Deamino Arginine Vasopressin
(NFLWUMRGJYTJIN-PNIOQBSNSA-N)
Structure
- SMILES
- NC(=O)C[C@@H]1NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](NC(=O)CCSSC[C@H](NC1=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(=O)NCC(=O)N)CCCN=C(N)N)Cc1ccc(cc1)O
- Type(s)
- Approved
- ATC code(s)
- H01BA02
- Molecular Formula:
- C46H64N14O12S2
- Molecular Weight:
- 1069.220
- Log P:
- 1.5235
- Hydrogen Bond Acceptor:
- 28
- Hydrogen Bond Donor:
- 13
- TPSA:
- 488.51
- CAS Number(s):
- 16679-58-6
Synonym(s)
1.
Deamino Arginine Vasopressin
2.
Desmopressin
3.
Vasopressin, Deamino Arginine
4.
1-Deamino-8-D-arginine Vasopressin
5.
1-Desamino-8-arginine Vasopressin
6.
Adiuretin
7.
Adiuretin SD
8.
Apo-Desmopressin
9.
DDAVP
10.
Desmogalen
11.
Desmopressin Acetate
12.
Desmopressin Monoacetate
13.
Desmopressin Monoacetate, Trihydrate
14.
Desmopressine Ferring
15.
Desmospray
16.
Desmotabs
17.
Minirin
18.
Minurin
19.
Nocutil
20.
Octim
21.
Octostim
22.
Acetate, Desmopressin
23.
Arginine Vasopressin, Deamino
24.
Ferring, Desmopressine
25.
Monoacetate, Desmopressin
26.
Monoacetate, Trihydrate Desmopressin
27.
Trihydrate Desmopressin Monoacetate
28.
Vasopressin, 1-Deamino-8-D-arginine
29.
Vasopressin, 1-Desamino-8-arginine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 51 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Product storage error | FAERS: 13 | US FAERS | |
| 3 | Product use in unapproved indication | FAERS: 13 | US FAERS | |
| 4 | Osmotic demyelination syndrome | FAERS: 10 | US FAERS | |
| 5 | Headache | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Vomiting | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Circumstance or information capable of leading to medication error | FAERS: 7 | US FAERS | |
| 8 | Product quality issue | FAERS: 7 | US FAERS | |
| 9 | Blood sodium decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Incorrect product storage | FAERS: 6 | US FAERS | |
| 11 | Nausea | FAERS: 6 | SIDER US FAERS | |
| 12 | Overdose | FAERS: 6 | US FAERS | |
| 13 | Polyuria | FAERS: 6 | US FAERS | |
| 14 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 15 | Polydipsia | FAERS: 5 | US FAERS | |
| 16 | Abdominal Pain | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 17 | Diabetes Insipidus | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Liquid product physical issue | FAERS: 4 | US FAERS | |
| 19 | Malaise | FAERS: 4 | SIDER US FAERS | |
| 20 | Personality Change | FAERS: 4 | US FAERS | |
| 21 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 22 | Product tampering | FAERS: 4 | US FAERS | |
| 23 | Thirst | FAERS: 4 | US FAERS | |
| 24 | Altered state of consciousness | FAERS: 3 | SIDER US FAERS | |
| 25 | Enuresis | FAERS: 3 | SIDER US FAERS | |
| 26 | Fatigue | FAERS: 3 | SIDER US FAERS | |
| 27 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 28 | Product container seal issue | FAERS: 3 | US FAERS | |
| 29 | Product substitution issue | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Product use issue | FAERS: 3 | US FAERS | |
| 31 | Pruritus | FAERS: 3 | SIDER US FAERS | |
| 32 | Syncope | FAERS: 3 | SIDER US FAERS | |
| 33 | Urinary Retention | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 34 | Urticaria | FAERS: 3 | SIDER US FAERS | |
| 35 | Water Intoxication | FAERS: 3 | SIDER US FAERS | |
| 36 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 37 | Amnesia | FAERS: 2 | US FAERS | |
| 38 | Aspartate Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 39 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 40 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 41 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 42 | Brain Contusion | FAERS: 2 | US FAERS | |
| 43 | Burning sensation | FAERS: 2 | US FAERS | |
| 44 | Crying | FAERS: 2 | US FAERS | |
| 45 | Dehydration | FAERS: 2 | SIDER US FAERS | |
| 46 | Delayed Graft Function | FAERS: 2 | US FAERS | |
| 47 | Demyelination | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 49 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 50 | Dizziness | FAERS: 2 | SIDER US FAERS | |
| 51 | Drug dose omission | FAERS: 2 | US FAERS | |
| 52 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 53 | Emotional disorder | FAERS: 2 | SIDER US FAERS | |
| 54 | Epistaxis | FAERS: 2 | SIDER US FAERS | |
| 55 | Extra dose administered | FAERS: 2 | US FAERS | |
| 56 | Fluid overload | FAERS: 2 | US FAERS | |
| 57 | Hypersensitivity | FAERS: 2 | SIDER US FAERS | |
| 58 | Incorrect dose administered by device | FAERS: 2 | US FAERS | |
| 59 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 60 | Mood swings | FAERS: 2 | SIDER US FAERS | |
| 61 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 62 | Product container issue | FAERS: 2 | US FAERS | |
| 63 | Product dose omission | FAERS: 2 | US FAERS | |
| 64 | Unevaluable event | FAERS: 2 | US FAERS | |
| 65 | Vertigo | FAERS: 2 | SIDER US FAERS | |
| 66 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 67 | treatment failure | FAERS: 2 | US FAERS | |
| 68 | Accidental overdose | FAERS: 1 | US FAERS | |
| 69 | Adverse event | FAERS: 1 | US FAERS | |
| 70 | Amniotic fluid index decreased | FAERS: 1 | US FAERS | |
| 71 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 72 | Application site discomfort | FAERS: 1 | US FAERS | |
| 73 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 74 | Ascites | FAERS: 1 | US FAERS | |
| 75 | Asthenia | FAERS: 1 | SIDER US FAERS | |
| 76 | Asthenopia | FAERS: 1 | US FAERS | |
| 77 | Asthma | FAERS: 1 | US FAERS | |
| 78 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 79 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 80 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 81 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 82 | Bradycardia | FAERS: 1 | US FAERS | |
| 83 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 84 | Constipation | FAERS: 1 | SIDER US FAERS | |
| 85 | Device malfunction | FAERS: 1 | US FAERS | |
| 86 | Device physical property issue | FAERS: 1 | US FAERS | |
| 87 | Disorientation | FAERS: 1 | US FAERS | |
| 88 | Drug Dependence | FAERS: 1 | US FAERS | |
| 89 | Drug abuser | FAERS: 1 | US FAERS | |
| 90 | Drug abuse | FAERS: 1 | US FAERS | |
| 91 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 92 | Drug administration error | FAERS: 1 | US FAERS | |
| 93 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 94 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 95 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 96 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 97 | Dry skin | FAERS: 1 | US FAERS | |
| 98 | Dysgeusia | FAERS: 1 | US FAERS | |
| 99 | Emotional distress | FAERS: 1 | US FAERS | |
| 100 | Erythema | FAERS: 1 | SIDER US FAERS | |
| 101 | Expired product administered | FAERS: 1 | US FAERS | |
| 102 | Feeling abnormal | FAERS: 1 | SIDER US FAERS | |
| 103 | Histiocytosis | FAERS: 1 | US FAERS | |
| 104 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 105 | Hyponatraemic seizure | FAERS: 1 | US FAERS | |
| 106 | Hypotension | FAERS: 1 | US FAERS | |
| 107 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 108 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 109 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 110 | Laceration | FAERS: 1 | US FAERS | |
| 111 | Live Birth | FAERS: 1 | US FAERS | |
| 112 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 113 | Medication residue present | FAERS: 1 | US FAERS | |
| 114 | Memory impairment | FAERS: 1 | SIDER US FAERS | |
| 115 | Middle insomnia | FAERS: 1 | US FAERS | |
| 116 | Multiple use of single-use product | FAERS: 1 | US FAERS | |
| 117 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 118 | Nasal discomfort | FAERS: 1 | SIDER US FAERS | |
| 119 | Nasal valve collapse | FAERS: 1 | US FAERS | |
| 120 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 121 | Neck Pain | FAERS: 1 | US FAERS | |
| 122 | No adverse event | FAERS: 1 | US FAERS | |
| 123 | Nocturia | FAERS: 1 | US FAERS | |
| 124 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 125 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 126 | Physical product label issue | FAERS: 1 | US FAERS | |
| 127 | Product commingling | FAERS: 1 | US FAERS | |
| 128 | Product label issue | FAERS: 1 | US FAERS | |
| 129 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 130 | Product physical issue | FAERS: 1 | US FAERS | |
| 131 | Product preparation error | FAERS: 1 | US FAERS | |
| 132 | Pseudobulbar Palsy | FAERS: 1 | US FAERS | |
| 133 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 134 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 135 | Quadriparesis | FAERS: 1 | US FAERS | |
| 136 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 137 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 138 | Respiratory arrest | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 140 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 141 | Skin irritation | FAERS: 1 | US FAERS | |
| 142 | Sleep Talking | FAERS: 1 | US FAERS | |
| 143 | Swelling | FAERS: 1 | SIDER US FAERS | |
| 144 | Tachycardia | FAERS: 1 | SIDER US FAERS | |
| 145 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 146 | Therapeutic response changed | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 148 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 149 | Thirst decreased | FAERS: 1 | US FAERS | |
| 150 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 151 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 152 | Tremor | FAERS: 1 | US FAERS | |
| 153 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 154 | Urine output increased | FAERS: 1 | US FAERS | |
| 155 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 156 | Abdominal Cramps | SIDER | ||
| 157 | Abdominal bloating | SIDER | ||
| 158 | Acute myocardial infarction | SIDER | ||
| 159 | Agitation | SIDER | ||
| 160 | Anaphylactic shock | SIDER | ||
| 161 | Anorexia | SIDER | ||
| 162 | Anxiety | SIDER | ||
| 163 | Aspartate aminotransferase normal | SIDER | ||
| 164 | Balanitis | SIDER | ||
| 165 | Bladder and urethral symptoms | SIDER | ||
| 166 | Blood pressure fluctuation | SIDER | ||
| 167 | Cardiac Arrest | Canada Vigilance: 1 | Canada Vigilance | |
| 168 | Chest Pain | SIDER | ||
| 169 | Chills | SIDER | ||
| 170 | Conjunctivitis | SIDER | ||
| 171 | Depressed Level of Consciousness | SIDER | ||
| 172 | Depressed mood | SIDER | ||
| 173 | Dermatitis | SIDER | ||
| 174 | Dyspepsia | SIDER | ||
| 175 | Ear and labyrinth disorders | SIDER | ||
| 176 | Flatulence | SIDER | ||
| 177 | Flushing | SIDER | ||
| 178 | Gastroenteritis | SIDER | ||
| 179 | Gastrointestinal Pain | SIDER | ||
| 180 | Hyperkinesia | SIDER | ||
| 181 | Hyponatraemic | SIDER | ||
| 182 | Infection | SIDER | ||
| 183 | Influenza | SIDER | ||
| 184 | Intermittent headache | SIDER | ||
| 185 | Malnutrition | SIDER | ||
| 186 | Musculoskeletal discomfort | SIDER | ||
| 187 | Myalgia | SIDER | ||
| 188 | Nervousness | SIDER | ||
| 189 | Oliguria | SIDER | ||
| 190 | Oropharyngeal discomfort | SIDER | ||
| 191 | Oropharyngeal pain | SIDER | ||
| 192 | Pain | SIDER | ||
| 193 | Palpitations | SIDER | ||
| 194 | Rash both legs | SIDER | ||
| 195 | Rhinitis | SIDER | ||
| 196 | Shock | SIDER | ||
| 197 | Somnolence | SIDER | ||
| 198 | Sweating | SIDER | ||
| 199 | Tension | SIDER | ||
| 200 | Thrombosis | SIDER | ||
| 201 | Vasodilation procedure | SIDER | ||
| 202 | Vasodilation | SIDER | ||
| 203 | Visual Impairment | SIDER | ||
| 204 | Wheezing | SIDER | ||
| 205 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.