BMS201038
(MBBCVAKAJPKAKM-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(c1ccccc1c1ccc(cc1)C(F)(F)F)NC1CCN(CC1)CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2c2c1cccc2
- Type(s)
- Approved; Investigational
- ATC code(s)
- C10AX12
- Molecular Formula:
- C39H37F6N3O2
- Molecular Weight:
- 693.720
- Log P:
- 9.1018
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 61.44
- CAS Number(s):
- 182431-12-5
Synonym(s)
1.
BMS201038
2.
AEGR 733
3.
AEGR-733
4.
AEGR733
5.
BMS 201038
6.
BMS-201038
7.
Juxtapid
8.
lomitapide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Weight decreased | FAERS: 355 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 2 | Therapy cessation | FAERS: 242 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 144 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 4 | Product used for unknown indication | FAERS: 97 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Drug dose omission | FAERS: 93 | US FAERS | |
| 6 | Flatulence | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Abdominal discomfort | FAERS: 59 | SIDER US FAERS | |
| 8 | Vomiting | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Inappropriate schedule of drug administration | FAERS: 47 | US FAERS | |
| 10 | Fatigue | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Low density lipoprotein increased | FAERS: 46 | US FAERS | |
| 12 | Malaise | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 13 | Blood cholesterol increased | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Headache | FAERS: 37 | SIDER US FAERS | |
| 15 | Abdominal Pain | FAERS: 35 | SIDER US FAERS | |
| 16 | Constipation | FAERS: 33 | SIDER US FAERS | |
| 17 | Dizziness | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Nasopharyngitis | FAERS: 26 | SIDER US FAERS | |
| 20 | Asthenia | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 21 | Back Pain | FAERS: 24 | SIDER US FAERS | |
| 22 | Chest Pain | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 23 | Influenza | FAERS: 23 | SIDER US FAERS | |
| 24 | Alanine Aminotransferase Increased | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Dyspepsia | FAERS: 19 | SIDER US FAERS | |
| 26 | Arthralgia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Drug administered to patient of inappropriate age | FAERS: 15 | US FAERS | |
| 28 | Drug ineffective | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Gastrointestinal sounds abnormal | FAERS: 15 | US FAERS | |
| 30 | Sinusitis | FAERS: 15 | SIDER US FAERS | |
| 31 | Myalgia | FAERS: 13 | SIDER US FAERS | |
| 32 | Aspartate Aminotransferase Increased | FAERS: 12 | SIDER US FAERS | |
| 33 | Myocardial Infarction | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Urinary tract infection | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Palpitations | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 37 | Bronchitis | FAERS: 8 | US FAERS | |
| 38 | Pneumonia | FAERS: 8 | US FAERS | |
| 39 | Dehydration | FAERS: 7 | SIDER US FAERS | |
| 40 | Vertigo | FAERS: 7 | SIDER US FAERS | |
| 41 | Arthritis | FAERS: 6 | US FAERS | |
| 42 | Atrial Fibrillation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Blood triglycerides increased | FAERS: 6 | US FAERS | |
| 44 | Chills | FAERS: 6 | SIDER US FAERS | |
| 45 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 46 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 47 | Pruritus | FAERS: 6 | US FAERS | |
| 48 | Somnolence | FAERS: 6 | SIDER US FAERS | |
| 49 | Alopecia | FAERS: 5 | US FAERS | |
| 50 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 51 | Depressed mood | FAERS: 5 | US FAERS | |
| 52 | Dry skin | FAERS: 5 | SIDER US FAERS | |
| 53 | Dysgeusia | FAERS: 5 | US FAERS | |
| 54 | Eructation | FAERS: 5 | SIDER US FAERS | |
| 55 | Feeling abnormal | FAERS: 5 | SIDER US FAERS | |
| 56 | Middle insomnia | FAERS: 5 | US FAERS | |
| 57 | Nocturia | FAERS: 5 | US FAERS | |
| 58 | Arthropathy | FAERS: 4 | US FAERS | |
| 59 | Blood creatine phosphokinase increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 61 | Burning sensation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Cellulitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Chromaturia | FAERS: 4 | US FAERS | |
| 64 | Erythema | FAERS: 4 | US FAERS | |
| 65 | Gastrointestinal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 66 | Gout | FAERS: 4 | US FAERS | |
| 67 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 68 | Joint injury | FAERS: 4 | US FAERS | |
| 69 | Musculoskeletal discomfort | FAERS: 4 | SIDER US FAERS | |
| 70 | Neck Pain | FAERS: 4 | US FAERS | |
| 71 | Pancreatitis | FAERS: 4 | US FAERS | |
| 72 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 73 | Toothache | FAERS: 4 | US FAERS | |
| 74 | Angina Pectoris | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 75 | Anxiety | FAERS: 3 | US FAERS | |
| 76 | Back disorder | FAERS: 3 | US FAERS | |
| 77 | Bone pain | FAERS: 3 | US FAERS | |
| 78 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 79 | Cataract | FAERS: 3 | US FAERS | |
| 80 | Chest discomfort | FAERS: 3 | US FAERS | |
| 81 | Drug administration error | FAERS: 3 | US FAERS | |
| 82 | Food Poisoning | FAERS: 3 | US FAERS | |
| 83 | Hernia | FAERS: 3 | US FAERS | |
| 84 | Hunger | FAERS: 3 | US FAERS | |
| 85 | Hypersomnia | FAERS: 3 | US FAERS | |
| 86 | Hypophagia | FAERS: 3 | US FAERS | |
| 87 | Hypotension | FAERS: 3 | US FAERS | |
| 88 | Incision site pain | FAERS: 3 | US FAERS | |
| 89 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 90 | Joint swelling | FAERS: 3 | SIDER US FAERS | |
| 91 | Limb injury | FAERS: 3 | US FAERS | |
| 92 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 93 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 94 | Neurostimulator implantation | FAERS: 3 | US FAERS | |
| 95 | No adverse event | FAERS: 3 | US FAERS | |
| 96 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 97 | Stress | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Throat irritation | FAERS: 3 | US FAERS | |
| 99 | Trigeminal Neuralgia | FAERS: 3 | US FAERS | |
| 100 | Urticaria | FAERS: 3 | US FAERS | |
| 101 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 102 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 103 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 104 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 105 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 106 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 107 | Epistaxis | FAERS: 2 | US FAERS | |
| 108 | Exposure via father | FAERS: 2 | US FAERS | |
| 109 | Eye Infection | FAERS: 2 | US FAERS | |
| 110 | Eye pain | FAERS: 2 | US FAERS | |
| 111 | Feeling Cold | FAERS: 2 | US FAERS | |
| 112 | Flank Pain | FAERS: 2 | US FAERS | |
| 113 | Head discomfort | FAERS: 2 | US FAERS | |
| 114 | High density lipoprotein increased | FAERS: 2 | US FAERS | |
| 115 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 116 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 117 | Infection | FAERS: 2 | SIDER US FAERS | |
| 118 | Inflammation | FAERS: 2 | US FAERS | |
| 119 | Initial insomnia | FAERS: 2 | US FAERS | |
| 120 | Intervertebral disc compression | FAERS: 2 | US FAERS | |
| 121 | Joint stiffness | FAERS: 2 | US FAERS | |
| 122 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 123 | Lethargy | FAERS: 2 | US FAERS | |
| 124 | Ligament rupture | FAERS: 2 | US FAERS | |
| 125 | Lipids abnormal | FAERS: 2 | US FAERS | |
| 126 | Low density lipoprotein abnormal | FAERS: 2 | US FAERS | |
| 127 | Muscle tightness | FAERS: 2 | US FAERS | |
| 128 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 129 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 130 | Presyncope | FAERS: 2 | US FAERS | |
| 131 | Product use issue | FAERS: 2 | US FAERS | |
| 132 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 133 | Sinus headache | FAERS: 2 | US FAERS | |
| 134 | Swelling | FAERS: 2 | US FAERS | |
| 135 | Syncope | FAERS: 2 | US FAERS | |
| 136 | Tension Headache | FAERS: 2 | US FAERS | |
| 137 | Tinnitus | FAERS: 2 | US FAERS | |
| 138 | Xanthoma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 139 | Abasia | FAERS: 1 | US FAERS | |
| 140 | Abdominal tenderness | FAERS: 1 | SIDER US FAERS | |
| 141 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 142 | Adverse event | FAERS: 1 | US FAERS | |
| 143 | Agitation | FAERS: 1 | US FAERS | |
| 144 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 145 | Amnesia | FAERS: 1 | US FAERS | |
| 146 | Aneurysm | FAERS: 1 | US FAERS | |
| 147 | Anorectal discomfort | FAERS: 1 | SIDER US FAERS | |
| 148 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 149 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 150 | Aphonia | FAERS: 1 | US FAERS | |
| 151 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 152 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 153 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 154 | Bile output increased | FAERS: 1 | US FAERS | |
| 155 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 156 | Blindness | FAERS: 1 | US FAERS | |
| 157 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 158 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 159 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 160 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 161 | Blood potassium decreased | FAERS: 1 | SIDER US FAERS | |
| 162 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 163 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 164 | Blood urine present | FAERS: 1 | US FAERS | |
| 165 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 166 | Brucellosis | FAERS: 1 | US FAERS | |
| 167 | Calcinosis | FAERS: 1 | US FAERS | |
| 168 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 169 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 170 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 171 | Colitis | FAERS: 1 | US FAERS | |
| 172 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 173 | Cystitis | FAERS: 1 | US FAERS | |
| 174 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 175 | Depressed Level of Consciousness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Device occlusion | FAERS: 1 | US FAERS | |
| 177 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 178 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 179 | Diplopia | FAERS: 1 | US FAERS | |
| 180 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 181 | Diverticulitis | FAERS: 1 | US FAERS | |
| 182 | Dysarthria | FAERS: 1 | US FAERS | |
| 183 | Dysuria | FAERS: 1 | US FAERS | |
| 184 | Escherichia urinary tract infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 186 | Feeling jittery | FAERS: 1 | US FAERS | |
| 187 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 188 | Food Allergy | FAERS: 1 | US FAERS | |
| 189 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 190 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 191 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 192 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 193 | Gastroenteritis | FAERS: 1 | SIDER US FAERS | |
| 194 | Gastrointestinal disorder postoperative | FAERS: 1 | US FAERS | |
| 195 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 196 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 197 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 198 | General symptom | FAERS: 1 | US FAERS | |
| 199 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 200 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 201 | Grief reaction | FAERS: 1 | US FAERS | |
| 202 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 203 | Hostility | FAERS: 1 | US FAERS | |
| 204 | Ileus | FAERS: 1 | US FAERS | |
| 205 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 206 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 207 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 208 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 209 | Laceration | FAERS: 1 | US FAERS | |
| 210 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 211 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 212 | Limb discomfort | FAERS: 1 | US FAERS | |
| 213 | Lip swelling | FAERS: 1 | US FAERS | |
| 214 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 215 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 216 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 217 | Memory impairment | FAERS: 1 | US FAERS | |
| 218 | Mesenteric arterial occlusion | FAERS: 1 | US FAERS | |
| 219 | Metabolic function test abnormal | FAERS: 1 | US FAERS | |
| 220 | Muscle strain | FAERS: 1 | US FAERS | |
| 221 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 222 | Nervousness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Neuralgia | FAERS: 1 | US FAERS | |
| 224 | Night sweats | FAERS: 1 | US FAERS | |
| 225 | Obesity | FAERS: 1 | US FAERS | |
| 226 | Ocular icterus | FAERS: 1 | US FAERS | |
| 227 | Onychoclasis | FAERS: 1 | US FAERS | |
| 228 | Ophthalmoplegic Migraine | FAERS: 1 | US FAERS | |
| 229 | Oral infection | FAERS: 1 | US FAERS | |
| 230 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 231 | Osteoporosis | FAERS: 1 | US FAERS | |
| 232 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 233 | Paratyphoid Fever | FAERS: 1 | US FAERS | |
| 234 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 235 | Post procedural complication | FAERS: 1 | US FAERS | |
| 236 | Post-tussive vomiting | FAERS: 1 | US FAERS | |
| 237 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 238 | Product selection error | FAERS: 1 | US FAERS | |
| 239 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 240 | Renal cyst | FAERS: 1 | US FAERS | |
| 241 | Renal pain | FAERS: 1 | US FAERS | |
| 242 | Respiratory distress | FAERS: 1 | US FAERS | |
| 243 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 244 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 245 | Skin lesion | FAERS: 1 | US FAERS | |
| 246 | Stomatitis | FAERS: 1 | US FAERS | |
| 247 | Tachycardia | FAERS: 1 | US FAERS | |
| 248 | Terminal state | FAERS: 1 | US FAERS | |
| 249 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 250 | Thrombosis | FAERS: 1 | US FAERS | |
| 251 | Transaminases increased | FAERS: 1 | SIDER US FAERS | |
| 252 | Tremor | FAERS: 1 | US FAERS | |
| 253 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 254 | Unevaluable event | FAERS: 1 | US FAERS | |
| 255 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 256 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 257 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 258 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 259 | Visual Impairment | FAERS: 1 | US FAERS | |
| 260 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 261 | furuncle | FAERS: 1 | US FAERS | |
| 262 | Blood alkaline phosphatase increased | SIDER | ||
| 263 | Blood and lymphatic system disorders | SIDER | ||
| 264 | Ear and labyrinth disorders | SIDER | ||
| 265 | Early satiety | SIDER | ||
| 266 | Ecchymosis | SIDER | ||
| 267 | Epigastric discomfort | SIDER | ||
| 268 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 269 | Gastric Dilatation | SIDER | ||
| 270 | Gastrointestinal infection | SIDER | ||
| 271 | Hepatomegaly | SIDER | ||
| 272 | Hepatotoxicity | SIDER | ||
| 273 | Infestation | SIDER | ||
| 274 | Malnutrition | SIDER | ||
| 275 | Neutrophil count decreased | SIDER | ||
| 276 | Neutrophil percentage increased | SIDER | ||
| 277 | Papule | SIDER | ||
| 278 | Pharyngeal lesion | SIDER | ||
| 279 | Pharyngolaryngeal Pain | SIDER | ||
| 280 | Product dose omission | Canada Vigilance: 4 | Canada Vigilance | |
| 281 | Rash erythematous | SIDER | ||
| 282 | Reaction gastrointestinal | SIDER | ||
| 283 | Rectal tenesmus | SIDER | ||
| 284 | Regurgitation | SIDER | ||
| 285 | Stomach dilation procedure | SIDER | ||
| 286 | Upper-airway cough syndrome | SIDER | ||
| 287 | Vascular stent occlusion | Canada Vigilance: 1 | Canada Vigilance | |
| 288 | White blood cell count decreased | SIDER | ||
| 289 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.