Deamino Arginine Vasopressin
(MLSVJHOYXJGGTR-IFHOVBQLSA-N)
Structure
- SMILES
- NC(=O)C[C@@H]1NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](NC(=O)CCSSC[C@H](NC1=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(=O)NCC(=O)N)CCCN=C(N)N)Cc1ccc(cc1)O.CC(=O)O
- Molecular Formula:
- C48H68N14O14S2
- Molecular Weight:
- 1129.270
- Log P:
- 1.6144
- Hydrogen Bond Acceptor:
- 30
- Hydrogen Bond Donor:
- 14
- TPSA:
- 525.81
- CAS Number(s):
- 62288-83-9
Synonym(s)
1.
Deamino Arginine Vasopressin
2.
Desmopressin
3.
Vasopressin, Deamino Arginine
4.
1-Deamino-8-D-arginine Vasopressin
5.
1-Desamino-8-arginine Vasopressin
6.
Adiuretin
7.
Adiuretin SD
8.
Apo-Desmopressin
9.
DDAVP
10.
Desmogalen
11.
Desmopressin Acetate
12.
Desmopressin Monoacetate
13.
Desmopressin Monoacetate, Trihydrate
14.
Desmopressine Ferring
15.
Desmospray
16.
Desmotabs
17.
Minirin
18.
Minurin
19.
Nocutil
20.
Octim
21.
Octostim
22.
Acetate, Desmopressin
23.
Arginine Vasopressin, Deamino
24.
Ferring, Desmopressine
25.
Monoacetate, Desmopressin
26.
Monoacetate, Trihydrate Desmopressin
27.
Trihydrate Desmopressin Monoacetate
28.
Vasopressin, 1-Deamino-8-D-arginine
29.
Vasopressin, 1-Desamino-8-arginine
External Link(s)
| MeSH | D003894 |
| PubChem Compound | 9833407 |
| BindingDB | 50247923 |
| CHEMBL | CHEMBL1200556 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 51 | US FAERS | |
| 2 | Headache | FAERS: 17 | US FAERS | |
| 3 | Vomiting | FAERS: 11 | US FAERS | |
| 4 | Blood sodium decreased | FAERS: 10 | US FAERS | |
| 5 | Water Intoxication | FAERS: 9 | US FAERS | |
| 6 | Overdose | FAERS: 8 | US FAERS | |
| 7 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 8 | Osmotic demyelination syndrome | FAERS: 7 | US FAERS | |
| 9 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 10 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 11 | Arterial thrombosis | FAERS: 5 | US FAERS | |
| 12 | Medication Error | FAERS: 5 | US FAERS | |
| 13 | Nausea | FAERS: 5 | US FAERS | |
| 14 | Budd-Chiari Syndrome | FAERS: 4 | US FAERS | |
| 15 | Dehydration | FAERS: 4 | US FAERS | |
| 16 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 17 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 18 | Malaise | FAERS: 4 | US FAERS | |
| 19 | Memory impairment | FAERS: 4 | US FAERS | |
| 20 | Mental status changes | FAERS: 4 | US FAERS | |
| 21 | Product substitution issue | FAERS: 4 | US FAERS | |
| 22 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 23 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 24 | Ascites | FAERS: 3 | US FAERS | |
| 25 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 26 | Epistaxis | FAERS: 3 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 28 | Incorrect storage of drug | FAERS: 3 | US FAERS | |
| 29 | Product container issue | FAERS: 3 | US FAERS | |
| 30 | Somnolence | FAERS: 3 | US FAERS | |
| 31 | Thirst | FAERS: 3 | US FAERS | |
| 32 | Troponin increased | FAERS: 3 | US FAERS | |
| 33 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 34 | Accidental overdose | FAERS: 2 | US FAERS | |
| 35 | Alopecia | FAERS: 2 | US FAERS | |
| 36 | Asthenia | FAERS: 2 | US FAERS | |
| 37 | Atrial thrombosis | FAERS: 2 | US FAERS | |
| 38 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 39 | Chest Pain | FAERS: 2 | US FAERS | |
| 40 | Chest discomfort | FAERS: 2 | US FAERS | |
| 41 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 42 | Delirium | FAERS: 2 | US FAERS | |
| 43 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 44 | Dizziness | FAERS: 2 | US FAERS | |
| 45 | Drug dose omission | FAERS: 2 | US FAERS | |
| 46 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 47 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 48 | Facial Paresis | FAERS: 2 | US FAERS | |
| 49 | Flushing | FAERS: 2 | US FAERS | |
| 50 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 51 | Hypotension | FAERS: 2 | US FAERS | |
| 52 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 53 | No adverse event | FAERS: 2 | US FAERS | |
| 54 | Polyuria | FAERS: 2 | US FAERS | |
| 55 | Precocious Puberty | FAERS: 2 | US FAERS | |
| 56 | Product quality issue | FAERS: 2 | US FAERS | |
| 57 | Product use issue | FAERS: 2 | US FAERS | |
| 58 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 59 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 60 | Thrombosis | FAERS: 2 | US FAERS | |
| 61 | Transaminases increased | FAERS: 2 | US FAERS | |
| 62 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 63 | Urine output increased | FAERS: 2 | US FAERS | |
| 64 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 65 | nervous system disorder | FAERS: 2 | US FAERS | |
| 66 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 67 | Anxiety | FAERS: 1 | US FAERS | |
| 68 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 69 | Apathy | FAERS: 1 | US FAERS | |
| 70 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 71 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 72 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 73 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 74 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 75 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 76 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 77 | Blood osmolarity increased | FAERS: 1 | US FAERS | |
| 78 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 79 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 80 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 81 | Burning sensation | FAERS: 1 | US FAERS | |
| 82 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 83 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 84 | Cataract | FAERS: 1 | US FAERS | |
| 85 | Cerebral hygroma | FAERS: 1 | US FAERS | |
| 86 | Cerebral salt-wasting syndrome | FAERS: 1 | US FAERS | |
| 87 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 88 | Choking | FAERS: 1 | US FAERS | |
| 89 | Coagulation factor VIII level increased | FAERS: 1 | US FAERS | |
| 90 | Colonic Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 91 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 92 | Cystitis | FAERS: 1 | US FAERS | |
| 93 | Device malfunction | FAERS: 1 | US FAERS | |
| 94 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 95 | Disorientation | FAERS: 1 | US FAERS | |
| 96 | Diverticulitis | FAERS: 1 | US FAERS | |
| 97 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 98 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 99 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 100 | Dysarthria | FAERS: 1 | US FAERS | |
| 101 | Dysphonia | FAERS: 1 | US FAERS | |
| 102 | Dysuria | FAERS: 1 | US FAERS | |
| 103 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 104 | Encephalitis | FAERS: 1 | US FAERS | |
| 105 | Enuresis | FAERS: 1 | US FAERS | |
| 106 | Epilepsy | FAERS: 1 | US FAERS | |
| 107 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 108 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 109 | Expired product administered | FAERS: 1 | US FAERS | |
| 110 | Extra dose administered | FAERS: 1 | US FAERS | |
| 111 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 112 | Hordeolum | FAERS: 1 | US FAERS | |
| 113 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 114 | Hypersomnia | FAERS: 1 | US FAERS | |
| 115 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 116 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 117 | Hyponatraemic seizure | FAERS: 1 | US FAERS | |
| 118 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 119 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 120 | Incontinence | FAERS: 1 | US FAERS | |
| 121 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 122 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 123 | Influenza | FAERS: 1 | US FAERS | |
| 124 | Infusion site pain | FAERS: 1 | US FAERS | |
| 125 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 126 | Lethargy | FAERS: 1 | US FAERS | |
| 127 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 128 | Multiple allergies | FAERS: 1 | US FAERS | |
| 129 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 130 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 131 | Nocturia | FAERS: 1 | US FAERS | |
| 132 | Oliguria | FAERS: 1 | US FAERS | |
| 133 | Oral contusion | FAERS: 1 | US FAERS | |
| 134 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 135 | Pallor | FAERS: 1 | US FAERS | |
| 136 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 137 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 138 | Peritonitis | FAERS: 1 | US FAERS | |
| 139 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 140 | Polydipsia | FAERS: 1 | US FAERS | |
| 141 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 142 | Post procedural complication | FAERS: 1 | US FAERS | |
| 143 | Procedural complication | FAERS: 1 | US FAERS | |
| 144 | Product administration error | FAERS: 1 | US FAERS | |
| 145 | Product dose omission | FAERS: 1 | US FAERS | |
| 146 | Product label confusion | FAERS: 1 | US FAERS | |
| 147 | Product label issue | FAERS: 1 | US FAERS | |
| 148 | Product storage error | FAERS: 1 | US FAERS | |
| 149 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 150 | Quadriparesis | FAERS: 1 | US FAERS | |
| 151 | Respiratory distress | FAERS: 1 | US FAERS | |
| 152 | Retching | FAERS: 1 | US FAERS | |
| 153 | Salt craving | FAERS: 1 | US FAERS | |
| 154 | Scab | FAERS: 1 | US FAERS | |
| 155 | Shock | FAERS: 1 | US FAERS | |
| 156 | Sinusitis | FAERS: 1 | US FAERS | |
| 157 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 158 | Stress | FAERS: 1 | US FAERS | |
| 159 | Syncope | FAERS: 1 | US FAERS | |
| 160 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 161 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 162 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 163 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 164 | Tooth Infection | FAERS: 1 | US FAERS | |
| 165 | Tremor | FAERS: 1 | US FAERS | |
| 166 | Unevaluable event | FAERS: 1 | US FAERS | |
| 167 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 168 | Urticaria | FAERS: 1 | US FAERS | |
| 169 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 170 | Von Willebrand's factor antigen increased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.