oxybutynin
(SWIJYDAEGSIQPZ-UHFFFAOYSA-N)
Structure
- SMILES
- CCN(CC#CCOC(=O)C(c1ccccc1)(C1CCCCC1)O)CC.Cl
- Molecular Formula:
- C22H32ClNO3
- Molecular Weight:
- 393.947
- Log P:
- 4.1449
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 49.77
- CAS Number(s):
- 1508-65-2
Synonym(s)
1.
oxybutynin
2.
4-(diethylamino)-2-butynyl-alpha-cyclohexyl-alpha-hydroxybenzeneacetate
3.
4-(diethylamino)-2-butynyl-alpha-phenylcyclohexaneglycolate
4.
Apo-Oxybutynin
5.
Contimin
6.
Cystonorm
7.
Cystrin
8.
Ditropan
9.
Dresplan
10.
Dridase
11.
Driptane
12.
Gen-Oxybutynin
13.
Novo-Oxybutynin
14.
Nu-Oxybutyn
15.
Oxyb AbZ
16.
Oxybugamma
17.
Oxybutin Holsten
18.
Oxybuton
19.
Oxybutynin AL
20.
Oxybutynin AZU
21.
Oxybutynin Heumann
22.
Oxybutynin Hexal
23.
Oxybutynin Stada
24.
Oxybutynin-Puren
25.
Oxybutynin-ratiopharm
26.
Oxymedin
27.
Oxytrol
28.
PMS-Oxybutynin
29.
Pollakisu
30.
Renamel
31.
Ryol
32.
Spasmex Oxybutynin
33.
Spasyt
34.
Tavor
35.
Zatur
36.
gelnique
37.
oxybutynin chloride
38.
oxybutynin hydrochloride
39.
oxybutynin von ct
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 61 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 17 | US FAERS | |
| 4 | Urinary Retention | FAERS: 11 | US FAERS | |
| 5 | Constipation | FAERS: 10 | US FAERS | |
| 6 | Urinary Incontinence | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Agitation | FAERS: 9 | US FAERS | |
| 8 | Pruritus | FAERS: 9 | US FAERS | |
| 9 | Fatigue | FAERS: 7 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 11 | Mental status changes | FAERS: 7 | US FAERS | |
| 12 | Delirium | FAERS: 6 | US FAERS | |
| 13 | Drug dose omission | FAERS: 6 | US FAERS | |
| 14 | Asthenia | FAERS: 5 | US FAERS | |
| 15 | Growth retardation | FAERS: 5 | US FAERS | |
| 16 | Nausea | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 18 | Diplopia | FAERS: 4 | US FAERS | |
| 19 | Dyspepsia | FAERS: 4 | US FAERS | |
| 20 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 21 | Incontinence | FAERS: 4 | US FAERS | |
| 22 | Medication residue present | FAERS: 4 | US FAERS | |
| 23 | Memory impairment | FAERS: 4 | US FAERS | |
| 24 | Oropharyngeal pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Pain | FAERS: 4 | US FAERS | |
| 26 | Product availability issue | FAERS: 4 | US FAERS | |
| 27 | Product quality issue | FAERS: 4 | US FAERS | |
| 28 | Product substitution issue | FAERS: 4 | US FAERS | |
| 29 | Somnolence | FAERS: 4 | US FAERS | |
| 30 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 31 | Urticaria | FAERS: 4 | US FAERS | |
| 32 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 33 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 34 | Bladder spasm | FAERS: 3 | US FAERS | |
| 35 | Dehydration | FAERS: 3 | US FAERS | |
| 36 | Dementia | FAERS: 3 | US FAERS | |
| 37 | Dental caries | FAERS: 3 | US FAERS | |
| 38 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 39 | Dry skin | FAERS: 3 | US FAERS | |
| 40 | Erythema | FAERS: 3 | US FAERS | |
| 41 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 42 | Laryngitis | FAERS: 3 | US FAERS | |
| 43 | Malaise | FAERS: 3 | US FAERS | |
| 44 | Medication Error | FAERS: 3 | US FAERS | |
| 45 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 46 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 47 | Weight decreased | FAERS: 3 | US FAERS | |
| 48 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 49 | Adverse event | FAERS: 2 | US FAERS | |
| 50 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 51 | Amnesia | FAERS: 2 | US FAERS | |
| 52 | Aphasia | FAERS: 2 | US FAERS | |
| 53 | Application site pain | FAERS: 2 | US FAERS | |
| 54 | Application site urticaria | FAERS: 2 | US FAERS | |
| 55 | Arthralgia | FAERS: 2 | US FAERS | |
| 56 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 57 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 58 | Blood urea increased | FAERS: 2 | US FAERS | |
| 59 | Chest Pain | FAERS: 2 | US FAERS | |
| 60 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 61 | Dysuria | FAERS: 2 | US FAERS | |
| 62 | Eye pain | FAERS: 2 | US FAERS | |
| 63 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 64 | Glaucoma | FAERS: 2 | US FAERS | |
| 65 | Hypotension | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 67 | Infection | FAERS: 2 | US FAERS | |
| 68 | Lip swelling | FAERS: 2 | US FAERS | |
| 69 | Mydriasis | FAERS: 2 | US FAERS | |
| 70 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 71 | Palpitations | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Product dose omission | FAERS: 2 | US FAERS | |
| 73 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 74 | Restlessness | FAERS: 2 | US FAERS | |
| 75 | Screaming | FAERS: 2 | US FAERS | |
| 76 | Stomatitis | FAERS: 2 | US FAERS | |
| 77 | Tachycardia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 79 | Tremor | FAERS: 2 | US FAERS | |
| 80 | Unevaluable event | FAERS: 2 | US FAERS | |
| 81 | Visual Impairment | FAERS: 2 | US FAERS | |
| 82 | Vomiting | FAERS: 2 | US FAERS | |
| 83 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 84 | Administration site irritation | FAERS: 1 | US FAERS | |
| 85 | Ageusia | FAERS: 1 | US FAERS | |
| 86 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 87 | Alopecia | FAERS: 1 | US FAERS | |
| 88 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 89 | Anger | FAERS: 1 | US FAERS | |
| 90 | Angioedema | FAERS: 1 | US FAERS | |
| 91 | Anhidrosis | FAERS: 1 | US FAERS | |
| 92 | Anorexia | FAERS: 1 | US FAERS | |
| 93 | Anxiety | FAERS: 1 | US FAERS | |
| 94 | Apathy | FAERS: 1 | US FAERS | |
| 95 | Application site exfoliation | FAERS: 1 | US FAERS | |
| 96 | Application site inflammation | FAERS: 1 | US FAERS | |
| 97 | Application site irritation | FAERS: 1 | US FAERS | |
| 98 | Application site pruritus | FAERS: 1 | US FAERS | |
| 99 | Application site rash | FAERS: 1 | US FAERS | |
| 100 | Application site reaction | FAERS: 1 | US FAERS | |
| 101 | Arthritis | FAERS: 1 | US FAERS | |
| 102 | Asterixis | FAERS: 1 | US FAERS | |
| 103 | Asthma | FAERS: 1 | US FAERS | |
| 104 | Bedridden | FAERS: 1 | US FAERS | |
| 105 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 106 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 107 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 108 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 109 | Blindness | FAERS: 1 | US FAERS | |
| 110 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 111 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 112 | Blood urine present | FAERS: 1 | US FAERS | |
| 113 | Cataract | FAERS: 1 | US FAERS | |
| 114 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 115 | Chest discomfort | FAERS: 1 | US FAERS | |
| 116 | Choking | FAERS: 1 | US FAERS | |
| 117 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 118 | Coating in mouth | FAERS: 1 | US FAERS | |
| 119 | Cystitis | FAERS: 1 | US FAERS | |
| 120 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 121 | Depressed mood | FAERS: 1 | US FAERS | |
| 122 | Drug administration error | FAERS: 1 | US FAERS | |
| 123 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 124 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 125 | Dysarthria | FAERS: 1 | US FAERS | |
| 126 | Dyscalculia | FAERS: 1 | US FAERS | |
| 127 | Dysgeusia | FAERS: 1 | US FAERS | |
| 128 | Dysgraphia | FAERS: 1 | US FAERS | |
| 129 | Dysphonia | FAERS: 1 | US FAERS | |
| 130 | Emotional disorder | FAERS: 1 | US FAERS | |
| 131 | Enuresis | FAERS: 1 | US FAERS | |
| 132 | Epistaxis | FAERS: 1 | US FAERS | |
| 133 | Expired product administered | FAERS: 1 | US FAERS | |
| 134 | Exsanguination | FAERS: 1 | US FAERS | |
| 135 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 136 | Flushing | FAERS: 1 | US FAERS | |
| 137 | Folliculitis | FAERS: 1 | US FAERS | |
| 138 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 139 | Hypersomnia | FAERS: 1 | US FAERS | |
| 140 | Hysterectomy | FAERS: 1 | US FAERS | |
| 141 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 142 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 143 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 144 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 145 | Joint swelling | FAERS: 1 | US FAERS | |
| 146 | Lack of administration site rotation | FAERS: 1 | US FAERS | |
| 147 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 148 | Lethargy | FAERS: 1 | US FAERS | |
| 149 | Lower Urinary Tract Symptoms | FAERS: 1 | US FAERS | |
| 150 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 151 | Multiple allergies | FAERS: 1 | US FAERS | |
| 152 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 153 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 154 | Myalgia | FAERS: 1 | US FAERS | |
| 155 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 156 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 157 | Nervousness | FAERS: 1 | US FAERS | |
| 158 | Nocturia | FAERS: 1 | US FAERS | |
| 159 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 160 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 161 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 162 | Oliguria | FAERS: 1 | US FAERS | |
| 163 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 164 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 165 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 166 | Personality Change | FAERS: 1 | US FAERS | |
| 167 | Physical product label issue | FAERS: 1 | US FAERS | |
| 168 | Pneumonia | FAERS: 1 | US FAERS | |
| 169 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 170 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 171 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 172 | Product dispensing error | FAERS: 1 | US FAERS | |
| 173 | Product label issue | FAERS: 1 | US FAERS | |
| 174 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 175 | Product physical issue | FAERS: 1 | US FAERS | |
| 176 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 177 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 178 | Product use complaint | FAERS: 1 | US FAERS | |
| 179 | Protein urine present | FAERS: 1 | US FAERS | |
| 180 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 181 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 182 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 183 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 184 | Retching | FAERS: 1 | US FAERS | |
| 185 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 186 | Skin Induration | FAERS: 1 | US FAERS | |
| 187 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 188 | Strabismus | FAERS: 1 | US FAERS | |
| 189 | Swelling | FAERS: 1 | US FAERS | |
| 190 | Syncope | FAERS: 1 | US FAERS | |
| 191 | Terminal dribbling | FAERS: 1 | US FAERS | |
| 192 | Therapy cessation | FAERS: 1 | US FAERS | |
| 193 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 194 | Thrombosis | FAERS: 1 | US FAERS | |
| 195 | Tongue biting | FAERS: 1 | US FAERS | |
| 196 | Urinary occult blood positive | FAERS: 1 | US FAERS | |
| 197 | Vertigo | FAERS: 1 | US FAERS | |
| 198 | treatment failure | FAERS: 1 | US FAERS | |
| 199 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 200 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.