OCC1CCN(CC1)C)Nc1ccc(cc1F)Br
- Type(s)
- Approved
- ATC code(s)
- L01XE12
- Molecular Formula:
- C22H24BrFN4O2
- Molecular Weight:
- 475.354
- Log P:
- 5.0151
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 59.51
- CAS Number(s):
- 338992-00-0; 443913-73-3
Synonym(s)
1.
N-(4-bromo-2-fluorophenyl)-6-methoxy-7-((1-methylpiperidin-4-yl)methoxy)quinazolin-4-amine
2.
ZD 6474
3.
ZD-6474
4.
ZD6474
5.
Zactima
6.
caprelsa
7.
vandetanib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 2 | Nausea | FAERS: 20 | SIDER US FAERS | |
| 3 | Disease Progression | FAERS: 17 | US FAERS | |
| 4 | Acne | FAERS: 15 | SIDER US FAERS | |
| 5 | Arthralgia | FAERS: 10 | SIDER US FAERS | |
| 6 | Epistaxis | FAERS: 10 | SIDER US FAERS | |
| 7 | Erythema | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Blood calcitonin increased | FAERS: 8 | US FAERS | |
| 9 | Headache | FAERS: 8 | SIDER US FAERS | |
| 10 | Pneumonia | FAERS: 8 | SIDER US FAERS | |
| 11 | Blood creatinine increased | FAERS: 7 | SIDER US FAERS | |
| 12 | Dehydration | FAERS: 7 | SIDER US FAERS | |
| 13 | Dizziness | FAERS: 7 | SIDER US FAERS | |
| 14 | Dry skin | FAERS: 7 | SIDER US FAERS | |
| 15 | Asthenia | FAERS: 6 | SIDER US FAERS | |
| 16 | Carcinoembryonic antigen increased | FAERS: 6 | US FAERS | |
| 17 | Drug ineffective | FAERS: 6 | US FAERS | |
| 18 | Pruritus | FAERS: 6 | SIDER US FAERS | |
| 19 | Abdominal Pain | FAERS: 5 | SIDER US FAERS | |
| 20 | Dermatitis acneiform | FAERS: 5 | SIDER US FAERS | |
| 21 | Malignant neoplasm progression | FAERS: 5 | US FAERS | |
| 22 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 23 | Stomatitis | FAERS: 5 | SIDER US FAERS | |
| 24 | Urinary tract infection | FAERS: 5 | SIDER US FAERS | |
| 25 | Adverse event | FAERS: 4 | US FAERS | |
| 26 | Blood thyroid stimulating hormone increased | FAERS: 4 | US FAERS | |
| 27 | Joint swelling | FAERS: 4 | US FAERS | |
| 28 | Malaise | FAERS: 4 | US FAERS | |
| 29 | Pain | FAERS: 4 | SIDER US FAERS | |
| 30 | Skin toxicity | FAERS: 4 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 32 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 33 | Chest discomfort | FAERS: 3 | US FAERS | |
| 34 | Colitis | FAERS: 3 | SIDER US FAERS | |
| 35 | Electrocardiogram QT interval abnormal | FAERS: 3 | US FAERS | |
| 36 | Electrocardiogram repolarisation abnormality | FAERS: 3 | US FAERS | |
| 37 | Erythrosis | FAERS: 3 | US FAERS | |
| 38 | Lymphocyte count decreased | FAERS: 3 | US FAERS | |
| 39 | Pneumonitis | FAERS: 3 | US FAERS | |
| 40 | Respiratory Failure | FAERS: 3 | SIDER US FAERS | |
| 41 | Sepsis | FAERS: 3 | SIDER US FAERS | |
| 42 | Tachycardia | FAERS: 3 | US FAERS | |
| 43 | Weight decreased | FAERS: 3 | SIDER US FAERS | |
| 44 | Abasia | FAERS: 2 | US FAERS | |
| 45 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 46 | Alanine Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 47 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 48 | Blood calcitonin decreased | FAERS: 2 | US FAERS | |
| 49 | Blood glucose decreased | FAERS: 2 | SIDER US FAERS | |
| 50 | Burning sensation | FAERS: 2 | US FAERS | |
| 51 | Cataract | FAERS: 2 | SIDER US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 53 | Chest Pain | FAERS: 2 | SIDER US FAERS | |
| 54 | Chills | FAERS: 2 | US FAERS | |
| 55 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 56 | Diverticulitis | FAERS: 2 | SIDER US FAERS | |
| 57 | Dysgeusia | FAERS: 2 | SIDER US FAERS | |
| 58 | Dysuria | FAERS: 2 | SIDER US FAERS | |
| 59 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 60 | Eye pain | FAERS: 2 | US FAERS | |
| 61 | General physical health deterioration | FAERS: 2 | SIDER US FAERS | |
| 62 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 63 | Hypertensive crisis | FAERS: 2 | SIDER US FAERS | |
| 64 | Hypotension | FAERS: 2 | US FAERS | |
| 65 | Impaired work ability | FAERS: 2 | US FAERS | |
| 66 | Intestinal Perforation | FAERS: 2 | SIDER US FAERS | |
| 67 | Leukopenia | FAERS: 2 | US FAERS | |
| 68 | Limb injury | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Lip swelling | FAERS: 2 | US FAERS | |
| 70 | Memory impairment | FAERS: 2 | US FAERS | |
| 71 | Muscle tightness | FAERS: 2 | US FAERS | |
| 72 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 73 | Nephrolithiasis | FAERS: 2 | SIDER US FAERS | |
| 74 | Oral pain | FAERS: 2 | US FAERS | |
| 75 | Oropharyngeal pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 77 | Peritonitis | FAERS: 2 | SIDER US FAERS | |
| 78 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 79 | Restlessness | FAERS: 2 | US FAERS | |
| 80 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 81 | Sunburn | FAERS: 2 | US FAERS | |
| 82 | Syncope | FAERS: 2 | US FAERS | |
| 83 | Urticaria | FAERS: 2 | US FAERS | |
| 84 | Visual Impairment | FAERS: 2 | SIDER US FAERS | |
| 85 | Vomiting | FAERS: 2 | SIDER US FAERS | |
| 86 | Abscess | FAERS: 1 | US FAERS | |
| 87 | Amnesia | FAERS: 1 | US FAERS | |
| 88 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 89 | Anuria | FAERS: 1 | SIDER US FAERS | |
| 90 | Aphagia | FAERS: 1 | US FAERS | |
| 91 | Aphasia | FAERS: 1 | US FAERS | |
| 92 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 93 | Ascites | FAERS: 1 | US FAERS | |
| 94 | Atrial Fibrillation | FAERS: 1 | SIDER US FAERS | |
| 95 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 96 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 97 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 98 | Blood glucose increased | FAERS: 1 | SIDER US FAERS | |
| 99 | Blood potassium decreased | FAERS: 1 | SIDER US FAERS | |
| 100 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 101 | Blood urea increased | FAERS: 1 | US FAERS | |
| 102 | Blood urine present | FAERS: 1 | US FAERS | |
| 103 | Bone abscess | FAERS: 1 | US FAERS | |
| 104 | Bone pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Carcinoembryonic antigen decreased | FAERS: 1 | US FAERS | |
| 106 | Cardiac Arrest | FAERS: 1 | SIDER US FAERS | |
| 107 | Cardiotoxicity | FAERS: 1 | 29630634 | CTD US FAERS |
| 108 | Cellulitis | FAERS: 1 | SIDER US FAERS | |
| 109 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 110 | Conjunctivochalasis | FAERS: 1 | US FAERS | |
| 111 | Constipation | FAERS: 1 | SIDER US FAERS | |
| 112 | Cornea verticillata | FAERS: 1 | US FAERS | |
| 113 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 114 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 115 | Depressed mood | FAERS: 1 | US FAERS | |
| 116 | Discomfort | FAERS: 1 | US FAERS | |
| 117 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 118 | Drug dose omission | FAERS: 1 | US FAERS | |
| 119 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 120 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 121 | Ear discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Electrocardiogram PQ interval prolonged | FAERS: 1 | US FAERS | |
| 123 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 124 | Enterocolitis | FAERS: 1 | US FAERS | |
| 125 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 126 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 127 | Eye irritation | FAERS: 1 | US FAERS | |
| 128 | Fibrosis | FAERS: 1 | US FAERS | |
| 129 | Folliculitis | FAERS: 1 | SIDER US FAERS | |
| 130 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 131 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 132 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 133 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 134 | Gene Mutation | FAERS: 1 | US FAERS | |
| 135 | Gingivitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 137 | Hordeolum | FAERS: 1 | US FAERS | |
| 138 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 139 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 140 | Hypothyroidism | FAERS: 1 | SIDER US FAERS | |
| 141 | Ileus | FAERS: 1 | SIDER US FAERS | |
| 142 | Infection | FAERS: 1 | SIDER US FAERS | |
| 143 | Infectious colitis | FAERS: 1 | US FAERS | |
| 144 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 145 | Keratopathy | FAERS: 1 | SIDER US FAERS | |
| 146 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 147 | Lens dislocation | FAERS: 1 | US FAERS | |
| 148 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 149 | Lung Abscess | FAERS: 1 | US FAERS | |
| 150 | Lung cyst | FAERS: 1 | US FAERS | |
| 151 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 152 | Lymphopenia | FAERS: 1 | US FAERS | |
| 153 | Malignant Hypertension | FAERS: 1 | SIDER US FAERS | |
| 154 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 155 | Mental impairment | FAERS: 1 | US FAERS | |
| 156 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 157 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 158 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 159 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 160 | Myalgia | FAERS: 1 | US FAERS | |
| 161 | Mydriasis | FAERS: 1 | US FAERS | |
| 162 | Myocarditis | FAERS: 1 | US FAERS | |
| 163 | Oliguria | FAERS: 1 | US FAERS | |
| 164 | Onychoclasis | FAERS: 1 | US FAERS | |
| 165 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 166 | Palpitations | FAERS: 1 | US FAERS | |
| 167 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 168 | Pancreatitis | FAERS: 1 | SIDER US FAERS | |
| 169 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 170 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 171 | Personality Change | FAERS: 1 | US FAERS | |
| 172 | Petechiae | FAERS: 1 | US FAERS | |
| 173 | Photophobia | FAERS: 1 | US FAERS | |
| 174 | Polydipsia | FAERS: 1 | US FAERS | |
| 175 | Polyuria | FAERS: 1 | US FAERS | |
| 176 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 177 | Procedural complication | FAERS: 1 | US FAERS | |
| 178 | Product label issue | FAERS: 1 | US FAERS | |
| 179 | Product supply issue | FAERS: 1 | US FAERS | |
| 180 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 181 | Product use issue | FAERS: 1 | US FAERS | |
| 182 | Proteinuria | FAERS: 1 | SIDER US FAERS | |
| 183 | Pyelonephritis | FAERS: 1 | SIDER US FAERS | |
| 184 | Rales | FAERS: 1 | US FAERS | |
| 185 | Rectal abscess | FAERS: 1 | US FAERS | |
| 186 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 187 | Retching | FAERS: 1 | US FAERS | |
| 188 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 189 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 190 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 191 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 192 | Skin reaction | FAERS: 1 | US FAERS | |
| 193 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 194 | Somnolence | FAERS: 1 | US FAERS | |
| 195 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 196 | Swelling | FAERS: 1 | US FAERS | |
| 197 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 198 | Therapy cessation | FAERS: 1 | US FAERS | |
| 199 | Thermal burn | FAERS: 1 | US FAERS | |
| 200 | Thrombocytopenia | FAERS: 1 | SIDER US FAERS | |
| 201 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 202 | Thyroid cancer stage IV | FAERS: 1 | US FAERS | |
| 203 | Toothache | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 205 | Ulcer | FAERS: 1 | US FAERS | |
| 206 | Vasculitis | FAERS: 1 | US FAERS | |
| 207 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 208 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 209 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 210 | Von Willebrand's factor antigen increased | FAERS: 1 | US FAERS | |
| 211 | Xerosis | FAERS: 1 | US FAERS | |
| 212 | furuncle | FAERS: 1 | SIDER US FAERS | |
| 213 | Adenocarcinoma | 15596048 | CTD | |
| 214 | Alanine aminotransferase normal | SIDER | ||
| 215 | Alopecia | SIDER | ||
| 216 | Altered state of consciousness | SIDER | ||
| 217 | Amylase increased | SIDER | ||
| 218 | Anxiety | SIDER | ||
| 219 | Appendicitis | SIDER | ||
| 220 | Bipolar Disorder | SIDER | ||
| 221 | Bipolar I disorder | SIDER | ||
| 222 | Bladder pain | SIDER | ||
| 223 | Blood magnesium decreased | SIDER | ||
| 224 | Blood magnesium increased | SIDER | ||
| 225 | Blood potassium increased | SIDER | ||
| 226 | Bradycardia | SIDER | ||
| 227 | Bronchitis | SIDER | ||
| 228 | Bronchospasm | SIDER | ||
| 229 | Ca++ increased | SIDER | ||
| 230 | Calcium low | SIDER | ||
| 231 | Cholecystitis | SIDER | ||
| 232 | Cholelithiasis | SIDER | ||
| 233 | Chromaturia | SIDER | ||
| 234 | Chylothorax | SIDER | ||
| 235 | Clonus | SIDER | ||
| 236 | Conjunctivitis | SIDER | ||
| 237 | Corneal Opacity | SIDER | ||
| 238 | Creatinine increased | SIDER | ||
| 239 | Cystitis | SIDER | ||
| 240 | Cyst | SIDER | ||
| 241 | Depressed Level of Consciousness | SIDER | ||
| 242 | Device occlusion | SIDER | ||
| 243 | Erythema Multiforme | SIDER | ||
| 244 | Gastritis | SIDER | ||
| 245 | Gastroenteritis | SIDER | ||
| 246 | Gastrointestinal Pain | SIDER | ||
| 247 | Glaucoma | SIDER | ||
| 248 | Glucose decreased | SIDER | ||
| 249 | Glucose increased | SIDER | ||
| 250 | Glucose low | SIDER | ||
| 251 | Infestation | SIDER | ||
| 252 | Influenza | SIDER | ||
| 253 | Joint injury | SIDER | ||
| 254 | Laryngitis | SIDER | ||
| 255 | Lethargy | SIDER | ||
| 256 | Lung Neoplasms | 15596048 | CTD | |
| 257 | Lymphatic Metastasis | 21350000 | CTD | |
| 258 | Mg reduced | SIDER | ||
| 259 | Mg++ increased | SIDER | ||
| 260 | Nasopharyngitis | SIDER | ||
| 261 | Neutropenia | SIDER | ||
| 262 | Pelvic venous thrombosis | SIDER | ||
| 263 | Pericarditis | SIDER | ||
| 264 | Pneumatosis intestinalis | SIDER | ||
| 265 | Posterior reversible encephalopathy syndrome | SIDER | ||
| 266 | Potassium increased | SIDER | ||
| 267 | Potassium low | SIDER | ||
| 268 | Protein urine present | SIDER | ||
| 269 | Renal Colic | SIDER | ||
| 270 | Respiratory arrest | SIDER | ||
| 271 | Serum Amylase Increased | SIDER | ||
| 272 | Sinusitis | SIDER | ||
| 273 | Skin Ulcer | SIDER | ||
| 274 | Stent occlusion | SIDER | ||
| 275 | Stevens-Johnson Syndrome | 25811541 | CTD SIDER | |
| 276 | Sudden death | SIDER | ||
| 277 | Tracheitis | SIDER | ||
| 278 | Tremor | SIDER | ||
| 279 | Ventricular arrhythmia | SIDER | ||
| 280 | White blood cell count decreased | SIDER | ||
| 281 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.