Vitamin B 6
(RBCOYOYDYNXAFA-UHFFFAOYSA-L)
Structure
- SMILES
- Cc1c(COP(=O)([O-])[O-])cnc(c1O)C
- Molecular Formula:
- C8H10NO5P--
- Molecular Weight:
- 231.142
- Log P:
- 1.8897
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 115.35
- CAS Number(s):
- 8059-24-3; 12001-78-4
Synonym(s)
1.
Vitamin B 6
2.
Vitamin B6
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Autistic Disorder | 16494569 16846101 | CTD | |
| 2 | Brain Damage, Chronic | 23690582 | CTD | |
| 3 | Cognition Disorders | 23690582 | CTD | |
| 4 | Coronary Restenosis | 15215483 | CTD | |
| 5 | Developmental Disabilities | 16846101 | CTD | |
| 6 | Drug Eruptions | 11792017 | CTD | |
| 7 | Epilepsy | 2265898 | CTD | |
| 8 | Hypercalciuria | 8112761 | CTD | |
| 9 | Hyperhomocysteinemia | 16397167 | CTD | |
| 10 | Hyperoxaluria | 8112761 | CTD | |
| 11 | Kidney Calculi | 8112761 | CTD | |
| 12 | Movement Disorders | 18052557 | CTD | |
| 13 | Neuralgia | 28716455 | CTD | |
| 14 | Neutropenia | 16322990 | CTD | |
| 15 | Paresthesia | 673833 | CTD | |
| 16 | Peripheral Nervous System Diseases | 3341945 | CTD | |
| 17 | Psychotic Disorders | 25729574 | CTD | |
| 18 | Rosacea | 11763399 | CTD | |
| 19 | Schizophrenia | 25729574 | CTD | |
| 20 | Seizures | 18326306 27466191 | CTD | |
| 21 | Sinus Thrombosis, Intracranial | 18786290 | CTD | |
| 22 | Sleep Initiation and Maintenance Disorders | 3341945 | CTD | |
| 23 | Tremor | 8017343 12075913 | CTD | |
| 24 | Urticaria | 11792017 | CTD | |
| 25 | Vitamin B 6 Deficiency | 3341945 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.