Aspirin, Dipyridamole Drug Combination
(NOHUXXDTQJPXSB-UHFFFAOYSA-N)
Structure
- SMILES
- CC(=O)Oc1ccccc1C(=O)O.OCCN(c1nc(N2CCCCC2)c2c(n1)c(nc(n2)N(CCO)CCO)N1CCCCC1)CCO
- Molecular Formula:
- C33H48N8O8
- Molecular Weight:
- 684.783
- Log P:
- 1.4225
- Hydrogen Bond Acceptor:
- 16
- Hydrogen Bond Donor:
- 5
- TPSA:
- 209.04
- CAS Number(s):
- 87653-67-6
Synonym(s)
1.
Aspirin, Dipyridamole Drug Combination
2.
Aggrenox
3.
Asasantin
4.
Asasantin Retard
5.
Aspirin-Dipyridamole Drug Combination
6.
Extended-Release Dipyridamole-Aspirin
7.
TX 3301
8.
TX-3301
9.
3301, TX
10.
Aspirin Dipyridamole Drug Combination
11.
Combination, Aspirin-Dipyridamole Drug
12.
Dipyridamole-Aspirin, Extended-Release
13.
Drug Combination, Aspirin-Dipyridamole
14.
Extended Release Dipyridamole Aspirin
15.
Retard, Asasantin
External Link(s)
| MeSH | D000068342 |
| PubChem Compound | 137329 |
| Therapeutic Target Database | D0F3IP |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 201 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Cerebrovascular accident | FAERS: 154 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Vomiting | FAERS: 68 | US FAERS | |
| 5 | Dizziness | FAERS: 43 | 12093268 | CTD US FAERS |
| 6 | Myocardial Infarction | FAERS: 34 | US FAERS | |
| 7 | Asthenia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 8 | Fatigue | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 9 | Abdominal discomfort | FAERS: 17 | US FAERS | |
| 10 | Chest Pain | FAERS: 15 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 13 | US FAERS | |
| 12 | Malaise | FAERS: 13 | US FAERS | |
| 13 | Pneumonia | FAERS: 13 | US FAERS | |
| 14 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 15 | Back Pain | FAERS: 11 | US FAERS | |
| 16 | Hypotension | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Constipation | FAERS: 10 | US FAERS | |
| 18 | Drug ineffective | FAERS: 10 | US FAERS | |
| 19 | Dyspepsia | FAERS: 10 | US FAERS | |
| 20 | Atrial Fibrillation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Cerebral Infarction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Epistaxis | FAERS: 9 | 7032379 | CTD US FAERS |
| 23 | Product quality issue | FAERS: 9 | US FAERS | |
| 24 | Dementia | FAERS: 8 | US FAERS | |
| 25 | Flushing | FAERS: 8 | US FAERS | |
| 26 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 27 | Myalgia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Blood urine present | FAERS: 7 | US FAERS | |
| 29 | Chills | FAERS: 7 | US FAERS | |
| 30 | Erythema | FAERS: 7 | US FAERS | |
| 31 | Hemiparesis | FAERS: 7 | US FAERS | |
| 32 | Unevaluable event | FAERS: 7 | US FAERS | |
| 33 | Ageusia | FAERS: 6 | US FAERS | |
| 34 | Arthralgia | FAERS: 6 | US FAERS | |
| 35 | Atrioventricular Block | FAERS: 6 | US FAERS | |
| 36 | Chromaturia | FAERS: 6 | US FAERS | |
| 37 | Deep Vein Thrombosis | FAERS: 6 | US FAERS | |
| 38 | Pruritus | FAERS: 6 | US FAERS | |
| 39 | Acute myocardial infarction | FAERS: 5 | OFFSIDES US FAERS | |
| 40 | Alopecia | FAERS: 5 | US FAERS | |
| 41 | Aphasia | FAERS: 5 | US FAERS | |
| 42 | Burning sensation | FAERS: 5 | US FAERS | |
| 43 | Dysgeusia | FAERS: 5 | US FAERS | |
| 44 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 45 | Infection | FAERS: 5 | OFFSIDES US FAERS | |
| 46 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 47 | Neck Pain | FAERS: 5 | US FAERS | |
| 48 | Pain | FAERS: 5 | US FAERS | |
| 49 | Somnolence | FAERS: 5 | US FAERS | |
| 50 | Tinnitus | FAERS: 5 | US FAERS | |
| 51 | Urticaria | FAERS: 5 | US FAERS | |
| 52 | Weight decreased | FAERS: 5 | US FAERS | |
| 53 | Alanine Aminotransferase Increased | FAERS: 4 | OFFSIDES US FAERS | |
| 54 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 55 | Chest discomfort | FAERS: 4 | US FAERS | |
| 56 | Choking | FAERS: 4 | US FAERS | |
| 57 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 58 | Flatulence | FAERS: 4 | US FAERS | |
| 59 | Joint swelling | FAERS: 4 | US FAERS | |
| 60 | Medication Error | FAERS: 4 | US FAERS | |
| 61 | Overdose | FAERS: 4 | US FAERS | |
| 62 | Palpitations | FAERS: 4 | US FAERS | |
| 63 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 64 | Purpura | FAERS: 4 | US FAERS | |
| 65 | Tachycardia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 67 | Thrombosis | FAERS: 4 | US FAERS | |
| 68 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 69 | Agitation | FAERS: 3 | US FAERS | |
| 70 | Amnesia | FAERS: 3 | US FAERS | |
| 71 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 72 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 73 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 74 | Disease recurrence | FAERS: 3 | US FAERS | |
| 75 | Dysarthria | FAERS: 3 | US FAERS | |
| 76 | Dysphonia | FAERS: 3 | OFFSIDES US FAERS | |
| 77 | Endarterectomy | FAERS: 3 | US FAERS | |
| 78 | Eye irritation | FAERS: 3 | US FAERS | |
| 79 | Influenza | FAERS: 3 | US FAERS | |
| 80 | Retching | FAERS: 3 | US FAERS | |
| 81 | Suicide attempt | FAERS: 3 | US FAERS | |
| 82 | Urinary tract infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 84 | Adverse event | FAERS: 2 | US FAERS | |
| 85 | Amaurosis | FAERS: 2 | US FAERS | |
| 86 | Anxiety | FAERS: 2 | US FAERS | |
| 87 | Aphonia | FAERS: 2 | US FAERS | |
| 88 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 89 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 90 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 91 | Cerebral calcification | FAERS: 2 | US FAERS | |
| 92 | Cerebrovascular stenosis | FAERS: 2 | US FAERS | |
| 93 | Coagulation time shortened | FAERS: 2 | US FAERS | |
| 94 | Deafness | FAERS: 2 | US FAERS | |
| 95 | Dehydration | FAERS: 2 | OFFSIDES US FAERS | |
| 96 | Delirium | FAERS: 2 | US FAERS | |
| 97 | Delusional disorder, unspecified type | FAERS: 2 | US FAERS | |
| 98 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 99 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 100 | Diplopia | FAERS: 2 | US FAERS | |
| 101 | Disability | FAERS: 2 | US FAERS | |
| 102 | Drug dose omission | FAERS: 2 | US FAERS | |
| 103 | Embolism | FAERS: 2 | US FAERS | |
| 104 | Epilepsy | FAERS: 2 | US FAERS | |
| 105 | Eructation | FAERS: 2 | US FAERS | |
| 106 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 107 | Head discomfort | FAERS: 2 | US FAERS | |
| 108 | Hemiplegia | FAERS: 2 | US FAERS | |
| 109 | Hernia | FAERS: 2 | US FAERS | |
| 110 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 111 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 112 | Limb injury | FAERS: 2 | US FAERS | |
| 113 | Loose tooth | FAERS: 2 | US FAERS | |
| 114 | Malabsorption | FAERS: 2 | OFFSIDES US FAERS | |
| 115 | Memory impairment | FAERS: 2 | US FAERS | |
| 116 | Meningitis | FAERS: 2 | US FAERS | |
| 117 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 118 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 119 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 120 | Myoclonus | FAERS: 2 | US FAERS | |
| 121 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 122 | Nerve injury | FAERS: 2 | US FAERS | |
| 123 | Night sweats | FAERS: 2 | US FAERS | |
| 124 | No adverse event | FAERS: 2 | US FAERS | |
| 125 | Pancreatitis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 126 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 127 | Petechiae | FAERS: 2 | US FAERS | |
| 128 | Presyncope | FAERS: 2 | US FAERS | |
| 129 | Proteinuria | FAERS: 2 | US FAERS | |
| 130 | Restlessness | FAERS: 2 | US FAERS | |
| 131 | Skin lesion | FAERS: 2 | US FAERS | |
| 132 | Sneezing | FAERS: 2 | US FAERS | |
| 133 | Syncope | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Throat irritation | FAERS: 2 | US FAERS | |
| 135 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 136 | Vertigo | FAERS: 2 | US FAERS | |
| 137 | Visual Impairment | FAERS: 2 | US FAERS | |
| 138 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 139 | nervous system disorder | FAERS: 2 | US FAERS | |
| 140 | Abdominal mass | FAERS: 1 | US FAERS | |
| 141 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 142 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 143 | Accidental overdose | FAERS: 1 | US FAERS | |
| 144 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 145 | Anger | FAERS: 1 | US FAERS | |
| 146 | Angioedema | FAERS: 1 | US FAERS | |
| 147 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 148 | Aphagia | FAERS: 1 | US FAERS | |
| 149 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 150 | Band neutrophil count increased | FAERS: 1 | US FAERS | |
| 151 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 152 | Bedridden | FAERS: 1 | US FAERS | |
| 153 | Blindness | FAERS: 1 | US FAERS | |
| 154 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 155 | Blood creatine phosphokinase MB | FAERS: 1 | US FAERS | |
| 156 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 157 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 158 | Blood urea increased | FAERS: 1 | OFFSIDES US FAERS | |
| 159 | Body height below normal | FAERS: 1 | US FAERS | |
| 160 | Bradycardia | FAERS: 1 | 12093268 | CTD OFFSIDES US FAERS |
| 161 | Bronchospasm | FAERS: 1 | US FAERS | |
| 162 | Candida test positive | FAERS: 1 | US FAERS | |
| 163 | Carcinoma in situ of skin | FAERS: 1 | US FAERS | |
| 164 | Cataract operation | FAERS: 1 | US FAERS | |
| 165 | Cataract | FAERS: 1 | US FAERS | |
| 166 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 167 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 168 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 169 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 170 | Cerebral microhaemorrhage | FAERS: 1 | US FAERS | |
| 171 | Cholecystitis | FAERS: 1 | US FAERS | |
| 172 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 173 | Coronary artery reocclusion | FAERS: 1 | US FAERS | |
| 174 | Crying | FAERS: 1 | US FAERS | |
| 175 | Cyanosis | FAERS: 1 | US FAERS | |
| 176 | Cyst | FAERS: 1 | US FAERS | |
| 177 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 178 | Depressed mood | FAERS: 1 | OFFSIDES US FAERS | |
| 179 | Dermatitis | FAERS: 1 | US FAERS | |
| 180 | Disease Progression | FAERS: 1 | US FAERS | |
| 181 | Disorientation | FAERS: 1 | US FAERS | |
| 182 | Dissociation | FAERS: 1 | US FAERS | |
| 183 | Drug abuser | FAERS: 1 | US FAERS | |
| 184 | Drug abuse | FAERS: 1 | US FAERS | |
| 185 | Drug administration error | FAERS: 1 | US FAERS | |
| 186 | Drug level decreased | FAERS: 1 | US FAERS | |
| 187 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 188 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 189 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 190 | Economic problem | FAERS: 1 | US FAERS | |
| 191 | Eczema | FAERS: 1 | US FAERS | |
| 192 | Epiglottitis | FAERS: 1 | US FAERS | |
| 193 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 194 | Eye pain | FAERS: 1 | US FAERS | |
| 195 | Facial Pain | FAERS: 1 | US FAERS | |
| 196 | Feeling Cold | FAERS: 1 | US FAERS | |
| 197 | Full blood count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 198 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 199 | General physical condition | FAERS: 1 | US FAERS | |
| 200 | Glaucoma | FAERS: 1 | US FAERS | |
| 201 | Global Amnesia | FAERS: 1 | US FAERS | |
| 202 | Glossopharyngeal Neuralgia | FAERS: 1 | US FAERS | |
| 203 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 204 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 205 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 206 | Incoherent | FAERS: 1 | US FAERS | |
| 207 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 208 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 209 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 210 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 211 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 212 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 213 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 214 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 215 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 216 | Laceration | FAERS: 1 | US FAERS | |
| 217 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 218 | Lethargy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 220 | Limb discomfort | FAERS: 1 | US FAERS | |
| 221 | Limb operation | FAERS: 1 | US FAERS | |
| 222 | Lip swelling | FAERS: 1 | US FAERS | |
| 223 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 224 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 225 | Malaria | FAERS: 1 | US FAERS | |
| 226 | Mastocytosis | FAERS: 1 | US FAERS | |
| 227 | Medication residue present | FAERS: 1 | US FAERS | |
| 228 | Menorrhagia | FAERS: 1 | US FAERS | |
| 229 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 230 | Mood swings | FAERS: 1 | US FAERS | |
| 231 | Nervousness | FAERS: 1 | US FAERS | |
| 232 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 233 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 234 | Oliguria | FAERS: 1 | US FAERS | |
| 235 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 236 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 237 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 238 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 239 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 240 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 241 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 242 | Polydipsia | FAERS: 1 | US FAERS | |
| 243 | Post procedural complication | FAERS: 1 | US FAERS | |
| 244 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 245 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 246 | Product quality control issue | FAERS: 1 | US FAERS | |
| 247 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 248 | Product storage error | FAERS: 1 | US FAERS | |
| 249 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 250 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 251 | Rash erythematous | FAERS: 1 | US FAERS | |
| 252 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 253 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 254 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 255 | Sarcoma | FAERS: 1 | US FAERS | |
| 256 | Scab | FAERS: 1 | US FAERS | |
| 257 | Shock | FAERS: 1 | US FAERS | |
| 258 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 259 | Sinusitis | FAERS: 1 | US FAERS | |
| 260 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 261 | Skin reaction | FAERS: 1 | US FAERS | |
| 262 | Somnambulism | FAERS: 1 | US FAERS | |
| 263 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 264 | Sputum retention | FAERS: 1 | US FAERS | |
| 265 | Stenosis | FAERS: 1 | US FAERS | |
| 266 | Sunburn | FAERS: 1 | US FAERS | |
| 267 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 268 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 269 | Tooth Infection | FAERS: 1 | US FAERS | |
| 270 | Tooth Loss | FAERS: 1 | US FAERS | |
| 271 | Toothache | FAERS: 1 | US FAERS | |
| 272 | Tremor | FAERS: 1 | US FAERS | |
| 273 | Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 274 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 275 | Urine output increased | FAERS: 1 | US FAERS | |
| 276 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 277 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 278 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 279 | Vasculitis | FAERS: 1 | US FAERS | |
| 280 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 281 | Vessel perforation | FAERS: 1 | US FAERS | |
| 282 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 283 | Wheezing | FAERS: 1 | US FAERS | |
| 284 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 285 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 286 | jaundice | FAERS: 1 | US FAERS | |
| 287 | Abulia | OFFSIDES | ||
| 288 | Acute kidney injury | Canada Vigilance: 1 | Canada Vigilance | |
| 289 | Adenocarcinoma | OFFSIDES | ||
| 290 | Agraphia | OFFSIDES | ||
| 291 | Anorexia | OFFSIDES | ||
| 292 | Blood albumin decreased | OFFSIDES | ||
| 293 | Blood amylase decreased | OFFSIDES | ||
| 294 | Blood chloride decreased | OFFSIDES | ||
| 295 | Blood creatinine increased | OFFSIDES | ||
| 296 | Blood folate increased | OFFSIDES | ||
| 297 | Blood iron decreased | OFFSIDES | ||
| 298 | Blood sodium | OFFSIDES | ||
| 299 | Bone marrow myelogram abnormal | OFFSIDES | ||
| 300 | Cardiac Tamponade | 3871322 | CTD | |
| 301 | Cardioactive drug level increased | OFFSIDES | ||
| 302 | Cardiomyopathies | 17541306 | CTD | |
| 303 | Cardiovascular Diseases | 16211203 | CTD | |
| 304 | Cellulitis | OFFSIDES | ||
| 305 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 306 | Cholangiolitis | OFFSIDES | ||
| 307 | Chronic left ventricular failure | OFFSIDES | ||
| 308 | Diarrhea | OFFSIDES | ||
| 309 | Discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 310 | Gamma-Glutamyltransferase Increased | OFFSIDES | ||
| 311 | Gastritis | Canada Vigilance: 1 | Canada Vigilance | |
| 312 | Gastrointestinal Hemorrhage | 7032379 | CTD | |
| 313 | General physical health deterioration | OFFSIDES | ||
| 314 | Hemorrhage | 9025160 | CTD | |
| 315 | Hepatitis | OFFSIDES | ||
| 316 | Hiccough | OFFSIDES | ||
| 317 | Intention tremor | OFFSIDES | ||
| 318 | Kidney Failure | OFFSIDES | ||
| 319 | Myocardial Ischemia | 17541306 | CTD | |
| 320 | Occult blood positive | OFFSIDES | ||
| 321 | Oropharyngeal discomfort | OFFSIDES | ||
| 322 | Panophthalmitis | OFFSIDES | ||
| 323 | Pericardial effusion | 8299624 | CTD | |
| 324 | Purpura, Thrombotic Thrombocytopenic | 7032379 | CTD | |
| 325 | Pyelonephritis | OFFSIDES | ||
| 326 | Subarachnoid Hemorrhage | 7032379 | CTD | |
| 327 | Supraventricular tachycardia | OFFSIDES | ||
| 328 | Ventricular Dysfunction, Left | 17541306 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.