Interleukin 1 Receptor Antagonist Protein
(HMLGSIZOMSVISS-UHFFFAOYSA-N)
Structure
- SMILES
- C=CC1=C(C(=O)O)N2C(SC1)C(C2=O)NC(=O)C(=NOCOC(=O)C(C)(C)C)c1csc(n1)N
- Molecular Formula:
- C20H23N5O7S2
- Molecular Weight:
- 509.556
- Log P:
- 1.8274
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 3
- TPSA:
- 227.05
- CAS Number(s):
- 143090-92-0
Synonym(s)
1.
Interleukin 1 Receptor Antagonist Protein
2.
Anakinra
3.
Antril
4.
IL-1 Inhibitor, Urine
5.
IL-1Ra
6.
IL1 Febrile Inhibitor
7.
Interleukin 1 Inhibitor, Urine
8.
Kineret
9.
Urine-Derived IL1 Inhibitor
10.
Febrile Inhibitor, IL1
11.
IL 1 Inhibitor, Urine
12.
IL1 Inhibitor, Urine-Derived
13.
Urine Derived IL1 Inhibitor
14.
Urine IL-1 Inhibitor
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Histiocytosis haematophagic | FAERS: 19 | US FAERS | |
| 2 | Injection site erythema | FAERS: 6 | US FAERS | |
| 3 | Drug ineffective | FAERS: 5 | US FAERS | |
| 4 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 5 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 6 | Pregnancy | FAERS: 4 | US FAERS | |
| 7 | Arthralgia | FAERS: 3 | US FAERS | |
| 8 | Cellulitis | FAERS: 3 | US FAERS | |
| 9 | Hepatitis | FAERS: 3 | US FAERS | |
| 10 | Joint warmth | FAERS: 3 | US FAERS | |
| 11 | Nausea | FAERS: 3 | US FAERS | |
| 12 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 13 | Vomiting | FAERS: 3 | US FAERS | |
| 14 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 15 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 16 | Aldolase increased | FAERS: 2 | US FAERS | |
| 17 | Arthritis | FAERS: 2 | US FAERS | |
| 18 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 19 | Atelectasis | FAERS: 2 | US FAERS | |
| 20 | Blood fibrinogen decreased | FAERS: 2 | US FAERS | |
| 21 | Dehydration | FAERS: 2 | US FAERS | |
| 22 | Disease recurrence | FAERS: 2 | US FAERS | |
| 23 | Infection | FAERS: 2 | US FAERS | |
| 24 | Injection site pain | FAERS: 2 | US FAERS | |
| 25 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 26 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 27 | Injection site warmth | FAERS: 2 | US FAERS | |
| 28 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 29 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 30 | Neutropenia | FAERS: 2 | US FAERS | |
| 31 | Post lumbar puncture syndrome | FAERS: 2 | US FAERS | |
| 32 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 33 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 34 | Urticaria | FAERS: 2 | US FAERS | |
| 35 | Abscess | FAERS: 1 | US FAERS | |
| 36 | Accidental underdose | FAERS: 1 | US FAERS | |
| 37 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 38 | Angioedema | FAERS: 1 | US FAERS | |
| 39 | Anxiety | FAERS: 1 | US FAERS | |
| 40 | Ascites | FAERS: 1 | US FAERS | |
| 41 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 42 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 43 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 44 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 45 | Bronchial wall thickening | FAERS: 1 | US FAERS | |
| 46 | Broncholithiasis | FAERS: 1 | US FAERS | |
| 47 | Chest Pain | FAERS: 1 | US FAERS | |
| 48 | Chills | FAERS: 1 | US FAERS | |
| 49 | Cytopenia | FAERS: 1 | US FAERS | |
| 50 | Disease Progression | FAERS: 1 | US FAERS | |
| 51 | Drug dose omission | FAERS: 1 | US FAERS | |
| 52 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 53 | Dyspepsia | FAERS: 1 | US FAERS | |
| 54 | Eosinophilia | FAERS: 1 | US FAERS | |
| 55 | Erythema | FAERS: 1 | US FAERS | |
| 56 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 57 | Headache | FAERS: 1 | US FAERS | |
| 58 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 59 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 60 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 61 | Hypophagia | FAERS: 1 | US FAERS | |
| 62 | Hypotension | FAERS: 1 | US FAERS | |
| 63 | Immunosuppression | FAERS: 1 | US FAERS | |
| 64 | Inflammation | FAERS: 1 | US FAERS | |
| 65 | Injection site nodule | FAERS: 1 | US FAERS | |
| 66 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 67 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 68 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 69 | Juvenile arthritis | FAERS: 1 | US FAERS | |
| 70 | Laryngospasm | FAERS: 1 | US FAERS | |
| 71 | Leishmaniasis | FAERS: 1 | US FAERS | |
| 72 | Leukopenia | FAERS: 1 | US FAERS | |
| 73 | Lip swelling | FAERS: 1 | US FAERS | |
| 74 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 75 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 76 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 77 | Lymphoma | FAERS: 1 | US FAERS | |
| 78 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 79 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 80 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 81 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 82 | Nodule | FAERS: 1 | US FAERS | |
| 83 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 84 | Paratracheal lymphadenopathy | FAERS: 1 | US FAERS | |
| 85 | Pneumonia | FAERS: 1 | US FAERS | |
| 86 | Pneumothorax | FAERS: 1 | US FAERS | |
| 87 | Post procedural complication | FAERS: 1 | US FAERS | |
| 88 | Product quality issue | FAERS: 1 | US FAERS | |
| 89 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 90 | Puncture site pain | FAERS: 1 | US FAERS | |
| 91 | Puncture site reaction | FAERS: 1 | US FAERS | |
| 92 | Rales | FAERS: 1 | US FAERS | |
| 93 | Respiratory distress | FAERS: 1 | US FAERS | |
| 94 | Retroperitoneal lymphadenopathy | FAERS: 1 | US FAERS | |
| 95 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 96 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 97 | Sepsis | FAERS: 1 | US FAERS | |
| 98 | Shock | FAERS: 1 | US FAERS | |
| 99 | Somnolence | FAERS: 1 | US FAERS | |
| 100 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 101 | Swelling | FAERS: 1 | US FAERS | |
| 102 | Transaminases increased | FAERS: 1 | US FAERS | |
| 103 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 104 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 105 | Weight decreased | FAERS: 1 | US FAERS | |
| 106 | furuncle | FAERS: 1 | US FAERS | |
| 107 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.