telotristat ethyl
(MDSQOJYHHZBZKA-GBXCKJPGSA-N)
Structure
- SMILES
- CCOC(=O)[C@H](Cc1ccc(cc1)c1cc(nc(n1)N)O[C@@H](C(F)(F)F)c1ccc(cc1n1ccc(n1)C)Cl)N
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C27H26ClF3N6O3
- Molecular Weight:
- 574.982
- Log P:
- 6.2701
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 2
- TPSA:
- 131.17
- CAS Number(s):
- 1033805-22-9
Synonym(s)
1.
telotristat ethyl
External Link(s)
| MeSH | C000621725 |
| PubChem Compound | 25181577 25025298 |
| CHEMBL | CHEMBL2105695 |
| DrugBank | DB12095 |
| DrugCentral | 5214 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 9490 |
| KEGG | dr:D09974 |
| Therapeutic Target Database | D0RE6T |
| ZINC | 43205655 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Constipation | FAERS: 163 | US FAERS | |
| 2 | Nausea | FAERS: 139 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Abdominal Pain | FAERS: 137 | US FAERS | |
| 4 | Flatulence | FAERS: 103 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Drug ineffective | FAERS: 92 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Fatigue | FAERS: 88 | US FAERS | |
| 7 | Headache | FAERS: 82 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Malaise | FAERS: 70 | US FAERS | |
| 9 | Flushing | FAERS: 66 | US FAERS | |
| 10 | Asthenia | FAERS: 56 | US FAERS | |
| 11 | Product dose omission | FAERS: 46 | US FAERS | |
| 12 | Vomiting | FAERS: 46 | US FAERS | |
| 13 | Dehydration | FAERS: 32 | US FAERS | |
| 14 | Dizziness | FAERS: 31 | US FAERS | |
| 15 | Drug dose omission | FAERS: 29 | US FAERS | |
| 16 | Abdominal discomfort | FAERS: 27 | US FAERS | |
| 17 | Back Pain | FAERS: 27 | US FAERS | |
| 18 | Weight decreased | FAERS: 27 | US FAERS | |
| 19 | Blood glucose increased | FAERS: 25 | US FAERS | |
| 20 | Blood potassium decreased | FAERS: 22 | US FAERS | |
| 21 | Chest Pain | FAERS: 22 | US FAERS | |
| 22 | Disease Progression | FAERS: 22 | US FAERS | |
| 23 | Hospice Care | FAERS: 19 | US FAERS | |
| 24 | Pain | FAERS: 19 | US FAERS | |
| 25 | Peripheral swelling | FAERS: 18 | US FAERS | |
| 26 | Urinary tract infection | FAERS: 18 | US FAERS | |
| 27 | Nasopharyngitis | FAERS: 15 | US FAERS | |
| 28 | Pruritus | FAERS: 13 | US FAERS | |
| 29 | Blood magnesium decreased | FAERS: 12 | US FAERS | |
| 30 | Anxiety | FAERS: 11 | US FAERS | |
| 31 | Blood alkaline phosphatase increased | FAERS: 11 | US FAERS | |
| 32 | Blood chromogranin A increased | FAERS: 11 | US FAERS | |
| 33 | Feeling abnormal | FAERS: 11 | US FAERS | |
| 34 | Somnolence | FAERS: 10 | US FAERS | |
| 35 | Influenza | FAERS: 9 | US FAERS | |
| 36 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 37 | Arthralgia | FAERS: 8 | US FAERS | |
| 38 | Blood albumin decreased | FAERS: 8 | US FAERS | |
| 39 | Hypotension | FAERS: 8 | US FAERS | |
| 40 | Intestinal Obstruction | FAERS: 8 | US FAERS | |
| 41 | Pneumonia | FAERS: 8 | US FAERS | |
| 42 | Adverse event | FAERS: 7 | US FAERS | |
| 43 | Lymphocyte count decreased | FAERS: 7 | US FAERS | |
| 44 | Palpitations | FAERS: 7 | US FAERS | |
| 45 | Anorectal discomfort | FAERS: 6 | US FAERS | |
| 46 | Ascites | FAERS: 6 | US FAERS | |
| 47 | Blood urea increased | FAERS: 6 | US FAERS | |
| 48 | Chills | FAERS: 6 | US FAERS | |
| 49 | Dysgeusia | FAERS: 6 | US FAERS | |
| 50 | Intra-abdominal fluid collection | FAERS: 6 | US FAERS | |
| 51 | Joint swelling | FAERS: 6 | US FAERS | |
| 52 | Emotional distress | FAERS: 5 | US FAERS | |
| 53 | Erythema | FAERS: 5 | US FAERS | |
| 54 | Gout | FAERS: 5 | US FAERS | |
| 55 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 56 | Protein total decreased | FAERS: 5 | US FAERS | |
| 57 | Stress | FAERS: 5 | US FAERS | |
| 58 | Syncope | FAERS: 5 | US FAERS | |
| 59 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 60 | Arthritis | FAERS: 4 | US FAERS | |
| 61 | Blood chloride decreased | FAERS: 4 | US FAERS | |
| 62 | Blood creatinine decreased | FAERS: 4 | US FAERS | |
| 63 | Blood iron decreased | FAERS: 4 | US FAERS | |
| 64 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 65 | Cancer Pain | FAERS: 4 | US FAERS | |
| 66 | Cataract operation | FAERS: 4 | US FAERS | |
| 67 | Cellulitis | FAERS: 4 | US FAERS | |
| 68 | Chest discomfort | FAERS: 4 | US FAERS | |
| 69 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 70 | Crying | FAERS: 4 | US FAERS | |
| 71 | Disorientation | FAERS: 4 | US FAERS | |
| 72 | Dry skin | FAERS: 4 | US FAERS | |
| 73 | Dysphonia | FAERS: 4 | US FAERS | |
| 74 | Epistaxis | FAERS: 4 | US FAERS | |
| 75 | Gastrointestinal Pain | FAERS: 4 | US FAERS | |
| 76 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 77 | Limb discomfort | FAERS: 4 | US FAERS | |
| 78 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 79 | Nervousness | FAERS: 4 | US FAERS | |
| 80 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 81 | Vertigo | FAERS: 4 | US FAERS | |
| 82 | Ageusia | FAERS: 3 | US FAERS | |
| 83 | Agitation | FAERS: 3 | US FAERS | |
| 84 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 85 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 86 | Chemotherapy | FAERS: 3 | US FAERS | |
| 87 | Eructation | FAERS: 3 | US FAERS | |
| 88 | Flank Pain | FAERS: 3 | US FAERS | |
| 89 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 90 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 91 | Hypophagia | FAERS: 3 | US FAERS | |
| 92 | Limb injury | FAERS: 3 | US FAERS | |
| 93 | Lip swelling | FAERS: 3 | US FAERS | |
| 94 | Metastasis | FAERS: 3 | US FAERS | |
| 95 | Neck Pain | FAERS: 3 | US FAERS | |
| 96 | Night sweats | FAERS: 3 | US FAERS | |
| 97 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 98 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 99 | Radioembolisation | FAERS: 3 | US FAERS | |
| 100 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 101 | Swelling | FAERS: 3 | US FAERS | |
| 102 | Thrombosis | FAERS: 3 | US FAERS | |
| 103 | Tinnitus | FAERS: 3 | US FAERS | |
| 104 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 105 | 5-hydroxyindolacetic acid in urine increased | FAERS: 2 | US FAERS | |
| 106 | 5-hydroxyindolacetic acid increased | FAERS: 2 | US FAERS | |
| 107 | Abdominal cavity drainage | FAERS: 2 | US FAERS | |
| 108 | Acne | FAERS: 2 | US FAERS | |
| 109 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 110 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 111 | Alopecia | FAERS: 2 | US FAERS | |
| 112 | Ammonia increased | FAERS: 2 | US FAERS | |
| 113 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 114 | Asthma | FAERS: 2 | US FAERS | |
| 115 | Bladder neoplasm surgery | FAERS: 2 | US FAERS | |
| 116 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 117 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 118 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 119 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 120 | Blood urine present | FAERS: 2 | US FAERS | |
| 121 | Bronchitis | FAERS: 2 | US FAERS | |
| 122 | Burning sensation | FAERS: 2 | US FAERS | |
| 123 | Complication associated with device | FAERS: 2 | US FAERS | |
| 124 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 125 | Cystitis | FAERS: 2 | US FAERS | |
| 126 | Depressed mood | FAERS: 2 | US FAERS | |
| 127 | Device related infection | FAERS: 2 | US FAERS | |
| 128 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 129 | Discomfort | FAERS: 2 | US FAERS | |
| 130 | Dyspepsia | FAERS: 2 | US FAERS | |
| 131 | Eating disorder symptom | FAERS: 2 | US FAERS | |
| 132 | Eczema | FAERS: 2 | US FAERS | |
| 133 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 134 | Eye Infection | FAERS: 2 | US FAERS | |
| 135 | Food Poisoning | FAERS: 2 | US FAERS | |
| 136 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 137 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 138 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 139 | Hunger | FAERS: 2 | US FAERS | |
| 140 | Hypersomnia | FAERS: 2 | US FAERS | |
| 141 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 142 | Joint injury | FAERS: 2 | US FAERS | |
| 143 | Laser Therapy | FAERS: 2 | US FAERS | |
| 144 | Lethargy | FAERS: 2 | US FAERS | |
| 145 | Leukocytosis | FAERS: 2 | US FAERS | |
| 146 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 147 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 148 | Muscle strain | FAERS: 2 | US FAERS | |
| 149 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 150 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 151 | Myalgia | FAERS: 2 | US FAERS | |
| 152 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 153 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 154 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 155 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 156 | Oncologic complication | FAERS: 2 | US FAERS | |
| 157 | Overdose | FAERS: 2 | US FAERS | |
| 158 | Pancreastatin increased | FAERS: 2 | US FAERS | |
| 159 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 160 | Paracentesis | FAERS: 2 | US FAERS | |
| 161 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 162 | Post procedural constipation | FAERS: 2 | US FAERS | |
| 163 | Rash erythematous | FAERS: 2 | US FAERS | |
| 164 | Rectal discharge | FAERS: 2 | US FAERS | |
| 165 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 166 | Regurgitation | FAERS: 2 | US FAERS | |
| 167 | Sepsis | FAERS: 2 | US FAERS | |
| 168 | Sneezing | FAERS: 2 | US FAERS | |
| 169 | Stomatitis | FAERS: 2 | US FAERS | |
| 170 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 171 | Suprapubic pain | FAERS: 2 | US FAERS | |
| 172 | Therapeutic procedure | FAERS: 2 | US FAERS | |
| 173 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 174 | Tremor | FAERS: 2 | US FAERS | |
| 175 | Urticaria | FAERS: 2 | US FAERS | |
| 176 | Visual Impairment | FAERS: 2 | US FAERS | |
| 177 | Wheezing | FAERS: 2 | US FAERS | |
| 178 | Wrong dose | FAERS: 2 | US FAERS | |
| 179 | diagnostic procedure | FAERS: 2 | US FAERS | |
| 180 | 5-hydroxyindolacetic acid decreased | FAERS: 1 | US FAERS | |
| 181 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 182 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 183 | Abscess | FAERS: 1 | US FAERS | |
| 184 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 185 | Anal abscess | FAERS: 1 | US FAERS | |
| 186 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 187 | Anger | FAERS: 1 | US FAERS | |
| 188 | Arteriovenous fistula occlusion | FAERS: 1 | US FAERS | |
| 189 | Arthropod sting | FAERS: 1 | US FAERS | |
| 190 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 191 | Aversion | FAERS: 1 | US FAERS | |
| 192 | Basophil percentage decreased | FAERS: 1 | US FAERS | |
| 193 | Bedridden | FAERS: 1 | US FAERS | |
| 194 | Biliary Colic | FAERS: 1 | US FAERS | |
| 195 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 196 | Blood bilirubin decreased | FAERS: 1 | US FAERS | |
| 197 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 198 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 199 | Blood gastrin increased | FAERS: 1 | US FAERS | |
| 200 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 201 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 202 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 203 | Bone pain | FAERS: 1 | US FAERS | |
| 204 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 205 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 206 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 207 | Breast tenderness | FAERS: 1 | US FAERS | |
| 208 | Bronchospasm | FAERS: 1 | US FAERS | |
| 209 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 210 | Carcinoid Heart Disease | FAERS: 1 | US FAERS | |
| 211 | Carcinoid crisis | FAERS: 1 | US FAERS | |
| 212 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 213 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 214 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 215 | Cold sweat | FAERS: 1 | US FAERS | |
| 216 | Colitis | FAERS: 1 | US FAERS | |
| 217 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 218 | Contrast media toxicity | FAERS: 1 | US FAERS | |
| 219 | Corneal implant | FAERS: 1 | US FAERS | |
| 220 | Device occlusion | FAERS: 1 | US FAERS | |
| 221 | Disease complication | FAERS: 1 | US FAERS | |
| 222 | Drooling | FAERS: 1 | US FAERS | |
| 223 | Drug administration error | FAERS: 1 | US FAERS | |
| 224 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 225 | Dysuria | FAERS: 1 | US FAERS | |
| 226 | Embolism | FAERS: 1 | US FAERS | |
| 227 | Emergency Care | FAERS: 1 | US FAERS | |
| 228 | Emotional disorder | FAERS: 1 | US FAERS | |
| 229 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 230 | Enteritis | FAERS: 1 | US FAERS | |
| 231 | Eosinophil percentage decreased | FAERS: 1 | US FAERS | |
| 232 | Exposure via father | FAERS: 1 | US FAERS | |
| 233 | Facial paralysis | FAERS: 1 | US FAERS | |
| 234 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 235 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 236 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 237 | Gait inability | FAERS: 1 | US FAERS | |
| 238 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 239 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 240 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 241 | General symptom | FAERS: 1 | US FAERS | |
| 242 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 243 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 244 | Hypokinesia | FAERS: 1 | US FAERS | |
| 245 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 246 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 247 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 248 | Incision site pain | FAERS: 1 | US FAERS | |
| 249 | Incisional hernia | FAERS: 1 | US FAERS | |
| 250 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 251 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 252 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 253 | Infection | FAERS: 1 | US FAERS | |
| 254 | Infectious colitis | FAERS: 1 | US FAERS | |
| 255 | Infusion site infection | FAERS: 1 | US FAERS | |
| 256 | Injection site mass | FAERS: 1 | US FAERS | |
| 257 | Intestinal metastasis | FAERS: 1 | US FAERS | |
| 258 | Intestinal resection | FAERS: 1 | US FAERS | |
| 259 | Joint stiffness | FAERS: 1 | US FAERS | |
| 260 | Keratomileusis | FAERS: 1 | US FAERS | |
| 261 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 262 | Liver Abscess | FAERS: 1 | US FAERS | |
| 263 | Liver ablation | FAERS: 1 | US FAERS | |
| 264 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 265 | Living in residential institution | FAERS: 1 | US FAERS | |
| 266 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 267 | Lung neoplasm surgery | FAERS: 1 | US FAERS | |
| 268 | Lymphatic system neoplasm | FAERS: 1 | US FAERS | |
| 269 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 270 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 271 | Malnutrition | FAERS: 1 | US FAERS | |
| 272 | Mastectomy | FAERS: 1 | US FAERS | |
| 273 | Memory impairment | FAERS: 1 | US FAERS | |
| 274 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 275 | Monocyte percentage decreased | FAERS: 1 | US FAERS | |
| 276 | Mood swings | FAERS: 1 | US FAERS | |
| 277 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 278 | Nocturia | FAERS: 1 | US FAERS | |
| 279 | Obstruction | FAERS: 1 | US FAERS | |
| 280 | Pain of skin | FAERS: 1 | US FAERS | |
| 281 | Palliative Care | FAERS: 1 | US FAERS | |
| 282 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 283 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 284 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 285 | Pneumothorax | FAERS: 1 | US FAERS | |
| 286 | Portal shunt procedure | FAERS: 1 | US FAERS | |
| 287 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 288 | Pregnancy | FAERS: 1 | US FAERS | |
| 289 | Prerenal failure | FAERS: 1 | US FAERS | |
| 290 | Product supply issue | FAERS: 1 | US FAERS | |
| 291 | Product use issue | FAERS: 1 | US FAERS | |
| 292 | Productive Cough | FAERS: 1 | US FAERS | |
| 293 | Protein Deficiency | FAERS: 1 | US FAERS | |
| 294 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 295 | Radiation injury | FAERS: 1 | US FAERS | |
| 296 | Renal Colic | FAERS: 1 | US FAERS | |
| 297 | Retching | FAERS: 1 | US FAERS | |
| 298 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 299 | Secretion discharge | FAERS: 1 | US FAERS | |
| 300 | Sinus headache | FAERS: 1 | US FAERS | |
| 301 | Skin lesion | FAERS: 1 | US FAERS | |
| 302 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 303 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 304 | Splenomegaly | FAERS: 1 | US FAERS | |
| 305 | Spondylitis | FAERS: 1 | US FAERS | |
| 306 | Tachycardia | FAERS: 1 | US FAERS | |
| 307 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 308 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 309 | Throat irritation | FAERS: 1 | US FAERS | |
| 310 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 311 | Toothache | FAERS: 1 | US FAERS | |
| 312 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 313 | Urinary Retention | FAERS: 1 | US FAERS | |
| 314 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 315 | Urine output increased | FAERS: 1 | US FAERS | |
| 316 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 317 | colonoscopy | FAERS: 1 | US FAERS | |
| 318 | jaundice | FAERS: 1 | US FAERS | |
| 319 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 320 | Skin reaction | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.