Oxymorphone
(BCGJBQBWUGVESK-KCTCKCTRSA-N)
Structure
- SMILES
- O=C1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O)O.Cl
- Molecular Formula:
- C17H20ClNO4
- Molecular Weight:
- 337.798
- Log P:
- 1.4851
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 70
- CAS Number(s):
- 357-07-3
Synonym(s)
1.
Oxymorphone
2.
Numorphan
3.
Opana
4.
Oxymorphone HCl
5.
Oxymorphone Hydrochloride
External Link(s)
| MeSH | D010111 |
| PubChem Compound | 5359390 |
| ChEBI | 7866 |
| CHEMBL | CHEMBL1200794 |
| KEGG | dr:D00844 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 407 | US FAERS | |
| 2 | Drug abuse | FAERS: 310 | US FAERS | |
| 3 | Medication residue present | FAERS: 236 | US FAERS | |
| 4 | Wrong technique in drug usage process | FAERS: 169 | US FAERS | |
| 5 | Incorrect route of drug administration | FAERS: 127 | US FAERS | |
| 6 | Intentional product use issue | FAERS: 107 | US FAERS | |
| 7 | Drug diversion | FAERS: 99 | US FAERS | |
| 8 | Intentional product misuse | FAERS: 98 | US FAERS | |
| 9 | Nausea | FAERS: 98 | US FAERS | |
| 10 | Malaise | FAERS: 84 | US FAERS | |
| 11 | Intentional drug misuse | FAERS: 75 | US FAERS | |
| 12 | Vomiting | FAERS: 73 | US FAERS | |
| 13 | Acute kidney injury | FAERS: 59 | US FAERS | |
| 14 | Overdose | FAERS: 59 | US FAERS | |
| 15 | Abdominal discomfort | FAERS: 56 | US FAERS | |
| 16 | Feeling abnormal | FAERS: 55 | US FAERS | |
| 17 | Inappropriate schedule of drug administration | FAERS: 51 | US FAERS | |
| 18 | Headache | FAERS: 46 | US FAERS | |
| 19 | Drug Dependence | FAERS: 40 | US FAERS | |
| 20 | Endocarditis | FAERS: 40 | US FAERS | |
| 21 | Constipation | FAERS: 39 | US FAERS | |
| 22 | Drug screen negative | FAERS: 37 | US FAERS | |
| 23 | Drug screen positive | FAERS: 35 | US FAERS | |
| 24 | Respiratory Failure | FAERS: 31 | US FAERS | |
| 25 | Hepatitis C | FAERS: 30 | US FAERS | |
| 26 | Injection site abscess | FAERS: 29 | US FAERS | |
| 27 | Medication residue | FAERS: 28 | US FAERS | |
| 28 | Septic Shock | FAERS: 28 | US FAERS | |
| 29 | Dizziness | FAERS: 27 | US FAERS | |
| 30 | Pruritus | FAERS: 27 | US FAERS | |
| 31 | Abdominal Pain | FAERS: 26 | US FAERS | |
| 32 | Pain | FAERS: 25 | US FAERS | |
| 33 | Adverse event | FAERS: 24 | US FAERS | |
| 34 | Drug effect delayed | FAERS: 23 | US FAERS | |
| 35 | Injection site cellulitis | FAERS: 23 | US FAERS | |
| 36 | Drug dispensing error | FAERS: 21 | US FAERS | |
| 37 | Tremor | FAERS: 21 | US FAERS | |
| 38 | Anxiety | FAERS: 19 | US FAERS | |
| 39 | Fatigue | FAERS: 19 | US FAERS | |
| 40 | Chest Pain | FAERS: 18 | US FAERS | |
| 41 | No adverse event | FAERS: 18 | US FAERS | |
| 42 | Drug withdrawal syndrome | FAERS: 17 | US FAERS | |
| 43 | Weight decreased | FAERS: 17 | US FAERS | |
| 44 | Hypersensitivity | FAERS: 15 | US FAERS | |
| 45 | Myocardial Infarction | FAERS: 15 | US FAERS | |
| 46 | Product formulation issue | FAERS: 15 | US FAERS | |
| 47 | Flatulence | FAERS: 14 | US FAERS | |
| 48 | Urticaria | FAERS: 14 | US FAERS | |
| 49 | Sepsis | FAERS: 13 | US FAERS | |
| 50 | Somnolence | FAERS: 13 | US FAERS | |
| 51 | Thrombocytopenic purpura | FAERS: 13 | US FAERS | |
| 52 | Thrombocytopenia | FAERS: 12 | US FAERS | |
| 53 | Accidental overdose | FAERS: 11 | US FAERS | |
| 54 | Blindness | FAERS: 11 | US FAERS | |
| 55 | Lethargy | FAERS: 11 | US FAERS | |
| 56 | Asthenia | FAERS: 10 | US FAERS | |
| 57 | Back Pain | FAERS: 10 | US FAERS | |
| 58 | Drug dose omission | FAERS: 10 | US FAERS | |
| 59 | Dyspepsia | FAERS: 10 | US FAERS | |
| 60 | Pericarditis | FAERS: 10 | US FAERS | |
| 61 | Pneumonia | FAERS: 10 | US FAERS | |
| 62 | Unresponsive to stimuli | FAERS: 10 | US FAERS | |
| 63 | Drug effect incomplete | FAERS: 9 | US FAERS | |
| 64 | Ejection Fraction Decreased | FAERS: 9 | US FAERS | |
| 65 | Mental status changes | FAERS: 9 | US FAERS | |
| 66 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 67 | Burning sensation | FAERS: 8 | US FAERS | |
| 68 | Intestinal Obstruction | FAERS: 8 | US FAERS | |
| 69 | Product quality issue | FAERS: 8 | US FAERS | |
| 70 | Product substitution issue | FAERS: 8 | US FAERS | |
| 71 | Abscess | FAERS: 7 | US FAERS | |
| 72 | Amnesia | FAERS: 7 | US FAERS | |
| 73 | Chest discomfort | FAERS: 7 | US FAERS | |
| 74 | Dependence | FAERS: 7 | US FAERS | |
| 75 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 76 | Nasopharyngitis | FAERS: 7 | US FAERS | |
| 77 | Respiratory Depression | FAERS: 7 | US FAERS | |
| 78 | Retching | FAERS: 7 | US FAERS | |
| 79 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 80 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 81 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 82 | Chills | FAERS: 6 | US FAERS | |
| 83 | Euphoric mood | FAERS: 6 | US FAERS | |
| 84 | Oropharyngeal pain | FAERS: 6 | US FAERS | |
| 85 | Osteomyelitis | FAERS: 6 | US FAERS | |
| 86 | Palpitations | FAERS: 6 | US FAERS | |
| 87 | Prescription form tampering | FAERS: 6 | US FAERS | |
| 88 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 89 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 90 | Dehydration | FAERS: 5 | US FAERS | |
| 91 | Dysuria | FAERS: 5 | US FAERS | |
| 92 | Erythema | FAERS: 5 | US FAERS | |
| 93 | Formication | FAERS: 5 | US FAERS | |
| 94 | Influenza | FAERS: 5 | US FAERS | |
| 95 | Joint swelling | FAERS: 5 | US FAERS | |
| 96 | Medication Error | FAERS: 5 | US FAERS | |
| 97 | Nervousness | FAERS: 5 | US FAERS | |
| 98 | Sneezing | FAERS: 5 | US FAERS | |
| 99 | Throat irritation | FAERS: 5 | US FAERS | |
| 100 | Unevaluable event | FAERS: 5 | US FAERS | |
| 101 | Alopecia | FAERS: 4 | US FAERS | |
| 102 | Arthropathy | FAERS: 4 | US FAERS | |
| 103 | Asthma | FAERS: 4 | US FAERS | |
| 104 | Cellulitis | FAERS: 4 | US FAERS | |
| 105 | Chromaturia | FAERS: 4 | US FAERS | |
| 106 | Crying | FAERS: 4 | US FAERS | |
| 107 | Disease Progression | FAERS: 4 | US FAERS | |
| 108 | Diverticulitis | FAERS: 4 | US FAERS | |
| 109 | Drug abuser | FAERS: 4 | US FAERS | |
| 110 | Drug toxicity | FAERS: 4 | US FAERS | |
| 111 | Feeling Cold | FAERS: 4 | US FAERS | |
| 112 | Feeling jittery | FAERS: 4 | US FAERS | |
| 113 | Memory impairment | FAERS: 4 | US FAERS | |
| 114 | Mood swings | FAERS: 4 | US FAERS | |
| 115 | Neck Pain | FAERS: 4 | US FAERS | |
| 116 | Night sweats | FAERS: 4 | US FAERS | |
| 117 | Product coating issue | FAERS: 4 | US FAERS | |
| 118 | Renal pain | FAERS: 4 | US FAERS | |
| 119 | Septic embolus | FAERS: 4 | US FAERS | |
| 120 | Suicide attempt | FAERS: 4 | US FAERS | |
| 121 | Swelling | FAERS: 4 | US FAERS | |
| 122 | Urinary Retention | FAERS: 4 | US FAERS | |
| 123 | Visual Impairment | FAERS: 4 | US FAERS | |
| 124 | Accidental exposure | FAERS: 3 | US FAERS | |
| 125 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 126 | Cold sweat | FAERS: 3 | US FAERS | |
| 127 | Cystitis | FAERS: 3 | US FAERS | |
| 128 | Deafness | FAERS: 3 | US FAERS | |
| 129 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 130 | Dysgeusia | FAERS: 3 | US FAERS | |
| 131 | Eructation | FAERS: 3 | US FAERS | |
| 132 | Infection | FAERS: 3 | US FAERS | |
| 133 | Limb injury | FAERS: 3 | US FAERS | |
| 134 | Muscle tightness | FAERS: 3 | US FAERS | |
| 135 | Non-cardiac chest pain | FAERS: 3 | US FAERS | |
| 136 | Personality Change | FAERS: 3 | US FAERS | |
| 137 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 138 | Regurgitation | FAERS: 3 | US FAERS | |
| 139 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 140 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 141 | Shock | FAERS: 3 | US FAERS | |
| 142 | Sinusitis | FAERS: 3 | US FAERS | |
| 143 | Somnambulism | FAERS: 3 | US FAERS | |
| 144 | Stomatitis | FAERS: 3 | US FAERS | |
| 145 | Therapy cessation | FAERS: 3 | US FAERS | |
| 146 | Tinnitus | FAERS: 3 | US FAERS | |
| 147 | Wheezing | FAERS: 3 | US FAERS | |
| 148 | nervous system disorder | FAERS: 3 | US FAERS | |
| 149 | Abasia | FAERS: 2 | US FAERS | |
| 150 | Accidental death | FAERS: 2 | US FAERS | |
| 151 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 152 | Apathy | FAERS: 2 | US FAERS | |
| 153 | Arthralgia | FAERS: 2 | US FAERS | |
| 154 | Ascites | FAERS: 2 | US FAERS | |
| 155 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 156 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 157 | Bradycardia | FAERS: 2 | US FAERS | |
| 158 | Breakthrough Pain | FAERS: 2 | US FAERS | |
| 159 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 160 | Choking | FAERS: 2 | US FAERS | |
| 161 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 162 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 163 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 164 | Disability | FAERS: 2 | US FAERS | |
| 165 | Disorientation | FAERS: 2 | US FAERS | |
| 166 | Dysarthria | FAERS: 2 | US FAERS | |
| 167 | Eye irritation | FAERS: 2 | US FAERS | |
| 168 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 169 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 170 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 171 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 172 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 173 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 174 | Head discomfort | FAERS: 2 | US FAERS | |
| 175 | Hernia | FAERS: 2 | US FAERS | |
| 176 | Hypersomnia | FAERS: 2 | US FAERS | |
| 177 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 178 | Hypotension | FAERS: 2 | US FAERS | |
| 179 | Impaired work ability | FAERS: 2 | US FAERS | |
| 180 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 181 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 182 | Laryngitis | FAERS: 2 | US FAERS | |
| 183 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 184 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 185 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 186 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 187 | Myalgia | FAERS: 2 | US FAERS | |
| 188 | Myoclonus | FAERS: 2 | US FAERS | |
| 189 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 190 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 191 | Photophobia | FAERS: 2 | US FAERS | |
| 192 | Pneumoperitoneum | FAERS: 2 | US FAERS | |
| 193 | Product physical issue | FAERS: 2 | US FAERS | |
| 194 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 195 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 196 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 197 | Rhonchi | FAERS: 2 | US FAERS | |
| 198 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 199 | Sinus headache | FAERS: 2 | US FAERS | |
| 200 | Sluggishness | FAERS: 2 | US FAERS | |
| 201 | Tachycardia | FAERS: 2 | US FAERS | |
| 202 | Thirst | FAERS: 2 | US FAERS | |
| 203 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 204 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 205 | Transaminases increased | FAERS: 2 | US FAERS | |
| 206 | Troponin increased | FAERS: 2 | US FAERS | |
| 207 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 208 | Vertigo | FAERS: 2 | US FAERS | |
| 209 | furuncle | FAERS: 2 | US FAERS | |
| 210 | Abdominal mass | FAERS: 1 | US FAERS | |
| 211 | Acidosis | FAERS: 1 | US FAERS | |
| 212 | Acne | FAERS: 1 | US FAERS | |
| 213 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 214 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 215 | Agitation | FAERS: 1 | US FAERS | |
| 216 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 217 | Airway burns | FAERS: 1 | US FAERS | |
| 218 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 219 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 220 | Aphonia | FAERS: 1 | US FAERS | |
| 221 | Arthropod bite | FAERS: 1 | US FAERS | |
| 222 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 223 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 224 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 225 | Bedridden | FAERS: 1 | US FAERS | |
| 226 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 227 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 228 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 229 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 230 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 231 | Blood urine present | FAERS: 1 | US FAERS | |
| 232 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 233 | Bronchospasm | FAERS: 1 | US FAERS | |
| 234 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 235 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 236 | Choking sensation | FAERS: 1 | US FAERS | |
| 237 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 238 | Colitis | FAERS: 1 | US FAERS | |
| 239 | Completed Suicide | FAERS: 1 | US FAERS | |
| 240 | Compression fracture | FAERS: 1 | US FAERS | |
| 241 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 242 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 243 | Craniotomy | FAERS: 1 | US FAERS | |
| 244 | Cyanosis | FAERS: 1 | US FAERS | |
| 245 | Delirium | FAERS: 1 | US FAERS | |
| 246 | Delusional perception | FAERS: 1 | US FAERS | |
| 247 | Dental caries | FAERS: 1 | US FAERS | |
| 248 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 249 | Depressed mood | FAERS: 1 | US FAERS | |
| 250 | Dermatitis | FAERS: 1 | US FAERS | |
| 251 | Diplegia | FAERS: 1 | US FAERS | |
| 252 | Discomfort | FAERS: 1 | US FAERS | |
| 253 | Dreamy state | FAERS: 1 | US FAERS | |
| 254 | Drooling | FAERS: 1 | US FAERS | |
| 255 | Drug administration error | FAERS: 1 | US FAERS | |
| 256 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 257 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 258 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 259 | Emotional disorder | FAERS: 1 | US FAERS | |
| 260 | Emotional distress | FAERS: 1 | US FAERS | |
| 261 | Empyema | FAERS: 1 | US FAERS | |
| 262 | Endocarditis pseudomonal | FAERS: 1 | US FAERS | |
| 263 | Epistaxis | FAERS: 1 | US FAERS | |
| 264 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 265 | Excoriation | FAERS: 1 | US FAERS | |
| 266 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 267 | Exposure via blood | FAERS: 1 | US FAERS | |
| 268 | Eye pain | FAERS: 1 | US FAERS | |
| 269 | False negative investigation result | FAERS: 1 | US FAERS | |
| 270 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 271 | Flank Pain | FAERS: 1 | US FAERS | |
| 272 | Flushing | FAERS: 1 | US FAERS | |
| 273 | Fracture | FAERS: 1 | US FAERS | |
| 274 | Gastritis | FAERS: 1 | US FAERS | |
| 275 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 276 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 277 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 278 | Genital pain | FAERS: 1 | US FAERS | |
| 279 | Gingival Recession | FAERS: 1 | US FAERS | |
| 280 | Gingival erythema | FAERS: 1 | US FAERS | |
| 281 | Gout | FAERS: 1 | US FAERS | |
| 282 | Heparin resistance | FAERS: 1 | US FAERS | |
| 283 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 284 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 285 | Homicide | FAERS: 1 | US FAERS | |
| 286 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 287 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 288 | Inadequate aseptic technique in use of product | FAERS: 1 | US FAERS | |
| 289 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 290 | Incontinence | FAERS: 1 | US FAERS | |
| 291 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 292 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 293 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 294 | Initial insomnia | FAERS: 1 | US FAERS | |
| 295 | Injection site erythema | FAERS: 1 | US FAERS | |
| 296 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 297 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 298 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 299 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 300 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 301 | Joint abscess | FAERS: 1 | US FAERS | |
| 302 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 303 | Laryngospasm | FAERS: 1 | US FAERS | |
| 304 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 305 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 306 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 307 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 308 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 309 | Mental impairment | FAERS: 1 | US FAERS | |
| 310 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 311 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 312 | Neuralgia | FAERS: 1 | US FAERS | |
| 313 | Nicotine Dependence | FAERS: 1 | US FAERS | |
| 314 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 315 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 316 | Oral administration complication | FAERS: 1 | US FAERS | |
| 317 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 318 | Oral pain | FAERS: 1 | US FAERS | |
| 319 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 320 | Pancreatic infarction | FAERS: 1 | US FAERS | |
| 321 | Pancreatitis | FAERS: 1 | US FAERS | |
| 322 | Pancytopenia | FAERS: 1 | US FAERS | |
| 323 | Panic Disorder | FAERS: 1 | US FAERS | |
| 324 | Paranoia | FAERS: 1 | US FAERS | |
| 325 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 326 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 327 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 328 | Post procedural complication | FAERS: 1 | US FAERS | |
| 329 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 330 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 331 | Presyncope | FAERS: 1 | US FAERS | |
| 332 | Product commingling | FAERS: 1 | US FAERS | |
| 333 | Product preparation error | FAERS: 1 | US FAERS | |
| 334 | Product selection error | FAERS: 1 | US FAERS | |
| 335 | Product size issue | FAERS: 1 | US FAERS | |
| 336 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 337 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 338 | Pseudoparalysis | FAERS: 1 | US FAERS | |
| 339 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 340 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 341 | Pyuria | FAERS: 1 | US FAERS | |
| 342 | Rash erythematous | FAERS: 1 | US FAERS | |
| 343 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 344 | Red blood cell schistocytes present | FAERS: 1 | US FAERS | |
| 345 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 346 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 347 | Respiratory distress | FAERS: 1 | US FAERS | |
| 348 | Restlessness | FAERS: 1 | US FAERS | |
| 349 | Reticulocytosis | FAERS: 1 | US FAERS | |
| 350 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 351 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 352 | Scab | FAERS: 1 | US FAERS | |
| 353 | Sciatica | FAERS: 1 | US FAERS | |
| 354 | Silicosis | FAERS: 1 | US FAERS | |
| 355 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 356 | Skin irritation | FAERS: 1 | US FAERS | |
| 357 | Skin laceration | FAERS: 1 | US FAERS | |
| 358 | Skin necrosis | FAERS: 1 | US FAERS | |
| 359 | Skin reaction | FAERS: 1 | US FAERS | |
| 360 | Skin tightness | FAERS: 1 | US FAERS | |
| 361 | Snoring | FAERS: 1 | US FAERS | |
| 362 | Solar dermatitis | FAERS: 1 | US FAERS | |
| 363 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 364 | Substance-induced mood disorder | FAERS: 1 | US FAERS | |
| 365 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 366 | Syncope | FAERS: 1 | US FAERS | |
| 367 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 368 | Therapy naive | FAERS: 1 | US FAERS | |
| 369 | Thromboembolectomy | FAERS: 1 | US FAERS | |
| 370 | Thrombosis | FAERS: 1 | US FAERS | |
| 371 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 372 | Tooth Loss | FAERS: 1 | US FAERS | |
| 373 | Trichotillomania | FAERS: 1 | US FAERS | |
| 374 | Ureteral spasm | FAERS: 1 | US FAERS | |
| 375 | Urinary straining | FAERS: 1 | US FAERS | |
| 376 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 377 | Yawning | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.