Ethacrynic Acid
(AVOLMBLBETYQHX-UHFFFAOYSA-N)
Structure
- SMILES
- CCC(=C)C(=O)c1ccc(c(c1Cl)Cl)OCC(=O)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- C03CC01
- Molecular Formula:
- C13H12Cl2O4
- Molecular Weight:
- 303.138
- Log P:
- 3.6057
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 63.6
- CAS Number(s):
- 58-54-8
Synonym(s)
1.
Ethacrynic Acid
2.
Edecrin
3.
Etacrynic Acid
4.
Ethacrinic Acid
5.
Ethacrynate Sodium
6.
Ethacrynic Acid, Sodium Salt
7.
Hydromedin
8.
Acid, Etacrynic
9.
Acid, Ethacrinic
10.
Acid, Ethacrynic
11.
Sodium, Ethacrynate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthenia | FAERS: 2 | US FAERS | |
| 2 | Drug ineffective | FAERS: 2 | US FAERS | |
| 3 | Vomiting | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 5 | Acute kidney injury | FAERS: 1 | 5695673 8150749 | CTD US FAERS |
| 6 | Arthropathy | FAERS: 1 | US FAERS | |
| 7 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 8 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 9 | Deafness Permanent | FAERS: 1 | US FAERS | |
| 10 | Deafness | FAERS: 1 Canada Vigilance: 1 |
65671
4178003 4179251 4179904 4739610 5095755 5108285 5426184 5446818 5576449 5666341 5794874 5935024 6973908 7402259 7737922 14587606 14587608 18220258 | CTD Canada Vigilance US FAERS |
| 11 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 12 | Drug dose omission | FAERS: 1 | US FAERS | |
| 13 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 14 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 15 | Headache | FAERS: 1 | US FAERS | |
| 16 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 17 | Inflammation | FAERS: 1 | US FAERS | |
| 18 | Joint swelling | FAERS: 1 | US FAERS | |
| 19 | Nausea | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Oliguria | FAERS: 1 | US FAERS | |
| 21 | Ototoxicity | FAERS: 1 | US FAERS | |
| 22 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 23 | Pneumonia | FAERS: 1 | US FAERS | |
| 24 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 25 | Sinus headache | FAERS: 1 | US FAERS | |
| 26 | Visual Impairment | FAERS: 1 | US FAERS | |
| 27 | Weight decreased | FAERS: 1 | US FAERS | |
| 28 | nervous system disorder | FAERS: 1 | US FAERS | |
| 29 | Abdominal Pain | 4755205 | CTD | |
| 30 | Agranulocytosis | Canada Vigilance: 1 | Canada Vigilance | |
| 31 | Alkalosis | Canada Vigilance: 1 | Canada Vigilance | |
| 32 | Anorexia | 5643946 | CTD | |
| 33 | Dehydration | 5643946 | CTD | |
| 34 | Gastroenteritis | Canada Vigilance: 1 | Canada Vigilance | |
| 35 | Hearing Loss, Bilateral | 8294265 | CTD | |
| 36 | Hearing Loss | 5754935 8150749 8647736 | CTD | |
| 37 | Hypokalemia | 5090186 | CTD | |
| 38 | Hyponatremia | 5090186 | CTD | |
| 39 | Hypotension | 19576883 | CTD | |
| 40 | Necrosis | 19135076 | CTD | |
| 41 | Pancreatitis | Canada Vigilance: 1 | Canada Vigilance | |
| 42 | Proteinuria | 6707927 | CTD | |
| 43 | Purpura | Canada Vigilance: 1 | Canada Vigilance | |
| 44 | Renal Insufficiency | 4178003 | CTD | |
| 45 | Seizures | CTD | ||
| 46 | Status Epilepticus | 2806362 | CTD | |
| 47 | Tinnitus | Canada Vigilance: 1 | Canada Vigilance | |
| 48 | Tremor | 5643946 | CTD | |
| 49 | Urticaria | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.