Lorcet
(GQIVTWIJJVAWQR-DANDVKJOSA-N)
Structure
- SMILES
- O[C@H]([C@H](C(=O)O)O)C(=O)O.CC(=O)Nc1ccc(cc1)O.COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4CCC1=O)C
- Molecular Formula:
- C30H36N2O11
- Molecular Weight:
- 600.614
- Log P:
- 1.1722
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 6
- TPSA:
- 203.16
- CAS Number(s):
- 330988-71-1
Synonym(s)
1.
Lorcet
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Completed Suicide | FAERS: 469 | US FAERS | |
| 2 | Drug ineffective | FAERS: 358 | US FAERS | |
| 3 | Nausea | FAERS: 143 | US FAERS | |
| 4 | Headache | FAERS: 121 | US FAERS | |
| 5 | Drug abuse | FAERS: 112 | US FAERS | |
| 6 | Intentional drug misuse | FAERS: 80 | US FAERS | |
| 7 | Product substitution issue | FAERS: 78 | US FAERS | |
| 8 | Toxicity to various agents | FAERS: 72 | US FAERS | |
| 9 | Vomiting | FAERS: 71 | US FAERS | |
| 10 | Malaise | FAERS: 68 | US FAERS | |
| 11 | Dizziness | FAERS: 67 | US FAERS | |
| 12 | Product quality issue | FAERS: 56 | US FAERS | |
| 13 | Respiratory arrest | FAERS: 56 | US FAERS | |
| 14 | Cardiac Arrest | FAERS: 55 | US FAERS | |
| 15 | Overdose | FAERS: 52 | US FAERS | |
| 16 | Pruritus | FAERS: 47 | US FAERS | |
| 17 | Abdominal discomfort | FAERS: 44 | US FAERS | |
| 18 | Pain | FAERS: 44 | US FAERS | |
| 19 | Feeling abnormal | FAERS: 43 | US FAERS | |
| 20 | Somnolence | FAERS: 40 | US FAERS | |
| 21 | Medication Error | FAERS: 34 | US FAERS | |
| 22 | Constipation | FAERS: 32 | US FAERS | |
| 23 | Intentional product misuse | FAERS: 25 | US FAERS | |
| 24 | Fatigue | FAERS: 24 | US FAERS | |
| 25 | Palpitations | FAERS: 24 | US FAERS | |
| 26 | Urticaria | FAERS: 24 | US FAERS | |
| 27 | Abdominal Pain | FAERS: 19 | US FAERS | |
| 28 | Anxiety | FAERS: 19 | US FAERS | |
| 29 | Drug dispensing error | FAERS: 19 | US FAERS | |
| 30 | Drug screen negative | FAERS: 18 | US FAERS | |
| 31 | Dyspepsia | FAERS: 17 | US FAERS | |
| 32 | Pharmaceutical product complaint | FAERS: 17 | US FAERS | |
| 33 | Inadequate analgesia | FAERS: 16 | US FAERS | |
| 34 | Wrong technique in product usage process | FAERS: 16 | US FAERS | |
| 35 | Product taste abnormal | FAERS: 15 | US FAERS | |
| 36 | Tremor | FAERS: 15 | US FAERS | |
| 37 | Mental status changes | FAERS: 14 | US FAERS | |
| 38 | Hypersensitivity | FAERS: 13 | US FAERS | |
| 39 | Drug screen positive | FAERS: 12 | US FAERS | |
| 40 | Product physical issue | FAERS: 12 | US FAERS | |
| 41 | Dysgeusia | FAERS: 11 | US FAERS | |
| 42 | Intentional product use issue | FAERS: 11 | US FAERS | |
| 43 | Metabolic acidosis | FAERS: 11 | US FAERS | |
| 44 | Tinnitus | FAERS: 11 | US FAERS | |
| 45 | Weight decreased | FAERS: 11 | US FAERS | |
| 46 | Angioedema | FAERS: 10 | US FAERS | |
| 47 | Asthenia | FAERS: 10 | US FAERS | |
| 48 | Chest Pain | FAERS: 10 | US FAERS | |
| 49 | Drug Dependence | FAERS: 10 | US FAERS | |
| 50 | Drug withdrawal syndrome | FAERS: 10 | US FAERS | |
| 51 | Suicide attempt | FAERS: 10 | US FAERS | |
| 52 | Suspected counterfeit product | FAERS: 10 | US FAERS | |
| 53 | Burning sensation | FAERS: 9 | US FAERS | |
| 54 | Drug diversion | FAERS: 9 | US FAERS | |
| 55 | Drug effect incomplete | FAERS: 9 | US FAERS | |
| 56 | Incorrect dose administered | FAERS: 9 | US FAERS | |
| 57 | Multiple drug overdose intentional | FAERS: 9 | US FAERS | |
| 58 | Nervousness | FAERS: 9 | US FAERS | |
| 59 | Product formulation issue | FAERS: 9 | US FAERS | |
| 60 | Therapeutic product effect incomplete | FAERS: 9 | US FAERS | |
| 61 | Back Pain | FAERS: 8 | US FAERS | |
| 62 | Extra dose administered | FAERS: 8 | US FAERS | |
| 63 | Anger | FAERS: 7 | US FAERS | |
| 64 | Neck Pain | FAERS: 7 | US FAERS | |
| 65 | Presyncope | FAERS: 7 | US FAERS | |
| 66 | Therapeutic product effect decreased | FAERS: 7 | US FAERS | |
| 67 | Chest discomfort | FAERS: 6 | US FAERS | |
| 68 | Cold sweat | FAERS: 6 | US FAERS | |
| 69 | Drug abuser | FAERS: 6 | US FAERS | |
| 70 | Drug toxicity | FAERS: 6 | US FAERS | |
| 71 | Feeling jittery | FAERS: 6 | US FAERS | |
| 72 | Oropharyngeal pain | FAERS: 6 | US FAERS | |
| 73 | Sinusitis | FAERS: 6 | US FAERS | |
| 74 | Swelling | FAERS: 6 | US FAERS | |
| 75 | Vertigo | FAERS: 6 | US FAERS | |
| 76 | Adverse event | FAERS: 5 | US FAERS | |
| 77 | Chills | FAERS: 5 | US FAERS | |
| 78 | Deafness Neurosensory | FAERS: 5 | US FAERS | |
| 79 | Disorientation | FAERS: 5 | US FAERS | |
| 80 | Drug Tolerance | FAERS: 5 | US FAERS | |
| 81 | Hypotension | FAERS: 5 | US FAERS | |
| 82 | Intentional misuse | FAERS: 5 | US FAERS | |
| 83 | Lethargy | FAERS: 5 | US FAERS | |
| 84 | Retching | FAERS: 5 | US FAERS | |
| 85 | Tachycardia | FAERS: 5 | US FAERS | |
| 86 | Therapeutic response unexpected with drug substitution | FAERS: 5 | US FAERS | |
| 87 | Unevaluable event | FAERS: 5 | US FAERS | |
| 88 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 89 | Dependence | FAERS: 4 | US FAERS | |
| 90 | Erythema | FAERS: 4 | US FAERS | |
| 91 | Euphoric mood | FAERS: 4 | US FAERS | |
| 92 | Flushing | FAERS: 4 | US FAERS | |
| 93 | Fungal test positive | FAERS: 4 | US FAERS | |
| 94 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 95 | Intercepted drug dispensing error | FAERS: 4 | US FAERS | |
| 96 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 97 | Memory impairment | FAERS: 4 | US FAERS | |
| 98 | Multiple drug overdose | FAERS: 4 | US FAERS | |
| 99 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 100 | Product dispensing error | FAERS: 4 | US FAERS | |
| 101 | Product measured potency issue | FAERS: 4 | US FAERS | |
| 102 | Transcription medication error | FAERS: 4 | US FAERS | |
| 103 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 104 | Wheezing | FAERS: 4 | US FAERS | |
| 105 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 106 | Accidental overdose | FAERS: 3 | US FAERS | |
| 107 | Agitation | FAERS: 3 | US FAERS | |
| 108 | Amnesia | FAERS: 3 | US FAERS | |
| 109 | Arthralgia | FAERS: 3 | US FAERS | |
| 110 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 111 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 112 | Crying | FAERS: 3 | US FAERS | |
| 113 | Cyanosis | FAERS: 3 | US FAERS | |
| 114 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 115 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 116 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 117 | Emotional disorder | FAERS: 3 | US FAERS | |
| 118 | Epistaxis | FAERS: 3 | US FAERS | |
| 119 | Feeling Cold | FAERS: 3 | US FAERS | |
| 120 | Hypoxia | FAERS: 3 | US FAERS | |
| 121 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 122 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 123 | Product coating issue | FAERS: 3 | US FAERS | |
| 124 | Product contamination | FAERS: 3 | US FAERS | |
| 125 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 126 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 127 | Product use issue | FAERS: 3 | US FAERS | |
| 128 | Rash erythematous | FAERS: 3 | US FAERS | |
| 129 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 130 | Renal pain | FAERS: 3 | US FAERS | |
| 131 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 132 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 133 | Syncope | FAERS: 3 | US FAERS | |
| 134 | Therapeutic product contamination | FAERS: 3 | US FAERS | |
| 135 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 136 | Therapy cessation | FAERS: 3 | US FAERS | |
| 137 | Toothache | FAERS: 3 | US FAERS | |
| 138 | Urinary Retention | FAERS: 3 | US FAERS | |
| 139 | Visual Impairment | FAERS: 3 | US FAERS | |
| 140 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 141 | Air Embolism | FAERS: 2 | US FAERS | |
| 142 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 143 | Alopecia | FAERS: 2 | US FAERS | |
| 144 | Amino acid level increased | FAERS: 2 | US FAERS | |
| 145 | Aphonia | FAERS: 2 | US FAERS | |
| 146 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 147 | Bladder pain | FAERS: 2 | US FAERS | |
| 148 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 149 | Bradycardia | FAERS: 2 | US FAERS | |
| 150 | Bronchitis | FAERS: 2 | US FAERS | |
| 151 | Choking | FAERS: 2 | US FAERS | |
| 152 | Deafness | FAERS: 2 | US FAERS | |
| 153 | Dehydration | FAERS: 2 | US FAERS | |
| 154 | Drug dispensed to wrong patient | FAERS: 2 | US FAERS | |
| 155 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 156 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 157 | Dysarthria | FAERS: 2 | US FAERS | |
| 158 | Dysphonia | FAERS: 2 | US FAERS | |
| 159 | Dysuria | FAERS: 2 | US FAERS | |
| 160 | Eructation | FAERS: 2 | US FAERS | |
| 161 | Excoriation | FAERS: 2 | US FAERS | |
| 162 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 163 | Eye irritation | FAERS: 2 | US FAERS | |
| 164 | Eye pain | FAERS: 2 | US FAERS | |
| 165 | False positive investigation result | FAERS: 2 | US FAERS | |
| 166 | Flatulence | FAERS: 2 | US FAERS | |
| 167 | Formication | FAERS: 2 | US FAERS | |
| 168 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 169 | Gastritis | FAERS: 2 | US FAERS | |
| 170 | Head discomfort | FAERS: 2 | US FAERS | |
| 171 | Impaired work ability | FAERS: 2 | US FAERS | |
| 172 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 173 | Initial insomnia | FAERS: 2 | US FAERS | |
| 174 | Joint swelling | FAERS: 2 | US FAERS | |
| 175 | Limb discomfort | FAERS: 2 | US FAERS | |
| 176 | Medication residue present | FAERS: 2 | US FAERS | |
| 177 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 178 | Myalgia | FAERS: 2 | US FAERS | |
| 179 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 180 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 181 | Ocular icterus | FAERS: 2 | US FAERS | |
| 182 | Oral pain | FAERS: 2 | US FAERS | |
| 183 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 184 | Paranoia | FAERS: 2 | US FAERS | |
| 185 | Personality Change | FAERS: 2 | US FAERS | |
| 186 | Pharmaceutical product counterfeit | FAERS: 2 | US FAERS | |
| 187 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 188 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 189 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 190 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 191 | Restlessness | FAERS: 2 | US FAERS | |
| 192 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 193 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 194 | Sluggishness | FAERS: 2 | US FAERS | |
| 195 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 196 | Tablet issue | FAERS: 2 | US FAERS | |
| 197 | Tension Headache | FAERS: 2 | US FAERS | |
| 198 | Therapeutic product effect variable | FAERS: 2 | US FAERS | |
| 199 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 200 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 201 | Wrong schedule | FAERS: 2 | US FAERS | |
| 202 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 203 | treatment failure | FAERS: 2 | US FAERS | |
| 204 | Abasia | FAERS: 1 | US FAERS | |
| 205 | Accidental exposure | FAERS: 1 | US FAERS | |
| 206 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 207 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 208 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 209 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 210 | Analgesic drug level above therapeutic | FAERS: 1 | US FAERS | |
| 211 | Analgesic drug level increased | FAERS: 1 | US FAERS | |
| 212 | Anti-cyclic citrullinated peptide antibody | FAERS: 1 | US FAERS | |
| 213 | Apathy | FAERS: 1 | US FAERS | |
| 214 | Arthritis | FAERS: 1 | US FAERS | |
| 215 | Asphyxia | FAERS: 1 | US FAERS | |
| 216 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 217 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 218 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 219 | Bladder spasm | FAERS: 1 | US FAERS | |
| 220 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 221 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 222 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 223 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 224 | Bone pain | FAERS: 1 | US FAERS | |
| 225 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 226 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 227 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 228 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 229 | Bruxism | FAERS: 1 | US FAERS | |
| 230 | Cancer Pain | FAERS: 1 | US FAERS | |
| 231 | Candidiasis | FAERS: 1 | US FAERS | |
| 232 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 233 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 234 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 235 | Cellulitis | FAERS: 1 | US FAERS | |
| 236 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 237 | Chemical injury | FAERS: 1 | US FAERS | |
| 238 | Choking sensation | FAERS: 1 | US FAERS | |
| 239 | Chromaturia | FAERS: 1 | US FAERS | |
| 240 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 241 | Delirium | FAERS: 1 | US FAERS | |
| 242 | Dementia | FAERS: 1 | US FAERS | |
| 243 | Diplopia | FAERS: 1 | US FAERS | |
| 244 | Discomfort | FAERS: 1 | US FAERS | |
| 245 | Drooling | FAERS: 1 | US FAERS | |
| 246 | Drug dose omission | FAERS: 1 | US FAERS | |
| 247 | Drug effect variable | FAERS: 1 | US FAERS | |
| 248 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 249 | Drug level decreased | FAERS: 1 | US FAERS | |
| 250 | Ductus arteriosus premature closure | FAERS: 1 | US FAERS | |
| 251 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 252 | Early satiety | FAERS: 1 | US FAERS | |
| 253 | Embolism | FAERS: 1 | US FAERS | |
| 254 | Emotional distress | FAERS: 1 | US FAERS | |
| 255 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 256 | Expired product administered | FAERS: 1 | US FAERS | |
| 257 | False negative investigation result | FAERS: 1 | US FAERS | |
| 258 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 259 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 260 | Flank Pain | FAERS: 1 | US FAERS | |
| 261 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 262 | Hernia | FAERS: 1 | US FAERS | |
| 263 | Hunger | FAERS: 1 | US FAERS | |
| 264 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 265 | Hypokinesia | FAERS: 1 | US FAERS | |
| 266 | Hypoventilation | FAERS: 1 | US FAERS | |
| 267 | Ileus | FAERS: 1 | US FAERS | |
| 268 | Immobile | FAERS: 1 | US FAERS | |
| 269 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 270 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 271 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 272 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 273 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 274 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 275 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 276 | Influenza | FAERS: 1 | US FAERS | |
| 277 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 278 | Intercepted wrong patient selected | FAERS: 1 | US FAERS | |
| 279 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 280 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 281 | Joint stiffness | FAERS: 1 | US FAERS | |
| 282 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 283 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 284 | Ligament injury | FAERS: 1 | US FAERS | |
| 285 | Lip swelling | FAERS: 1 | US FAERS | |
| 286 | Loose tooth | FAERS: 1 | US FAERS | |
| 287 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 288 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 289 | Mastication disorder | FAERS: 1 | US FAERS | |
| 290 | Medication overuse headache | FAERS: 1 | US FAERS | |
| 291 | Mental impairment | FAERS: 1 | US FAERS | |
| 292 | Moaning | FAERS: 1 | US FAERS | |
| 293 | Mood swings | FAERS: 1 | US FAERS | |
| 294 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 295 | Muscle tightness | FAERS: 1 | US FAERS | |
| 296 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 297 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 298 | Nerve injury | FAERS: 1 | US FAERS | |
| 299 | Neuralgia | FAERS: 1 | US FAERS | |
| 300 | Night sweats | FAERS: 1 | US FAERS | |
| 301 | No adverse event | FAERS: 1 | US FAERS | |
| 302 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 303 | Oral Cavity Fistula | FAERS: 1 | US FAERS | |
| 304 | Ototoxicity | FAERS: 1 | US FAERS | |
| 305 | Pallor | FAERS: 1 | US FAERS | |
| 306 | Photophobia | FAERS: 1 | US FAERS | |
| 307 | Physical product label issue | FAERS: 1 | US FAERS | |
| 308 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 309 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 310 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 311 | Product commingling | FAERS: 1 | US FAERS | |
| 312 | Product complaint | FAERS: 1 | US FAERS | |
| 313 | Product dose omission | FAERS: 1 | US FAERS | |
| 314 | Product friable | FAERS: 1 | US FAERS | |
| 315 | Product label confusion | FAERS: 1 | US FAERS | |
| 316 | Product shape issue | FAERS: 1 | US FAERS | |
| 317 | Product size issue | FAERS: 1 | US FAERS | |
| 318 | Product substitution | FAERS: 1 | US FAERS | |
| 319 | Product use complaint | FAERS: 1 | US FAERS | |
| 320 | Productive Cough | FAERS: 1 | US FAERS | |
| 321 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 322 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 323 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 324 | Pulmonary artery stenosis | FAERS: 1 | US FAERS | |
| 325 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 326 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 327 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 328 | Pyroglutamate increased | FAERS: 1 | US FAERS | |
| 329 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 330 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 331 | Respiratory distress | FAERS: 1 | US FAERS | |
| 332 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 333 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 334 | Scab | FAERS: 1 | US FAERS | |
| 335 | Screaming | FAERS: 1 | US FAERS | |
| 336 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 337 | Sepsis | FAERS: 1 | US FAERS | |
| 338 | Septic Shock | FAERS: 1 | US FAERS | |
| 339 | Shock | FAERS: 1 | US FAERS | |
| 340 | Sinus headache | FAERS: 1 | US FAERS | |
| 341 | Skin laceration | FAERS: 1 | US FAERS | |
| 342 | Sneezing | FAERS: 1 | US FAERS | |
| 343 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 344 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 345 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 346 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 347 | Theft | FAERS: 1 | US FAERS | |
| 348 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 349 | Therapy change | FAERS: 1 | US FAERS | |
| 350 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 351 | Throat irritation | FAERS: 1 | US FAERS | |
| 352 | Thrombosis | FAERS: 1 | US FAERS | |
| 353 | Tongue blistering | FAERS: 1 | US FAERS | |
| 354 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 355 | Tooth Loss | FAERS: 1 | US FAERS | |
| 356 | Trismus | FAERS: 1 | US FAERS | |
| 357 | Upper airway necrosis | FAERS: 1 | US FAERS | |
| 358 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 359 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 360 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 361 | White blood cell count decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.