lifitegrast
(JFOZKMSJYSPYLN-QHCPKHFHSA-N)
Structure
- SMILES
- OC(=O)[C@@H](NC(=O)c1c(Cl)cc2c(c1Cl)CCN(C2)C(=O)c1ccc2c(c1)occ2)Cc1cccc(c1)S(=O)(=O)C
- Type(s)
- Approved
- ATC code(s)
- S01XA25
- Molecular Formula:
- C29H24Cl2N2O7S
- Molecular Weight:
- 615.481
- Log P:
- 6.1769
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 2
- TPSA:
- 142.37
- CAS Number(s):
- 1025967-78-5
Synonym(s)
1.
lifitegrast
2.
(2S)-2-(((2-(benzofuran-6-ylcarbonyl)-5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6- yl)carbonyl)amino)-3-(3-(methylsulfonyl)phenyl)propanoic acid
3.
L-phenylalanine, n-((2-(6-benzofuranylcarbonyl)-5,7-dichloro-1,2,3,4-tetrahydro-6-isoquinolinyl)carbonyl)-3-(methylsulfonyl)-
4.
SAR 1118
5.
SAR-1118
6.
SHP-606
7.
SHP606
8.
Xiidra
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Instillation site pain | FAERS: 942 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 2 | Instillation site reaction | FAERS: 770 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 3 | Dysgeusia | FAERS: 411 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 309 Canada Vigilance: 24 | Canada Vigilance US FAERS | |
| 5 | Product quality issue | FAERS: 187 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Instillation site erythema | FAERS: 163 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Instillation site irritation | FAERS: 156 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Eye irritation | FAERS: 148 | US FAERS | |
| 9 | Instillation site lacrimation | FAERS: 138 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Instillation site pruritus | FAERS: 138 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 11 | Headache | FAERS: 102 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 12 | Inappropriate schedule of drug administration | FAERS: 88 | US FAERS | |
| 13 | Instillation site discharge | FAERS: 88 | US FAERS | |
| 14 | Eye pain | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Visual Impairment | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Hypersensitivity | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | No adverse event | FAERS: 61 | US FAERS | |
| 18 | Product container issue | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Instillation site swelling | FAERS: 55 | US FAERS | |
| 20 | Nausea | FAERS: 53 | US FAERS | |
| 21 | Wrong technique in product usage process | FAERS: 52 | US FAERS | |
| 22 | Incorrect dose administered | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Drug dose omission | FAERS: 46 | US FAERS | |
| 24 | Instillation site discomfort | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Instillation site dryness | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Product taste abnormal | FAERS: 34 | US FAERS | |
| 27 | Instillation site foreign body sensation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Dizziness | FAERS: 29 | US FAERS | |
| 29 | Abdominal discomfort | FAERS: 28 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Product use complaint | FAERS: 28 | US FAERS | |
| 32 | Eyelid margin crusting | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Foreign body sensation in eyes | FAERS: 27 | US FAERS | |
| 34 | Sinusitis | FAERS: 27 | US FAERS | |
| 35 | Erythema | FAERS: 26 | US FAERS | |
| 36 | Oropharyngeal pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Therapeutic response unexpected | FAERS: 26 | US FAERS | |
| 38 | Throat irritation | FAERS: 25 | US FAERS | |
| 39 | Unevaluable event | FAERS: 25 | US FAERS | |
| 40 | Adverse event | FAERS: 24 | US FAERS | |
| 41 | Photophobia | FAERS: 24 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 42 | Inappropriate schedule of product administration | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Malaise | FAERS: 21 | US FAERS | |
| 44 | Product use issue | FAERS: 20 | US FAERS | |
| 45 | Pruritus | FAERS: 20 | US FAERS | |
| 46 | Instillation site inflammation | FAERS: 19 | US FAERS | |
| 47 | Frustration tolerance decreased | FAERS: 17 | US FAERS | |
| 48 | Instillation site burn | FAERS: 17 | US FAERS | |
| 49 | Ocular discomfort | FAERS: 16 | US FAERS | |
| 50 | Pain | FAERS: 16 | US FAERS | |
| 51 | Arthritis | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Product storage error | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Urticaria | FAERS: 15 | US FAERS | |
| 54 | Epistaxis | FAERS: 14 | US FAERS | |
| 55 | Lip swelling | FAERS: 14 | US FAERS | |
| 56 | Asthenopia | FAERS: 13 | US FAERS | |
| 57 | Blepharitis | FAERS: 13 | US FAERS | |
| 58 | Diplopia | FAERS: 13 | US FAERS | |
| 59 | Incorrect product storage | FAERS: 13 | US FAERS | |
| 60 | Instillation site hypersensitivity | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Product packaging issue | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Product packaging quantity issue | FAERS: 13 | US FAERS | |
| 63 | Upper-airway cough syndrome | FAERS: 13 | US FAERS | |
| 64 | Dysphonia | FAERS: 12 | US FAERS | |
| 65 | Hordeolum | FAERS: 12 | US FAERS | |
| 66 | Ageusia | FAERS: 11 | US FAERS | |
| 67 | Eye Infection | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Tremor | FAERS: 11 | US FAERS | |
| 69 | Burning sensation | FAERS: 10 | US FAERS | |
| 70 | Cataract | FAERS: 10 | US FAERS | |
| 71 | Discomfort | FAERS: 10 | US FAERS | |
| 72 | Dry skin | FAERS: 10 | US FAERS | |
| 73 | Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Superficial injury of eye | FAERS: 10 | US FAERS | |
| 75 | Dyspepsia | FAERS: 9 | US FAERS | |
| 76 | Emotional distress | FAERS: 9 | US FAERS | |
| 77 | Eyelid irritation | FAERS: 9 | US FAERS | |
| 78 | Inability to afford medication | FAERS: 9 | US FAERS | |
| 79 | Overdose | FAERS: 9 | US FAERS | |
| 80 | Palpitations | FAERS: 9 | US FAERS | |
| 81 | Punctate keratitis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Accidental overdose | FAERS: 8 | US FAERS | |
| 83 | Conjunctivitis | FAERS: 8 | US FAERS | |
| 84 | Depressed mood | FAERS: 8 | US FAERS | |
| 85 | Flushing | FAERS: 8 | US FAERS | |
| 86 | Secretion discharge | FAERS: 8 | US FAERS | |
| 87 | Swelling of eyelid | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Vitreous floaters | FAERS: 8 | US FAERS | |
| 89 | Alopecia | FAERS: 7 | US FAERS | |
| 90 | Anxiety | FAERS: 7 | US FAERS | |
| 91 | Aphonia | FAERS: 7 | US FAERS | |
| 92 | Expired product administered | FAERS: 7 | US FAERS | |
| 93 | Eye inflammation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Nasal discomfort | FAERS: 7 | US FAERS | |
| 95 | Vomiting | FAERS: 7 | US FAERS | |
| 96 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 97 | Anosmia | FAERS: 6 | US FAERS | |
| 98 | Dacryostenosis acquired | FAERS: 6 | US FAERS | |
| 99 | Excessive eye blinking | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Impaired driving ability | FAERS: 6 | US FAERS | |
| 101 | Instillation site infection | FAERS: 6 | US FAERS | |
| 102 | Instillation site rash | FAERS: 6 | US FAERS | |
| 103 | Keratitis | FAERS: 6 | US FAERS | |
| 104 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 105 | Tinnitus | FAERS: 6 | US FAERS | |
| 106 | Chest discomfort | FAERS: 5 | US FAERS | |
| 107 | Drug administration error | FAERS: 5 | US FAERS | |
| 108 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 109 | Product physical issue | FAERS: 5 | US FAERS | |
| 110 | Sneezing | FAERS: 5 | US FAERS | |
| 111 | Vertigo | FAERS: 5 | US FAERS | |
| 112 | Anger | FAERS: 4 | US FAERS | |
| 113 | Blindness | FAERS: 4 | US FAERS | |
| 114 | Bronchospasm | FAERS: 4 | US FAERS | |
| 115 | Corneal dystrophy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Eczema | FAERS: 4 | US FAERS | |
| 117 | Facial Pain | FAERS: 4 | US FAERS | |
| 118 | Facial paralysis | FAERS: 4 | US FAERS | |
| 119 | Feeling jittery | FAERS: 4 | US FAERS | |
| 120 | Instillation site vesicles | FAERS: 4 | US FAERS | |
| 121 | Liquid product physical issue | FAERS: 4 | US FAERS | |
| 122 | Mydriasis | FAERS: 4 | US FAERS | |
| 123 | Neck Pain | FAERS: 4 | US FAERS | |
| 124 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 125 | Pneumonia | FAERS: 4 | US FAERS | |
| 126 | Skin irritation | FAERS: 4 | US FAERS | |
| 127 | Agitation | FAERS: 3 | US FAERS | |
| 128 | Asthenia | FAERS: 3 | US FAERS | |
| 129 | Asthma | FAERS: 3 | US FAERS | |
| 130 | Bronchitis | FAERS: 3 | US FAERS | |
| 131 | Corneal erosion | FAERS: 3 | US FAERS | |
| 132 | Crying | FAERS: 3 | US FAERS | |
| 133 | Dermatitis | FAERS: 3 | US FAERS | |
| 134 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 135 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 136 | Erythema Nodosum | FAERS: 3 | US FAERS | |
| 137 | Extra dose administered | FAERS: 3 | US FAERS | |
| 138 | Eyelid rash | FAERS: 3 | US FAERS | |
| 139 | Eyelid skin dryness | FAERS: 3 | US FAERS | |
| 140 | Glaucoma | FAERS: 3 | US FAERS | |
| 141 | Infection | FAERS: 3 | US FAERS | |
| 142 | Insurance issue | FAERS: 3 | US FAERS | |
| 143 | Lacrimation decreased | FAERS: 3 | US FAERS | |
| 144 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 145 | Oral pain | FAERS: 3 | US FAERS | |
| 146 | Oropharyngeal blistering | FAERS: 3 | US FAERS | |
| 147 | Paranasal sinus discomfort | FAERS: 3 | US FAERS | |
| 148 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 149 | Product dropper issue | FAERS: 3 | US FAERS | |
| 150 | Product expiration date issue | FAERS: 3 | US FAERS | |
| 151 | Respiratory distress | FAERS: 3 | US FAERS | |
| 152 | Sinus pain | FAERS: 3 | US FAERS | |
| 153 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 154 | Swelling | FAERS: 3 | US FAERS | |
| 155 | Tachycardia | FAERS: 3 | US FAERS | |
| 156 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 157 | Toothache | FAERS: 3 | US FAERS | |
| 158 | Vital dye staining cornea present | FAERS: 3 | US FAERS | |
| 159 | Weight decreased | FAERS: 3 | US FAERS | |
| 160 | treatment failure | FAERS: 3 | US FAERS | |
| 161 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 162 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 163 | Amnesia | FAERS: 2 | US FAERS | |
| 164 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 165 | Application site pain | FAERS: 2 | US FAERS | |
| 166 | Arthropod sting | FAERS: 2 | US FAERS | |
| 167 | Back Pain | FAERS: 2 | US FAERS | |
| 168 | Back disorder | FAERS: 2 | US FAERS | |
| 169 | Blood urine present | FAERS: 2 | US FAERS | |
| 170 | Chemical burns of eye | FAERS: 2 | US FAERS | |
| 171 | Chest Pain | FAERS: 2 | US FAERS | |
| 172 | Corneal epithelium defect | FAERS: 2 | US FAERS | |
| 173 | Corneal exfoliation | FAERS: 2 | US FAERS | |
| 174 | Corneal lesion | FAERS: 2 | US FAERS | |
| 175 | Dehydration | FAERS: 2 | US FAERS | |
| 176 | Emotional disorder | FAERS: 2 | US FAERS | |
| 177 | Eructation | FAERS: 2 | US FAERS | |
| 178 | Eye Burns | FAERS: 2 | US FAERS | |
| 179 | Eye complication associated with device | FAERS: 2 | US FAERS | |
| 180 | Eye ulcer | FAERS: 2 | US FAERS | |
| 181 | Eyelid exfoliation | FAERS: 2 | US FAERS | |
| 182 | Hyperacusis | FAERS: 2 | US FAERS | |
| 183 | Impaired work ability | FAERS: 2 | US FAERS | |
| 184 | Inflammation | FAERS: 2 | US FAERS | |
| 185 | Instillation site coldness | FAERS: 2 | US FAERS | |
| 186 | Instillation site exfoliation | FAERS: 2 | US FAERS | |
| 187 | Instillation site pustules | FAERS: 2 | US FAERS | |
| 188 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 189 | Iridocyclitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Joint swelling | FAERS: 2 | US FAERS | |
| 191 | Limb injury | FAERS: 2 | US FAERS | |
| 192 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 193 | Macular degeneration | FAERS: 2 | US FAERS | |
| 194 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 195 | Mouth swelling | FAERS: 2 | US FAERS | |
| 196 | Muscle tightness | FAERS: 2 | US FAERS | |
| 197 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 198 | Nervousness | FAERS: 2 | US FAERS | |
| 199 | Nodule | FAERS: 2 | US FAERS | |
| 200 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 201 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 202 | Packaging design issue | FAERS: 2 | US FAERS | |
| 203 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 204 | Product closure issue | FAERS: 2 | US FAERS | |
| 205 | Product label confusion | FAERS: 2 | US FAERS | |
| 206 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 207 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 208 | Rash erythematous | FAERS: 2 | US FAERS | |
| 209 | Skin discomfort | FAERS: 2 | US FAERS | |
| 210 | Somnolence | FAERS: 2 | US FAERS | |
| 211 | Stomatitis | FAERS: 2 | US FAERS | |
| 212 | Therapy cessation | FAERS: 2 | US FAERS | |
| 213 | Thirst | FAERS: 2 | US FAERS | |
| 214 | Tongue eruption | FAERS: 2 | US FAERS | |
| 215 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 216 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 217 | Accidental underdose | FAERS: 1 | US FAERS | |
| 218 | Acne | FAERS: 1 | US FAERS | |
| 219 | Administration site hypersensitivity | FAERS: 1 | US FAERS | |
| 220 | Administration site injury | FAERS: 1 | US FAERS | |
| 221 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 222 | Angioedema | FAERS: 1 | US FAERS | |
| 223 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 224 | Aphasia | FAERS: 1 | US FAERS | |
| 225 | Application site irritation | FAERS: 1 | US FAERS | |
| 226 | Arthralgia | FAERS: 1 | US FAERS | |
| 227 | Blepharospasm | FAERS: 1 | US FAERS | |
| 228 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 229 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 230 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 231 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 232 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 233 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 234 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 235 | Cellulitis | FAERS: 1 | US FAERS | |
| 236 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 237 | Choking sensation | FAERS: 1 | US FAERS | |
| 238 | Choking | FAERS: 1 | US FAERS | |
| 239 | Coating in mouth | FAERS: 1 | US FAERS | |
| 240 | Conjunctival deposit | FAERS: 1 | US FAERS | |
| 241 | Conjunctival staining | FAERS: 1 | US FAERS | |
| 242 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 243 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 244 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 245 | Corneal Scar | FAERS: 1 | US FAERS | |
| 246 | Corneal defect | FAERS: 1 | US FAERS | |
| 247 | Corneal thickening | FAERS: 1 | US FAERS | |
| 248 | Corneal thinning | FAERS: 1 | US FAERS | |
| 249 | Corrective lens user | FAERS: 1 | US FAERS | |
| 250 | Cystitis | FAERS: 1 | US FAERS | |
| 251 | Dacryocystitis | FAERS: 1 | US FAERS | |
| 252 | Dacryostenosis congenital | FAERS: 1 | US FAERS | |
| 253 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 254 | Dellen | FAERS: 1 | US FAERS | |
| 255 | Depression suicidal | FAERS: 1 | US FAERS | |
| 256 | Device material issue | FAERS: 1 | US FAERS | |
| 257 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 258 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 259 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 260 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 261 | Dysarthria | FAERS: 1 | US FAERS | |
| 262 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 263 | Ectropion | FAERS: 1 | US FAERS | |
| 264 | Encephalitis | FAERS: 1 | US FAERS | |
| 265 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 266 | Entropion | FAERS: 1 | US FAERS | |
| 267 | Exophthalmos | FAERS: 1 | US FAERS | |
| 268 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 269 | Eye opacity | FAERS: 1 | US FAERS | |
| 270 | Eye operation complication | FAERS: 1 | US FAERS | |
| 271 | Eye symptom | FAERS: 1 | US FAERS | |
| 272 | Eyelash changes | FAERS: 1 | US FAERS | |
| 273 | Eyelash hyperpigmentation | FAERS: 1 | US FAERS | |
| 274 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 275 | Eyelid pain | FAERS: 1 | US FAERS | |
| 276 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 277 | Formication | FAERS: 1 | US FAERS | |
| 278 | Gastritis | FAERS: 1 | US FAERS | |
| 279 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 280 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 281 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 282 | General symptom | FAERS: 1 | US FAERS | |
| 283 | Genital infection | FAERS: 1 | US FAERS | |
| 284 | Gingival blister | FAERS: 1 | US FAERS | |
| 285 | Gingival erythema | FAERS: 1 | US FAERS | |
| 286 | Gingival pruritus | FAERS: 1 | US FAERS | |
| 287 | Growth of eyelashes | FAERS: 1 | US FAERS | |
| 288 | Head discomfort | FAERS: 1 | US FAERS | |
| 289 | Hearing aid user | FAERS: 1 | US FAERS | |
| 290 | Incontinence | FAERS: 1 | US FAERS | |
| 291 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 292 | Influenza | FAERS: 1 | US FAERS | |
| 293 | Injection site erythema | FAERS: 1 | US FAERS | |
| 294 | Injection site irritation | FAERS: 1 | US FAERS | |
| 295 | Injection site pain | FAERS: 1 | US FAERS | |
| 296 | Instillation site bruise | FAERS: 1 | US FAERS | |
| 297 | Instillation site complication | FAERS: 1 | US FAERS | |
| 298 | Instillation site warmth | FAERS: 1 | US FAERS | |
| 299 | Keratopathy | FAERS: 1 | US FAERS | |
| 300 | Lethargy | FAERS: 1 | US FAERS | |
| 301 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 302 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 303 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 304 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 305 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 306 | Mastication disorder | FAERS: 1 | US FAERS | |
| 307 | Memory impairment | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 308 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 309 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 310 | Myopia | FAERS: 1 | US FAERS | |
| 311 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 312 | Noninfective conjunctivitis | FAERS: 1 | US FAERS | |
| 313 | Obstruction | FAERS: 1 | US FAERS | |
| 314 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 315 | Oral pruritus | FAERS: 1 | US FAERS | |
| 316 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 317 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 318 | Pain of skin | FAERS: 1 | US FAERS | |
| 319 | Palatal swelling | FAERS: 1 | US FAERS | |
| 320 | Papule | FAERS: 1 | US FAERS | |
| 321 | Paranoia | FAERS: 1 | US FAERS | |
| 322 | Performance status decreased | FAERS: 1 | US FAERS | |
| 323 | Periorbital Infection | FAERS: 1 | US FAERS | |
| 324 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 325 | Physical product label issue | FAERS: 1 | US FAERS | |
| 326 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 327 | Procedural complication | FAERS: 1 | US FAERS | |
| 328 | Product availability issue | FAERS: 1 | US FAERS | |
| 329 | Product complaint | FAERS: 1 | US FAERS | |
| 330 | Product container seal issue | FAERS: 1 | US FAERS | |
| 331 | Product contamination | FAERS: 1 | US FAERS | |
| 332 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 333 | Product dose omission | FAERS: 1 | US FAERS | |
| 334 | Product label issue | FAERS: 1 | US FAERS | |
| 335 | Product leakage | FAERS: 1 | US FAERS | |
| 336 | Product lot number issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 338 | Product residue present | FAERS: 1 | US FAERS | |
| 339 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 340 | Productive Cough | FAERS: 1 | US FAERS | |
| 341 | Proteinuria | FAERS: 1 | US FAERS | |
| 342 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 343 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 344 | Retching | FAERS: 1 | US FAERS | |
| 345 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 346 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 347 | Rhinalgia | FAERS: 1 | US FAERS | |
| 348 | Rhinitis | FAERS: 1 | US FAERS | |
| 349 | Rosacea | FAERS: 1 | US FAERS | |
| 350 | Scleral thinning | FAERS: 1 | US FAERS | |
| 351 | Screaming | FAERS: 1 | US FAERS | |
| 352 | Sebaceous hyperplasia | FAERS: 1 | US FAERS | |
| 353 | Skin procedural complication | FAERS: 1 | US FAERS | |
| 354 | Skin reaction | FAERS: 1 | US FAERS | |
| 355 | Steroid withdrawal syndrome | FAERS: 1 | US FAERS | |
| 356 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 357 | Strabismus | FAERS: 1 | US FAERS | |
| 358 | Stress | FAERS: 1 | US FAERS | |
| 359 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 360 | Swollen tear duct | FAERS: 1 | US FAERS | |
| 361 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 362 | Tension Headache | FAERS: 1 | US FAERS | |
| 363 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Therapeutic product effect delayed | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 365 | Therapy change | FAERS: 1 | US FAERS | |
| 366 | Thrombosis | FAERS: 1 | US FAERS | |
| 367 | Time perception altered | FAERS: 1 | US FAERS | |
| 368 | Tongue blistering | FAERS: 1 | US FAERS | |
| 369 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 370 | Tooth Loss | FAERS: 1 | US FAERS | |
| 371 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 372 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 373 | Urticarial vasculitis | FAERS: 1 | US FAERS | |
| 374 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 375 | Wheezing | FAERS: 1 | US FAERS | |
| 376 | Xanthopsia | FAERS: 1 | US FAERS | |
| 377 | fibroma | FAERS: 1 | US FAERS | |
| 378 | skin abrasion | FAERS: 1 | US FAERS | |
| 379 | Eye allergy | Canada Vigilance: 1 | Canada Vigilance | |
| 380 | Product packaging difficult to open | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.