Avalide
(NZPSYYOURGWZCM-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2
- Molecular Formula:
- C32H36ClN9O5S2
- Molecular Weight:
- 726.269
- Log P:
- 7.1283
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 4
- TPSA:
- 222.25
- CAS Number(s):
- 448264-66-2
Synonym(s)
1.
Avalide
External Link(s)
| PubChem Compound | 9831761 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 53 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 47 | SIDER US FAERS | |
| 3 | Headache | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 4 | Product contamination microbial | FAERS: 28 | US FAERS | |
| 5 | Dysgeusia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Medication Error | FAERS: 21 | US FAERS | |
| 7 | Malaise | FAERS: 17 | SIDER US FAERS | |
| 8 | Nausea | FAERS: 16 | SIDER US FAERS | |
| 9 | Adverse event | FAERS: 13 | US FAERS | |
| 10 | Fatigue | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Hypotension | FAERS: 13 | SIDER US FAERS | |
| 12 | Palpitations | FAERS: 12 | US FAERS | |
| 13 | Asthenia | FAERS: 11 | SIDER US FAERS | |
| 14 | Back Pain | FAERS: 11 | US FAERS | |
| 15 | Blood pressure fluctuation | FAERS: 10 | US FAERS | |
| 16 | Blood pressure inadequately controlled | FAERS: 10 | US FAERS | |
| 17 | Erectile dysfunction | FAERS: 10 | US FAERS | |
| 18 | Product quality issue | FAERS: 10 | US FAERS | |
| 19 | Tinnitus | FAERS: 10 | SIDER US FAERS | |
| 20 | Drug dose omission | FAERS: 9 | US FAERS | |
| 21 | Myalgia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Alopecia | FAERS: 8 | US FAERS | |
| 24 | Hypersensitivity | FAERS: 7 | SIDER US FAERS | |
| 25 | Pruritus | FAERS: 7 | SIDER US FAERS | |
| 26 | Urticaria | FAERS: 7 | SIDER US FAERS | |
| 27 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 28 | Angioedema | FAERS: 6 | SIDER US FAERS | |
| 29 | Feeling abnormal | FAERS: 6 | SIDER US FAERS | |
| 30 | Joint swelling | FAERS: 6 | US FAERS | |
| 31 | Swelling | FAERS: 6 | US FAERS | |
| 32 | Vomiting | FAERS: 6 | SIDER US FAERS | |
| 33 | Anxiety | FAERS: 5 | SIDER US FAERS | |
| 34 | Blood potassium decreased | FAERS: 5 | US FAERS | |
| 35 | Chest Pain | FAERS: 5 | SIDER US FAERS | |
| 36 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 37 | Flushing | FAERS: 5 | SIDER US FAERS | |
| 38 | Gout | FAERS: 5 | SIDER US FAERS | |
| 39 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 40 | Tachycardia | FAERS: 5 | SIDER US FAERS | |
| 41 | Tremor | FAERS: 5 | SIDER US FAERS | |
| 42 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 43 | Abdominal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 44 | Arthropathy | FAERS: 4 | US FAERS | |
| 45 | Blood creatinine increased | FAERS: 4 | US FAERS | |
| 46 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 47 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 48 | Diabetes Mellitus | FAERS: 4 | SIDER US FAERS | |
| 49 | Dyspepsia | FAERS: 4 | SIDER US FAERS | |
| 50 | Flatulence | FAERS: 4 | SIDER US FAERS | |
| 51 | No adverse event | FAERS: 4 | US FAERS | |
| 52 | Pregnancy | FAERS: 4 | US FAERS | |
| 53 | Syncope | FAERS: 4 | SIDER US FAERS | |
| 54 | Vertigo | FAERS: 4 | SIDER US FAERS | |
| 55 | Visual Impairment | FAERS: 4 | SIDER US FAERS | |
| 56 | Apparent death | FAERS: 3 | US FAERS | |
| 57 | Asthma | FAERS: 3 | US FAERS | |
| 58 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 59 | Chills | FAERS: 3 | US FAERS | |
| 60 | Constipation | FAERS: 3 | SIDER US FAERS | |
| 61 | Deafness | FAERS: 3 | US FAERS | |
| 62 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 63 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 64 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 65 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 66 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 67 | Nocturia | FAERS: 3 | US FAERS | |
| 68 | Overdose | FAERS: 3 | US FAERS | |
| 69 | Shock | FAERS: 3 | SIDER US FAERS | |
| 70 | Somnolence | FAERS: 3 | SIDER US FAERS | |
| 71 | Unevaluable event | FAERS: 3 | US FAERS | |
| 72 | Ageusia | FAERS: 2 | US FAERS | |
| 73 | Arthralgia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 75 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 76 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 77 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 78 | Cyst | FAERS: 2 | US FAERS | |
| 79 | Depressed mood | FAERS: 2 | US FAERS | |
| 80 | Disorientation | FAERS: 2 | US FAERS | |
| 81 | Dry skin | FAERS: 2 | US FAERS | |
| 82 | Dysuria | FAERS: 2 | US FAERS | |
| 83 | Electrolyte imbalance | FAERS: 2 | SIDER US FAERS | |
| 84 | Epistaxis | FAERS: 2 | SIDER US FAERS | |
| 85 | Erythema | FAERS: 2 | SIDER US FAERS | |
| 86 | Flank Pain | FAERS: 2 | US FAERS | |
| 87 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 88 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 89 | Muscle tightness | FAERS: 2 | US FAERS | |
| 90 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 91 | Night sweats | FAERS: 2 | US FAERS | |
| 92 | Olfactory Nerve Disorder | FAERS: 2 | US FAERS | |
| 93 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 94 | Polyuria | FAERS: 2 | US FAERS | |
| 95 | Product counterfeit | FAERS: 2 | US FAERS | |
| 96 | Product substitution issue | FAERS: 2 | US FAERS | |
| 97 | Renal pain | FAERS: 2 | US FAERS | |
| 98 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 99 | Rhabdomyolysis | FAERS: 2 | SIDER US FAERS | |
| 100 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 101 | Throat irritation | FAERS: 2 | US FAERS | |
| 102 | Transaminases increased | FAERS: 2 | US FAERS | |
| 103 | Weight decreased | FAERS: 2 | US FAERS | |
| 104 | Abasia | FAERS: 1 | US FAERS | |
| 105 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 106 | Accidental overdose | FAERS: 1 | US FAERS | |
| 107 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 108 | Agitation | FAERS: 1 | SIDER US FAERS | |
| 109 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 110 | Aneurysm | FAERS: 1 | US FAERS | |
| 111 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 112 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 113 | Arthritis | FAERS: 1 | SIDER US FAERS | |
| 114 | Atopy | FAERS: 1 | US FAERS | |
| 115 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 116 | Bladder spasm | FAERS: 1 | US FAERS | |
| 117 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 118 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 119 | Blood electrolytes increased | FAERS: 1 | US FAERS | |
| 120 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 121 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 122 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 123 | Blood urea increased | FAERS: 1 | US FAERS | |
| 124 | Blood urine present | FAERS: 1 | US FAERS | |
| 125 | Bone pain | FAERS: 1 | SIDER US FAERS | |
| 126 | Bronchitis | FAERS: 1 | US FAERS | |
| 127 | Burning sensation | FAERS: 1 | US FAERS | |
| 128 | Bursitis | FAERS: 1 | US FAERS | |
| 129 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 130 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 131 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 132 | Chest discomfort | FAERS: 1 | US FAERS | |
| 133 | Cold sweat | FAERS: 1 | US FAERS | |
| 134 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 135 | Crying | FAERS: 1 | US FAERS | |
| 136 | Dehydration | FAERS: 1 | US FAERS | |
| 137 | Dementia | FAERS: 1 | US FAERS | |
| 138 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 139 | Disability | FAERS: 1 | US FAERS | |
| 140 | Disease complication | FAERS: 1 | US FAERS | |
| 141 | Drug abuse | FAERS: 1 | US FAERS | |
| 142 | Drug administration error | FAERS: 1 | US FAERS | |
| 143 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 144 | Dysarthria | FAERS: 1 | US FAERS | |
| 145 | Dysphonia | FAERS: 1 | US FAERS | |
| 146 | Ear discomfort | FAERS: 1 | US FAERS | |
| 147 | Eczema | FAERS: 1 | US FAERS | |
| 148 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 149 | Emotional disorder | FAERS: 1 | US FAERS | |
| 150 | Eructation | FAERS: 1 | US FAERS | |
| 151 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 152 | Expired drug administered | FAERS: 1 | US FAERS | |
| 153 | Feeling jittery | FAERS: 1 | US FAERS | |
| 154 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 155 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 156 | Gastritis | FAERS: 1 | US FAERS | |
| 157 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 158 | Ileus | FAERS: 1 | US FAERS | |
| 159 | Impaired work ability | FAERS: 1 | US FAERS | |
| 160 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 161 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 162 | Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 164 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 165 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 166 | Intraocular pressure fluctuation | FAERS: 1 | US FAERS | |
| 167 | Joint injury | FAERS: 1 | US FAERS | |
| 168 | Keratitis | FAERS: 1 | US FAERS | |
| 169 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 170 | Laceration | FAERS: 1 | US FAERS | |
| 171 | Lethargy | FAERS: 1 | US FAERS | |
| 172 | Lichen Planus | FAERS: 1 | US FAERS | |
| 173 | Limb operation | FAERS: 1 | US FAERS | |
| 174 | Lip swelling | FAERS: 1 | US FAERS | |
| 175 | Lipoma | FAERS: 1 | US FAERS | |
| 176 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 177 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 178 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 179 | Memory impairment | FAERS: 1 | US FAERS | |
| 180 | Meniscus injury | FAERS: 1 | US FAERS | |
| 181 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 182 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 183 | Musculoskeletal stiffness | FAERS: 1 | SIDER US FAERS | |
| 184 | Mydriasis | FAERS: 1 | US FAERS | |
| 185 | Myocardial Infarction | FAERS: 1 | SIDER US FAERS | |
| 186 | Neck Pain | FAERS: 1 | US FAERS | |
| 187 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 188 | Osteoporosis | FAERS: 1 | US FAERS | |
| 189 | Ototoxicity | FAERS: 1 | US FAERS | |
| 190 | Pancreatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 191 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 192 | Pharyngotonsillitis | FAERS: 1 | US FAERS | |
| 193 | Pneumonia | FAERS: 1 | SIDER US FAERS | |
| 194 | Polymyositis | FAERS: 1 | US FAERS | |
| 195 | Product commingling | FAERS: 1 | US FAERS | |
| 196 | Product dose omission | FAERS: 1 | US FAERS | |
| 197 | Product formulation issue | FAERS: 1 | US FAERS | |
| 198 | Product packaging issue | FAERS: 1 | US FAERS | |
| 199 | Product size issue | FAERS: 1 | US FAERS | |
| 200 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 201 | Product use issue | FAERS: 1 | US FAERS | |
| 202 | Proteinuria | FAERS: 1 | US FAERS | |
| 203 | Psoriasis | FAERS: 1 | US FAERS | |
| 204 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 205 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 206 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 207 | Retching | FAERS: 1 | US FAERS | |
| 208 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 209 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 210 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 211 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 212 | Scab | FAERS: 1 | US FAERS | |
| 213 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 214 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 215 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 216 | Urinary Retention | FAERS: 1 | US FAERS | |
| 217 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 218 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 219 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 220 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 221 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 222 | Acute Coronary Syndrome | SIDER | ||
| 223 | Agranulocytosis | SIDER | ||
| 224 | Angina Pectoris | Canada Vigilance: 1 | Canada Vigilance | |
| 225 | Anorexia | SIDER | ||
| 226 | Atrial rhythm | SIDER | ||
| 227 | Bradycardia | SIDER | ||
| 228 | Coordination disturbance | SIDER | ||
| 229 | Dermatitis | SIDER | ||
| 230 | Discomfort | SIDER | ||
| 231 | Epigastric discomfort | SIDER | ||
| 232 | Epigastric pain | SIDER | ||
| 233 | Feeling Cold | SIDER | ||
| 234 | Gastric irritation | SIDER | ||
| 235 | Gastrointestinal Pain | SIDER | ||
| 236 | Glycosuria | SIDER | ||
| 237 | Heartburn | SIDER | ||
| 238 | Hepatitis | SIDER | ||
| 239 | Leukopenia | SIDER | ||
| 240 | Metastasis | Canada Vigilance: 1 | Canada Vigilance | |
| 241 | Monoparesis | SIDER | ||
| 242 | Mood swings | SIDER | ||
| 243 | Neutropenia | SIDER | ||
| 244 | Numbness | SIDER | ||
| 245 | Oral lesion | SIDER | ||
| 246 | Pharyngitis | SIDER | ||
| 247 | Respiratory distress | SIDER | ||
| 248 | Rhinitis | SIDER | ||
| 249 | Sensation of warmth | SIDER | ||
| 250 | Sexual Dysfunction | SIDER | ||
| 251 | Skin discomfort | SIDER | ||
| 252 | Stiffness | SIDER | ||
| 253 | Stress | SIDER | ||
| 254 | Swelling of limb | SIDER | ||
| 255 | Tension | SIDER | ||
| 256 | Thrombocytopenia | SIDER | ||
| 257 | Toxic Epidermal Necrolysis | SIDER | ||
| 258 | Trauma | SIDER | ||
| 259 | Vasculitis | SIDER | ||
| 260 | Ventricular arrhythmia | SIDER | ||
| 261 | Wheezing | SIDER | ||
| 262 | Xanthopsia | SIDER | ||
| 263 | bad taste | SIDER | ||
| 264 | jaundice | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.