Breo Ellipta
(IVFHIIPWLILHCX-KVXXQBCDSA-N)
Structure
- SMILES
- OCc1cc(ccc1O)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O.FCSC(=O)[C@@]1(OC(=O)c2ccco2)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1(C2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F
- Molecular Formula:
- C51H62Cl2F3NO11S
- Molecular Weight:
- 1025.000
- Log P:
- 9.9258
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 5
- TPSA:
- 210.29
- CAS Number(s):
- N/A
Synonym(s)
1.
Breo Ellipta
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Wrong technique in device usage process | FAERS: 694 | US FAERS | |
| 2 | Drug ineffective | FAERS: 587 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 3 | Drug dose omission | FAERS: 513 | US FAERS | |
| 4 | Device use error | FAERS: 505 | US FAERS | |
| 5 | Product quality issue | FAERS: 476 | US FAERS | |
| 6 | Drug dispensing error | FAERS: 380 | US FAERS | |
| 7 | Wrong technique in product usage process | FAERS: 294 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Dysphonia | FAERS: 263 | US FAERS | |
| 9 | Overdose | FAERS: 245 | US FAERS | |
| 10 | Product complaint | FAERS: 234 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 11 | Product dose omission | FAERS: 215 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Circumstance or information capable of leading to medication error | FAERS: 165 | US FAERS | |
| 13 | Product label confusion | FAERS: 161 | US FAERS | |
| 14 | Malaise | FAERS: 152 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 15 | Product packaging confusion | FAERS: 151 | US FAERS | |
| 16 | Product use in unapproved indication | FAERS: 145 | US FAERS | |
| 17 | Product use issue | FAERS: 143 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Prescribed overdose | FAERS: 134 | US FAERS | |
| 19 | Headache | FAERS: 101 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Asthma | FAERS: 99 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Pneumonia | FAERS: 96 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 22 | Dizziness | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Intentional product misuse | FAERS: 90 | US FAERS | |
| 24 | Oropharyngeal pain | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Extra dose administered | FAERS: 84 | US FAERS | |
| 26 | Chest discomfort | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Inappropriate schedule of drug administration | FAERS: 78 | US FAERS | |
| 28 | Drug prescribing error | FAERS: 77 | US FAERS | |
| 29 | Wheezing | FAERS: 72 | US FAERS | |
| 30 | Chest Pain | FAERS: 65 | US FAERS | |
| 31 | Inability to afford medication | FAERS: 63 | US FAERS | |
| 32 | Throat irritation | FAERS: 60 | US FAERS | |
| 33 | Productive Cough | FAERS: 58 | US FAERS | |
| 34 | Medication Error | FAERS: 57 | US FAERS | |
| 35 | Drug effect incomplete | FAERS: 56 | US FAERS | |
| 36 | Fatigue | FAERS: 56 | US FAERS | |
| 37 | Product dispensing error | FAERS: 53 | US FAERS | |
| 38 | Oral candidiasis | FAERS: 52 | US FAERS | |
| 39 | Palpitations | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Product storage error | FAERS: 51 | US FAERS | |
| 41 | Tremor | FAERS: 49 | US FAERS | |
| 42 | Nausea | FAERS: 47 | US FAERS | |
| 43 | Asthenia | FAERS: 44 | US FAERS | |
| 44 | Feeling abnormal | FAERS: 44 | US FAERS | |
| 45 | Expired product administered | FAERS: 40 | US FAERS | |
| 46 | Hypersensitivity | FAERS: 40 | US FAERS | |
| 47 | Nasopharyngitis | FAERS: 40 | US FAERS | |
| 48 | Bronchitis | FAERS: 38 | US FAERS | |
| 49 | Accidental overdose | FAERS: 37 | US FAERS | |
| 50 | Anxiety | FAERS: 37 | US FAERS | |
| 51 | Pain | FAERS: 37 | US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 34 | US FAERS | |
| 53 | Pruritus | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Therapeutic response unexpected | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Drug administration error | FAERS: 32 | US FAERS | |
| 56 | Stomatitis | FAERS: 32 | US FAERS | |
| 57 | Urticaria | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Drug administered to patient of inappropriate age | FAERS: 31 | US FAERS | |
| 59 | Aphonia | FAERS: 30 | US FAERS | |
| 60 | Intentional product use issue | FAERS: 29 | US FAERS | |
| 61 | Intercepted medication error | FAERS: 29 | US FAERS | |
| 62 | Back Pain | FAERS: 27 | US FAERS | |
| 63 | Myocardial Infarction | FAERS: 27 | US FAERS | |
| 64 | Oral pain | FAERS: 27 | US FAERS | |
| 65 | Arthralgia | FAERS: 26 | US FAERS | |
| 66 | Influenza | FAERS: 26 | US FAERS | |
| 67 | Sinusitis | FAERS: 26 | US FAERS | |
| 68 | Bronchospasm | FAERS: 25 | US FAERS | |
| 69 | Incorrect dose administered | FAERS: 25 | US FAERS | |
| 70 | Dysgeusia | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 71 | Feeling jittery | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Nervousness | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Peripheral swelling | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Visual Impairment | FAERS: 22 | US FAERS | |
| 75 | Incorrect product storage | FAERS: 21 | US FAERS | |
| 76 | Intercepted drug prescribing error | FAERS: 21 | US FAERS | |
| 77 | Secretion discharge | FAERS: 21 | US FAERS | |
| 78 | Inappropriate schedule of product administration | FAERS: 20 | US FAERS | |
| 79 | Tachycardia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Adverse event | FAERS: 19 | US FAERS | |
| 81 | Product prescribing error | FAERS: 19 | US FAERS | |
| 82 | Atrial Fibrillation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Accidental exposure to product | FAERS: 17 | US FAERS | |
| 84 | Circumstance or information capable of leading to device use error | FAERS: 17 | US FAERS | |
| 85 | Laryngitis | FAERS: 17 | US FAERS | |
| 86 | Vomiting | FAERS: 17 | US FAERS | |
| 87 | Blood glucose increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Myalgia | FAERS: 16 | US FAERS | |
| 89 | Prescription drug used without a prescription | FAERS: 16 | US FAERS | |
| 90 | Choking | FAERS: 15 | US FAERS | |
| 91 | Infection | FAERS: 15 | US FAERS | |
| 92 | Product taste abnormal | FAERS: 15 | US FAERS | |
| 93 | Cataract | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Drug ineffective for unapproved indication | FAERS: 13 | US FAERS | |
| 95 | Epistaxis | FAERS: 13 | US FAERS | |
| 96 | Intentional dose omission | FAERS: 13 | US FAERS | |
| 97 | Intercepted drug dispensing error | FAERS: 13 | US FAERS | |
| 98 | Abdominal discomfort | FAERS: 12 | US FAERS | |
| 99 | Chills | FAERS: 12 | US FAERS | |
| 100 | Diabetes Mellitus | FAERS: 12 | US FAERS | |
| 101 | Lower respiratory tract infection | FAERS: 12 | US FAERS | |
| 102 | Memory impairment | FAERS: 12 | US FAERS | |
| 103 | Rehabilitation therapy | FAERS: 12 | US FAERS | |
| 104 | Retching | FAERS: 12 | US FAERS | |
| 105 | Swelling | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Constipation | FAERS: 11 | US FAERS | |
| 107 | Device malfunction | FAERS: 11 | US FAERS | |
| 108 | Discomfort | FAERS: 11 | US FAERS | |
| 109 | Erythema | FAERS: 11 | US FAERS | |
| 110 | Intercepted drug administration error | FAERS: 11 | US FAERS | |
| 111 | Lip swelling | FAERS: 11 | US FAERS | |
| 112 | Ageusia | FAERS: 10 | US FAERS | |
| 113 | Arthritis | FAERS: 10 | US FAERS | |
| 114 | Burning sensation | FAERS: 10 | US FAERS | |
| 115 | Cataract operation | FAERS: 10 | US FAERS | |
| 116 | Emergency care examination | FAERS: 10 | US FAERS | |
| 117 | Intentional device misuse | FAERS: 10 | US FAERS | |
| 118 | Joint swelling | FAERS: 10 | US FAERS | |
| 119 | Oropharyngeal discomfort | FAERS: 10 | US FAERS | |
| 120 | Respiratory tract congestion | FAERS: 10 | US FAERS | |
| 121 | Amnesia | FAERS: 9 | US FAERS | |
| 122 | Increased upper airway secretion | FAERS: 9 | US FAERS | |
| 123 | Alopecia | FAERS: 8 | US FAERS | |
| 124 | Angioedema | FAERS: 8 | US FAERS | |
| 125 | Disorientation | FAERS: 8 | US FAERS | |
| 126 | Eye pain | FAERS: 8 | US FAERS | |
| 127 | Glaucoma | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 128 | Oral fungal infection | FAERS: 8 | US FAERS | |
| 129 | Sepsis | FAERS: 8 | US FAERS | |
| 130 | Somnolence | FAERS: 8 | US FAERS | |
| 131 | Thrombosis | FAERS: 8 | US FAERS | |
| 132 | Tongue discomfort | FAERS: 8 | US FAERS | |
| 133 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 134 | Choking sensation | FAERS: 7 | US FAERS | |
| 135 | Dyspepsia | FAERS: 7 | US FAERS | |
| 136 | Incorrect dose administered by device | FAERS: 7 | US FAERS | |
| 137 | Multiple allergies | FAERS: 7 | US FAERS | |
| 138 | Nonspecific reaction | FAERS: 7 | US FAERS | |
| 139 | Product availability issue | FAERS: 7 | US FAERS | |
| 140 | Weight decreased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Accidental underdose | FAERS: 6 | US FAERS | |
| 142 | Blindness | FAERS: 6 | US FAERS | |
| 143 | Device difficult to use | FAERS: 6 | US FAERS | |
| 144 | Emotional distress | FAERS: 6 | US FAERS | |
| 145 | Exposure via ingestion | FAERS: 6 | US FAERS | |
| 146 | Flushing | FAERS: 6 | US FAERS | |
| 147 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 148 | Increased bronchial secretion | FAERS: 6 | US FAERS | |
| 149 | Macular degeneration | FAERS: 6 | US FAERS | |
| 150 | Mouth swelling | FAERS: 6 | US FAERS | |
| 151 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 152 | Poor quality sleep | FAERS: 6 | US FAERS | |
| 153 | Product communication issue | FAERS: 6 | US FAERS | |
| 154 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 155 | Sneezing | FAERS: 6 | US FAERS | |
| 156 | Syncope | FAERS: 6 | US FAERS | |
| 157 | Therapy cessation | FAERS: 6 | US FAERS | |
| 158 | Upper-airway cough syndrome | FAERS: 6 | US FAERS | |
| 159 | Urinary Retention | FAERS: 6 | US FAERS | |
| 160 | Agitation | FAERS: 5 | US FAERS | |
| 161 | Blood urine present | FAERS: 5 | US FAERS | |
| 162 | Device use issue | FAERS: 5 | US FAERS | |
| 163 | Dysuria | FAERS: 5 | US FAERS | |
| 164 | Emergency Care | FAERS: 5 | US FAERS | |
| 165 | Eye irritation | FAERS: 5 | US FAERS | |
| 166 | Hip surgery | FAERS: 5 | US FAERS | |
| 167 | Middle insomnia | FAERS: 5 | US FAERS | |
| 168 | Oxygen supplementation | FAERS: 5 | US FAERS | |
| 169 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 170 | Pulmonary pain | FAERS: 5 | US FAERS | |
| 171 | Rash erythematous | FAERS: 5 | US FAERS | |
| 172 | Rotator cuff syndrome | FAERS: 5 | US FAERS | |
| 173 | Scab | FAERS: 5 | US FAERS | |
| 174 | Throat clearing | FAERS: 5 | US FAERS | |
| 175 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 176 | Abdominal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 178 | Anger | FAERS: 4 | US FAERS | |
| 179 | Anosmia | FAERS: 4 | US FAERS | |
| 180 | Apparent death | FAERS: 4 | US FAERS | |
| 181 | Cheilitis | FAERS: 4 | US FAERS | |
| 182 | Contraindicated product administered | FAERS: 4 | US FAERS | |
| 183 | Dementia | FAERS: 4 | US FAERS | |
| 184 | Euphoric mood | FAERS: 4 | US FAERS | |
| 185 | Exposure via skin contact | FAERS: 4 | US FAERS | |
| 186 | Flatulence | FAERS: 4 | US FAERS | |
| 187 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 188 | Genital infection fungal | FAERS: 4 | US FAERS | |
| 189 | Head discomfort | FAERS: 4 | US FAERS | |
| 190 | Hyperventilation | FAERS: 4 | US FAERS | |
| 191 | Hypoxia | FAERS: 4 | US FAERS | |
| 192 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 193 | Lower respiratory tract congestion | FAERS: 4 | US FAERS | |
| 194 | Neck Pain | FAERS: 4 | US FAERS | |
| 195 | Oral mucosal erythema | FAERS: 4 | US FAERS | |
| 196 | Oropharyngeal candidiasis | FAERS: 4 | US FAERS | |
| 197 | Pancreatitis | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 198 | Physical product label issue | FAERS: 4 | US FAERS | |
| 199 | Product design confusion | FAERS: 4 | US FAERS | |
| 200 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 201 | Sciatica | FAERS: 4 | US FAERS | |
| 202 | Terminal state | FAERS: 4 | US FAERS | |
| 203 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 204 | Wrong patient received medication | FAERS: 4 | US FAERS | |
| 205 | Arthropathy | FAERS: 3 | US FAERS | |
| 206 | Bronchiectasis | FAERS: 3 | US FAERS | |
| 207 | Cystitis | FAERS: 3 | US FAERS | |
| 208 | Depressed mood | FAERS: 3 | US FAERS | |
| 209 | Dermatitis | FAERS: 3 | US FAERS | |
| 210 | Device defective | FAERS: 3 | US FAERS | |
| 211 | Dry skin | FAERS: 3 | US FAERS | |
| 212 | Feeling Cold | FAERS: 3 | US FAERS | |
| 213 | Gait inability | FAERS: 3 | US FAERS | |
| 214 | Gingival blister | FAERS: 3 | US FAERS | |
| 215 | Gingival erythema | FAERS: 3 | US FAERS | |
| 216 | Hospice Care | FAERS: 3 | US FAERS | |
| 217 | Hypotension | FAERS: 3 | US FAERS | |
| 218 | Immunosuppression | FAERS: 3 | US FAERS | |
| 219 | Impaired work ability | FAERS: 3 | US FAERS | |
| 220 | Initial insomnia | FAERS: 3 | US FAERS | |
| 221 | Insurance issue | FAERS: 3 | US FAERS | |
| 222 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 223 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 224 | Joint injury | FAERS: 3 | US FAERS | |
| 225 | Limb operation | FAERS: 3 | US FAERS | |
| 226 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 227 | Muscle tightness | FAERS: 3 | US FAERS | |
| 228 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 229 | Oral infection | FAERS: 3 | US FAERS | |
| 230 | Pneumonectomy | FAERS: 3 | US FAERS | |
| 231 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 232 | Product administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 233 | Product residue present | FAERS: 3 | US FAERS | |
| 234 | Product substitution issue | FAERS: 3 | US FAERS | |
| 235 | Respiratory distress | FAERS: 3 | US FAERS | |
| 236 | Respiratory tract irritation | FAERS: 3 | US FAERS | |
| 237 | Therapeutic product effect incomplete | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Tongue blistering | FAERS: 3 | US FAERS | |
| 239 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 240 | Unevaluable event | FAERS: 3 | US FAERS | |
| 241 | Upper respiratory tract congestion | FAERS: 3 | US FAERS | |
| 242 | Vertigo | FAERS: 3 | US FAERS | |
| 243 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 244 | cancer surgery | FAERS: 3 | US FAERS | |
| 245 | colonoscopy | FAERS: 3 | US FAERS | |
| 246 | treatment failure | FAERS: 3 | US FAERS | |
| 247 | Abasia | FAERS: 2 | US FAERS | |
| 248 | Abdominal cavity drainage | FAERS: 2 | US FAERS | |
| 249 | Accidental exposure to product packaging | FAERS: 2 | US FAERS | |
| 250 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 251 | Amphetamines positive | FAERS: 2 | US FAERS | |
| 252 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 253 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 254 | Aphasia | FAERS: 2 | US FAERS | |
| 255 | Asthenopia | FAERS: 2 | US FAERS | |
| 256 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 257 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 258 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 259 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 260 | Bone pain | FAERS: 2 | US FAERS | |
| 261 | Breast Feeding | FAERS: 2 | US FAERS | |
| 262 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 263 | Cold sweat | FAERS: 2 | US FAERS | |
| 264 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 265 | Croup infectious | FAERS: 2 | US FAERS | |
| 266 | Crying | FAERS: 2 | US FAERS | |
| 267 | Deafness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 268 | Dental caries | FAERS: 2 | US FAERS | |
| 269 | Device breakage | FAERS: 2 | US FAERS | |
| 270 | Device leakage | FAERS: 2 | US FAERS | |
| 271 | Diplopia | FAERS: 2 | US FAERS | |
| 272 | Drug-disease interaction | FAERS: 2 | US FAERS | |
| 273 | Electrocardiogram QT interval abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 274 | Eructation | FAERS: 2 | US FAERS | |
| 275 | Escherichia infection | FAERS: 2 | US FAERS | |
| 276 | Facial Pain | FAERS: 2 | US FAERS | |
| 277 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 278 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 279 | Fungal pharyngitis | FAERS: 2 | US FAERS | |
| 280 | Gingival Recession | FAERS: 2 | US FAERS | |
| 281 | Glossitis | FAERS: 2 | US FAERS | |
| 282 | Hunger | FAERS: 2 | US FAERS | |
| 283 | Hypersomnia | FAERS: 2 | US FAERS | |
| 284 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 285 | Hypophagia | FAERS: 2 | US FAERS | |
| 286 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 287 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 288 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 289 | Inhalation Therapy | FAERS: 2 | US FAERS | |
| 290 | Intercepted product dispensing error | FAERS: 2 | US FAERS | |
| 291 | Intercepted product prescribing error | FAERS: 2 | US FAERS | |
| 292 | Intercepted product selection error | FAERS: 2 | US FAERS | |
| 293 | Laceration | FAERS: 2 | US FAERS | |
| 294 | Limb discomfort | FAERS: 2 | US FAERS | |
| 295 | Limb injury | FAERS: 2 | US FAERS | |
| 296 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 297 | Lung carcinoma cell type unspecified stage II | FAERS: 2 | US FAERS | |
| 298 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 299 | Medication residue present | FAERS: 2 | US FAERS | |
| 300 | Mental status changes | FAERS: 2 | US FAERS | |
| 301 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 302 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 303 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 304 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 305 | Neuralgia | FAERS: 2 | US FAERS | |
| 306 | Nocturia | FAERS: 2 | US FAERS | |
| 307 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 308 | Oral discharge | FAERS: 2 | US FAERS | |
| 309 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 310 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 311 | Pain of skin | FAERS: 2 | US FAERS | |
| 312 | Pallor | FAERS: 2 | US FAERS | |
| 313 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 314 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 315 | Photophobia | FAERS: 2 | US FAERS | |
| 316 | Pneumonitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 317 | Pneumothorax | FAERS: 2 | US FAERS | |
| 318 | Polyuria | FAERS: 2 | US FAERS | |
| 319 | Product dosage form confusion | FAERS: 2 | US FAERS | |
| 320 | Product package associated injury | FAERS: 2 | US FAERS | |
| 321 | Product packaging issue | FAERS: 2 | US FAERS | |
| 322 | Product physical issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Product preparation error | FAERS: 2 | US FAERS | |
| 324 | Product use complaint | FAERS: 2 | US FAERS | |
| 325 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 326 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 327 | Rhinalgia | FAERS: 2 | US FAERS | |
| 328 | Rhinitis | FAERS: 2 | US FAERS | |
| 329 | Sinus operation | FAERS: 2 | US FAERS | |
| 330 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 331 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 332 | Skin reaction | FAERS: 2 | US FAERS | |
| 333 | Somnambulism | FAERS: 2 | US FAERS | |
| 334 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 335 | Stress | FAERS: 2 | US FAERS | |
| 336 | Supraventricular tachycardia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 338 | Thirst | FAERS: 2 | US FAERS | |
| 339 | Thyroidectomy | FAERS: 2 | US FAERS | |
| 340 | Tinnitus | FAERS: 2 | US FAERS | |
| 341 | Tobacco user | FAERS: 2 | US FAERS | |
| 342 | Tooth Infection | FAERS: 2 | US FAERS | |
| 343 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 344 | Wound Infection | FAERS: 2 | US FAERS | |
| 345 | Wrong strength | FAERS: 2 | US FAERS | |
| 346 | furuncle | FAERS: 2 | US FAERS | |
| 347 | Abscess | FAERS: 1 | US FAERS | |
| 348 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 349 | Acne | FAERS: 1 | US FAERS | |
| 350 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 351 | Amino acid level increased | FAERS: 1 | US FAERS | |
| 352 | Aneurysm | FAERS: 1 | US FAERS | |
| 353 | Arthropod bite | FAERS: 1 | US FAERS | |
| 354 | Atelectasis | FAERS: 1 | US FAERS | |
| 355 | Atrioventricular Block | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Aura | FAERS: 1 | US FAERS | |
| 357 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 358 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 359 | Bed rest | FAERS: 1 | US FAERS | |
| 360 | Bedridden | FAERS: 1 | US FAERS | |
| 361 | Biliary Colic | FAERS: 1 | US FAERS | |
| 362 | Blepharitis | FAERS: 1 | US FAERS | |
| 363 | Blood carbon monoxide increased | FAERS: 1 | US FAERS | |
| 364 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 365 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 366 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 367 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 368 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 369 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 370 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 371 | Bradycardia | FAERS: 1 | US FAERS | |
| 372 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 373 | Bruxism | FAERS: 1 | US FAERS | |
| 374 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 375 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 376 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 377 | Cardiac ablation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 379 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 380 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 381 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 382 | Catatonia | FAERS: 1 | US FAERS | |
| 383 | Cellulitis | FAERS: 1 | US FAERS | |
| 384 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 385 | Chromaturia | FAERS: 1 | US FAERS | |
| 386 | Colitis | FAERS: 1 | US FAERS | |
| 387 | Colon cancer recurrent | FAERS: 1 | US FAERS | |
| 388 | Complication associated with device | FAERS: 1 | US FAERS | |
| 389 | Congenital cardiovascular anomaly repair | FAERS: 1 | US FAERS | |
| 390 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 391 | Conversion disorder | FAERS: 1 | US FAERS | |
| 392 | Cyst | FAERS: 1 | US FAERS | |
| 393 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 394 | Dehydration | FAERS: 1 | US FAERS | |
| 395 | Delirium | FAERS: 1 | US FAERS | |
| 396 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 397 | Device damage | FAERS: 1 | US FAERS | |
| 398 | Device effect variable | FAERS: 1 | US FAERS | |
| 399 | Device ineffective | FAERS: 1 | US FAERS | |
| 400 | Device material issue | FAERS: 1 | US FAERS | |
| 401 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 402 | Disability | FAERS: 1 | US FAERS | |
| 403 | Discontinued product administered | FAERS: 1 | US FAERS | |
| 404 | Disease Progression | FAERS: 1 | US FAERS | |
| 405 | Disease complication | FAERS: 1 | US FAERS | |
| 406 | Disease recurrence | FAERS: 1 | US FAERS | |
| 407 | Dissociation | FAERS: 1 | US FAERS | |
| 408 | Diverticulitis | FAERS: 1 | US FAERS | |
| 409 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 410 | Drug dispensing issue | FAERS: 1 | US FAERS | |
| 411 | Drug dose omission by device | FAERS: 1 | US FAERS | |
| 412 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 413 | Drug effect variable | FAERS: 1 | US FAERS | |
| 414 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 415 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 416 | Drug screen positive | FAERS: 1 | US FAERS | |
| 417 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 418 | Duodenogastric Reflux | FAERS: 1 | US FAERS | |
| 419 | Dysarthria | FAERS: 1 | US FAERS | |
| 420 | Dyschezia | FAERS: 1 | US FAERS | |
| 421 | Dystonia | FAERS: 1 | US FAERS | |
| 422 | Ear congestion | FAERS: 1 | US FAERS | |
| 423 | Economic problem | FAERS: 1 | US FAERS | |
| 424 | Elephantiasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 425 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 426 | Epiglottic erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 427 | Epiglottitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 428 | Epilepsy | FAERS: 1 | US FAERS | |
| 429 | Exposed bone in jaw | FAERS: 1 | US FAERS | |
| 430 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 431 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 432 | Exposure via contaminated device | FAERS: 1 | US FAERS | |
| 433 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 434 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 435 | Eye Infection | FAERS: 1 | US FAERS | |
| 436 | Feeding tube user | FAERS: 1 | US FAERS | |
| 437 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 438 | Fracture treatment | FAERS: 1 | US FAERS | |
| 439 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 440 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 441 | General symptom | FAERS: 1 | US FAERS | |
| 442 | Genital infection | FAERS: 1 | US FAERS | |
| 443 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 444 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 445 | Head titubation | FAERS: 1 | US FAERS | |
| 446 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 447 | Hepatitis | FAERS: 1 | US FAERS | |
| 448 | Hepatotoxicity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 449 | Hernia | FAERS: 1 | US FAERS | |
| 450 | Hirsutism | FAERS: 1 | US FAERS | |
| 451 | Hyperacusis | FAERS: 1 | US FAERS | |
| 452 | Hypokinesia | FAERS: 1 | US FAERS | |
| 453 | Hysterectomy | FAERS: 1 | US FAERS | |
| 454 | Increased viscosity of nasal secretion | FAERS: 1 | US FAERS | |
| 455 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 456 | Infarction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 457 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 458 | Inspiratory capacity decreased | FAERS: 1 | US FAERS | |
| 459 | Intention tremor | FAERS: 1 | US FAERS | |
| 460 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 461 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 462 | Iritis | FAERS: 1 | US FAERS | |
| 463 | Iron deficiency | FAERS: 1 | US FAERS | |
| 464 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 465 | Large intestinal polypectomy | FAERS: 1 | US FAERS | |
| 466 | Laryngeal erythema | FAERS: 1 | US FAERS | |
| 467 | Larynx irritation | FAERS: 1 | US FAERS | |
| 468 | Lethargy | FAERS: 1 | US FAERS | |
| 469 | Leukopenia | FAERS: 1 | US FAERS | |
| 470 | Ligament rupture | FAERS: 1 | US FAERS | |
| 471 | Lip pruritus | FAERS: 1 | US FAERS | |
| 472 | Live Birth | FAERS: 1 | US FAERS | |
| 473 | Living in residential institution | FAERS: 1 | US FAERS | |
| 474 | Lower respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 475 | Lymphoma | FAERS: 1 | US FAERS | |
| 476 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 477 | Mastication disorder | FAERS: 1 | US FAERS | |
| 478 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 479 | Meniscus injury | FAERS: 1 | US FAERS | |
| 480 | Mental impairment | FAERS: 1 | US FAERS | |
| 481 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 482 | Metastasis | FAERS: 1 | US FAERS | |
| 483 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 484 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 485 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 486 | Milk Allergy | FAERS: 1 | US FAERS | |
| 487 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 488 | Muscle strain | FAERS: 1 | US FAERS | |
| 489 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 490 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 491 | Nerve injury | FAERS: 1 | US FAERS | |
| 492 | Night sweats | FAERS: 1 | US FAERS | |
| 493 | No adverse event | FAERS: 1 | US FAERS | |
| 494 | Nodule | FAERS: 1 | US FAERS | |
| 495 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 496 | Obstruction | FAERS: 1 | US FAERS | |
| 497 | Oral administration complication | FAERS: 1 | US FAERS | |
| 498 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 499 | Oral pruritus | FAERS: 1 | US FAERS | |
| 500 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 501 | Osteoporosis | FAERS: 1 | US FAERS | |
| 502 | Ovarian cancer stage IV | FAERS: 1 | US FAERS | |
| 503 | Panic Disorder | FAERS: 1 | US FAERS | |
| 504 | Papule | FAERS: 1 | US FAERS | |
| 505 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 506 | Paranasal sinus hyposecretion | FAERS: 1 | US FAERS | |
| 507 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 508 | Personality Change | FAERS: 1 | US FAERS | |
| 509 | Personality change due to a general medical condition | FAERS: 1 | US FAERS | |
| 510 | Petechiae | FAERS: 1 | US FAERS | |
| 511 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 512 | Pharyngitis | FAERS: 1 | US FAERS | |
| 513 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 514 | Pleural Infection | FAERS: 1 | US FAERS | |
| 515 | Pleurisy | FAERS: 1 | US FAERS | |
| 516 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 517 | Post procedural infection | FAERS: 1 | US FAERS | |
| 518 | Presyncope | FAERS: 1 | US FAERS | |
| 519 | Product administration error | FAERS: 1 | US FAERS | |
| 520 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 521 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 522 | Product container seal issue | FAERS: 1 | US FAERS | |
| 523 | Product deposit | FAERS: 1 | US FAERS | |
| 524 | Product label issue | FAERS: 1 | US FAERS | |
| 525 | Product name confusion | FAERS: 1 | US FAERS | |
| 526 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 527 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 528 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 529 | Product selection error | FAERS: 1 | US FAERS | |
| 530 | Product shape issue | FAERS: 1 | US FAERS | |
| 531 | Product supply issue | FAERS: 1 | US FAERS | |
| 532 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 533 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 534 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 535 | Purpura | FAERS: 1 | US FAERS | |
| 536 | Rales | FAERS: 1 | US FAERS | |
| 537 | Regurgitation | FAERS: 1 | US FAERS | |
| 538 | Renal cyst | FAERS: 1 | US FAERS | |
| 539 | Respiratory Therapy | FAERS: 1 | US FAERS | |
| 540 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 541 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 542 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 543 | Restlessness | FAERS: 1 | US FAERS | |
| 544 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 545 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 546 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 547 | Rosacea | FAERS: 1 | US FAERS | |
| 548 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 549 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 550 | Septic Shock | FAERS: 1 | US FAERS | |
| 551 | Silicosis | FAERS: 1 | US FAERS | |
| 552 | Skin laceration | FAERS: 1 | US FAERS | |
| 553 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 554 | Skin tightness | FAERS: 1 | US FAERS | |
| 555 | Sleep Talking | FAERS: 1 | US FAERS | |
| 556 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 557 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 558 | Spirometry abnormal | FAERS: 1 | US FAERS | |
| 559 | Steroid withdrawal syndrome | FAERS: 1 | US FAERS | |
| 560 | Sudden death | FAERS: 1 | US FAERS | |
| 561 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 562 | Suspected product tampering | FAERS: 1 | US FAERS | |
| 563 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 564 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 565 | Teeth brittle | FAERS: 1 | US FAERS | |
| 566 | Tension | FAERS: 1 | US FAERS | |
| 567 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 568 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 569 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 570 | Therapy change | FAERS: 1 | US FAERS | |
| 571 | Thermal burn | FAERS: 1 | US FAERS | |
| 572 | Throat cancer | FAERS: 1 | US FAERS | |
| 573 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 574 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 575 | Tongue erythema | FAERS: 1 | US FAERS | |
| 576 | Tongue fungal infection | FAERS: 1 | US FAERS | |
| 577 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 578 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 579 | Toothache | FAERS: 1 | US FAERS | |
| 580 | Unemployment | FAERS: 1 | US FAERS | |
| 581 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 582 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 583 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 584 | Urine output increased | FAERS: 1 | US FAERS | |
| 585 | Vertebroplasty | FAERS: 1 | US FAERS | |
| 586 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 587 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 588 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 589 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 590 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 591 | Walking aid user | FAERS: 1 | US FAERS | |
| 592 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 593 | Wrong patient received product | FAERS: 1 | US FAERS | |
| 594 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 595 | intensive care | FAERS: 1 | US FAERS | |
| 596 | muscle injury | FAERS: 1 | US FAERS | |
| 597 | nervous system disorder | FAERS: 1 | US FAERS | |
| 598 | Therapeutic product effect variable | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.