Pramipexole
(QMNWXHSYPXQFSK-KLXURFKVSA-N)
Structure
- SMILES
- CCCN[C@H]1CCc2c(C1)sc(n2)N.Cl.Cl
- Molecular Formula:
- C10H19Cl2N3S
- Molecular Weight:
- 284.249
- Log P:
- 4.1583
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 4
- TPSA:
- 79.18
- CAS Number(s):
- 104632-25-9
Synonym(s)
1.
Pramipexole
2.
2-Amino-4,5,6,7-tetrahydro-6-propylaminobenzothiazole
3.
2-Amino-6-propylaminotetrahydrobenzothiazole
4.
4,5,6,7-Tetrahydro-N6-propyl-2,6-benzothiazole-diamine
5.
6,7-Tetrahydro-N6-propyl-2,6-benzothiazolediamine dihydrochloride monohydrate
6.
Dexpramipexole
7.
KNS 760704
8.
KNS-760704
9.
KNS760704
10.
Mirapex
11.
Pramipexol
12.
Pramipexol Dihydrobromide, (+-)-isomer
13.
Pramipexol Dihydrochloride, (S)-isomer
14.
Pramipexol, (+-)-isomer
15.
Pramipexol, (R)-isomer
16.
Pramipexole Dihydrochloride
17.
Pramipexole Dihydrochloride Anhydrous
18.
Pramipexole Hydrochloride Monohydrate
19.
SND 919CL2x
20.
SND-919
21.
SND-919CL2x
22.
SND919CL2x
23.
Sifrol
24.
2 Amino 6 propylaminotetrahydrobenzothiazole
25.
SND 919
External Link(s)
| MeSH | D000077487 |
| PubChem Compound | 25137927 119569 |
| ChEBI | 51148 |
| CHEMBL | CHEMBL3143955 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 29 | US FAERS | |
| 2 | Product substitution issue | FAERS: 22 | US FAERS | |
| 3 | Compulsive shopping | FAERS: 15 | US FAERS | |
| 4 | Dizziness | FAERS: 15 | US FAERS | |
| 5 | Somnolence | FAERS: 15 | US FAERS | |
| 6 | Drug ineffective for unapproved indication | FAERS: 13 | US FAERS | |
| 7 | Fatigue | FAERS: 12 | US FAERS | |
| 8 | Fracture | FAERS: 11 | US FAERS | |
| 9 | Nausea | FAERS: 11 | US FAERS | |
| 10 | Dependence | FAERS: 10 | US FAERS | |
| 11 | Vomiting | FAERS: 10 | US FAERS | |
| 12 | Headache | FAERS: 9 | US FAERS | |
| 13 | Delirium | FAERS: 8 | US FAERS | |
| 14 | Overdose | FAERS: 8 | US FAERS | |
| 15 | Tremor | FAERS: 8 | US FAERS | |
| 16 | Obsessive-Compulsive Disorder | FAERS: 7 | US FAERS | |
| 17 | Product quality issue | FAERS: 7 | US FAERS | |
| 18 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 19 | Anxiety | FAERS: 6 | US FAERS | |
| 20 | Crying | FAERS: 6 | US FAERS | |
| 21 | Economic problem | FAERS: 6 | US FAERS | |
| 22 | Memory impairment | FAERS: 6 | US FAERS | |
| 23 | Restless Legs Syndrome | FAERS: 6 | US FAERS | |
| 24 | Restlessness | FAERS: 6 | US FAERS | |
| 25 | Asthenia | FAERS: 5 | US FAERS | |
| 26 | Back Pain | FAERS: 5 | US FAERS | |
| 27 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 28 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 29 | Euphoric mood | FAERS: 5 | US FAERS | |
| 30 | Malaise | FAERS: 5 | US FAERS | |
| 31 | Product use issue | FAERS: 5 | US FAERS | |
| 32 | Abasia | FAERS: 4 | US FAERS | |
| 33 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 34 | Chest Pain | FAERS: 4 | US FAERS | |
| 35 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 36 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 37 | Jealous delusion | FAERS: 4 | US FAERS | |
| 38 | Pain | FAERS: 4 | US FAERS | |
| 39 | Palpitations | FAERS: 4 | US FAERS | |
| 40 | Product physical issue | FAERS: 4 | US FAERS | |
| 41 | Arthralgia | FAERS: 3 | US FAERS | |
| 42 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 43 | Depressed mood | FAERS: 3 | US FAERS | |
| 44 | Drug abuse | FAERS: 3 | US FAERS | |
| 45 | Dysarthria | FAERS: 3 | US FAERS | |
| 46 | Hypersomnia | FAERS: 3 | US FAERS | |
| 47 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 48 | Medication Error | FAERS: 3 | US FAERS | |
| 49 | Middle insomnia | FAERS: 3 | US FAERS | |
| 50 | Pneumonia | FAERS: 3 | US FAERS | |
| 51 | Sudden onset of sleep | FAERS: 3 | US FAERS | |
| 52 | Suicide attempt | FAERS: 3 | US FAERS | |
| 53 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 54 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 55 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 56 | Alopecia | FAERS: 2 | US FAERS | |
| 57 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 58 | Depression suicidal | FAERS: 2 | US FAERS | |
| 59 | Dopamine dysregulation syndrome | FAERS: 2 | US FAERS | |
| 60 | Drug administration error | FAERS: 2 | US FAERS | |
| 61 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 62 | Dystonia | FAERS: 2 | US FAERS | |
| 63 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 64 | Fear of falling | FAERS: 2 | US FAERS | |
| 65 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 66 | Feeling jittery | FAERS: 2 | US FAERS | |
| 67 | Gambling | FAERS: 2 | US FAERS | |
| 68 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 69 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 70 | Myalgia | FAERS: 2 | US FAERS | |
| 71 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 72 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 73 | Paranoia | FAERS: 2 | US FAERS | |
| 74 | Pericarditis | FAERS: 2 | US FAERS | |
| 75 | Personality Change | FAERS: 2 | US FAERS | |
| 76 | Rash erythematous | FAERS: 2 | US FAERS | |
| 77 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 78 | Urinary Retention | FAERS: 2 | US FAERS | |
| 79 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 80 | Accidental overdose | FAERS: 1 | US FAERS | |
| 81 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 82 | Akinesia | FAERS: 1 | US FAERS | |
| 83 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 84 | Amnesia | FAERS: 1 | US FAERS | |
| 85 | Anger | FAERS: 1 | US FAERS | |
| 86 | Anhedonia | FAERS: 1 | US FAERS | |
| 87 | Apathy | FAERS: 1 | US FAERS | |
| 88 | Aphagia | FAERS: 1 | US FAERS | |
| 89 | Aphasia | FAERS: 1 | US FAERS | |
| 90 | Asthma | FAERS: 1 | US FAERS | |
| 91 | Automatism | FAERS: 1 | US FAERS | |
| 92 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 93 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 94 | Bone pain | FAERS: 1 | US FAERS | |
| 95 | Bradykinesia | FAERS: 1 | US FAERS | |
| 96 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 97 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 98 | Bronchitis | FAERS: 1 | US FAERS | |
| 99 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 100 | Camptocormia | FAERS: 1 | US FAERS | |
| 101 | Cataract operation | FAERS: 1 | US FAERS | |
| 102 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 103 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 104 | Chills | FAERS: 1 | US FAERS | |
| 105 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 106 | Claustrophobia | FAERS: 1 | US FAERS | |
| 107 | Completed Suicide | FAERS: 1 | US FAERS | |
| 108 | Compulsive hoarding | FAERS: 1 | US FAERS | |
| 109 | Constipation | FAERS: 1 | US FAERS | |
| 110 | Cyanosis | FAERS: 1 | US FAERS | |
| 111 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 112 | Diplopia | FAERS: 1 | US FAERS | |
| 113 | Discomfort | FAERS: 1 | US FAERS | |
| 114 | Disease Progression | FAERS: 1 | US FAERS | |
| 115 | Disorientation | FAERS: 1 | US FAERS | |
| 116 | Drug Dependence | FAERS: 1 | US FAERS | |
| 117 | Dysgeusia | FAERS: 1 | US FAERS | |
| 118 | Dyspepsia | FAERS: 1 | US FAERS | |
| 119 | Dysuria | FAERS: 1 | US FAERS | |
| 120 | Erythema | FAERS: 1 | US FAERS | |
| 121 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 122 | Flatulence | FAERS: 1 | US FAERS | |
| 123 | Flight of ideas | FAERS: 1 | US FAERS | |
| 124 | Food craving | FAERS: 1 | US FAERS | |
| 125 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 126 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 127 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 128 | Hyperphagia | FAERS: 1 | US FAERS | |
| 129 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 130 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 131 | Hypomania | FAERS: 1 | US FAERS | |
| 132 | Hypotension | FAERS: 1 | US FAERS | |
| 133 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 134 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 135 | Infection | FAERS: 1 | US FAERS | |
| 136 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 137 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 138 | Joint swelling | FAERS: 1 | US FAERS | |
| 139 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 141 | Myoclonus | FAERS: 1 | US FAERS | |
| 142 | Narcolepsy | FAERS: 1 | US FAERS | |
| 143 | Near Drowning | FAERS: 1 | US FAERS | |
| 144 | Neuropsychological test abnormal | FAERS: 1 | US FAERS | |
| 145 | Onychoclasis | FAERS: 1 | US FAERS | |
| 146 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 147 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 148 | Pleurisy | FAERS: 1 | US FAERS | |
| 149 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 150 | Product administration error | FAERS: 1 | US FAERS | |
| 151 | Product commingling | FAERS: 1 | US FAERS | |
| 152 | Product dispensing error | FAERS: 1 | US FAERS | |
| 153 | Product label issue | FAERS: 1 | US FAERS | |
| 154 | Product packaging issue | FAERS: 1 | US FAERS | |
| 155 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 156 | Productive Cough | FAERS: 1 | US FAERS | |
| 157 | Pruritus | FAERS: 1 | US FAERS | |
| 158 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 159 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 160 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 161 | Respiratory distress | FAERS: 1 | US FAERS | |
| 162 | Resting Tremor | FAERS: 1 | US FAERS | |
| 163 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 164 | Sleep Talking | FAERS: 1 | US FAERS | |
| 165 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 166 | Staring | FAERS: 1 | US FAERS | |
| 167 | Stress | FAERS: 1 | US FAERS | |
| 168 | Subileus | FAERS: 1 | US FAERS | |
| 169 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 170 | Syncope | FAERS: 1 | US FAERS | |
| 171 | Terminal state | FAERS: 1 | US FAERS | |
| 172 | Theft | FAERS: 1 | US FAERS | |
| 173 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 174 | Unevaluable event | FAERS: 1 | US FAERS | |
| 175 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 176 | Vertigo | FAERS: 1 | US FAERS | |
| 177 | Visual Impairment | FAERS: 1 | US FAERS | |
| 178 | Wrong dosage form | FAERS: 1 | US FAERS | |
| 179 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 180 | kyphosis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.