Diclofenac
(KXZOIWWTXOCYKR-UHFFFAOYSA-M)
Structure
- SMILES
- [O-]C(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl.[K+]
- Molecular Formula:
- C14H10Cl2KNO2
- Molecular Weight:
- 334.239
- Log P:
- 3.1024
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 52.16
- CAS Number(s):
- 15307-81-0
Synonym(s)
1.
Diclofenac
2.
Diclophenac
3.
Dichlofenal
4.
Diclofenac Potassium
5.
Diclofenac Sodium
6.
Diclonate P
7.
Dicrofenac
8.
Feloran
9.
GP-45,840
10.
Novapirina
11.
Orthofen
12.
Orthophen
13.
Ortofen
14.
SR-38
15.
Sodium Diclofenac
16.
Voltaren
17.
Voltarol
18.
Diclofenac, Sodium
19.
GP 45,840
20.
GP45,840
21.
SR 38
22.
SR38
External Link(s)
| MeSH | D004008 |
| PubChem Compound | 23667642 |
| ChEBI | 4508 |
| CHEMBL | CHEMBL1200804 |
| KEGG | dr:D00903 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 309 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug administered to patient of inappropriate age | FAERS: 107 | US FAERS | |
| 3 | Drug ineffective for unapproved indication | FAERS: 93 | US FAERS | |
| 4 | Product use issue | FAERS: 86 | US FAERS | |
| 5 | Product use in unapproved indication | FAERS: 71 | US FAERS | |
| 6 | Nausea | FAERS: 54 | US FAERS | |
| 7 | Vomiting | FAERS: 48 | US FAERS | |
| 8 | Abdominal discomfort | FAERS: 40 | US FAERS | |
| 9 | Drug prescribing error | FAERS: 40 | US FAERS | |
| 10 | Headache | FAERS: 39 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 36 | US FAERS | |
| 12 | Dizziness | FAERS: 32 | US FAERS | |
| 13 | Pain | FAERS: 29 | US FAERS | |
| 14 | Product quality issue | FAERS: 29 | US FAERS | |
| 15 | Fatigue | FAERS: 24 | US FAERS | |
| 16 | Product taste abnormal | FAERS: 23 | US FAERS | |
| 17 | Pruritus | FAERS: 21 | US FAERS | |
| 18 | Anaphylactic shock | FAERS: 18 | US FAERS | |
| 19 | Feeling abnormal | FAERS: 16 | US FAERS | |
| 20 | Urticaria | FAERS: 13 | US FAERS | |
| 21 | Dyspepsia | FAERS: 12 | US FAERS | |
| 22 | Back Pain | FAERS: 11 | US FAERS | |
| 23 | Chest Pain | FAERS: 11 | US FAERS | |
| 24 | Erythema | FAERS: 10 | US FAERS | |
| 25 | Palpitations | FAERS: 10 | US FAERS | |
| 26 | Somnolence | FAERS: 10 | US FAERS | |
| 27 | Abdominal Pain | FAERS: 9 | US FAERS | |
| 28 | Drug exposure during pregnancy | FAERS: 8 | US FAERS | |
| 29 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 30 | Malaise | FAERS: 8 | US FAERS | |
| 31 | Swelling | FAERS: 8 | US FAERS | |
| 32 | Throat irritation | FAERS: 8 | US FAERS | |
| 33 | Product difficult to swallow | FAERS: 7 | US FAERS | |
| 34 | Asthenia | FAERS: 6 | US FAERS | |
| 35 | Drug Dependence | FAERS: 6 | US FAERS | |
| 36 | Dysphonia | FAERS: 6 | US FAERS | |
| 37 | Gastric ulcer | FAERS: 6 | US FAERS | |
| 38 | Gastritis | FAERS: 6 | US FAERS | |
| 39 | Hypotension | FAERS: 6 | US FAERS | |
| 40 | Kounis Syndrome | FAERS: 6 | US FAERS | |
| 41 | Retching | FAERS: 6 | US FAERS | |
| 42 | Weight decreased | FAERS: 6 | US FAERS | |
| 43 | furuncle | FAERS: 6 | US FAERS | |
| 44 | Apparent death | FAERS: 5 | US FAERS | |
| 45 | Asphyxia | FAERS: 5 | US FAERS | |
| 46 | Bronchitis | FAERS: 5 | US FAERS | |
| 47 | Burning sensation | FAERS: 5 | US FAERS | |
| 48 | Dehydration | FAERS: 5 | US FAERS | |
| 49 | Hepatitis | FAERS: 5 | US FAERS | |
| 50 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 51 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 52 | Amnesia | FAERS: 4 | US FAERS | |
| 53 | Asthma | FAERS: 4 | US FAERS | |
| 54 | Bladder pain | FAERS: 4 | US FAERS | |
| 55 | Dengue Fever | FAERS: 4 | US FAERS | |
| 56 | Dysgeusia | FAERS: 4 | US FAERS | |
| 57 | Epistaxis | FAERS: 4 | US FAERS | |
| 58 | Flushing | FAERS: 4 | US FAERS | |
| 59 | Injection site pain | FAERS: 4 | US FAERS | |
| 60 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 61 | Intestinal diaphragm disease | FAERS: 4 | US FAERS | |
| 62 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 63 | Medication Error | FAERS: 4 | US FAERS | |
| 64 | Oligohydramnios | FAERS: 4 | US FAERS | |
| 65 | Piloerection | FAERS: 4 | US FAERS | |
| 66 | Prescription drug used without a prescription | FAERS: 4 | US FAERS | |
| 67 | Respiratory distress | FAERS: 4 | US FAERS | |
| 68 | Soft tissue swelling | FAERS: 4 | US FAERS | |
| 69 | Application site pain | FAERS: 3 | US FAERS | |
| 70 | Arthralgia | FAERS: 3 | US FAERS | |
| 71 | Arthritis | FAERS: 3 | US FAERS | |
| 72 | Aura | FAERS: 3 | US FAERS | |
| 73 | Bronchospasm | FAERS: 3 | US FAERS | |
| 74 | Cerebral Palsy | FAERS: 3 | US FAERS | |
| 75 | Chromaturia | FAERS: 3 | US FAERS | |
| 76 | Colitis | FAERS: 3 | US FAERS | |
| 77 | Constipation | FAERS: 3 | US FAERS | |
| 78 | Delirium | FAERS: 3 | US FAERS | |
| 79 | Disability | FAERS: 3 | US FAERS | |
| 80 | Diverticulum | FAERS: 3 | US FAERS | |
| 81 | Drug administration error | FAERS: 3 | US FAERS | |
| 82 | Drug dispensed to wrong patient | FAERS: 3 | US FAERS | |
| 83 | Gastric Lavage | FAERS: 3 | US FAERS | |
| 84 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 85 | Inflammation | FAERS: 3 | US FAERS | |
| 86 | Injection site inflammation | FAERS: 3 | US FAERS | |
| 87 | Injection site necrosis | FAERS: 3 | US FAERS | |
| 88 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 89 | Intercepted drug prescribing error | FAERS: 3 | US FAERS | |
| 90 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 91 | Limb discomfort | FAERS: 3 | US FAERS | |
| 92 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 93 | Nervousness | FAERS: 3 | US FAERS | |
| 94 | Pneumonia | FAERS: 3 | US FAERS | |
| 95 | Product counterfeit | FAERS: 3 | US FAERS | |
| 96 | Product formulation issue | FAERS: 3 | US FAERS | |
| 97 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 98 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 99 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 100 | Rectal polyp | FAERS: 3 | US FAERS | |
| 101 | Renal failure neonatal | FAERS: 3 | US FAERS | |
| 102 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 103 | Sinusitis | FAERS: 3 | US FAERS | |
| 104 | Stridor | FAERS: 3 | US FAERS | |
| 105 | Syncope | FAERS: 3 | US FAERS | |
| 106 | Toothache | FAERS: 3 | US FAERS | |
| 107 | Tremor | FAERS: 3 | US FAERS | |
| 108 | Vasculitis | FAERS: 3 | US FAERS | |
| 109 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 110 | Accidental overdose | FAERS: 2 | US FAERS | |
| 111 | Angioedema | FAERS: 2 | US FAERS | |
| 112 | Anxiety | FAERS: 2 | US FAERS | |
| 113 | Application site erythema | FAERS: 2 | US FAERS | |
| 114 | Application site swelling | FAERS: 2 | US FAERS | |
| 115 | Application site vesicles | FAERS: 2 | US FAERS | |
| 116 | Blindness | FAERS: 2 | US FAERS | |
| 117 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 118 | Blood urea increased | FAERS: 2 | US FAERS | |
| 119 | Blood urine present | FAERS: 2 | US FAERS | |
| 120 | Bone pain | FAERS: 2 | US FAERS | |
| 121 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 122 | Chest discomfort | FAERS: 2 | US FAERS | |
| 123 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 124 | Crying | FAERS: 2 | US FAERS | |
| 125 | Cyanosis | FAERS: 2 | US FAERS | |
| 126 | Deafness | FAERS: 2 | US FAERS | |
| 127 | Depressed mood | FAERS: 2 | US FAERS | |
| 128 | Diplopia | FAERS: 2 | US FAERS | |
| 129 | Drug toxicity | FAERS: 2 | US FAERS | |
| 130 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 131 | Expired product administered | FAERS: 2 | US FAERS | |
| 132 | Formication | FAERS: 2 | US FAERS | |
| 133 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 134 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 135 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 136 | Induration | FAERS: 2 | US FAERS | |
| 137 | Infarction | FAERS: 2 | US FAERS | |
| 138 | Infection | FAERS: 2 | US FAERS | |
| 139 | Injection site scar | FAERS: 2 | US FAERS | |
| 140 | Laryngeal Obstruction | FAERS: 2 | US FAERS | |
| 141 | Lip swelling | FAERS: 2 | US FAERS | |
| 142 | Malaria | FAERS: 2 | US FAERS | |
| 143 | Memory impairment | FAERS: 2 | US FAERS | |
| 144 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 145 | Myocardial Infarction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Neck Pain | FAERS: 2 | US FAERS | |
| 147 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 148 | Nodule | FAERS: 2 | US FAERS | |
| 149 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 150 | Overdose | FAERS: 2 | US FAERS | |
| 151 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 152 | Peritonitis | FAERS: 2 | US FAERS | |
| 153 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 154 | Product substitution issue | FAERS: 2 | US FAERS | |
| 155 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 156 | Rash erythematous | FAERS: 2 | US FAERS | |
| 157 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 158 | Sepsis | FAERS: 2 | US FAERS | |
| 159 | Shock | FAERS: 2 | US FAERS | |
| 160 | Skin necrosis | FAERS: 2 | US FAERS | |
| 161 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 162 | Stress | FAERS: 2 | US FAERS | |
| 163 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 164 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 165 | Visual Impairment | FAERS: 2 | US FAERS | |
| 166 | Accidental exposure | FAERS: 1 | US FAERS | |
| 167 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 168 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 169 | Administration site warmth | FAERS: 1 | US FAERS | |
| 170 | Adverse event | FAERS: 1 | US FAERS | |
| 171 | Agitation | FAERS: 1 | US FAERS | |
| 172 | Alopecia | FAERS: 1 | US FAERS | |
| 173 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 174 | Anger | FAERS: 1 | US FAERS | |
| 175 | Aplasia Cutis Congenita | FAERS: 1 | US FAERS | |
| 176 | Application site pustules | FAERS: 1 | US FAERS | |
| 177 | Application site rash | FAERS: 1 | US FAERS | |
| 178 | Arthropathy | FAERS: 1 | US FAERS | |
| 179 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 180 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 181 | Back disorder | FAERS: 1 | US FAERS | |
| 182 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 183 | Blepharospasm | FAERS: 1 | US FAERS | |
| 184 | Blood blister | FAERS: 1 | US FAERS | |
| 185 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 186 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 187 | Bone marrow necrosis | FAERS: 1 | US FAERS | |
| 188 | Cataplexy | FAERS: 1 | US FAERS | |
| 189 | Chills | FAERS: 1 | US FAERS | |
| 190 | Choking | FAERS: 1 | US FAERS | |
| 191 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 192 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 193 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 194 | Drug abuse | FAERS: 1 | US FAERS | |
| 195 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 196 | Drug dose omission | FAERS: 1 | US FAERS | |
| 197 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 198 | Dysarthria | FAERS: 1 | US FAERS | |
| 199 | Dysentery | FAERS: 1 | US FAERS | |
| 200 | Emotional distress | FAERS: 1 | US FAERS | |
| 201 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 202 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 203 | Eosinophilia | FAERS: 1 | US FAERS | |
| 204 | Expired drug administered | FAERS: 1 | US FAERS | |
| 205 | Eye irritation | FAERS: 1 | US FAERS | |
| 206 | Eye pain | FAERS: 1 | US FAERS | |
| 207 | Feeling Cold | FAERS: 1 | US FAERS | |
| 208 | Fibrosis | FAERS: 1 | US FAERS | |
| 209 | Food Poisoning | FAERS: 1 | US FAERS | |
| 210 | Gastroduodenitis | FAERS: 1 | US FAERS | |
| 211 | Gingival erythema | FAERS: 1 | US FAERS | |
| 212 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 213 | Glycogen Storage Disease Type I | FAERS: 1 | US FAERS | |
| 214 | Gout | FAERS: 1 | US FAERS | |
| 215 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 216 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 217 | Impetigo | FAERS: 1 | US FAERS | |
| 218 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 219 | Injection site erythema | FAERS: 1 | US FAERS | |
| 220 | Injection site irritation | FAERS: 1 | US FAERS | |
| 221 | Injection site nodule | FAERS: 1 | US FAERS | |
| 222 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 223 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 224 | Limb injury | FAERS: 1 | US FAERS | |
| 225 | Mood swings | FAERS: 1 | US FAERS | |
| 226 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 227 | Muscle strain | FAERS: 1 | US FAERS | |
| 228 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 229 | Myalgia | FAERS: 1 | US FAERS | |
| 230 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 231 | Neuralgia | FAERS: 1 | US FAERS | |
| 232 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 233 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 234 | Oral pruritus | FAERS: 1 | US FAERS | |
| 235 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 236 | Osteoporosis | FAERS: 1 | US FAERS | |
| 237 | Pain of skin | FAERS: 1 | US FAERS | |
| 238 | Pancytopenia | FAERS: 1 | US FAERS | |
| 239 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 240 | Petechiae | FAERS: 1 | US FAERS | |
| 241 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 242 | Pharyngitis | FAERS: 1 | US FAERS | |
| 243 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 244 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 245 | Presyncope | FAERS: 1 | US FAERS | |
| 246 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 247 | Product label issue | FAERS: 1 | US FAERS | |
| 248 | Product prescribing error | FAERS: 1 | US FAERS | |
| 249 | Renal pain | FAERS: 1 | US FAERS | |
| 250 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 251 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 252 | Restlessness | FAERS: 1 | US FAERS | |
| 253 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 254 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 255 | Sneezing | FAERS: 1 | US FAERS | |
| 256 | Stillbirth | FAERS: 1 | US FAERS | |
| 257 | Sudden death | FAERS: 1 | US FAERS | |
| 258 | Syphilis test positive | FAERS: 1 | US FAERS | |
| 259 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 260 | Tension Headache | FAERS: 1 | US FAERS | |
| 261 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 262 | Thrombosis | FAERS: 1 | US FAERS | |
| 263 | Tinnitus | FAERS: 1 | US FAERS | |
| 264 | Torticollis | FAERS: 1 | US FAERS | |
| 265 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 266 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 267 | Ulcer | FAERS: 1 | US FAERS | |
| 268 | Vulvitis | FAERS: 1 | US FAERS | |
| 269 | Wound Debridement | FAERS: 1 | US FAERS | |
| 270 | muscle injury | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.