Dichlorphenamide
(GJQPMPFPNINLKP-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc(cc(c1Cl)S(=O)(=O)N)S(=O)(=O)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- G01AE10; S01EC02
- Molecular Formula:
- C6H6Cl2N2O4S2
- Molecular Weight:
- 305.159
- Log P:
- 3.8504
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 137.08
- CAS Number(s):
- 120-97-8
Synonym(s)
1.
Dichlorphenamide
2.
Diclofenamid
3.
Daranide
4.
Dichlofenamide
5.
Glauconide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 81 | SIDER US FAERS | |
| 2 | Disease recurrence | FAERS: 79 | US FAERS | |
| 3 | Feeling abnormal | FAERS: 53 | SIDER US FAERS | |
| 4 | Dizziness | FAERS: 45 | SIDER US FAERS | |
| 5 | Nausea | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Dysgeusia | FAERS: 42 | US FAERS | |
| 7 | Intentional product use issue | FAERS: 31 | US FAERS | |
| 8 | Malaise | FAERS: 30 | US FAERS | |
| 9 | Asthenia | FAERS: 28 | SIDER US FAERS | |
| 10 | Drug dose omission | FAERS: 27 | US FAERS | |
| 11 | Headache | FAERS: 27 | SIDER US FAERS | |
| 12 | Weight decreased | FAERS: 26 | SIDER US FAERS | |
| 13 | Blood potassium decreased | FAERS: 24 | US FAERS | |
| 14 | Memory impairment | FAERS: 22 | US FAERS | |
| 15 | Abdominal discomfort | FAERS: 20 | US FAERS | |
| 16 | Nasopharyngitis | FAERS: 20 | US FAERS | |
| 17 | Drug ineffective | FAERS: 19 | US FAERS | |
| 18 | Influenza | FAERS: 19 | US FAERS | |
| 19 | Myalgia | FAERS: 16 | US FAERS | |
| 20 | Prescribed underdose | FAERS: 15 | US FAERS | |
| 21 | Arthralgia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Aphasia | FAERS: 13 | US FAERS | |
| 23 | Somnolence | FAERS: 13 | SIDER US FAERS | |
| 24 | Intentional dose omission | FAERS: 12 | US FAERS | |
| 25 | Nephrolithiasis | FAERS: 12 | SIDER US FAERS | |
| 26 | Pain | FAERS: 12 | US FAERS | |
| 27 | Drug effect incomplete | FAERS: 11 | US FAERS | |
| 28 | Product dose omission | FAERS: 10 | US FAERS | |
| 29 | Pruritus | FAERS: 10 | SIDER US FAERS | |
| 30 | Amnesia | FAERS: 8 | US FAERS | |
| 31 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 32 | Polyuria | FAERS: 8 | US FAERS | |
| 33 | Sinusitis | FAERS: 8 | US FAERS | |
| 34 | Visual Impairment | FAERS: 8 | US FAERS | |
| 35 | Anxiety | FAERS: 7 | US FAERS | |
| 36 | Dyspepsia | FAERS: 7 | SIDER US FAERS | |
| 37 | Palpitations | FAERS: 7 | US FAERS | |
| 38 | Therapeutic response unexpected | FAERS: 7 | US FAERS | |
| 39 | Vomiting | FAERS: 7 | SIDER US FAERS | |
| 40 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 41 | Back Pain | FAERS: 6 | US FAERS | |
| 42 | Dehydration | FAERS: 6 | US FAERS | |
| 43 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 44 | Mental impairment | FAERS: 6 | US FAERS | |
| 45 | Tinnitus | FAERS: 6 | SIDER US FAERS | |
| 46 | Bronchitis | FAERS: 5 | US FAERS | |
| 47 | Depressed mood | FAERS: 5 | US FAERS | |
| 48 | Diplopia | FAERS: 5 | US FAERS | |
| 49 | Feeling Cold | FAERS: 5 | US FAERS | |
| 50 | Hunger | FAERS: 5 | US FAERS | |
| 51 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 52 | Pneumonia | FAERS: 5 | US FAERS | |
| 53 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 54 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 55 | Chest discomfort | FAERS: 4 | US FAERS | |
| 56 | Chills | FAERS: 4 | US FAERS | |
| 57 | Disorientation | FAERS: 4 | SIDER US FAERS | |
| 58 | Hypersomnia | FAERS: 4 | US FAERS | |
| 59 | Lethargy | FAERS: 4 | US FAERS | |
| 60 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 61 | Metabolic acidosis | FAERS: 4 | SIDER US FAERS | |
| 62 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 63 | Syncope | FAERS: 4 | US FAERS | |
| 64 | Tooth Infection | FAERS: 4 | US FAERS | |
| 65 | Tremor | FAERS: 4 | SIDER US FAERS | |
| 66 | Acidosis | FAERS: 3 | US FAERS | |
| 67 | Adverse event | FAERS: 3 | US FAERS | |
| 68 | Asthenopia | FAERS: 3 | US FAERS | |
| 69 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 70 | Burning sensation | FAERS: 3 | US FAERS | |
| 71 | Chest Pain | FAERS: 3 | US FAERS | |
| 72 | Chromaturia | FAERS: 3 | US FAERS | |
| 73 | Constipation | FAERS: 3 | SIDER US FAERS | |
| 74 | Disease Progression | FAERS: 3 | US FAERS | |
| 75 | Erythema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Eye pain | FAERS: 3 | US FAERS | |
| 77 | Head discomfort | FAERS: 3 | US FAERS | |
| 78 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 79 | Hypogeusia | FAERS: 3 | US FAERS | |
| 80 | Hypokinesia | FAERS: 3 | US FAERS | |
| 81 | Hypotension | FAERS: 3 | US FAERS | |
| 82 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 83 | Limb discomfort | FAERS: 3 | US FAERS | |
| 84 | Nocturia | FAERS: 3 | US FAERS | |
| 85 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 86 | Product use issue | FAERS: 3 | US FAERS | |
| 87 | Renal pain | FAERS: 3 | US FAERS | |
| 88 | Sunburn | FAERS: 3 | US FAERS | |
| 89 | Thirst | FAERS: 3 | US FAERS | |
| 90 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 91 | Vertigo | FAERS: 3 | US FAERS | |
| 92 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 93 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 94 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 95 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 96 | Bradycardia | FAERS: 2 | US FAERS | |
| 97 | Drug effect variable | FAERS: 2 | US FAERS | |
| 98 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 99 | Dysarthria | FAERS: 2 | US FAERS | |
| 100 | Dysmetropsia | FAERS: 2 | US FAERS | |
| 101 | Ear discomfort | FAERS: 2 | US FAERS | |
| 102 | Epistaxis | FAERS: 2 | US FAERS | |
| 103 | Eructation | FAERS: 2 | US FAERS | |
| 104 | Gout | FAERS: 2 | US FAERS | |
| 105 | Infection | FAERS: 2 | US FAERS | |
| 106 | Initial insomnia | FAERS: 2 | US FAERS | |
| 107 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 108 | Medication Error | FAERS: 2 | US FAERS | |
| 109 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 110 | Myopathy | FAERS: 2 | US FAERS | |
| 111 | Nervousness | FAERS: 2 | SIDER US FAERS | |
| 112 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 113 | Paranoia | FAERS: 2 | US FAERS | |
| 114 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 115 | Polydipsia | FAERS: 2 | US FAERS | |
| 116 | Restlessness | FAERS: 2 | US FAERS | |
| 117 | Secretion discharge | FAERS: 2 | US FAERS | |
| 118 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 119 | Skin irritation | FAERS: 2 | US FAERS | |
| 120 | Sluggishness | FAERS: 2 | US FAERS | |
| 121 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 122 | Stress at work | FAERS: 2 | US FAERS | |
| 123 | Symptom recurrence | FAERS: 2 | US FAERS | |
| 124 | Throat irritation | FAERS: 2 | US FAERS | |
| 125 | Trismus | FAERS: 2 | US FAERS | |
| 126 | Unevaluable event | FAERS: 2 | US FAERS | |
| 127 | Urticaria | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | furuncle | FAERS: 2 | US FAERS | |
| 129 | Abasia | FAERS: 1 | US FAERS | |
| 130 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 131 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 132 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 133 | Alopecia | FAERS: 1 | US FAERS | |
| 134 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 135 | Apathy | FAERS: 1 | US FAERS | |
| 136 | Ataxia | FAERS: 1 | SIDER US FAERS | |
| 137 | Back disorder | FAERS: 1 | US FAERS | |
| 138 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 139 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 140 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 141 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 142 | Bone pain | FAERS: 1 | US FAERS | |
| 143 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 144 | Cataract operation | FAERS: 1 | US FAERS | |
| 145 | Cellulitis | FAERS: 1 | US FAERS | |
| 146 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 147 | Chemotherapy | FAERS: 1 | US FAERS | |
| 148 | Colitis | FAERS: 1 | US FAERS | |
| 149 | Crying | FAERS: 1 | US FAERS | |
| 150 | Cyst | FAERS: 1 | US FAERS | |
| 151 | Diplegia | FAERS: 1 | US FAERS | |
| 152 | Discontinued product administered | FAERS: 1 | US FAERS | |
| 153 | Diverticulitis | FAERS: 1 | US FAERS | |
| 154 | Drooling | FAERS: 1 | US FAERS | |
| 155 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 156 | Dry skin | FAERS: 1 | US FAERS | |
| 157 | Electrolyte imbalance | FAERS: 1 | SIDER US FAERS | |
| 158 | Emotional distress | FAERS: 1 | US FAERS | |
| 159 | Epicondylitis | FAERS: 1 | US FAERS | |
| 160 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 161 | Exophthalmos | FAERS: 1 | US FAERS | |
| 162 | Extra dose administered | FAERS: 1 | US FAERS | |
| 163 | Eye irritation | FAERS: 1 | US FAERS | |
| 164 | Facial Pain | FAERS: 1 | US FAERS | |
| 165 | Feeling jittery | FAERS: 1 | US FAERS | |
| 166 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 167 | Flat affect | FAERS: 1 | US FAERS | |
| 168 | Food Poisoning | FAERS: 1 | US FAERS | |
| 169 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 170 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 171 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 172 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 173 | Glaucoma | FAERS: 1 | US FAERS | |
| 174 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 175 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 176 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 177 | Impaired work ability | FAERS: 1 | US FAERS | |
| 178 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 179 | Incoherent | FAERS: 1 | US FAERS | |
| 180 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 181 | Joint injury | FAERS: 1 | US FAERS | |
| 182 | Joint stiffness | FAERS: 1 | US FAERS | |
| 183 | Joint swelling | FAERS: 1 | US FAERS | |
| 184 | Laryngitis | FAERS: 1 | US FAERS | |
| 185 | Limb injury | FAERS: 1 | US FAERS | |
| 186 | Lip swelling | FAERS: 1 | US FAERS | |
| 187 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 188 | Lyme Disease | FAERS: 1 | US FAERS | |
| 189 | Mastectomy | FAERS: 1 | US FAERS | |
| 190 | Mouth swelling | FAERS: 1 | US FAERS | |
| 191 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 192 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 193 | Muscle tightness | FAERS: 1 | US FAERS | |
| 194 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 195 | Myotonia | FAERS: 1 | US FAERS | |
| 196 | Nerve injury | FAERS: 1 | US FAERS | |
| 197 | Neuralgia | FAERS: 1 | US FAERS | |
| 198 | Osteopenia | FAERS: 1 | US FAERS | |
| 199 | Periarthritis | FAERS: 1 | US FAERS | |
| 200 | Photophobia | FAERS: 1 | US FAERS | |
| 201 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 202 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 203 | Pregnancy | FAERS: 1 | US FAERS | |
| 204 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 205 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 206 | Product substitution issue | FAERS: 1 | US FAERS | |
| 207 | Productive Cough | FAERS: 1 | US FAERS | |
| 208 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 209 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 210 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 211 | Salt craving | FAERS: 1 | US FAERS | |
| 212 | Sciatica | FAERS: 1 | US FAERS | |
| 213 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 214 | Stress | FAERS: 1 | US FAERS | |
| 215 | Swelling | FAERS: 1 | US FAERS | |
| 216 | Tachycardia | FAERS: 1 | US FAERS | |
| 217 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 218 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 219 | Therapy change | FAERS: 1 | US FAERS | |
| 220 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 221 | Tongue pigmentation | FAERS: 1 | US FAERS | |
| 222 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 223 | Urinary Retention | FAERS: 1 | US FAERS | |
| 224 | Vein collapse | FAERS: 1 | US FAERS | |
| 225 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 226 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 227 | Wheelchair user | FAERS: 1 | US FAERS | |
| 228 | muscle injury | FAERS: 1 | US FAERS | |
| 229 | Agranulocytosis | SIDER | ||
| 230 | Anorexia | SIDER | ||
| 231 | Conversion disorder | SIDER | ||
| 232 | Discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 233 | Drowsiness | SIDER | ||
| 234 | Hepatic Insufficiency | SIDER | ||
| 235 | Lassitude | SIDER | ||
| 236 | Leukopenia | SIDER | ||
| 237 | Pallor | Canada Vigilance: 1 | Canada Vigilance | |
| 238 | Rash erythematous | Canada Vigilance: 1 | Canada Vigilance | |
| 239 | Renal Colic | SIDER | ||
| 240 | Tension | SIDER | ||
| 241 | Thrombocytopenia | SIDER | ||
| 242 | Urine phosphorus increased | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.