Loteprednol Etabonate
(DMKSVUSAATWOCU-HROMYWEYSA-N)
Structure
- SMILES
- ClCOC(=O)[C@]1(CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)C=C[C@]12C)OC(=O)OCC
- Type(s)
- Approved
- Molecular Formula:
- C24H31ClO7
- Molecular Weight:
- 466.952
- Log P:
- 3.9165
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 99.13
- CAS Number(s):
- 82034-46-6
Synonym(s)
1.
Loteprednol Etabonate
2.
Alrex
3.
CEHOAC
4.
Chloromethyl 17-ethoxycarbonyloxy-11-hydroxy-3-oxoandrosta-1,4-diene-17-carboxylate
5.
Lotemax
6.
Loteprednol
7.
17-ethoxycarbonyloxy-11-hydroxy-3-oxoandrosta-1,4-diene-17-carboxylate, Chloromethyl
8.
Chloromethyl 17 ethoxycarbonyloxy 11 hydroxy 3 oxoandrosta 1,4 diene 17 carboxylate
9.
Etabonate, Loteprednol
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 60 | US FAERS | |
| 2 | Eye pain | FAERS: 41 | OFFSIDES US FAERS | |
| 3 | Drug ineffective | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Headache | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Foreign body sensation in eyes | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Drug ineffective for unapproved indication | FAERS: 12 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 11 | US FAERS | |
| 8 | Ocular discomfort | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 9 | Visual Impairment | FAERS: 10 | US FAERS | |
| 10 | Burning sensation | FAERS: 9 | US FAERS | |
| 11 | No adverse event | FAERS: 9 | US FAERS | |
| 12 | Erythema | FAERS: 8 | OFFSIDES US FAERS | |
| 13 | Pain | FAERS: 8 | OFFSIDES US FAERS | |
| 14 | Photophobia | FAERS: 8 | US FAERS | |
| 15 | Product use in unapproved indication | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Eye inflammation | FAERS: 7 | OFFSIDES US FAERS | |
| 17 | Disease recurrence | FAERS: 6 | US FAERS | |
| 18 | Drug dose omission | FAERS: 6 | US FAERS | |
| 19 | Dizziness | FAERS: 5 | OFFSIDES US FAERS | |
| 20 | Eyelids pruritus | FAERS: 5 | OFFSIDES US FAERS | |
| 21 | Glaucoma | FAERS: 5 | OFFSIDES US FAERS | |
| 22 | Nausea | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Pruritus | FAERS: 5 | US FAERS | |
| 24 | Swelling | FAERS: 5 | US FAERS | |
| 25 | Asthenopia | FAERS: 4 | US FAERS | |
| 26 | Cataract | FAERS: 4 | OFFSIDES US FAERS | |
| 27 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 28 | Dysgeusia | FAERS: 4 | OFFSIDES US FAERS | |
| 29 | Expired product administered | FAERS: 4 | US FAERS | |
| 30 | Eye allergy | FAERS: 4 | US FAERS | |
| 31 | Eyelid margin crusting | FAERS: 4 | US FAERS | |
| 32 | Iritis | FAERS: 4 | OFFSIDES US FAERS | |
| 33 | Keratitis | FAERS: 4 | US FAERS | |
| 34 | Oropharyngeal pain | FAERS: 4 | OFFSIDES US FAERS | |
| 35 | Product physical consistency issue | FAERS: 4 | US FAERS | |
| 36 | Product quality issue | FAERS: 4 | US FAERS | |
| 37 | Urticaria | FAERS: 4 | US FAERS | |
| 38 | Anxiety | FAERS: 3 | OFFSIDES US FAERS | |
| 39 | Deposit eye | FAERS: 3 | US FAERS | |
| 40 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 41 | Endophthalmitis | FAERS: 3 | OFFSIDES US FAERS | |
| 42 | Eyelid irritation | FAERS: 3 | US FAERS | |
| 43 | Feeling abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 44 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 45 | Lip swelling | FAERS: 3 | US FAERS | |
| 46 | Product container issue | FAERS: 3 | US FAERS | |
| 47 | Product storage error | FAERS: 3 | US FAERS | |
| 48 | Punctate keratitis | FAERS: 3 | OFFSIDES US FAERS | |
| 49 | Reaction to preservatives | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Swelling of eyelid | FAERS: 3 | US FAERS | |
| 51 | Tinnitus | FAERS: 3 | US FAERS | |
| 52 | Vertigo | FAERS: 3 | US FAERS | |
| 53 | Abdominal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 54 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 55 | Alopecia | FAERS: 2 | US FAERS | |
| 56 | Blepharospasm | FAERS: 2 | US FAERS | |
| 57 | Blindness | FAERS: 2 | US FAERS | |
| 58 | Crying | FAERS: 2 | US FAERS | |
| 59 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 60 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 61 | Ear discomfort | FAERS: 2 | US FAERS | |
| 62 | Eye Infection | FAERS: 2 | US FAERS | |
| 63 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 64 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 65 | Inflammation | FAERS: 2 | US FAERS | |
| 66 | Instillation site irritation | FAERS: 2 | US FAERS | |
| 67 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 68 | Malaise | FAERS: 2 | US FAERS | |
| 69 | Nervousness | FAERS: 2 | US FAERS | |
| 70 | Palpitations | FAERS: 2 | US FAERS | |
| 71 | Product deposit | FAERS: 2 | US FAERS | |
| 72 | Product dropper issue | FAERS: 2 | US FAERS | |
| 73 | Product use issue | FAERS: 2 | US FAERS | |
| 74 | Salivary gland pain | FAERS: 2 | US FAERS | |
| 75 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 76 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 77 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 78 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 79 | Acne | FAERS: 1 | US FAERS | |
| 80 | Adverse event | FAERS: 1 | US FAERS | |
| 81 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 82 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 83 | Anosmia | FAERS: 1 | US FAERS | |
| 84 | Application site reaction | FAERS: 1 | US FAERS | |
| 85 | Application site ulcer | FAERS: 1 | US FAERS | |
| 86 | Arthropod sting | FAERS: 1 | US FAERS | |
| 87 | Asthenia | FAERS: 1 | OFFSIDES US FAERS | |
| 88 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 89 | Blepharitis | FAERS: 1 | US FAERS | |
| 90 | Bursitis | FAERS: 1 | US FAERS | |
| 91 | Chemical injury | FAERS: 1 | US FAERS | |
| 92 | Chest Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 93 | Corneal Opacity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 95 | Cyclitis | FAERS: 1 | US FAERS | |
| 96 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 97 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 98 | Diplopia | FAERS: 1 | OFFSIDES US FAERS | |
| 99 | Drug administration error | FAERS: 1 | US FAERS | |
| 100 | Dysphonia | FAERS: 1 | US FAERS | |
| 101 | Eczema | FAERS: 1 | US FAERS | |
| 102 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 103 | Eyelash thickening | FAERS: 1 | US FAERS | |
| 104 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 105 | Facial Pain | FAERS: 1 | US FAERS | |
| 106 | Fatigue | FAERS: 1 | OFFSIDES US FAERS | |
| 107 | Flushing | FAERS: 1 | US FAERS | |
| 108 | Foreign body trauma | FAERS: 1 | OFFSIDES US FAERS | |
| 109 | Head discomfort | FAERS: 1 | US FAERS | |
| 110 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 111 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 112 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 113 | Instillation site erythema | FAERS: 1 | US FAERS | |
| 114 | Instillation site pain | FAERS: 1 | US FAERS | |
| 115 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 116 | Joint swelling | FAERS: 1 | US FAERS | |
| 117 | Lacrimal duct procedure | FAERS: 1 | US FAERS | |
| 118 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 119 | Medication residue | FAERS: 1 | OFFSIDES US FAERS | |
| 120 | Meibomian gland dysfunction | FAERS: 1 | US FAERS | |
| 121 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 122 | Mydriasis | FAERS: 1 | US FAERS | |
| 123 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 124 | Neck Pain | FAERS: 1 | US FAERS | |
| 125 | Oral pruritus | FAERS: 1 | US FAERS | |
| 126 | Overdose | FAERS: 1 | US FAERS | |
| 127 | Papule | FAERS: 1 | US FAERS | |
| 128 | Physical product label issue | FAERS: 1 | US FAERS | |
| 129 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 130 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 131 | Product contamination physical | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 133 | Product physical issue | FAERS: 1 | US FAERS | |
| 134 | Product residue present | FAERS: 1 | US FAERS | |
| 135 | Product substitution issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Rebound effect | FAERS: 1 | US FAERS | |
| 137 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 138 | Rhinitis | FAERS: 1 | US FAERS | |
| 139 | Sensitive skin | FAERS: 1 | US FAERS | |
| 140 | Sinus headache | FAERS: 1 | OFFSIDES US FAERS | |
| 141 | Skin irritation | FAERS: 1 | US FAERS | |
| 142 | Skin tightness | FAERS: 1 | US FAERS | |
| 143 | Sneezing | FAERS: 1 | US FAERS | |
| 144 | Stress | FAERS: 1 | US FAERS | |
| 145 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 146 | Tachycardia | FAERS: 1 | US FAERS | |
| 147 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 148 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 149 | Thirst | FAERS: 1 | US FAERS | |
| 150 | Toothache | FAERS: 1 | US FAERS | |
| 151 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 152 | Tremor | FAERS: 1 | US FAERS | |
| 153 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 154 | Uveitis | FAERS: 1 | US FAERS | |
| 155 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 156 | Visual brightness | FAERS: 1 | US FAERS | |
| 157 | Vomiting | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 159 | Wheezing | FAERS: 1 | US FAERS | |
| 160 | Abasia | OFFSIDES | ||
| 161 | Abdominal Pain | OFFSIDES | ||
| 162 | Acute prerenal failure | OFFSIDES | ||
| 163 | Altered bowel function | OFFSIDES | ||
| 164 | Alveolitis | OFFSIDES | ||
| 165 | Angiomyolipoma | OFFSIDES | ||
| 166 | Anhedonia | OFFSIDES | ||
| 167 | Anticholinergic Syndrome | OFFSIDES | ||
| 168 | Apathy | OFFSIDES | ||
| 169 | Aspergillosis | OFFSIDES | ||
| 170 | Atrial Flutter | OFFSIDES | ||
| 171 | Aura | Canada Vigilance: 1 | Canada Vigilance | |
| 172 | Blepharoptosis | OFFSIDES | ||
| 173 | Blood Glucose | OFFSIDES | ||
| 174 | Blood cholesterol | OFFSIDES | ||
| 175 | Blood glucose decreased | OFFSIDES | ||
| 176 | Blurred vision | OFFSIDES | ||
| 177 | Bronchitis | OFFSIDES | ||
| 178 | Carotid artery occlusion | OFFSIDES | ||
| 179 | Cataract operation | OFFSIDES | ||
| 180 | Caustic injury | OFFSIDES | ||
| 181 | Cellulitis | OFFSIDES | ||
| 182 | Chemical burns of eye | OFFSIDES | ||
| 183 | Chemical eye injury | OFFSIDES | ||
| 184 | Choking sensation | OFFSIDES | ||
| 185 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 186 | Conjunctival deposit | OFFSIDES | ||
| 187 | Contact lens intolerance | OFFSIDES | ||
| 188 | Corneal Infection | OFFSIDES | ||
| 189 | Corneal Perforation | OFFSIDES | ||
| 190 | Corneal Scar | OFFSIDES | ||
| 191 | Corneal Ulcer | OFFSIDES | ||
| 192 | Corneal epithelium defect | OFFSIDES | ||
| 193 | Corneal pigmentation | OFFSIDES | ||
| 194 | Culture positive | OFFSIDES | ||
| 195 | Demyelination | OFFSIDES | ||
| 196 | Diabetes | OFFSIDES | ||
| 197 | Drug toxicity | OFFSIDES | ||
| 198 | Drug withdrawal headache | OFFSIDES | ||
| 199 | Economic problem | OFFSIDES | ||
| 200 | Ejection Fraction Decreased | OFFSIDES | ||
| 201 | Emotional disorder | OFFSIDES | ||
| 202 | Emotional distress | OFFSIDES | ||
| 203 | Eosinophilia | 12861354 | CTD | |
| 204 | Erythema dyschromicum perstans | OFFSIDES | ||
| 205 | Escherichia infection | OFFSIDES | ||
| 206 | Facial Neuralgia | OFFSIDES | ||
| 207 | Fluid overload | OFFSIDES | ||
| 208 | Gambling | OFFSIDES | ||
| 209 | Globulinuria | OFFSIDES | ||
| 210 | Goiter | OFFSIDES | ||
| 211 | Hostility | OFFSIDES | ||
| 212 | Hyperkeratosis | OFFSIDES | ||
| 213 | Hypophagia | OFFSIDES | ||
| 214 | Hypoxia | OFFSIDES | ||
| 215 | Impaired driving ability | OFFSIDES | ||
| 216 | Impaired work ability | OFFSIDES | ||
| 217 | Injection site pruritus | OFFSIDES | ||
| 218 | Intraocular inflammation | OFFSIDES | ||
| 219 | Joint Range of Motion Decreased | OFFSIDES | ||
| 220 | Joint sprain | OFFSIDES | ||
| 221 | Joint stiffness | OFFSIDES | ||
| 222 | Keratitis sicca | OFFSIDES | ||
| 223 | Lichen Planus | OFFSIDES | ||
| 224 | Mutism | OFFSIDES | ||
| 225 | Nasal discomfort | OFFSIDES | ||
| 226 | Neuralgia | OFFSIDES | ||
| 227 | Ocular Hypertension | 10088814 | CTD | |
| 228 | Ocular Toxicity | OFFSIDES | ||
| 229 | Onychoclasis | OFFSIDES | ||
| 230 | Oppositional Defiant Disorder | OFFSIDES | ||
| 231 | Oral fungal infection | OFFSIDES | ||
| 232 | Oropharyngeal swelling | OFFSIDES | ||
| 233 | Paranoia | OFFSIDES | ||
| 234 | Pericardial effusion | OFFSIDES | ||
| 235 | Procedural hypotension | OFFSIDES | ||
| 236 | Pulmonary congestion | OFFSIDES | ||
| 237 | Purulence | OFFSIDES | ||
| 238 | Rales | OFFSIDES | ||
| 239 | Residual urine | OFFSIDES | ||
| 240 | Rhinorrhea | OFFSIDES | ||
| 241 | Scleroderma | OFFSIDES | ||
| 242 | Scotoma | OFFSIDES | ||
| 243 | Self Mutilation | OFFSIDES | ||
| 244 | Skin laceration | OFFSIDES | ||
| 245 | Snoring | OFFSIDES | ||
| 246 | Sputum culture positive | OFFSIDES | ||
| 247 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 248 | Synovitis | OFFSIDES | ||
| 249 | Tenosynovitis | OFFSIDES | ||
| 250 | Unemployment | OFFSIDES | ||
| 251 | Unresponsive to stimuli | OFFSIDES | ||
| 252 | Urinary tract infection enterococcal | OFFSIDES | ||
| 253 | Vitreous Detachment | Canada Vigilance: 1 | Canada Vigilance | |
| 254 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.