Advil PM
(LQUQNXNHAIYHIS-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)C(CC(=O)O)(CC(=O)O)O.CC(Cc1ccc(cc1)C(C(=O)O)C)C.CN(CCOC(c1ccccc1)c1ccccc1)C
- Molecular Formula:
- C36H47NO10
- Molecular Weight:
- 653.759
- Log P:
- 5.1789
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 5
- TPSA:
- 181.9
- CAS Number(s):
- 1357928-54-1
Synonym(s)
1.
Advil PM
External Link(s)
| PubChem Compound | 24848049 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 770 | US FAERS | |
| 2 | Somnolence | FAERS: 233 | US FAERS | |
| 3 | Feeling abnormal | FAERS: 132 | US FAERS | |
| 4 | Drug effect incomplete | FAERS: 88 | US FAERS | |
| 5 | Dizziness | FAERS: 81 | US FAERS | |
| 6 | Overdose | FAERS: 79 | US FAERS | |
| 7 | Intentional product misuse | FAERS: 77 | US FAERS | |
| 8 | Fatigue | FAERS: 64 | US FAERS | |
| 9 | Malaise | FAERS: 60 | US FAERS | |
| 10 | Headache | FAERS: 53 | US FAERS | |
| 11 | Restlessness | FAERS: 46 | US FAERS | |
| 12 | Nausea | FAERS: 40 | US FAERS | |
| 13 | Poor quality sleep | FAERS: 39 | US FAERS | |
| 14 | Abdominal discomfort | FAERS: 32 | US FAERS | |
| 15 | Feeling jittery | FAERS: 32 | US FAERS | |
| 16 | Restless Legs Syndrome | FAERS: 31 | US FAERS | |
| 17 | Intentional product use issue | FAERS: 30 | US FAERS | |
| 18 | Pain | FAERS: 30 | US FAERS | |
| 19 | Product use issue | FAERS: 30 | US FAERS | |
| 20 | Vomiting | FAERS: 29 | US FAERS | |
| 21 | Drug effect delayed | FAERS: 27 | US FAERS | |
| 22 | Poor quality drug administered | FAERS: 25 | US FAERS | |
| 23 | Product size issue | FAERS: 25 | US FAERS | |
| 24 | Middle insomnia | FAERS: 24 | US FAERS | |
| 25 | Wrong drug administered | FAERS: 24 | US FAERS | |
| 26 | Choking | FAERS: 23 | US FAERS | |
| 27 | Product physical issue | FAERS: 22 | US FAERS | |
| 28 | Product difficult to swallow | FAERS: 21 | US FAERS | |
| 29 | Product quality issue | FAERS: 21 | US FAERS | |
| 30 | Tremor | FAERS: 20 | US FAERS | |
| 31 | Nervousness | FAERS: 19 | US FAERS | |
| 32 | Throat irritation | FAERS: 19 | US FAERS | |
| 33 | Accidental overdose | FAERS: 18 | US FAERS | |
| 34 | Expired product administered | FAERS: 18 | US FAERS | |
| 35 | Product use complaint | FAERS: 18 | US FAERS | |
| 36 | Urticaria | FAERS: 17 | US FAERS | |
| 37 | Agitation | FAERS: 16 | US FAERS | |
| 38 | Anxiety | FAERS: 16 | US FAERS | |
| 39 | Drug Dependence | FAERS: 16 | US FAERS | |
| 40 | Incorrect dose administered | FAERS: 16 | US FAERS | |
| 41 | Palpitations | FAERS: 16 | US FAERS | |
| 42 | Pre-existing condition improved | FAERS: 16 | US FAERS | |
| 43 | Product taste abnormal | FAERS: 16 | US FAERS | |
| 44 | Pruritus | FAERS: 16 | US FAERS | |
| 45 | Therapeutic response unexpected | FAERS: 16 | US FAERS | |
| 46 | Foreign body in respiratory tract | FAERS: 15 | US FAERS | |
| 47 | Tinnitus | FAERS: 15 | US FAERS | |
| 48 | Drug ineffective for unapproved indication | FAERS: 14 | US FAERS | |
| 49 | Dysgeusia | FAERS: 14 | US FAERS | |
| 50 | Hypersensitivity | FAERS: 14 | US FAERS | |
| 51 | Drug screen positive | FAERS: 13 | US FAERS | |
| 52 | Dyspepsia | FAERS: 13 | US FAERS | |
| 53 | Hypersomnia | FAERS: 13 | US FAERS | |
| 54 | Product shape issue | FAERS: 13 | US FAERS | |
| 55 | Asthenia | FAERS: 11 | US FAERS | |
| 56 | Back Pain | FAERS: 11 | US FAERS | |
| 57 | Chest Pain | FAERS: 11 | US FAERS | |
| 58 | Constipation | FAERS: 10 | US FAERS | |
| 59 | Erythema | FAERS: 10 | US FAERS | |
| 60 | Suicide attempt | FAERS: 10 | US FAERS | |
| 61 | Discomfort | FAERS: 9 | US FAERS | |
| 62 | Drug screen false positive | FAERS: 9 | US FAERS | |
| 63 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 64 | Visual Impairment | FAERS: 9 | US FAERS | |
| 65 | Head discomfort | FAERS: 8 | US FAERS | |
| 66 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 67 | Memory impairment | FAERS: 8 | US FAERS | |
| 68 | Retching | FAERS: 8 | US FAERS | |
| 69 | Myocardial Infarction | FAERS: 7 | US FAERS | |
| 70 | Night sweats | FAERS: 7 | US FAERS | |
| 71 | Product label issue | FAERS: 7 | US FAERS | |
| 72 | Vertigo | FAERS: 7 | US FAERS | |
| 73 | Accidental exposure to product by child | FAERS: 6 | US FAERS | |
| 74 | Arthralgia | FAERS: 6 | US FAERS | |
| 75 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 76 | Dysuria | FAERS: 6 | US FAERS | |
| 77 | Extra dose administered | FAERS: 6 | US FAERS | |
| 78 | Intentional drug misuse | FAERS: 6 | US FAERS | |
| 79 | Sluggishness | FAERS: 6 | US FAERS | |
| 80 | Stress | FAERS: 6 | US FAERS | |
| 81 | Choking sensation | FAERS: 5 | US FAERS | |
| 82 | Dependence | FAERS: 5 | US FAERS | |
| 83 | Dysarthria | FAERS: 5 | US FAERS | |
| 84 | Expired drug administered | FAERS: 5 | US FAERS | |
| 85 | Formication | FAERS: 5 | US FAERS | |
| 86 | Lip swelling | FAERS: 5 | US FAERS | |
| 87 | Product label confusion | FAERS: 5 | US FAERS | |
| 88 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 89 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 90 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 91 | Amnesia | FAERS: 4 | US FAERS | |
| 92 | Burning sensation | FAERS: 4 | US FAERS | |
| 93 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 94 | Chest discomfort | FAERS: 4 | US FAERS | |
| 95 | Disorientation | FAERS: 4 | US FAERS | |
| 96 | Drug Tolerance | FAERS: 4 | US FAERS | |
| 97 | Epistaxis | FAERS: 4 | US FAERS | |
| 98 | Hypervigilance | FAERS: 4 | US FAERS | |
| 99 | Joint swelling | FAERS: 4 | US FAERS | |
| 100 | Lethargy | FAERS: 4 | US FAERS | |
| 101 | Limb discomfort | FAERS: 4 | US FAERS | |
| 102 | Sleep Talking | FAERS: 4 | US FAERS | |
| 103 | Somnambulism | FAERS: 4 | US FAERS | |
| 104 | Thirst | FAERS: 4 | US FAERS | |
| 105 | Ulcer | FAERS: 4 | US FAERS | |
| 106 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 107 | Asthenopia | FAERS: 3 | US FAERS | |
| 108 | Blood urine present | FAERS: 3 | US FAERS | |
| 109 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 110 | Cystitis | FAERS: 3 | US FAERS | |
| 111 | Euphoric mood | FAERS: 3 | US FAERS | |
| 112 | Flatulence | FAERS: 3 | US FAERS | |
| 113 | Gastritis | FAERS: 3 | US FAERS | |
| 114 | Hypokinesia | FAERS: 3 | US FAERS | |
| 115 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 116 | Inflammation | FAERS: 3 | US FAERS | |
| 117 | Laziness | FAERS: 3 | US FAERS | |
| 118 | No adverse event | FAERS: 3 | US FAERS | |
| 119 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 120 | Physical product label issue | FAERS: 3 | US FAERS | |
| 121 | Polyuria | FAERS: 3 | US FAERS | |
| 122 | Poor quality product administered | FAERS: 3 | US FAERS | |
| 123 | Product commingling | FAERS: 3 | US FAERS | |
| 124 | Product contamination physical | FAERS: 3 | US FAERS | |
| 125 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 126 | Product selection error | FAERS: 3 | US FAERS | |
| 127 | Rash erythematous | FAERS: 3 | US FAERS | |
| 128 | Swelling | FAERS: 3 | US FAERS | |
| 129 | Syncope | FAERS: 3 | US FAERS | |
| 130 | Tension | FAERS: 3 | US FAERS | |
| 131 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 132 | Accidental exposure | FAERS: 2 | US FAERS | |
| 133 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 134 | Amphetamines positive | FAERS: 2 | US FAERS | |
| 135 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 136 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 137 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 138 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 139 | Chills | FAERS: 2 | US FAERS | |
| 140 | Deafness | FAERS: 2 | US FAERS | |
| 141 | Dementia | FAERS: 2 | US FAERS | |
| 142 | Depressed mood | FAERS: 2 | US FAERS | |
| 143 | Diplopia | FAERS: 2 | US FAERS | |
| 144 | Disease recurrence | FAERS: 2 | US FAERS | |
| 145 | Drug abuse | FAERS: 2 | US FAERS | |
| 146 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 147 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 148 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 149 | False positive investigation result | FAERS: 2 | US FAERS | |
| 150 | Feeling Cold | FAERS: 2 | US FAERS | |
| 151 | Hypotension | FAERS: 2 | US FAERS | |
| 152 | Influenza | FAERS: 2 | US FAERS | |
| 153 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 154 | Myalgia | FAERS: 2 | US FAERS | |
| 155 | Oral pain | FAERS: 2 | US FAERS | |
| 156 | Product complaint | FAERS: 2 | US FAERS | |
| 157 | Product contamination | FAERS: 2 | US FAERS | |
| 158 | Product formulation issue | FAERS: 2 | US FAERS | |
| 159 | Product package associated injury | FAERS: 2 | US FAERS | |
| 160 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 161 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 162 | Renal pain | FAERS: 2 | US FAERS | |
| 163 | Rosacea | FAERS: 2 | US FAERS | |
| 164 | Sepsis | FAERS: 2 | US FAERS | |
| 165 | Sneezing | FAERS: 2 | US FAERS | |
| 166 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 167 | Tardive Dyskinesia | FAERS: 2 | US FAERS | |
| 168 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 169 | Unevaluable event | FAERS: 2 | US FAERS | |
| 170 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 171 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 172 | Acne | FAERS: 1 | US FAERS | |
| 173 | Adverse event | FAERS: 1 | US FAERS | |
| 174 | Alopecia | FAERS: 1 | US FAERS | |
| 175 | Aneurysm | FAERS: 1 | US FAERS | |
| 176 | Anger | FAERS: 1 | US FAERS | |
| 177 | Aphagia | FAERS: 1 | US FAERS | |
| 178 | Aphonia | FAERS: 1 | US FAERS | |
| 179 | Apparent death | FAERS: 1 | US FAERS | |
| 180 | Arthritis | FAERS: 1 | US FAERS | |
| 181 | Arthropathy | FAERS: 1 | US FAERS | |
| 182 | Asthma | FAERS: 1 | US FAERS | |
| 183 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 184 | Auricular swelling | FAERS: 1 | US FAERS | |
| 185 | Blood alcohol abnormal | FAERS: 1 | US FAERS | |
| 186 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 187 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 188 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 189 | Capsule issue | FAERS: 1 | US FAERS | |
| 190 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 191 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 192 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 193 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 194 | Cheilitis | FAERS: 1 | US FAERS | |
| 195 | Cold sweat | FAERS: 1 | US FAERS | |
| 196 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 197 | Deformity | FAERS: 1 | US FAERS | |
| 198 | Dehydration | FAERS: 1 | US FAERS | |
| 199 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 200 | Dermatitis | FAERS: 1 | US FAERS | |
| 201 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 202 | Drug abuser | FAERS: 1 | US FAERS | |
| 203 | Drug administration error | FAERS: 1 | US FAERS | |
| 204 | Drug dose omission | FAERS: 1 | US FAERS | |
| 205 | Drug label confusion | FAERS: 1 | US FAERS | |
| 206 | Dry skin | FAERS: 1 | US FAERS | |
| 207 | Emotional distress | FAERS: 1 | US FAERS | |
| 208 | Encephalitis | FAERS: 1 | US FAERS | |
| 209 | Eye pain | FAERS: 1 | US FAERS | |
| 210 | Flushing | FAERS: 1 | US FAERS | |
| 211 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 212 | Frustration | FAERS: 1 | US FAERS | |
| 213 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 214 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 215 | Gingival blister | FAERS: 1 | US FAERS | |
| 216 | Global Amnesia | FAERS: 1 | US FAERS | |
| 217 | Hordeolum | FAERS: 1 | US FAERS | |
| 218 | Hunger | FAERS: 1 | US FAERS | |
| 219 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 220 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 221 | Initial insomnia | FAERS: 1 | US FAERS | |
| 222 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 223 | Laryngitis | FAERS: 1 | US FAERS | |
| 224 | Malabsorption | FAERS: 1 | US FAERS | |
| 225 | Medication Error | FAERS: 1 | US FAERS | |
| 226 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 227 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 228 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 229 | Muscle tightness | FAERS: 1 | US FAERS | |
| 230 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 231 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 232 | Nocturia | FAERS: 1 | US FAERS | |
| 233 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 234 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 235 | Ocular surface disease | FAERS: 1 | US FAERS | |
| 236 | Opiates positive | FAERS: 1 | US FAERS | |
| 237 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 238 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 239 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 240 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 241 | Paranoia | FAERS: 1 | US FAERS | |
| 242 | Personality Change | FAERS: 1 | US FAERS | |
| 243 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 244 | Presyncope | FAERS: 1 | US FAERS | |
| 245 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 246 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 247 | Product coating issue | FAERS: 1 | US FAERS | |
| 248 | Product container seal issue | FAERS: 1 | US FAERS | |
| 249 | Product name confusion | FAERS: 1 | US FAERS | |
| 250 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 251 | Product storage error | FAERS: 1 | US FAERS | |
| 252 | Purulent discharge | FAERS: 1 | US FAERS | |
| 253 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 254 | Screaming | FAERS: 1 | US FAERS | |
| 255 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 256 | Shock | FAERS: 1 | US FAERS | |
| 257 | Sinus headache | FAERS: 1 | US FAERS | |
| 258 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 259 | Skin lesion | FAERS: 1 | US FAERS | |
| 260 | Skin tightness | FAERS: 1 | US FAERS | |
| 261 | Snoring | FAERS: 1 | US FAERS | |
| 262 | Stomatitis | FAERS: 1 | US FAERS | |
| 263 | Stupor | FAERS: 1 | US FAERS | |
| 264 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 265 | Time perception altered | FAERS: 1 | US FAERS | |
| 266 | Tongue blistering | FAERS: 1 | US FAERS | |
| 267 | Toothache | FAERS: 1 | US FAERS | |
| 268 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 269 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 270 | Urinary Retention | FAERS: 1 | US FAERS | |
| 271 | Weight decreased | FAERS: 1 | US FAERS | |
| 272 | Wheezing | FAERS: 1 | US FAERS | |
| 273 | Wrong dose | FAERS: 1 | US FAERS | |
| 274 | nervous system disorder | FAERS: 1 | US FAERS | |
| 275 | prostatitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.