eluxadoline
(QFNHIDANIVGXPE-FNZWTVRRSA-N)
Structure
- SMILES
- COc1ccc(cc1C(=O)O)CN([C@H](c1ncc([nH]1)c1ccccc1)C)C(=O)[C@H](Cc1c(C)cc(cc1C)C(=O)N)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- A07DA06
- Molecular Formula:
- C32H35N5O5
- Molecular Weight:
- 569.651
- Log P:
- 5.5596
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 164.63
- CAS Number(s):
- 864821-90-9
Synonym(s)
1.
eluxadoline
2.
Viberzi
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 241 Canada Vigilance: 1 | 23583433 26789872 27922029 | CTD Canada Vigilance US FAERS |
| 2 | Pancreatitis | FAERS: 219 Canada Vigilance: 2 | 26789872 27922029 | CTD Canada Vigilance US FAERS |
| 3 | Constipation | FAERS: 152 | 26789872 27922029 | CTD US FAERS |
| 4 | Drug ineffective | FAERS: 119 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 5 | Inappropriate schedule of drug administration | FAERS: 101 | US FAERS | |
| 6 | Nausea | FAERS: 89 Canada Vigilance: 1 | 26789872 27922029 | CTD Canada Vigilance US FAERS |
| 7 | Sphincter of Oddi Dysfunction | FAERS: 70 | US FAERS | |
| 8 | Vomiting | FAERS: 55 | US FAERS | |
| 9 | Contraindicated drug prescribed | FAERS: 53 | US FAERS | |
| 10 | Wrong technique in product usage process | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Dizziness | FAERS: 43 | US FAERS | |
| 12 | Incorrect dose administered | FAERS: 43 | US FAERS | |
| 13 | Contraindicated product administered | FAERS: 39 | US FAERS | |
| 14 | Feeling abnormal | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Chest Pain | FAERS: 35 | US FAERS | |
| 16 | Drug dose omission | FAERS: 35 | US FAERS | |
| 17 | Pain | FAERS: 29 | US FAERS | |
| 18 | Malaise | FAERS: 26 | US FAERS | |
| 19 | Fatigue | FAERS: 24 | US FAERS | |
| 20 | Back Pain | FAERS: 23 | US FAERS | |
| 21 | Abdominal discomfort | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Contraindicated product prescribed | FAERS: 18 | US FAERS | |
| 23 | Drug prescribing error | FAERS: 18 | US FAERS | |
| 24 | Flatulence | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Euphoric mood | FAERS: 16 | US FAERS | |
| 26 | Headache | FAERS: 16 | US FAERS | |
| 27 | Lipase increased | FAERS: 16 | US FAERS | |
| 28 | Somnolence | FAERS: 16 | US FAERS | |
| 29 | Pruritus | FAERS: 14 | US FAERS | |
| 30 | Inappropriate schedule of product administration | FAERS: 12 | US FAERS | |
| 31 | Hypersensitivity | FAERS: 11 | US FAERS | |
| 32 | Alanine Aminotransferase Increased | FAERS: 10 | US FAERS | |
| 33 | Dehydration | FAERS: 10 | US FAERS | |
| 34 | Palpitations | FAERS: 10 | US FAERS | |
| 35 | Drug ineffective for unapproved indication | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Dyspepsia | FAERS: 9 | US FAERS | |
| 37 | Anxiety | FAERS: 8 | US FAERS | |
| 38 | Asthenia | FAERS: 8 | US FAERS | |
| 39 | Chest discomfort | FAERS: 7 | US FAERS | |
| 40 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 41 | Intestinal Obstruction | FAERS: 7 | US FAERS | |
| 42 | Musculoskeletal Pain | FAERS: 7 | US FAERS | |
| 43 | Pancreatic enzymes increased | FAERS: 7 | US FAERS | |
| 44 | Therapeutic response unexpected | FAERS: 7 | US FAERS | |
| 45 | Urticaria | FAERS: 7 | US FAERS | |
| 46 | Weight decreased | FAERS: 7 | US FAERS | |
| 47 | Amylase increased | FAERS: 6 | US FAERS | |
| 48 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 49 | Bowel movement irregularity | FAERS: 6 | US FAERS | |
| 50 | Drug screen positive | FAERS: 6 | US FAERS | |
| 51 | Product dose omission | FAERS: 6 | US FAERS | |
| 52 | Abdominal rigidity | FAERS: 5 | US FAERS | |
| 53 | Head discomfort | FAERS: 5 | US FAERS | |
| 54 | Hepatitis | FAERS: 5 | US FAERS | |
| 55 | Hypotension | FAERS: 5 | US FAERS | |
| 56 | Irritable Bowel Syndrome | FAERS: 5 | 27647873 27922029 | CTD US FAERS |
| 57 | Myalgia | FAERS: 5 | US FAERS | |
| 58 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 59 | Arthralgia | FAERS: 4 | US FAERS | |
| 60 | Chills | FAERS: 4 | US FAERS | |
| 61 | Colitis | FAERS: 4 | US FAERS | |
| 62 | Flushing | FAERS: 4 | US FAERS | |
| 63 | Limb discomfort | FAERS: 4 | US FAERS | |
| 64 | Product prescribing error | FAERS: 4 | US FAERS | |
| 65 | Tremor | FAERS: 4 | US FAERS | |
| 66 | Amnesia | FAERS: 3 | US FAERS | |
| 67 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 68 | Bronchitis | FAERS: 3 | US FAERS | |
| 69 | Burning sensation | FAERS: 3 | US FAERS | |
| 70 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 71 | Cold sweat | FAERS: 3 | US FAERS | |
| 72 | Discomfort | FAERS: 3 | US FAERS | |
| 73 | Dysphonia | FAERS: 3 | US FAERS | |
| 74 | Enzyme level increased | FAERS: 3 | US FAERS | |
| 75 | Eructation | FAERS: 3 | US FAERS | |
| 76 | Erythema | FAERS: 3 | US FAERS | |
| 77 | Expired product administered | FAERS: 3 | US FAERS | |
| 78 | Gastrointestinal Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 80 | Ileus | FAERS: 3 | US FAERS | |
| 81 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 82 | Lethargy | FAERS: 3 | US FAERS | |
| 83 | Ocular icterus | FAERS: 3 | US FAERS | |
| 84 | Product storage error | FAERS: 3 | US FAERS | |
| 85 | Syncope | FAERS: 3 | US FAERS | |
| 86 | Absent bowel movement | FAERS: 2 | US FAERS | |
| 87 | Adverse event | FAERS: 2 | US FAERS | |
| 88 | Alopecia | FAERS: 2 | US FAERS | |
| 89 | Biliary Colic | FAERS: 2 | US FAERS | |
| 90 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 91 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 92 | Cholangitis | FAERS: 2 | US FAERS | |
| 93 | Chromaturia | FAERS: 2 | US FAERS | |
| 94 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 95 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 96 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 97 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 98 | Lip swelling | FAERS: 2 | US FAERS | |
| 99 | Muscle tightness | FAERS: 2 | US FAERS | |
| 100 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 101 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 102 | Overdose | FAERS: 2 | US FAERS | |
| 103 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 104 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 105 | Product use issue | FAERS: 2 | US FAERS | |
| 106 | Rectal discharge | FAERS: 2 | US FAERS | |
| 107 | Sluggishness | FAERS: 2 | US FAERS | |
| 108 | Stress | FAERS: 2 | US FAERS | |
| 109 | Transaminases increased | FAERS: 2 | US FAERS | |
| 110 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 111 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 112 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 113 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 114 | Ammonia increased | FAERS: 1 | US FAERS | |
| 115 | Anorgasmia | FAERS: 1 | US FAERS | |
| 116 | Aphasia | FAERS: 1 | US FAERS | |
| 117 | Ataxia | FAERS: 1 | US FAERS | |
| 118 | Bladder spasm | FAERS: 1 | US FAERS | |
| 119 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 120 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 121 | Blood urine present | FAERS: 1 | US FAERS | |
| 122 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 123 | Cardiac infection | FAERS: 1 | US FAERS | |
| 124 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 125 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 126 | Crying | FAERS: 1 | US FAERS | |
| 127 | Disability | FAERS: 1 | US FAERS | |
| 128 | Disease complication | FAERS: 1 | US FAERS | |
| 129 | Disorientation | FAERS: 1 | US FAERS | |
| 130 | Dissociation | FAERS: 1 | US FAERS | |
| 131 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 132 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 133 | Drug administration error | FAERS: 1 | US FAERS | |
| 134 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 135 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 136 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 137 | Epistaxis | FAERS: 1 | US FAERS | |
| 138 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 139 | Facial paralysis | FAERS: 1 | US FAERS | |
| 140 | False positive investigation result | FAERS: 1 | US FAERS | |
| 141 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 142 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 143 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 144 | Gastritis | FAERS: 1 | US FAERS | |
| 145 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 146 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 147 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 148 | Glossitis | FAERS: 1 | US FAERS | |
| 149 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 150 | Hepatitis A | FAERS: 1 | US FAERS | |
| 151 | Hunger | FAERS: 1 | US FAERS | |
| 152 | Hyperventilation | FAERS: 1 | US FAERS | |
| 153 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 154 | Infection | FAERS: 1 | US FAERS | |
| 155 | Inflammation | FAERS: 1 | US FAERS | |
| 156 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 157 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 158 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 159 | Joint injury | FAERS: 1 | US FAERS | |
| 160 | Joint swelling | FAERS: 1 | US FAERS | |
| 161 | Joint warmth | FAERS: 1 | US FAERS | |
| 162 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 163 | Leukocytosis | FAERS: 1 | US FAERS | |
| 164 | Lipase abnormal | FAERS: 1 | US FAERS | |
| 165 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 166 | Malabsorption | FAERS: 1 | US FAERS | |
| 167 | Medication Error | FAERS: 1 | US FAERS | |
| 168 | Memory impairment | FAERS: 1 | US FAERS | |
| 169 | Menorrhagia | FAERS: 1 | US FAERS | |
| 170 | Mouth swelling | FAERS: 1 | US FAERS | |
| 171 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 172 | Muscle Fatigue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 174 | Muscle strain | FAERS: 1 | US FAERS | |
| 175 | Musculoskeletal stiffness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 177 | Neck Pain | FAERS: 1 | US FAERS | |
| 178 | Nervousness | FAERS: 1 | US FAERS | |
| 179 | No adverse event | FAERS: 1 | US FAERS | |
| 180 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 181 | Pancreatic Enzymes Decreased | FAERS: 1 | US FAERS | |
| 182 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 183 | Personality Change | FAERS: 1 | US FAERS | |
| 184 | Pneumonia | FAERS: 1 | US FAERS | |
| 185 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 186 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 187 | Presyncope | FAERS: 1 | US FAERS | |
| 188 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 189 | Product dispensing error | FAERS: 1 | US FAERS | |
| 190 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 191 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 192 | Product use complaint | FAERS: 1 | US FAERS | |
| 193 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 194 | Rash erythematous | FAERS: 1 | US FAERS | |
| 195 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 196 | Retching | FAERS: 1 | US FAERS | |
| 197 | Rhinitis | FAERS: 1 | US FAERS | |
| 198 | Rosacea | FAERS: 1 | US FAERS | |
| 199 | Sepsis | FAERS: 1 | US FAERS | |
| 200 | Septic Shock | FAERS: 1 | US FAERS | |
| 201 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 202 | Sinusitis | FAERS: 1 | US FAERS | |
| 203 | Skin irritation | FAERS: 1 | US FAERS | |
| 204 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 205 | Sunburn | FAERS: 1 | US FAERS | |
| 206 | Swelling | FAERS: 1 | US FAERS | |
| 207 | Tachycardia | FAERS: 1 | US FAERS | |
| 208 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 209 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 210 | Therapy cessation | FAERS: 1 | US FAERS | |
| 211 | Thirst | FAERS: 1 | US FAERS | |
| 212 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 213 | Unevaluable event | FAERS: 1 | US FAERS | |
| 214 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 215 | Urinary Retention | FAERS: 1 | US FAERS | |
| 216 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 217 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 218 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 219 | Visual Impairment | FAERS: 1 | US FAERS | |
| 220 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 221 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 222 | furuncle | FAERS: 1 | US FAERS | |
| 223 | jaundice | FAERS: 1 | US FAERS | |
| 224 | Diarrhea | 23583433 25261794 26789872 | CTD | |
| 225 | Pneumatosis intestinalis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.