nintedanib
(CPMDPSXJELVGJG-UHFFFAOYSA-N)
Structure
- SMILES
- COC(=O)c1ccc2c(c1)[nH]c(c2C(=Nc1ccc(cc1)N(C(=O)CN1CCN(CC1)C)C)c1ccccc1)O
- Type(s)
- Approved
- ATC code(s)
- L01XE31
- Molecular Formula:
- C31H33N5O4
- Molecular Weight:
- 539.625
- Log P:
- 3.9152
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 101.47
- CAS Number(s):
- 656247-17-5; 928326-83-4; 1160294-26-7
Synonym(s)
1.
nintedanib
2.
BIBF 1120
3.
BIBF-1120
4.
BIBF1120
5.
Nintedanib esylate
6.
Ofev
7.
vargatef
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 50 | US FAERS | |
| 2 | Idiopathic Pulmonary Fibrosis | FAERS: 32 | US FAERS | |
| 3 | Nausea | FAERS: 18 | US FAERS | |
| 4 | Pneumonia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Pneumothorax | FAERS: 12 | US FAERS | |
| 6 | Vomiting | FAERS: 11 | US FAERS | |
| 7 | Embolism | FAERS: 9 | US FAERS | |
| 8 | Febrile Neutropenia | FAERS: 9 | US FAERS | |
| 9 | Alanine Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 10 | Disease Progression | FAERS: 8 | US FAERS | |
| 11 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 12 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 13 | Constipation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Fatigue | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 16 | Asthenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Dehydration | FAERS: 6 | US FAERS | |
| 18 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 19 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 20 | Malaise | FAERS: 5 | US FAERS | |
| 21 | Performance status decreased | FAERS: 5 | US FAERS | |
| 22 | Pneumonitis | FAERS: 5 | US FAERS | |
| 23 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 24 | Sudden death | FAERS: 5 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 26 | Back Pain | FAERS: 4 | US FAERS | |
| 27 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 28 | Chest Pain | FAERS: 4 | US FAERS | |
| 29 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 30 | Erythema | FAERS: 4 | US FAERS | |
| 31 | Leukopenia | FAERS: 4 | US FAERS | |
| 32 | Weight decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 34 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 35 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 36 | Ascites | FAERS: 3 | US FAERS | |
| 37 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 38 | Cystitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Dizziness | FAERS: 3 | US FAERS | |
| 40 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 41 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 42 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 43 | Sepsis | FAERS: 3 | US FAERS | |
| 44 | Wound Infection | FAERS: 3 | US FAERS | |
| 45 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 46 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 2 | US FAERS | |
| 47 | Arthralgia | FAERS: 2 | US FAERS | |
| 48 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 49 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 50 | Bradycardia | FAERS: 2 | US FAERS | |
| 51 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 52 | Cell marker increased | FAERS: 2 | US FAERS | |
| 53 | Cellulitis | FAERS: 2 | US FAERS | |
| 54 | Colitis | FAERS: 2 | US FAERS | |
| 55 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 56 | Enteritis | FAERS: 2 | US FAERS | |
| 57 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 58 | Hepatitis | FAERS: 2 | US FAERS | |
| 59 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 60 | Hypobarism | FAERS: 2 | US FAERS | |
| 61 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 62 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 63 | Pain | FAERS: 2 | US FAERS | |
| 64 | Pelvic venous thrombosis | FAERS: 2 | US FAERS | |
| 65 | Respiratory distress | FAERS: 2 | US FAERS | |
| 66 | Retinal vascular thrombosis | FAERS: 2 | US FAERS | |
| 67 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 68 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 69 | Abasia | FAERS: 1 | US FAERS | |
| 70 | Acidosis | FAERS: 1 | US FAERS | |
| 71 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 72 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 73 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 74 | Biliary Dyskinesia | FAERS: 1 | US FAERS | |
| 75 | Blindness | FAERS: 1 | US FAERS | |
| 76 | Bone infarction | FAERS: 1 | US FAERS | |
| 77 | Bone pain | FAERS: 1 | US FAERS | |
| 78 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 79 | Carcinoid Heart Disease | FAERS: 1 | US FAERS | |
| 80 | Cardiac ventricular thrombosis | FAERS: 1 | US FAERS | |
| 81 | Cataract | FAERS: 1 | US FAERS | |
| 82 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 83 | Cholestasis | FAERS: 1 | US FAERS | |
| 84 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 85 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 86 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 87 | Delirium | FAERS: 1 | US FAERS | |
| 88 | Depressed mood | FAERS: 1 | US FAERS | |
| 89 | Diplopia | FAERS: 1 | US FAERS | |
| 90 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 91 | Drug ineffective | FAERS: 1 | US FAERS | |
| 92 | Dysarthria | FAERS: 1 | US FAERS | |
| 93 | Dysentery | FAERS: 1 | US FAERS | |
| 94 | Dyspepsia | FAERS: 1 | US FAERS | |
| 95 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 96 | Eosinophilia | FAERS: 1 | US FAERS | |
| 97 | Epistaxis | FAERS: 1 | US FAERS | |
| 98 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 99 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 100 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 101 | Headache | FAERS: 1 | US FAERS | |
| 102 | Hospice Care | FAERS: 1 | US FAERS | |
| 103 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 104 | Hypoxia | FAERS: 1 | US FAERS | |
| 105 | Ileus | FAERS: 1 | US FAERS | |
| 106 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 107 | Impetigo | FAERS: 1 | US FAERS | |
| 108 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 109 | Infection | FAERS: 1 | US FAERS | |
| 110 | Influenza | FAERS: 1 | US FAERS | |
| 111 | Joint injury | FAERS: 1 | US FAERS | |
| 112 | Liver Abscess | FAERS: 1 | US FAERS | |
| 113 | Malignant ascites | FAERS: 1 | US FAERS | |
| 114 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 115 | Neutropenia | FAERS: 1 | US FAERS | |
| 116 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 117 | Overdose | FAERS: 1 | US FAERS | |
| 118 | Pancytopenia | FAERS: 1 | US FAERS | |
| 119 | Peritonitis | FAERS: 1 | US FAERS | |
| 120 | Phlebitis | FAERS: 1 | US FAERS | |
| 121 | Pneumocephalus | FAERS: 1 | US FAERS | |
| 122 | Product prescribing error | FAERS: 1 | US FAERS | |
| 123 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 124 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 125 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 126 | Rales | FAERS: 1 | US FAERS | |
| 127 | Regurgitation | FAERS: 1 | US FAERS | |
| 128 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 129 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 130 | Skeletal injury | FAERS: 1 | US FAERS | |
| 131 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 132 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 133 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 134 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 135 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 136 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 137 | Tinnitus | FAERS: 1 | US FAERS | |
| 138 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 139 | Transaminases increased | FAERS: 1 | US FAERS | |
| 140 | Unevaluable event | FAERS: 1 | US FAERS | |
| 141 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 142 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 143 | Malnutrition | Canada Vigilance: 1 | Canada Vigilance | |
| 144 | Nocturia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.