Roflumilast
(MNDBXUUTURYVHR-UHFFFAOYSA-N)
Structure
- SMILES
- FC(Oc1ccc(cc1OCC1CC1)C(=O)Nc1c(Cl)cncc1Cl)F
- Type(s)
- Approved
- ATC code(s)
- R03DX07
- Molecular Formula:
- C17H14Cl2F2N2O3
- Molecular Weight:
- 403.207
- Log P:
- 5.1039
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 60.45
- CAS Number(s):
- 162401-32-3
Synonym(s)
1.
Roflumilast
2.
3-cyclopropylmethoxy-4-difluoromethoxy-N-(3,5-di-chloropyrid-4-yl)benzamide
3.
daliresp
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Weight decreased | FAERS: 109 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 2 | Nausea | FAERS: 101 Canada Vigilance: 1 | 16317827 | CTD SIDER Canada Vigilance US FAERS |
| 3 | Headache | FAERS: 69 Canada Vigilance: 2 | 16317827 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Dizziness | FAERS: 59 | SIDER US FAERS | |
| 5 | Malaise | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Pneumonia | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 7 | Tremor | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Anxiety | FAERS: 40 | SIDER US FAERS | |
| 9 | Back Pain | FAERS: 34 | SIDER US FAERS | |
| 10 | Vomiting | FAERS: 33 | SIDER US FAERS | |
| 11 | Asthenia | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Feeling abnormal | FAERS: 27 | SIDER US FAERS | |
| 13 | Fatigue | FAERS: 21 | SIDER US FAERS | |
| 14 | Abdominal discomfort | FAERS: 15 | US FAERS | |
| 15 | Dehydration | FAERS: 15 | US FAERS | |
| 16 | Nervousness | FAERS: 15 | SIDER US FAERS | |
| 17 | Abdominal Pain | FAERS: 14 | 16317827 | CTD SIDER US FAERS |
| 18 | Intentional product misuse | FAERS: 14 | US FAERS | |
| 19 | Pain | FAERS: 14 | US FAERS | |
| 20 | Suicide attempt | FAERS: 14 | US FAERS | |
| 21 | Atrial Fibrillation | FAERS: 12 | SIDER US FAERS | |
| 22 | Chest Pain | FAERS: 12 | US FAERS | |
| 23 | Drug dose omission | FAERS: 12 | US FAERS | |
| 24 | Tachycardia | FAERS: 12 | US FAERS | |
| 25 | Palpitations | FAERS: 11 | SIDER US FAERS | |
| 26 | Arthralgia | FAERS: 9 | US FAERS | |
| 27 | Drug ineffective | FAERS: 9 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 28 | Dyspepsia | FAERS: 9 | SIDER US FAERS | |
| 29 | Medication Error | FAERS: 9 | US FAERS | |
| 30 | Unevaluable event | FAERS: 9 | US FAERS | |
| 31 | Agitation | FAERS: 8 | US FAERS | |
| 32 | Myalgia | FAERS: 8 | SIDER US FAERS | |
| 33 | Pancreatitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 35 | Restlessness | FAERS: 8 | US FAERS | |
| 36 | Adverse event | FAERS: 7 | US FAERS | |
| 37 | Crying | FAERS: 7 | US FAERS | |
| 38 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 39 | Feeling jittery | FAERS: 6 | US FAERS | |
| 40 | Mood swings | FAERS: 6 | US FAERS | |
| 41 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 42 | Product use issue | FAERS: 6 | US FAERS | |
| 43 | Pruritus | FAERS: 6 | US FAERS | |
| 44 | Somnolence | FAERS: 6 | US FAERS | |
| 45 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 46 | Abasia | FAERS: 5 | US FAERS | |
| 47 | Bronchitis | FAERS: 5 | US FAERS | |
| 48 | Epistaxis | FAERS: 5 | US FAERS | |
| 49 | Influenza | FAERS: 5 | SIDER US FAERS | |
| 50 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 51 | Syncope | FAERS: 5 | US FAERS | |
| 52 | Urticaria | FAERS: 5 | SIDER US FAERS | |
| 53 | Visual Impairment | FAERS: 5 | US FAERS | |
| 54 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 55 | Asthma | FAERS: 4 | 16317827 | CTD US FAERS |
| 56 | Chest discomfort | FAERS: 4 | US FAERS | |
| 57 | Cholecystitis | FAERS: 4 | US FAERS | |
| 58 | Completed Suicide | FAERS: 4 | SIDER US FAERS | |
| 59 | Constipation | FAERS: 4 | SIDER US FAERS | |
| 60 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 61 | Depressed mood | FAERS: 4 | US FAERS | |
| 62 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 63 | Hypotension | FAERS: 4 | US FAERS | |
| 64 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 65 | Infection | FAERS: 4 | SIDER US FAERS | |
| 66 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 67 | Memory impairment | FAERS: 4 | US FAERS | |
| 68 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 69 | Retching | FAERS: 4 | US FAERS | |
| 70 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 71 | Bone pain | FAERS: 3 | US FAERS | |
| 72 | Bronchospasm | FAERS: 3 | US FAERS | |
| 73 | Burning sensation | FAERS: 3 | US FAERS | |
| 74 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 75 | Chills | FAERS: 3 | US FAERS | |
| 76 | Cold sweat | FAERS: 3 | US FAERS | |
| 77 | Deafness Neurosensory | FAERS: 3 | US FAERS | |
| 78 | Erythema | FAERS: 3 | US FAERS | |
| 79 | Food aversion | FAERS: 3 | US FAERS | |
| 80 | Hypoxia | FAERS: 3 | US FAERS | |
| 81 | Increased bronchial secretion | FAERS: 3 | US FAERS | |
| 82 | Increased upper airway secretion | FAERS: 3 | US FAERS | |
| 83 | Lipoma | FAERS: 3 | US FAERS | |
| 84 | Neck Pain | FAERS: 3 | US FAERS | |
| 85 | Paranoia | FAERS: 3 | US FAERS | |
| 86 | Proctitis | FAERS: 3 | US FAERS | |
| 87 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 88 | Productive Cough | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 90 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 91 | Thrombosis | FAERS: 3 | US FAERS | |
| 92 | Tinnitus | FAERS: 3 | US FAERS | |
| 93 | Vasculitis | FAERS: 3 | US FAERS | |
| 94 | Alopecia | FAERS: 2 | US FAERS | |
| 95 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 96 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 97 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 98 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 99 | Blood urine present | FAERS: 2 | US FAERS | |
| 100 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 101 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 102 | Cheilitis | FAERS: 2 | US FAERS | |
| 103 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 104 | Claustrophobia | FAERS: 2 | US FAERS | |
| 105 | Colitis | FAERS: 2 | US FAERS | |
| 106 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 107 | Disease Progression | FAERS: 2 | US FAERS | |
| 108 | Disorientation | FAERS: 2 | US FAERS | |
| 109 | Drug administration error | FAERS: 2 | US FAERS | |
| 110 | Dysphonia | FAERS: 2 | US FAERS | |
| 111 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 112 | Flatulence | FAERS: 2 | US FAERS | |
| 113 | Flushing | FAERS: 2 | US FAERS | |
| 114 | Gamma-Glutamyltransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 115 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 116 | Hunger | FAERS: 2 | US FAERS | |
| 117 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 118 | Joint swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Lipase increased | FAERS: 2 | US FAERS | |
| 120 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 121 | Mechanical ileus | FAERS: 2 | US FAERS | |
| 122 | Mental status changes | FAERS: 2 | US FAERS | |
| 123 | Monoplegia | FAERS: 2 | US FAERS | |
| 124 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 125 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 126 | Overdose | FAERS: 2 | US FAERS | |
| 127 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 128 | Respiratory distress | FAERS: 2 | US FAERS | |
| 129 | Sepsis | FAERS: 2 | US FAERS | |
| 130 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 131 | Sinusitis | FAERS: 2 | SIDER US FAERS | |
| 132 | Subileus | FAERS: 2 | US FAERS | |
| 133 | Swelling | FAERS: 2 | US FAERS | |
| 134 | Terminal state | FAERS: 2 | US FAERS | |
| 135 | Therapy cessation | FAERS: 2 | US FAERS | |
| 136 | Urinary Retention | FAERS: 2 | US FAERS | |
| 137 | Urinary tract infection | FAERS: 2 | SIDER US FAERS | |
| 138 | Accidental overdose | FAERS: 1 | US FAERS | |
| 139 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 140 | Ageusia | FAERS: 1 | US FAERS | |
| 141 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 142 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 143 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 144 | Anger | FAERS: 1 | US FAERS | |
| 145 | Apathy | FAERS: 1 | US FAERS | |
| 146 | Aphagia | FAERS: 1 | US FAERS | |
| 147 | Appendicitis | FAERS: 1 | US FAERS | |
| 148 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 149 | Asphyxia | FAERS: 1 | US FAERS | |
| 150 | Atelectasis | FAERS: 1 | US FAERS | |
| 151 | Autoscopy | FAERS: 1 | US FAERS | |
| 152 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 153 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 154 | Bedridden | FAERS: 1 | US FAERS | |
| 155 | Blindness | FAERS: 1 | US FAERS | |
| 156 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 157 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 158 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 159 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 160 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 161 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 162 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 163 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 164 | Bursitis | FAERS: 1 | US FAERS | |
| 165 | Cachexia | FAERS: 1 | US FAERS | |
| 166 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 167 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 168 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 169 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 170 | Cartilage injury | FAERS: 1 | US FAERS | |
| 171 | Cataract operation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 173 | Compression fracture | FAERS: 1 | US FAERS | |
| 174 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 175 | Cystitis | FAERS: 1 | US FAERS | |
| 176 | Cyst | FAERS: 1 | US FAERS | |
| 177 | Deafness | FAERS: 1 | US FAERS | |
| 178 | Delirium | FAERS: 1 | US FAERS | |
| 179 | Device related infection | FAERS: 1 | US FAERS | |
| 180 | Disability | FAERS: 1 | US FAERS | |
| 181 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 182 | Drug Dependence | FAERS: 1 | US FAERS | |
| 183 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 184 | Dysphemia | FAERS: 1 | US FAERS | |
| 185 | Dystonia | FAERS: 1 | US FAERS | |
| 186 | Dysuria | FAERS: 1 | US FAERS | |
| 187 | Early satiety | FAERS: 1 | US FAERS | |
| 188 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 189 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 190 | Emotional disorder | FAERS: 1 | US FAERS | |
| 191 | Endocarditis | FAERS: 1 | US FAERS | |
| 192 | Enteritis | FAERS: 1 | US FAERS | |
| 193 | Eosinophilia | FAERS: 1 | US FAERS | |
| 194 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 195 | Euthanasia | FAERS: 1 | US FAERS | |
| 196 | Exophthalmos | FAERS: 1 | US FAERS | |
| 197 | Extra dose administered | FAERS: 1 | US FAERS | |
| 198 | Eye pain | FAERS: 1 | US FAERS | |
| 199 | Food Poisoning | FAERS: 1 | US FAERS | |
| 200 | Fracture | FAERS: 1 | US FAERS | |
| 201 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 202 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 203 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 204 | Gingival blister | FAERS: 1 | US FAERS | |
| 205 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 206 | Gout | FAERS: 1 | US FAERS | |
| 207 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 208 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 209 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 210 | Hypophagia | FAERS: 1 | US FAERS | |
| 211 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 212 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 213 | Inflammation | FAERS: 1 | US FAERS | |
| 214 | Laceration | FAERS: 1 | US FAERS | |
| 215 | Lactobacillus infection | FAERS: 1 | US FAERS | |
| 216 | Lethargy | FAERS: 1 | US FAERS | |
| 217 | Leukocytosis | FAERS: 1 | US FAERS | |
| 218 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 219 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 220 | Mantle cell lymphoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Menopause | FAERS: 1 | US FAERS | |
| 222 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 223 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 224 | Middle insomnia | FAERS: 1 | US FAERS | |
| 225 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 226 | Negative thoughts | FAERS: 1 | US FAERS | |
| 227 | Neutropenia | FAERS: 1 | US FAERS | |
| 228 | No adverse event | FAERS: 1 | US FAERS | |
| 229 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 230 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 231 | Panic Disorder | FAERS: 1 | US FAERS | |
| 232 | Pericarditis | FAERS: 1 | US FAERS | |
| 233 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 234 | Personality Change | FAERS: 1 | US FAERS | |
| 235 | Pneumothorax | FAERS: 1 | US FAERS | |
| 236 | Procedural complication | FAERS: 1 | US FAERS | |
| 237 | Product dose omission | FAERS: 1 | US FAERS | |
| 238 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 239 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 240 | Pulmonary congestion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 242 | Regurgitation | FAERS: 1 | US FAERS | |
| 243 | Renal cyst | FAERS: 1 | US FAERS | |
| 244 | Respiratory tract congestion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 245 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 246 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 247 | Scan abnormal | FAERS: 1 | US FAERS | |
| 248 | Screaming | FAERS: 1 | US FAERS | |
| 249 | Secretion discharge | FAERS: 1 | US FAERS | |
| 250 | Senile dementia | FAERS: 1 | US FAERS | |
| 251 | Septic Shock | FAERS: 1 | US FAERS | |
| 252 | Shock | FAERS: 1 | US FAERS | |
| 253 | Skin irritation | FAERS: 1 | US FAERS | |
| 254 | Skin lesion | FAERS: 1 | US FAERS | |
| 255 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 256 | Sneezing | FAERS: 1 | US FAERS | |
| 257 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 258 | Stress | FAERS: 1 | US FAERS | |
| 259 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 260 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 261 | Throat cancer | FAERS: 1 | US FAERS | |
| 262 | Throat irritation | FAERS: 1 | US FAERS | |
| 263 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 264 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 265 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 266 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 267 | Vertigo | FAERS: 1 | SIDER US FAERS | |
| 268 | Wheezing | FAERS: 1 | US FAERS | |
| 269 | Angioedema | SIDER | ||
| 270 | Carcinoma of lung | SIDER | ||
| 271 | Dermatitis | SIDER | ||
| 272 | Diarrhea | 16317827 | CTD | |
| 273 | Dysgeusia | SIDER | ||
| 274 | Gastrointestinal Pain | SIDER | ||
| 275 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 276 | Infestation | SIDER | ||
| 277 | Malnutrition | SIDER | ||
| 278 | Musculoskeletal discomfort | SIDER | ||
| 279 | Rhinitis | SIDER | ||
| 280 | Tension | SIDER | ||
| 281 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.