Dextromethorphan
(MISZALMBODQYFT-URVXVIKDSA-N)
Structure
- SMILES
- COc1ccc2c(c1)[C@@]13CCCC[C@@H]3[C@H](C2)N(CC1)C.Br
- Molecular Formula:
- C18H26BrNO
- Molecular Weight:
- 352.309
- Log P:
- 4.2794
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 12.47
- CAS Number(s):
- 125-69-9; 6700-34-1
Synonym(s)
1.
Dextromethorphan
2.
d-Methorphan
3.
Delsym
4.
Dextromethorphan Hydrobromide
5.
Dextromethorphan Hydrobromide, (+-)-Isomer
6.
Dextromethorphan Hydrobromide, Monohydrate
7.
Dextromethorphan Hydrochloride
8.
Dextromethorphan, (+-)-Isomer
9.
Levomethorphan
10.
Racemethorphan
11.
l-Methorphan
12.
Hydrobromide, Dextromethorphan
13.
Hydrochloride, Dextromethorphan
External Link(s)
| MeSH | D003915 |
| PubChem Compound | 5464025 |
| CHEMBL | CHEMBL1201004 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 956 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Overdose | FAERS: 240 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | No adverse event | FAERS: 212 | US FAERS | |
| 4 | Accidental overdose | FAERS: 167 | US FAERS | |
| 5 | Dizziness | FAERS: 166 | US FAERS | |
| 6 | Drug abuse | FAERS: 129 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Somnolence | FAERS: 80 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 77 | US FAERS | |
| 9 | Nausea | FAERS: 74 | US FAERS | |
| 10 | Vomiting | FAERS: 69 | US FAERS | |
| 11 | Accidental exposure to product by child | FAERS: 67 | US FAERS | |
| 12 | Drug administered to patient of inappropriate age | FAERS: 64 | US FAERS | |
| 13 | Inappropriate schedule of drug administration | FAERS: 62 | US FAERS | |
| 14 | Headache | FAERS: 56 | US FAERS | |
| 15 | Incorrect drug administration duration | FAERS: 41 | US FAERS | |
| 16 | Incorrect dose administered | FAERS: 39 | US FAERS | |
| 17 | Malaise | FAERS: 39 | US FAERS | |
| 18 | Mydriasis | FAERS: 39 | US FAERS | |
| 19 | Fatigue | FAERS: 36 | US FAERS | |
| 20 | Abdominal discomfort | FAERS: 34 | US FAERS | |
| 21 | Hypersensitivity | FAERS: 34 | US FAERS | |
| 22 | Drug effect incomplete | FAERS: 32 | US FAERS | |
| 23 | Euphoric mood | FAERS: 31 | US FAERS | |
| 24 | Urticaria | FAERS: 30 | US FAERS | |
| 25 | Expired product administered | FAERS: 27 | US FAERS | |
| 26 | Blood glucose increased | FAERS: 26 | US FAERS | |
| 27 | Pruritus | FAERS: 22 | US FAERS | |
| 28 | Tremor | FAERS: 22 | US FAERS | |
| 29 | Agitation | FAERS: 21 | US FAERS | |
| 30 | Product taste abnormal | FAERS: 19 | US FAERS | |
| 31 | Anxiety | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Disorientation | FAERS: 17 | US FAERS | |
| 33 | Drug Dependence | FAERS: 17 | US FAERS | |
| 34 | Asthenia | FAERS: 16 | US FAERS | |
| 35 | Dysarthria | FAERS: 16 | US FAERS | |
| 36 | Toxicity to various agents | FAERS: 16 | US FAERS | |
| 37 | Nervousness | FAERS: 15 | US FAERS | |
| 38 | Unevaluable event | FAERS: 15 | US FAERS | |
| 39 | Lethargy | FAERS: 13 | US FAERS | |
| 40 | Palpitations | FAERS: 13 | US FAERS | |
| 41 | Restlessness | FAERS: 13 | US FAERS | |
| 42 | Erythema | FAERS: 12 | US FAERS | |
| 43 | Incorrect product administration duration | FAERS: 12 | US FAERS | |
| 44 | Product use issue | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Drug toxicity | FAERS: 11 | US FAERS | |
| 46 | Feeling jittery | FAERS: 11 | US FAERS | |
| 47 | Retching | FAERS: 11 | US FAERS | |
| 48 | Wrong technique in product usage process | FAERS: 11 | US FAERS | |
| 49 | Inappropriate schedule of product administration | FAERS: 10 | US FAERS | |
| 50 | Throat irritation | FAERS: 10 | US FAERS | |
| 51 | Accidental drug intake by child | FAERS: 9 | US FAERS | |
| 52 | Ataxia | FAERS: 9 | US FAERS | |
| 53 | Chest Pain | FAERS: 9 | US FAERS | |
| 54 | Constipation | FAERS: 9 | US FAERS | |
| 55 | Intentional drug misuse | FAERS: 9 | US FAERS | |
| 56 | Product administered to patient of inappropriate age | FAERS: 9 | US FAERS | |
| 57 | Syncope | FAERS: 9 | US FAERS | |
| 58 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 59 | Medication Error | FAERS: 8 | US FAERS | |
| 60 | Product quality issue | FAERS: 8 | US FAERS | |
| 61 | Tachycardia | FAERS: 8 | US FAERS | |
| 62 | Vertigo | FAERS: 8 | US FAERS | |
| 63 | Visual Impairment | FAERS: 8 | US FAERS | |
| 64 | Completed Suicide | FAERS: 7 | US FAERS | |
| 65 | Drug abuser | FAERS: 7 | US FAERS | |
| 66 | Extra dose administered | FAERS: 7 | US FAERS | |
| 67 | Feeling Cold | FAERS: 7 | US FAERS | |
| 68 | Flushing | FAERS: 7 | US FAERS | |
| 69 | Pain | FAERS: 7 | US FAERS | |
| 70 | Stupor | FAERS: 7 | US FAERS | |
| 71 | Tinnitus | FAERS: 7 | US FAERS | |
| 72 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 73 | Delirium | FAERS: 6 | US FAERS | |
| 74 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 75 | Discomfort | FAERS: 6 | US FAERS | |
| 76 | Dysphonia | FAERS: 6 | US FAERS | |
| 77 | Dysuria | FAERS: 6 | US FAERS | |
| 78 | Flatulence | FAERS: 6 | US FAERS | |
| 79 | Head discomfort | FAERS: 6 | US FAERS | |
| 80 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 81 | Nystagmus | FAERS: 6 | US FAERS | |
| 82 | Paranoia | FAERS: 6 | US FAERS | |
| 83 | Amnesia | FAERS: 5 | US FAERS | |
| 84 | Chest discomfort | FAERS: 5 | US FAERS | |
| 85 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 86 | Dehydration | FAERS: 5 | US FAERS | |
| 87 | Dyspepsia | FAERS: 5 | US FAERS | |
| 88 | Epistaxis | FAERS: 5 | US FAERS | |
| 89 | Lip swelling | FAERS: 5 | US FAERS | |
| 90 | Mental impairment | FAERS: 5 | US FAERS | |
| 91 | Mental status changes | FAERS: 5 | US FAERS | |
| 92 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 93 | Poisoning | FAERS: 5 | US FAERS | |
| 94 | Product label issue | FAERS: 5 | US FAERS | |
| 95 | Wheezing | FAERS: 5 | US FAERS | |
| 96 | Wrong drug administered | FAERS: 5 | US FAERS | |
| 97 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 98 | Adverse event | FAERS: 4 | US FAERS | |
| 99 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 100 | Bronchitis | FAERS: 4 | US FAERS | |
| 101 | Burning sensation | FAERS: 4 | US FAERS | |
| 102 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 103 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 104 | Cold sweat | FAERS: 4 | US FAERS | |
| 105 | Dissociation | FAERS: 4 | US FAERS | |
| 106 | Drug screen positive | FAERS: 4 | US FAERS | |
| 107 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 108 | Hypotension | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Incoherent | FAERS: 4 | US FAERS | |
| 110 | Presyncope | FAERS: 4 | US FAERS | |
| 111 | Product lot number issue | FAERS: 4 | US FAERS | |
| 112 | Serotonin Syndrome | FAERS: 4 | US FAERS | |
| 113 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 114 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 115 | Anosmia | FAERS: 3 | US FAERS | |
| 116 | Aphonia | FAERS: 3 | US FAERS | |
| 117 | Asthma | FAERS: 3 | US FAERS | |
| 118 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 119 | Dysgeusia | FAERS: 3 | US FAERS | |
| 120 | Dystonia | FAERS: 3 | US FAERS | |
| 121 | Hyperventilation | FAERS: 3 | US FAERS | |
| 122 | Hypervigilance | FAERS: 3 | US FAERS | |
| 123 | Influenza | FAERS: 3 | US FAERS | |
| 124 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 125 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 126 | Pallor | FAERS: 3 | US FAERS | |
| 127 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 128 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 129 | Photophobia | FAERS: 3 | US FAERS | |
| 130 | Product expiration date issue | FAERS: 3 | US FAERS | |
| 131 | Product packaging issue | FAERS: 3 | US FAERS | |
| 132 | Product use complaint | FAERS: 3 | US FAERS | |
| 133 | Productive Cough | FAERS: 3 | US FAERS | |
| 134 | Swelling | FAERS: 3 | US FAERS | |
| 135 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 136 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 137 | Accidental exposure | FAERS: 2 | US FAERS | |
| 138 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 139 | Ageusia | FAERS: 2 | US FAERS | |
| 140 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 141 | Anorexia | FAERS: 2 | US FAERS | |
| 142 | Autoscopy | FAERS: 2 | US FAERS | |
| 143 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 144 | Chills | FAERS: 2 | US FAERS | |
| 145 | Chromaturia | FAERS: 2 | US FAERS | |
| 146 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 147 | Crying | FAERS: 2 | US FAERS | |
| 148 | Dependence | FAERS: 2 | US FAERS | |
| 149 | Diplopia | FAERS: 2 | US FAERS | |
| 150 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 151 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 152 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 153 | Eye pain | FAERS: 2 | US FAERS | |
| 154 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 2 | US FAERS | |
| 155 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 156 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 157 | Glaucoma | FAERS: 2 | US FAERS | |
| 158 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 159 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 160 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 161 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 162 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 163 | Memory impairment | FAERS: 2 | US FAERS | |
| 164 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 165 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 166 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 167 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 168 | Physical assault | FAERS: 2 | US FAERS | |
| 169 | Pneumonia | FAERS: 2 | US FAERS | |
| 170 | Product complaint | FAERS: 2 | US FAERS | |
| 171 | Product formulation issue | FAERS: 2 | US FAERS | |
| 172 | Product use in unapproved indication | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 173 | Reaction to preservatives | FAERS: 2 | US FAERS | |
| 174 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 175 | Sinusitis | FAERS: 2 | US FAERS | |
| 176 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 177 | Sneezing | FAERS: 2 | US FAERS | |
| 178 | Status Asthmaticus | FAERS: 2 | US FAERS | |
| 179 | Stillbirth | FAERS: 2 | US FAERS | |
| 180 | Stress | FAERS: 2 | US FAERS | |
| 181 | Tension | FAERS: 2 | US FAERS | |
| 182 | Urinary Retention | FAERS: 2 | US FAERS | |
| 183 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 184 | Weight decreased | FAERS: 2 | US FAERS | |
| 185 | nervous system disorder | FAERS: 2 | US FAERS | |
| 186 | Abasia | FAERS: 1 | US FAERS | |
| 187 | Abdominal mass | FAERS: 1 | US FAERS | |
| 188 | Accidental death | FAERS: 1 | US FAERS | |
| 189 | Acne | FAERS: 1 | US FAERS | |
| 190 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 191 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 192 | Anger | FAERS: 1 | US FAERS | |
| 193 | Anhedonia | FAERS: 1 | US FAERS | |
| 194 | Anorgasmia | FAERS: 1 | US FAERS | |
| 195 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 196 | Arthralgia | FAERS: 1 | US FAERS | |
| 197 | Arthritis | FAERS: 1 | US FAERS | |
| 198 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 199 | Back Pain | FAERS: 1 | US FAERS | |
| 200 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 201 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 202 | Blepharospasm | FAERS: 1 | US FAERS | |
| 203 | Blood urine present | FAERS: 1 | US FAERS | |
| 204 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 205 | Catatonia | FAERS: 1 | US FAERS | |
| 206 | Cellulitis | FAERS: 1 | US FAERS | |
| 207 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 208 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 209 | Choking sensation | FAERS: 1 | US FAERS | |
| 210 | Choking | FAERS: 1 | US FAERS | |
| 211 | Cyanosis | FAERS: 1 | US FAERS | |
| 212 | Deformity | FAERS: 1 | US FAERS | |
| 213 | Depressed mood | FAERS: 1 | US FAERS | |
| 214 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 215 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 216 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 217 | Dreamy state | FAERS: 1 | US FAERS | |
| 218 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 219 | Drug administration error | FAERS: 1 | US FAERS | |
| 220 | Drug dose omission | FAERS: 1 | US FAERS | |
| 221 | Ear discomfort | FAERS: 1 | US FAERS | |
| 222 | Economic problem | FAERS: 1 | US FAERS | |
| 223 | Elevated mood | FAERS: 1 | US FAERS | |
| 224 | Emergency Care | FAERS: 1 | US FAERS | |
| 225 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 226 | Facial Pain | FAERS: 1 | US FAERS | |
| 227 | Facial paralysis | FAERS: 1 | US FAERS | |
| 228 | Food Poisoning | FAERS: 1 | US FAERS | |
| 229 | Formication | FAERS: 1 | US FAERS | |
| 230 | Gastritis | FAERS: 1 | US FAERS | |
| 231 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 232 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 233 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 234 | Hemiparesis | FAERS: 1 | US FAERS | |
| 235 | Hunger | FAERS: 1 | US FAERS | |
| 236 | Hyperacusis | FAERS: 1 | US FAERS | |
| 237 | Hypersomnia | FAERS: 1 | US FAERS | |
| 238 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 239 | Hypoxia | FAERS: 1 | US FAERS | |
| 240 | Impaired work ability | FAERS: 1 | US FAERS | |
| 241 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 242 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 243 | Infection | FAERS: 1 | US FAERS | |
| 244 | Initial insomnia | FAERS: 1 | US FAERS | |
| 245 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 246 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 247 | Joint swelling | FAERS: 1 | US FAERS | |
| 248 | Laceration | FAERS: 1 | US FAERS | |
| 249 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 250 | Limb discomfort | FAERS: 1 | US FAERS | |
| 251 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 252 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 253 | Macrocytosis | FAERS: 1 | US FAERS | |
| 254 | Mouth swelling | FAERS: 1 | US FAERS | |
| 255 | Muscle strain | FAERS: 1 | US FAERS | |
| 256 | Myalgia | FAERS: 1 | US FAERS | |
| 257 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 258 | Neck Pain | FAERS: 1 | US FAERS | |
| 259 | Night sweats | FAERS: 1 | US FAERS | |
| 260 | Opisthotonus | FAERS: 1 | US FAERS | |
| 261 | Patient-device incompatibility | FAERS: 1 | US FAERS | |
| 262 | Petechiae | FAERS: 1 | US FAERS | |
| 263 | Phobia of driving | FAERS: 1 | US FAERS | |
| 264 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 265 | Polyuria | FAERS: 1 | US FAERS | |
| 266 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 267 | Product barcode issue | FAERS: 1 | US FAERS | |
| 268 | Product container issue | FAERS: 1 | US FAERS | |
| 269 | Product contamination physical | FAERS: 1 | US FAERS | |
| 270 | Product label confusion | FAERS: 1 | US FAERS | |
| 271 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 272 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 273 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 274 | Product tampering | FAERS: 1 | US FAERS | |
| 275 | Rash erythematous | FAERS: 1 | US FAERS | |
| 276 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 277 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 278 | Regurgitation | FAERS: 1 | US FAERS | |
| 279 | Renal pain | FAERS: 1 | US FAERS | |
| 280 | Respiratory distress | FAERS: 1 | US FAERS | |
| 281 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 282 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 283 | Saliva altered | FAERS: 1 | US FAERS | |
| 284 | Screaming | FAERS: 1 | US FAERS | |
| 285 | Skin irritation | FAERS: 1 | US FAERS | |
| 286 | Slow speech | FAERS: 1 | US FAERS | |
| 287 | Somnambulism | FAERS: 1 | US FAERS | |
| 288 | Spinal cord herniation | FAERS: 1 | US FAERS | |
| 289 | Staring | FAERS: 1 | US FAERS | |
| 290 | Stridor | FAERS: 1 | US FAERS | |
| 291 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 292 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 293 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 294 | Thirst | FAERS: 1 | US FAERS | |
| 295 | Tongue eruption | FAERS: 1 | US FAERS | |
| 296 | Tongue erythema | FAERS: 1 | US FAERS | |
| 297 | Tonsillitis | FAERS: 1 | US FAERS | |
| 298 | Toothache | FAERS: 1 | US FAERS | |
| 299 | Torticollis | FAERS: 1 | US FAERS | |
| 300 | Transient aphasia | FAERS: 1 | US FAERS | |
| 301 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 302 | Unemployment | FAERS: 1 | US FAERS | |
| 303 | Unmasking of previously unidentified disease | FAERS: 1 | US FAERS | |
| 304 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 305 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 306 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 307 | Visual disturbance | FAERS: 1 | US FAERS | |
| 308 | Wound Complication | FAERS: 1 | US FAERS | |
| 309 | Wrong dose | FAERS: 1 | US FAERS | |
| 310 | Hyperpyrexia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120330
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.