N-(3-amino-1-(cyclobutylmethyl)-2,3-dioxopropyl)-3-(2-((((1,1-dimethylethyl)amino)carbonyl)amino)-3,3-dimethyl-1-oxobutyl)-6,6-dimethyl-3-azabicyclo(3.1.0)hexan-2-carboxamide
(LHHCSNFAOIFYRV-DOVBMPENSA-N)
Structure
- SMILES
- O=C(NC(C)(C)C)N[C@@H](C(C)(C)C)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C(=O)C(=O)N)CC1CCC1)C2(C)C
- Type(s)
- Approved; Withdrawn
- ATC code(s)
- J05AP03
- Molecular Formula:
- C27H45N5O5
- Molecular Weight:
- 519.677
- Log P:
- 3.5221
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 150.7
- CAS Number(s):
- 394730-60-0
Synonym(s)
1.
N-(3-amino-1-(cyclobutylmethyl)-2,3-dioxopropyl)-3-(2-((((1,1-dimethylethyl)amino)carbonyl)amino)-3,3-dimethyl-1-oxobutyl)-6,6-dimethyl-3-azabicyclo(3.1.0)hexan-2-carboxamide
2.
Sch 503034
3.
Sch-503034
4.
Sch503034
5.
boceprevir
6.
victrelis
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 73 | SIDER US FAERS | |
| 2 | Dysgeusia | FAERS: 67 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 49 | SIDER US FAERS | |
| 4 | Vomiting | FAERS: 42 | SIDER US FAERS | |
| 5 | No adverse event | FAERS: 36 | US FAERS | |
| 6 | Pruritus | FAERS: 32 | SIDER US FAERS | |
| 7 | Weight decreased | FAERS: 32 | SIDER US FAERS | |
| 8 | Urticaria | FAERS: 27 | SIDER US FAERS | |
| 9 | Headache | FAERS: 26 | SIDER US FAERS | |
| 10 | Adverse event | FAERS: 21 | US FAERS | |
| 11 | Asthenia | FAERS: 18 | SIDER US FAERS | |
| 12 | Dry skin | FAERS: 17 | SIDER US FAERS | |
| 13 | Product quality issue | FAERS: 15 | US FAERS | |
| 14 | Dizziness | FAERS: 14 | SIDER US FAERS | |
| 15 | Pneumonia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Leukopenia | FAERS: 12 | SIDER US FAERS | |
| 17 | Malaise | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Neutropenia | FAERS: 12 | SIDER US FAERS | |
| 19 | Agitation | FAERS: 11 | SIDER US FAERS | |
| 20 | Drug dose omission | FAERS: 11 | US FAERS | |
| 21 | Thrombocytopenia | FAERS: 11 | SIDER US FAERS | |
| 22 | White blood cell count decreased | FAERS: 11 | US FAERS | |
| 23 | Drug ineffective | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 24 | Inappropriate schedule of drug administration | FAERS: 10 | US FAERS | |
| 25 | Anxiety | FAERS: 8 | SIDER US FAERS | |
| 26 | Incorrect storage of drug | FAERS: 8 | US FAERS | |
| 27 | Pain | FAERS: 8 | SIDER US FAERS | |
| 28 | Back Pain | FAERS: 7 | SIDER US FAERS | |
| 29 | Drug administration error | FAERS: 7 | US FAERS | |
| 30 | Mood swings | FAERS: 7 | SIDER US FAERS | |
| 31 | Syncope | FAERS: 7 | SIDER US FAERS | |
| 32 | Chills | FAERS: 6 | SIDER US FAERS | |
| 33 | Dyspepsia | FAERS: 6 | SIDER US FAERS | |
| 34 | Memory impairment | FAERS: 6 | SIDER US FAERS | |
| 35 | Mental status changes | FAERS: 6 | SIDER US FAERS | |
| 36 | Pancytopenia | FAERS: 6 | SIDER US FAERS | |
| 37 | Stomatitis | FAERS: 6 | SIDER US FAERS | |
| 38 | treatment failure | FAERS: 6 | US FAERS | |
| 39 | Alopecia | FAERS: 5 | SIDER US FAERS | |
| 40 | Capsule physical issue | FAERS: 5 | US FAERS | |
| 41 | Constipation | FAERS: 5 | SIDER US FAERS | |
| 42 | Hepatitis C | FAERS: 5 | US FAERS | |
| 43 | Myalgia | FAERS: 5 | SIDER US FAERS | |
| 44 | Urinary tract infection | FAERS: 5 | SIDER US FAERS | |
| 45 | Visual Impairment | FAERS: 5 | SIDER US FAERS | |
| 46 | Abdominal Pain | FAERS: 4 | SIDER US FAERS | |
| 47 | Aphagia | FAERS: 4 | US FAERS | |
| 48 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 49 | Chest Pain | FAERS: 4 | SIDER US FAERS | |
| 50 | Chest discomfort | FAERS: 4 | SIDER US FAERS | |
| 51 | Dehydration | FAERS: 4 | SIDER US FAERS | |
| 52 | Dysuria | FAERS: 4 | SIDER US FAERS | |
| 53 | Feeling abnormal | FAERS: 4 | SIDER US FAERS | |
| 54 | Gastroenteritis | FAERS: 4 | SIDER US FAERS | |
| 55 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 56 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 57 | Product physical issue | FAERS: 4 | US FAERS | |
| 58 | Pulmonary Embolism | FAERS: 4 | SIDER US FAERS | |
| 59 | Retching | FAERS: 4 | US FAERS | |
| 60 | Viral load increased | FAERS: 4 | US FAERS | |
| 61 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 62 | Abdominal discomfort | FAERS: 3 | SIDER US FAERS | |
| 63 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 64 | Amnesia | FAERS: 3 | SIDER US FAERS | |
| 65 | Cellulitis | FAERS: 3 | SIDER US FAERS | |
| 66 | Erythema Multiforme | FAERS: 3 | SIDER US FAERS | |
| 67 | Flushing | FAERS: 3 | SIDER US FAERS | |
| 68 | Hypersensitivity | FAERS: 3 | SIDER US FAERS | |
| 69 | Limb discomfort | FAERS: 3 | US FAERS | |
| 70 | Nervousness | FAERS: 3 | US FAERS | |
| 71 | Nocturia | FAERS: 3 | SIDER US FAERS | |
| 72 | Oropharyngeal pain | FAERS: 3 | SIDER US FAERS | |
| 73 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 74 | Regurgitation | FAERS: 3 | US FAERS | |
| 75 | Sepsis | FAERS: 3 | SIDER US FAERS | |
| 76 | Somnolence | FAERS: 3 | US FAERS | |
| 77 | Thirst | FAERS: 3 | US FAERS | |
| 78 | Accidental overdose | FAERS: 2 | US FAERS | |
| 79 | Anger | FAERS: 2 | SIDER US FAERS | |
| 80 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 81 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 82 | Ascites | FAERS: 2 | US FAERS | |
| 83 | Blindness | FAERS: 2 | US FAERS | |
| 84 | Blood count abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 86 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 87 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 88 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 89 | Blood urea increased | FAERS: 2 | US FAERS | |
| 90 | Bronchitis | FAERS: 2 | SIDER US FAERS | |
| 91 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 92 | Choking | FAERS: 2 | US FAERS | |
| 93 | Disease recurrence | FAERS: 2 | US FAERS | |
| 94 | Erythema | FAERS: 2 | SIDER US FAERS | |
| 95 | Eye Infection | FAERS: 2 | US FAERS | |
| 96 | Formication | FAERS: 2 | US FAERS | |
| 97 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 98 | Gingival Hyperplasia | FAERS: 2 | US FAERS | |
| 99 | Hypotension | FAERS: 2 | SIDER US FAERS | |
| 100 | Infection | FAERS: 2 | SIDER US FAERS | |
| 101 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 102 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 103 | Lip swelling | FAERS: 2 | US FAERS | |
| 104 | Lymphopenia | FAERS: 2 | SIDER US FAERS | |
| 105 | Myocardial Infarction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 107 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 108 | Oral pain | FAERS: 2 | SIDER US FAERS | |
| 109 | Overdose | FAERS: 2 | US FAERS | |
| 110 | Pallor | FAERS: 2 | SIDER US FAERS | |
| 111 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 112 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 113 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 114 | Rash erythematous | FAERS: 2 | SIDER US FAERS | |
| 115 | Renal pain | FAERS: 2 | US FAERS | |
| 116 | Sinusitis | FAERS: 2 | SIDER US FAERS | |
| 117 | Spinal column injury | FAERS: 2 | US FAERS | |
| 118 | Stress | FAERS: 2 | US FAERS | |
| 119 | Swelling | FAERS: 2 | US FAERS | |
| 120 | Toothache | FAERS: 2 | US FAERS | |
| 121 | Toxicologic test abnormal | FAERS: 2 | US FAERS | |
| 122 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 123 | Abscess | FAERS: 1 | US FAERS | |
| 124 | Ageusia | FAERS: 1 | US FAERS | |
| 125 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 126 | Ammonia increased | FAERS: 1 | US FAERS | |
| 127 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 128 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 129 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 130 | Arthralgia | FAERS: 1 | SIDER US FAERS | |
| 131 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 132 | Atrial Fibrillation | FAERS: 1 | SIDER US FAERS | |
| 133 | Bedridden | FAERS: 1 | US FAERS | |
| 134 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 135 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 136 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 137 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 138 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 139 | Cataract operation | FAERS: 1 | US FAERS | |
| 140 | Cataract | FAERS: 1 | US FAERS | |
| 141 | Cheilitis | FAERS: 1 | SIDER US FAERS | |
| 142 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 143 | Completed Suicide | FAERS: 1 | SIDER US FAERS | |
| 144 | Coronary Artery Disease | FAERS: 1 | SIDER US FAERS | |
| 145 | Crying | FAERS: 1 | US FAERS | |
| 146 | Cyst | FAERS: 1 | SIDER US FAERS | |
| 147 | Deafness | FAERS: 1 | SIDER US FAERS | |
| 148 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 149 | Deep Vein Thrombosis | FAERS: 1 | SIDER US FAERS | |
| 150 | Diabetes Mellitus | FAERS: 1 | SIDER US FAERS | |
| 151 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 152 | Empyema | FAERS: 1 | US FAERS | |
| 153 | Epilepsy | FAERS: 1 | US FAERS | |
| 154 | Eye pain | FAERS: 1 | SIDER US FAERS | |
| 155 | Gastric infection | FAERS: 1 | US FAERS | |
| 156 | Genital Herpes | FAERS: 1 | US FAERS | |
| 157 | Gout | FAERS: 1 | SIDER US FAERS | |
| 158 | Hemiplegia | FAERS: 1 | US FAERS | |
| 159 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 160 | Hepatitis C RNA positive | FAERS: 1 | US FAERS | |
| 161 | Hypothyroidism | FAERS: 1 | SIDER US FAERS | |
| 162 | Impaired work ability | FAERS: 1 | US FAERS | |
| 163 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 164 | Inflammation | FAERS: 1 | US FAERS | |
| 165 | Injection site bruising | FAERS: 1 | US FAERS | |
| 166 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 167 | Limb injury | FAERS: 1 | US FAERS | |
| 168 | Lymphadenopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 169 | Medication Error | FAERS: 1 | US FAERS | |
| 170 | Meningitis | FAERS: 1 | US FAERS | |
| 171 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 172 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 173 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 174 | Neck Pain | FAERS: 1 | SIDER US FAERS | |
| 175 | Pain of skin | FAERS: 1 | US FAERS | |
| 176 | Paracentesis | FAERS: 1 | US FAERS | |
| 177 | Paranoia | FAERS: 1 | SIDER US FAERS | |
| 178 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 179 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 180 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 181 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 182 | Retinal exudates | FAERS: 1 | SIDER US FAERS | |
| 183 | Skin lesion | FAERS: 1 | SIDER US FAERS | |
| 184 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 185 | Suicide attempt | FAERS: 1 | SIDER US FAERS | |
| 186 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 187 | Thrombosis | FAERS: 1 | US FAERS | |
| 188 | Tinnitus | FAERS: 1 | SIDER US FAERS | |
| 189 | Unevaluable event | FAERS: 1 | US FAERS | |
| 190 | Vertigo | FAERS: 1 | SIDER US FAERS | |
| 191 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 192 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 193 | Wheezing | FAERS: 1 | SIDER US FAERS | |
| 194 | Acute myocardial infarction | SIDER | ||
| 195 | Agranulocytosis | SIDER | ||
| 196 | Anorectal discomfort | SIDER | ||
| 197 | Apathy | SIDER | ||
| 198 | Aphthous Stomatitis | SIDER | ||
| 199 | Aspermia | SIDER | ||
| 200 | Bipolar Disorder | SIDER | ||
| 201 | Bipolar I disorder | SIDER | ||
| 202 | Blood and lymphatic system disorders | SIDER | ||
| 203 | Blood triglycerides increased | SIDER | ||
| 204 | Bone pain | SIDER | ||
| 205 | Cholecystitis | SIDER | ||
| 206 | Colitis | SIDER | ||
| 207 | Conjunctivitis | SIDER | ||
| 208 | Delirium | Canada Vigilance: 1 | Canada Vigilance | |
| 209 | Dermatitis | SIDER | ||
| 210 | Discomfort | SIDER | ||
| 211 | Dysphonia | SIDER | ||
| 212 | Ear and labyrinth disorders | SIDER | ||
| 213 | Ear discomfort | SIDER | ||
| 214 | Eczema | SIDER | ||
| 215 | Endophthalmitis | SIDER | ||
| 216 | Eosinophilia | SIDER | ||
| 217 | Epiglottitis | SIDER | ||
| 218 | Epistaxis | SIDER | ||
| 219 | Erectile dysfunction | SIDER | ||
| 220 | Exfoliative rash | SIDER | ||
| 221 | Feeling of body temperature change | SIDER | ||
| 222 | Flat affect | SIDER | ||
| 223 | Flatulence | SIDER | ||
| 224 | Gastritis | SIDER | ||
| 225 | Gastrointestinal Pain | SIDER | ||
| 226 | Gingivitis | SIDER | ||
| 227 | Glossitis | SIDER | ||
| 228 | Hepatitis C RNA increased | Canada Vigilance: 1 | Canada Vigilance | |
| 229 | Hyperthyroidism | SIDER | ||
| 230 | Increased upper airway secretion | SIDER | ||
| 231 | Infestation | SIDER | ||
| 232 | Injection Site Reaction | SIDER | ||
| 233 | Joint swelling | SIDER | ||
| 234 | Lethargy | SIDER | ||
| 235 | Libido disorder | SIDER | ||
| 236 | Malnutrition | SIDER | ||
| 237 | Menorrhagia | SIDER | ||
| 238 | Mental Retardation | SIDER | ||
| 239 | Metrorrhagia | SIDER | ||
| 240 | Musculoskeletal Pain | SIDER | ||
| 241 | Musculoskeletal chest pain | SIDER | ||
| 242 | Neuralgia | SIDER | ||
| 243 | Neutrophil count decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 244 | Night sweats | SIDER | ||
| 245 | Nodule | SIDER | ||
| 246 | Non-cardiac chest pain | SIDER | ||
| 247 | Onychomycosis | SIDER | ||
| 248 | Optic Neuritis | SIDER | ||
| 249 | Oral fungal infection | SIDER | ||
| 250 | Oropharyngeal blistering | SIDER | ||
| 251 | Otitis Media | SIDER | ||
| 252 | Palpitations | SIDER | ||
| 253 | Pancreatic Insufficiency | SIDER | ||
| 254 | Pathogen resistance | Canada Vigilance: 4 | Canada Vigilance | |
| 255 | Pericardial effusion | SIDER | ||
| 256 | Pericarditis | SIDER | ||
| 257 | Pharyngitis | SIDER | ||
| 258 | Photophobia | SIDER | ||
| 259 | Pleuritic pain | SIDER | ||
| 260 | Porphyria non-acute | SIDER | ||
| 261 | Presyncope | SIDER | ||
| 262 | Prurigo | SIDER | ||
| 263 | Psoriasis | SIDER | ||
| 264 | Psychiatric decompensation | SIDER | ||
| 265 | Respiratory Failure | SIDER | ||
| 266 | Respiratory tract congestion | SIDER | ||
| 267 | Rhinitis | SIDER | ||
| 268 | Sarcoidosis | SIDER | ||
| 269 | Shock | SIDER | ||
| 270 | Skin Ulcer | SIDER | ||
| 271 | Stevens-Johnson Syndrome | SIDER | ||
| 272 | Tachycardia | SIDER | ||
| 273 | Thyroid Neoplasm | SIDER | ||
| 274 | Venous Thrombosis | SIDER | ||
| 275 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.