nefazodone
(DYCKFEBIOUQECE-UHFFFAOYSA-N)
Structure
- SMILES
- CCc1nn(c(=O)n1CCOc1ccccc1)CCCN1CCN(CC1)c1cccc(c1)Cl.Cl
- Molecular Formula:
- C25H33Cl2N5O2
- Molecular Weight:
- 506.468
- Log P:
- 4.3568
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 55.53
- CAS Number(s):
- 82752-99-6
Synonym(s)
1.
nefazodone
2.
Apo-Nefazodone
3.
Dutonin
4.
Lin-Nefazodone
5.
Menfazona
6.
Nefadar
7.
Rulivan
8.
Serzone
9.
nefazodone hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 36 | US FAERS | |
| 2 | Chromaturia | FAERS: 24 | US FAERS | |
| 3 | Fatigue | FAERS: 23 | US FAERS | |
| 4 | Hepatitis C | FAERS: 23 | US FAERS | |
| 5 | Dizziness | FAERS: 21 | US FAERS | |
| 6 | Alanine Aminotransferase Increased | FAERS: 19 | US FAERS | |
| 7 | Anorexia | FAERS: 19 | US FAERS | |
| 8 | Aspartate Aminotransferase Increased | FAERS: 17 | US FAERS | |
| 9 | Weight decreased | FAERS: 14 | US FAERS | |
| 10 | Abdominal Pain | FAERS: 13 | US FAERS | |
| 11 | Drug ineffective | FAERS: 13 | US FAERS | |
| 12 | Anxiety | FAERS: 12 | US FAERS | |
| 13 | jaundice | FAERS: 12 | US FAERS | |
| 14 | Malaise | FAERS: 11 | US FAERS | |
| 15 | Constipation | FAERS: 10 | US FAERS | |
| 16 | Visual disturbance | FAERS: 10 | US FAERS | |
| 17 | Amnesia | FAERS: 9 | US FAERS | |
| 18 | Completed Suicide | FAERS: 9 | US FAERS | |
| 19 | Headache | FAERS: 9 | US FAERS | |
| 20 | Pharmaceutical product complaint | FAERS: 9 | US FAERS | |
| 21 | Vomiting | FAERS: 9 | US FAERS | |
| 22 | Hepatitis | FAERS: 8 | US FAERS | |
| 23 | Pain | FAERS: 8 | US FAERS | |
| 24 | Somnolence | FAERS: 8 | US FAERS | |
| 25 | Asthenia | FAERS: 7 | US FAERS | |
| 26 | Drug exposure during pregnancy | FAERS: 7 | US FAERS | |
| 27 | Medication Error | FAERS: 7 | US FAERS | |
| 28 | Agitation | FAERS: 6 | US FAERS | |
| 29 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 30 | Hepatomegaly | FAERS: 6 | US FAERS | |
| 31 | Sexual Dysfunction | FAERS: 6 | US FAERS | |
| 32 | Arthralgia | FAERS: 5 | US FAERS | |
| 33 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 34 | Chills | FAERS: 5 | US FAERS | |
| 35 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 36 | Pregnancy | FAERS: 5 | US FAERS | |
| 37 | Priapism | FAERS: 5 | US FAERS | |
| 38 | Back Pain | FAERS: 4 | US FAERS | |
| 39 | Chest Pain | FAERS: 4 | US FAERS | |
| 40 | Drug toxicity | FAERS: 4 | US FAERS | |
| 41 | Feeling Cold | FAERS: 4 | US FAERS | |
| 42 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 43 | Nervousness | FAERS: 4 | US FAERS | |
| 44 | Tremor | FAERS: 4 | US FAERS | |
| 45 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 46 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 47 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 48 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 49 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 50 | Mood swings | FAERS: 3 | US FAERS | |
| 51 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 52 | Overdose | FAERS: 3 | US FAERS | |
| 53 | Palpitations | FAERS: 3 | US FAERS | |
| 54 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 55 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 56 | Tinnitus | FAERS: 3 | US FAERS | |
| 57 | Unevaluable event | FAERS: 3 | US FAERS | |
| 58 | Urticaria | FAERS: 3 | US FAERS | |
| 59 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 60 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 61 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 62 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 63 | Burning sensation | FAERS: 2 | US FAERS | |
| 64 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 65 | Cholestasis | FAERS: 2 | US FAERS | |
| 66 | Deafness | FAERS: 2 | US FAERS | |
| 67 | Dehydration | FAERS: 2 | US FAERS | |
| 68 | Dysgeusia | FAERS: 2 | US FAERS | |
| 69 | Dyspepsia | FAERS: 2 | US FAERS | |
| 70 | Eczema | FAERS: 2 | US FAERS | |
| 71 | Feeling jittery | FAERS: 2 | US FAERS | |
| 72 | Food aversion | FAERS: 2 | US FAERS | |
| 73 | Hepatitis A | FAERS: 2 | US FAERS | |
| 74 | Infertility | FAERS: 2 | US FAERS | |
| 75 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 76 | Lethargy | FAERS: 2 | US FAERS | |
| 77 | Mental status changes | FAERS: 2 | US FAERS | |
| 78 | Myalgia | FAERS: 2 | US FAERS | |
| 79 | Night sweats | FAERS: 2 | US FAERS | |
| 80 | Pruritus | FAERS: 2 | US FAERS | |
| 81 | Suicide attempt | FAERS: 2 | US FAERS | |
| 82 | Thrombosis | FAERS: 2 | US FAERS | |
| 83 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 84 | Acne | FAERS: 1 | US FAERS | |
| 85 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 86 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 87 | Adverse event | FAERS: 1 | US FAERS | |
| 88 | Ageusia | FAERS: 1 | US FAERS | |
| 89 | Akathisia | FAERS: 1 | US FAERS | |
| 90 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 91 | Alopecia | FAERS: 1 | US FAERS | |
| 92 | Ammonia increased | FAERS: 1 | US FAERS | |
| 93 | Amputation | FAERS: 1 | US FAERS | |
| 94 | Anger | FAERS: 1 | US FAERS | |
| 95 | Antibody test positive | FAERS: 1 | US FAERS | |
| 96 | Asthma | FAERS: 1 | US FAERS | |
| 97 | Blepharitis | FAERS: 1 | US FAERS | |
| 98 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 99 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 100 | Blood urea increased | FAERS: 1 | US FAERS | |
| 101 | Bradycardia | FAERS: 1 | US FAERS | |
| 102 | Bronchitis | FAERS: 1 | US FAERS | |
| 103 | Candida sepsis | FAERS: 1 | US FAERS | |
| 104 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 105 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 106 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 107 | Cataract | FAERS: 1 | US FAERS | |
| 108 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 109 | Chest discomfort | FAERS: 1 | US FAERS | |
| 110 | Cholecystitis | FAERS: 1 | US FAERS | |
| 111 | Cognitive deterioration | FAERS: 1 | US FAERS | |
| 112 | Colitis | FAERS: 1 | US FAERS | |
| 113 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 114 | Crying | FAERS: 1 | US FAERS | |
| 115 | Cyst | FAERS: 1 | US FAERS | |
| 116 | Dental caries | FAERS: 1 | US FAERS | |
| 117 | Depression suicidal | FAERS: 1 | US FAERS | |
| 118 | Disorientation | FAERS: 1 | US FAERS | |
| 119 | Drowning | FAERS: 1 | US FAERS | |
| 120 | Drug Dependence | FAERS: 1 | US FAERS | |
| 121 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 122 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 123 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 124 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 125 | Dysuria | FAERS: 1 | US FAERS | |
| 126 | Epididymitis | FAERS: 1 | US FAERS | |
| 127 | Erection increased | FAERS: 1 | US FAERS | |
| 128 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 129 | Excitability | FAERS: 1 | US FAERS | |
| 130 | Eye irritation | FAERS: 1 | US FAERS | |
| 131 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 132 | Flight of ideas | FAERS: 1 | US FAERS | |
| 133 | Flushing | FAERS: 1 | US FAERS | |
| 134 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 135 | Gout | FAERS: 1 | US FAERS | |
| 136 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 137 | Hepatoblastoma | FAERS: 1 | US FAERS | |
| 138 | Hirsutism | FAERS: 1 | US FAERS | |
| 139 | Hypersomnia | FAERS: 1 | US FAERS | |
| 140 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 141 | Hypotension | FAERS: 1 | US FAERS | |
| 142 | Immature respiratory system | FAERS: 1 | US FAERS | |
| 143 | Impaired work ability | FAERS: 1 | US FAERS | |
| 144 | Incoherent | FAERS: 1 | US FAERS | |
| 145 | Incontinence | FAERS: 1 | US FAERS | |
| 146 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 147 | Laryngitis | FAERS: 1 | US FAERS | |
| 148 | Liver Abscess | FAERS: 1 | US FAERS | |
| 149 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 150 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 151 | Malignant melanoma of sites other than skin | FAERS: 1 | US FAERS | |
| 152 | Memory impairment | FAERS: 1 | US FAERS | |
| 153 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 154 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 155 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 156 | Mydriasis | FAERS: 1 | US FAERS | |
| 157 | Ocular icterus | FAERS: 1 | US FAERS | |
| 158 | Oculogyration | FAERS: 1 | US FAERS | |
| 159 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 160 | Paranoia | FAERS: 1 | US FAERS | |
| 161 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 162 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 163 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 164 | Portal triaditis | FAERS: 1 | US FAERS | |
| 165 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 166 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 167 | Scotoma | FAERS: 1 | US FAERS | |
| 168 | Sepsis | FAERS: 1 | US FAERS | |
| 169 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 170 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 171 | Sinusitis | FAERS: 1 | US FAERS | |
| 172 | Splenic neoplasm malignancy unspecified | FAERS: 1 | US FAERS | |
| 173 | Splenomegaly | FAERS: 1 | US FAERS | |
| 174 | Syncope | FAERS: 1 | US FAERS | |
| 175 | Theft | FAERS: 1 | US FAERS | |
| 176 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 177 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 178 | Thirst | FAERS: 1 | US FAERS | |
| 179 | Tooth Loss | FAERS: 1 | US FAERS | |
| 180 | Torticollis | FAERS: 1 | US FAERS | |
| 181 | Trismus | FAERS: 1 | US FAERS | |
| 182 | Ulcer | FAERS: 1 | US FAERS | |
| 183 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 184 | Urinary Retention | FAERS: 1 | US FAERS | |
| 185 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 186 | Vertigo | FAERS: 1 | US FAERS | |
| 187 | Visual Impairment | FAERS: 1 | US FAERS | |
| 188 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 189 | Wrong technique in product usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.