levocetirizine
(PGLIUCLTXOYQMV-GHVWMZMZSA-N)
Structure
- SMILES
- OC(=O)COCCN1CCN(CC1)[C@@H](c1ccc(cc1)Cl)c1ccccc1.Cl.Cl
- Molecular Formula:
- C21H27Cl3N2O3
- Molecular Weight:
- 461.810
- Log P:
- 4.6280
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 53.01
- CAS Number(s):
- 130018-87-0
Synonym(s)
1.
levocetirizine
2.
(2-(4-((R)-(4-chlorophenyl)phenylmethyl)piperazin-1-yl)ethoxy)acetic acid dihydrochloride
3.
(2-(4-((R)-p-chloro-alpha-phenylbenzyl)-1-piperazinyl)ethoxy)acetic acid
4.
UCB-28556
5.
Xusal
6.
Xyzal
7.
acetic acid, (2-(4-((R)-(4-chlorophenyl)phenylmethyl)-1-piperazinyl)ethoxy)-
8.
acetic acid, (2-(4-((R)-(4-chlorophenyl)phenylmethyl)-1-piperazinyl)ethoxy)-, dihydrochloride
9.
cetirizine (R)-form dihydrochloride
10.
levocetirizine dihydrochloride
11.
levocetirizine hydrochloride
12.
levocetrizine
External Link(s)
| MeSH | C472067 |
| PubChem Compound | 9955977 15977288 |
| CHEMBL | CHEMBL1201190 |
| KEGG | dr:D08118 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 819 | US FAERS | |
| 2 | Somnolence | FAERS: 434 | US FAERS | |
| 3 | Fatigue | FAERS: 131 | US FAERS | |
| 4 | Feeling abnormal | FAERS: 108 | US FAERS | |
| 5 | Headache | FAERS: 80 | US FAERS | |
| 6 | Dizziness | FAERS: 62 | US FAERS | |
| 7 | Sneezing | FAERS: 59 | US FAERS | |
| 8 | Hypersensitivity | FAERS: 57 | US FAERS | |
| 9 | Pruritus | FAERS: 50 | US FAERS | |
| 10 | Malaise | FAERS: 38 | US FAERS | |
| 11 | Unevaluable event | FAERS: 37 | US FAERS | |
| 12 | Extra dose administered | FAERS: 33 | US FAERS | |
| 13 | Drug effect incomplete | FAERS: 31 | US FAERS | |
| 14 | Urticaria | FAERS: 29 | US FAERS | |
| 15 | Epistaxis | FAERS: 26 | US FAERS | |
| 16 | Nausea | FAERS: 25 | US FAERS | |
| 17 | Intentional product misuse | FAERS: 21 | US FAERS | |
| 18 | Anxiety | FAERS: 20 | US FAERS | |
| 19 | Hypersomnia | FAERS: 19 | US FAERS | |
| 20 | Pain | FAERS: 19 | US FAERS | |
| 21 | Lethargy | FAERS: 18 | US FAERS | |
| 22 | Adverse event | FAERS: 17 | US FAERS | |
| 23 | Agitation | FAERS: 16 | US FAERS | |
| 24 | Asthenia | FAERS: 16 | US FAERS | |
| 25 | Product packaging issue | FAERS: 16 | US FAERS | |
| 26 | Product use issue | FAERS: 16 | US FAERS | |
| 27 | Throat irritation | FAERS: 16 | US FAERS | |
| 28 | Oropharyngeal pain | FAERS: 15 | US FAERS | |
| 29 | Palpitations | FAERS: 15 | US FAERS | |
| 30 | Product quality issue | FAERS: 15 | US FAERS | |
| 31 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 32 | Back Pain | FAERS: 10 | US FAERS | |
| 33 | Overdose | FAERS: 10 | US FAERS | |
| 34 | Vomiting | FAERS: 10 | US FAERS | |
| 35 | Anger | FAERS: 9 | US FAERS | |
| 36 | Chest discomfort | FAERS: 9 | US FAERS | |
| 37 | Eye irritation | FAERS: 9 | US FAERS | |
| 38 | Tremor | FAERS: 9 | US FAERS | |
| 39 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 40 | No adverse event | FAERS: 8 | US FAERS | |
| 41 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 42 | Abdominal discomfort | FAERS: 7 | US FAERS | |
| 43 | Arthralgia | FAERS: 7 | US FAERS | |
| 44 | Burning sensation | FAERS: 7 | US FAERS | |
| 45 | Chest Pain | FAERS: 7 | US FAERS | |
| 46 | Constipation | FAERS: 7 | US FAERS | |
| 47 | Crying | FAERS: 7 | US FAERS | |
| 48 | Drug dose omission | FAERS: 7 | US FAERS | |
| 49 | Dysgeusia | FAERS: 7 | US FAERS | |
| 50 | Erythema | FAERS: 7 | US FAERS | |
| 51 | Myalgia | FAERS: 7 | US FAERS | |
| 52 | Nasal discomfort | FAERS: 7 | US FAERS | |
| 53 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 54 | Vertigo | FAERS: 7 | US FAERS | |
| 55 | Altered state of consciousness | FAERS: 6 | US FAERS | |
| 56 | Drug Dependence | FAERS: 6 | US FAERS | |
| 57 | Dysphonia | FAERS: 6 | US FAERS | |
| 58 | Sinusitis | FAERS: 6 | US FAERS | |
| 59 | Thirst | FAERS: 6 | US FAERS | |
| 60 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 61 | Dysuria | FAERS: 5 | US FAERS | |
| 62 | Feeling jittery | FAERS: 5 | US FAERS | |
| 63 | Head discomfort | FAERS: 5 | US FAERS | |
| 64 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 65 | Lip swelling | FAERS: 5 | US FAERS | |
| 66 | Medication Error | FAERS: 5 | US FAERS | |
| 67 | Nasal pruritus | FAERS: 5 | US FAERS | |
| 68 | Product taste abnormal | FAERS: 5 | US FAERS | |
| 69 | Restlessness | FAERS: 5 | US FAERS | |
| 70 | Sinus headache | FAERS: 5 | US FAERS | |
| 71 | Sluggishness | FAERS: 5 | US FAERS | |
| 72 | Swelling | FAERS: 5 | US FAERS | |
| 73 | Upper-airway cough syndrome | FAERS: 5 | US FAERS | |
| 74 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 75 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 76 | Accidental overdose | FAERS: 4 | US FAERS | |
| 77 | Asthma | FAERS: 4 | US FAERS | |
| 78 | Dehydration | FAERS: 4 | US FAERS | |
| 79 | Depressed mood | FAERS: 4 | US FAERS | |
| 80 | Drug Tolerance | FAERS: 4 | US FAERS | |
| 81 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 82 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 83 | Influenza | FAERS: 4 | US FAERS | |
| 84 | Memory impairment | FAERS: 4 | US FAERS | |
| 85 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 86 | Product physical issue | FAERS: 4 | US FAERS | |
| 87 | Product size issue | FAERS: 4 | US FAERS | |
| 88 | Product substitution issue | FAERS: 4 | US FAERS | |
| 89 | Therapeutic product effect incomplete | FAERS: 4 | US FAERS | |
| 90 | Urinary Retention | FAERS: 4 | US FAERS | |
| 91 | Visual Impairment | FAERS: 4 | US FAERS | |
| 92 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 93 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 94 | Amnesia | FAERS: 3 | US FAERS | |
| 95 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 96 | Anosmia | FAERS: 3 | US FAERS | |
| 97 | Drug administration error | FAERS: 3 | US FAERS | |
| 98 | Euphoric mood | FAERS: 3 | US FAERS | |
| 99 | Feeling Cold | FAERS: 3 | US FAERS | |
| 100 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 101 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 102 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 103 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 104 | Neck Pain | FAERS: 3 | US FAERS | |
| 105 | Nervousness | FAERS: 3 | US FAERS | |
| 106 | Obsessive thoughts | FAERS: 3 | US FAERS | |
| 107 | Poisoning | FAERS: 3 | US FAERS | |
| 108 | Product blister packaging issue | FAERS: 3 | US FAERS | |
| 109 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 110 | Product use complaint | FAERS: 3 | US FAERS | |
| 111 | Productive Cough | FAERS: 3 | US FAERS | |
| 112 | Tachycardia | FAERS: 3 | US FAERS | |
| 113 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 114 | Alopecia | FAERS: 2 | US FAERS | |
| 115 | Angioedema | FAERS: 2 | US FAERS | |
| 116 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 117 | Bladder pain | FAERS: 2 | US FAERS | |
| 118 | Bronchitis | FAERS: 2 | US FAERS | |
| 119 | Chills | FAERS: 2 | US FAERS | |
| 120 | Cold sweat | FAERS: 2 | US FAERS | |
| 121 | Diplopia | FAERS: 2 | US FAERS | |
| 122 | Discomfort | FAERS: 2 | US FAERS | |
| 123 | Dreamy state | FAERS: 2 | US FAERS | |
| 124 | Drug effect faster than expected | FAERS: 2 | US FAERS | |
| 125 | Drug effect variable | FAERS: 2 | US FAERS | |
| 126 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 127 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 128 | Dry skin | FAERS: 2 | US FAERS | |
| 129 | Ear discomfort | FAERS: 2 | US FAERS | |
| 130 | Eye Burns | FAERS: 2 | US FAERS | |
| 131 | Flatulence | FAERS: 2 | US FAERS | |
| 132 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 133 | Glaucoma | FAERS: 2 | US FAERS | |
| 134 | Impatience | FAERS: 2 | US FAERS | |
| 135 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 136 | Iridocyclitis | FAERS: 2 | US FAERS | |
| 137 | Joint swelling | FAERS: 2 | US FAERS | |
| 138 | Limb discomfort | FAERS: 2 | US FAERS | |
| 139 | Middle insomnia | FAERS: 2 | US FAERS | |
| 140 | Mood swings | FAERS: 2 | US FAERS | |
| 141 | Night sweats | FAERS: 2 | US FAERS | |
| 142 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 143 | Product dose omission | FAERS: 2 | US FAERS | |
| 144 | Product label issue | FAERS: 2 | US FAERS | |
| 145 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 146 | Rash erythematous | FAERS: 2 | US FAERS | |
| 147 | Renal pain | FAERS: 2 | US FAERS | |
| 148 | Rhinitis | FAERS: 2 | US FAERS | |
| 149 | Secretion discharge | FAERS: 2 | US FAERS | |
| 150 | Somnambulism | FAERS: 2 | US FAERS | |
| 151 | Tinnitus | FAERS: 2 | US FAERS | |
| 152 | Urine amphetamine positive | FAERS: 2 | US FAERS | |
| 153 | treatment failure | FAERS: 2 | US FAERS | |
| 154 | Acne | FAERS: 1 | US FAERS | |
| 155 | Acquired von Willebrand's disease | FAERS: 1 | US FAERS | |
| 156 | Ageusia | FAERS: 1 | US FAERS | |
| 157 | Aphonia | FAERS: 1 | US FAERS | |
| 158 | Arthritis | FAERS: 1 | US FAERS | |
| 159 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 160 | Blepharitis | FAERS: 1 | US FAERS | |
| 161 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 162 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 163 | Blood urine present | FAERS: 1 | US FAERS | |
| 164 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 165 | Bronchospasm | FAERS: 1 | US FAERS | |
| 166 | Cataract | FAERS: 1 | US FAERS | |
| 167 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 168 | Cheilitis | FAERS: 1 | US FAERS | |
| 169 | Choking sensation | FAERS: 1 | US FAERS | |
| 170 | Cholestasis | FAERS: 1 | US FAERS | |
| 171 | Colitis | FAERS: 1 | US FAERS | |
| 172 | Completed Suicide | FAERS: 1 | US FAERS | |
| 173 | Deafness | FAERS: 1 | US FAERS | |
| 174 | Delirium | FAERS: 1 | US FAERS | |
| 175 | Deposit eye | FAERS: 1 | US FAERS | |
| 176 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 177 | Device ineffective | FAERS: 1 | US FAERS | |
| 178 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 179 | Drug resistance | FAERS: 1 | US FAERS | |
| 180 | Dyspepsia | FAERS: 1 | US FAERS | |
| 181 | Dysphemia | FAERS: 1 | US FAERS | |
| 182 | Dystonia | FAERS: 1 | US FAERS | |
| 183 | Emotional disorder | FAERS: 1 | US FAERS | |
| 184 | Emotional distress | FAERS: 1 | US FAERS | |
| 185 | Eosinophilic myocarditis | FAERS: 1 | US FAERS | |
| 186 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 187 | Erection increased | FAERS: 1 | US FAERS | |
| 188 | Exophthalmos | FAERS: 1 | US FAERS | |
| 189 | Eye pain | FAERS: 1 | US FAERS | |
| 190 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 191 | Facial Pain | FAERS: 1 | US FAERS | |
| 192 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 193 | Flushing | FAERS: 1 | US FAERS | |
| 194 | Freezing phenomenon | FAERS: 1 | US FAERS | |
| 195 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 196 | Gastritis | FAERS: 1 | US FAERS | |
| 197 | Gout | FAERS: 1 | US FAERS | |
| 198 | Hostility | FAERS: 1 | US FAERS | |
| 199 | Hypoxia | FAERS: 1 | US FAERS | |
| 200 | Impaired work ability | FAERS: 1 | US FAERS | |
| 201 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 202 | Initial insomnia | FAERS: 1 | US FAERS | |
| 203 | Joint stiffness | FAERS: 1 | US FAERS | |
| 204 | Laceration | FAERS: 1 | US FAERS | |
| 205 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 206 | Laziness | FAERS: 1 | US FAERS | |
| 207 | Limb injury | FAERS: 1 | US FAERS | |
| 208 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 209 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 210 | Macular degeneration | FAERS: 1 | US FAERS | |
| 211 | Mastocytosis | FAERS: 1 | US FAERS | |
| 212 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 213 | Mental impairment | FAERS: 1 | US FAERS | |
| 214 | Motion Sickness | FAERS: 1 | US FAERS | |
| 215 | Multiple allergies | FAERS: 1 | US FAERS | |
| 216 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 217 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 218 | Mydriasis | FAERS: 1 | US FAERS | |
| 219 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 220 | Nocturia | FAERS: 1 | US FAERS | |
| 221 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 222 | Oral pruritus | FAERS: 1 | US FAERS | |
| 223 | Packaging design issue | FAERS: 1 | US FAERS | |
| 224 | Pallor | FAERS: 1 | US FAERS | |
| 225 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 226 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 227 | Paranasal sinus hyposecretion | FAERS: 1 | US FAERS | |
| 228 | Perennial allergy | FAERS: 1 | US FAERS | |
| 229 | Pericarditis | FAERS: 1 | US FAERS | |
| 230 | Personality Change | FAERS: 1 | US FAERS | |
| 231 | Pharyngitis | FAERS: 1 | US FAERS | |
| 232 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 233 | Pregnancy | FAERS: 1 | US FAERS | |
| 234 | Product closure issue | FAERS: 1 | US FAERS | |
| 235 | Product complaint | FAERS: 1 | US FAERS | |
| 236 | Product contamination | FAERS: 1 | US FAERS | |
| 237 | Product package associated injury | FAERS: 1 | US FAERS | |
| 238 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 239 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 240 | Product shape issue | FAERS: 1 | US FAERS | |
| 241 | Product storage error | FAERS: 1 | US FAERS | |
| 242 | Rectal discharge | FAERS: 1 | US FAERS | |
| 243 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 244 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 245 | Screaming | FAERS: 1 | US FAERS | |
| 246 | Sedation complication | FAERS: 1 | US FAERS | |
| 247 | Sinus pain | FAERS: 1 | US FAERS | |
| 248 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 249 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 250 | Stomatitis | FAERS: 1 | US FAERS | |
| 251 | Stress | FAERS: 1 | US FAERS | |
| 252 | Suicide attempt | FAERS: 1 | US FAERS | |
| 253 | Sunburn | FAERS: 1 | US FAERS | |
| 254 | Syncope | FAERS: 1 | US FAERS | |
| 255 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 256 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 257 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 258 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 259 | Therapy cessation | FAERS: 1 | US FAERS | |
| 260 | Tongue blistering | FAERS: 1 | US FAERS | |
| 261 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 262 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 263 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 264 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 265 | Wrong product administered | FAERS: 1 | US FAERS | |
| 266 | prostatitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.