Iron citrate
(HUTBITLDXCEAPZ-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)C(CC(=O)O)(CC(=O)O)O.[Fe]
- Molecular Formula:
- C6H8FeO7
- Molecular Weight:
- 247.969
- Log P:
- -1.2510
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 132.13
- CAS Number(s):
- 2338-05-8
Synonym(s)
1.
Iron citrate
2.
Auryxia
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Transferrin saturation increased | FAERS: 68 | US FAERS | |
| 2 | Constipation | FAERS: 41 | US FAERS | |
| 3 | Prescribed overdose | FAERS: 40 | US FAERS | |
| 4 | Cardiac Arrest | FAERS: 39 | US FAERS | |
| 5 | Pruritus | FAERS: 26 | US FAERS | |
| 6 | Nausea | FAERS: 25 | US FAERS | |
| 7 | Vomiting | FAERS: 25 | US FAERS | |
| 8 | Myocardial Infarction | FAERS: 22 | US FAERS | |
| 9 | Drug ineffective | FAERS: 20 | US FAERS | |
| 10 | Abdominal discomfort | FAERS: 18 | US FAERS | |
| 11 | Abdominal Pain | FAERS: 17 | US FAERS | |
| 12 | Pneumonia | FAERS: 10 | US FAERS | |
| 13 | Blood iron increased | FAERS: 9 | US FAERS | |
| 14 | Intentional product misuse | FAERS: 9 | US FAERS | |
| 15 | Alopecia | FAERS: 8 | US FAERS | |
| 16 | Chest Pain | FAERS: 7 | US FAERS | |
| 17 | Sepsis | FAERS: 7 | US FAERS | |
| 18 | Abdominal symptom | FAERS: 6 | US FAERS | |
| 19 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 20 | Infection | FAERS: 6 | US FAERS | |
| 21 | Overdose | FAERS: 6 | US FAERS | |
| 22 | Urticaria | FAERS: 6 | US FAERS | |
| 23 | Dizziness | FAERS: 5 | US FAERS | |
| 24 | Malaise | FAERS: 5 | US FAERS | |
| 25 | Calciphylaxis | FAERS: 4 | US FAERS | |
| 26 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 27 | Clostridium difficile infection | FAERS: 4 | US FAERS | |
| 28 | Dyspepsia | FAERS: 4 | US FAERS | |
| 29 | Flatulence | FAERS: 4 | US FAERS | |
| 30 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 31 | Limb injury | FAERS: 4 | US FAERS | |
| 32 | Procedural complication | FAERS: 4 | US FAERS | |
| 33 | Thrombosis | FAERS: 4 | US FAERS | |
| 34 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 35 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 36 | Blood phosphorus increased | FAERS: 3 | US FAERS | |
| 37 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 38 | Central Nervous System Infection | FAERS: 3 | US FAERS | |
| 39 | Chromaturia | FAERS: 3 | US FAERS | |
| 40 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 41 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 42 | Gangrene | FAERS: 3 | US FAERS | |
| 43 | Mental impairment | FAERS: 3 | US FAERS | |
| 44 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 45 | Therapy cessation | FAERS: 3 | US FAERS | |
| 46 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 47 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 48 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 49 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 50 | Brain Hypoxia | FAERS: 2 | US FAERS | |
| 51 | Cardiac Death | FAERS: 2 | US FAERS | |
| 52 | Cardiac pacemaker adjustment | FAERS: 2 | US FAERS | |
| 53 | Cellulitis | FAERS: 2 | US FAERS | |
| 54 | Chest discomfort | FAERS: 2 | US FAERS | |
| 55 | Complication associated with device | FAERS: 2 | US FAERS | |
| 56 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 57 | Dysgeusia | FAERS: 2 | US FAERS | |
| 58 | Fluid overload | FAERS: 2 | US FAERS | |
| 59 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 60 | Headache | FAERS: 2 | US FAERS | |
| 61 | Mental status changes | FAERS: 2 | US FAERS | |
| 62 | Myalgia | FAERS: 2 | US FAERS | |
| 63 | No adverse event | FAERS: 2 | US FAERS | |
| 64 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 65 | Pain | FAERS: 2 | US FAERS | |
| 66 | Palpitations | FAERS: 2 | US FAERS | |
| 67 | Peritonitis | FAERS: 2 | US FAERS | |
| 68 | Post procedural complication | FAERS: 2 | US FAERS | |
| 69 | Pregnancy | FAERS: 2 | US FAERS | |
| 70 | Product use issue | FAERS: 2 | US FAERS | |
| 71 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 72 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 73 | Respiratory distress | FAERS: 2 | US FAERS | |
| 74 | Septic Shock | FAERS: 2 | US FAERS | |
| 75 | Skin irritation | FAERS: 2 | US FAERS | |
| 76 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 77 | Urine output increased | FAERS: 2 | US FAERS | |
| 78 | Wound Infection | FAERS: 2 | US FAERS | |
| 79 | Abdominal mass | FAERS: 1 | US FAERS | |
| 80 | Adverse event | FAERS: 1 | US FAERS | |
| 81 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 82 | Anal Fissure | FAERS: 1 | US FAERS | |
| 83 | Asthenia | FAERS: 1 | US FAERS | |
| 84 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 85 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 86 | Blood phosphorus abnormal | FAERS: 1 | US FAERS | |
| 87 | Blood urine present | FAERS: 1 | US FAERS | |
| 88 | Calcinosis | FAERS: 1 | US FAERS | |
| 89 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 90 | Choking | FAERS: 1 | US FAERS | |
| 91 | Dehydration | FAERS: 1 | US FAERS | |
| 92 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 93 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 94 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 95 | Fatigue | FAERS: 1 | US FAERS | |
| 96 | Flushing | FAERS: 1 | US FAERS | |
| 97 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 98 | Hepatic siderosis | FAERS: 1 | US FAERS | |
| 99 | Hypercapnia | FAERS: 1 | US FAERS | |
| 100 | Hypotension | FAERS: 1 | US FAERS | |
| 101 | Implant site infection | FAERS: 1 | US FAERS | |
| 102 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 103 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 104 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 105 | Iron Overload | FAERS: 1 | US FAERS | |
| 106 | Lip swelling | FAERS: 1 | US FAERS | |
| 107 | Medication Error | FAERS: 1 | US FAERS | |
| 108 | Muscle tightness | FAERS: 1 | US FAERS | |
| 109 | Nervousness | FAERS: 1 | US FAERS | |
| 110 | Occult blood positive | FAERS: 1 | US FAERS | |
| 111 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 112 | Parathyroidectomy | FAERS: 1 | US FAERS | |
| 113 | Peptic ulcer helicobacter | FAERS: 1 | US FAERS | |
| 114 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 115 | Product label confusion | FAERS: 1 | US FAERS | |
| 116 | Product prescribing error | FAERS: 1 | US FAERS | |
| 117 | Product quality issue | FAERS: 1 | US FAERS | |
| 118 | Product use complaint | FAERS: 1 | US FAERS | |
| 119 | Psoriasis | FAERS: 1 | US FAERS | |
| 120 | Rectal abscess | FAERS: 1 | US FAERS | |
| 121 | Scab | FAERS: 1 | US FAERS | |
| 122 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 123 | Transcription medication error | FAERS: 1 | US FAERS | |
| 124 | Tremor | FAERS: 1 | US FAERS | |
| 125 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 126 | jaundice | FAERS: 1 | US FAERS | |
| 127 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.