Vincristine
(AQTQHPDCURKLKT-JKDPCDLQSA-N)
Structure
- SMILES
- OS(=O)(=O)O.O=CN1c2cc(OC)c(cc2[C@]23[C@@H]1[C@@](O)(C(=O)OC)[C@H](OC(=O)C)[C@]1([C@@H]3N(CC2)CC=C1)CC)[C@]1(C[C@@H]2CN(CCc3c1[nH]c1c3cccc1)C[C@](C2)(O)CC)C(=O)OC
- Molecular Formula:
- C46H58N4O14S
- Molecular Weight:
- 923.036
- Log P:
- 4.5222
- Hydrogen Bond Acceptor:
- 17
- Hydrogen Bond Donor:
- 5
- TPSA:
- 254.15
- CAS Number(s):
- 2068-78-2; 1217704-93-2
Synonym(s)
1.
Vincristine
2.
Leurocristine
3.
Citomid
4.
Farmistin
5.
Oncovin
6.
Oncovine
7.
Onkocristin
8.
Vincasar
9.
Vincasar PFS
10.
Vincristin Bristol
11.
Vincristin medac
12.
Vincristine Sulfate
13.
Vincrisul
14.
Vintec
15.
cellcristin
16.
PFS, Vincasar
17.
Sulfate, Vincristine
External Link(s)
| MeSH | D014750 |
| PubChem Compound | 249332 138911098 |
| ChEBI | 79401 |
| CHEMBL | CHEMBL501867 |
| KEGG | dr:D02197 cpd:C13974 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Incorrect route of drug administration | FAERS: 9 | US FAERS | |
| 2 | Mononeuropathy Multiplex | FAERS: 9 | US FAERS | |
| 3 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 4 | Autonomic neuropathy | FAERS: 7 | US FAERS | |
| 5 | Neutropenia | FAERS: 6 | US FAERS | |
| 6 | Asthenia | FAERS: 5 | US FAERS | |
| 7 | Vocal Cord Paralysis | FAERS: 5 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 5 | US FAERS | |
| 9 | Constipation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Medication Error | FAERS: 4 | US FAERS | |
| 11 | Quadriplegia | FAERS: 4 | US FAERS | |
| 12 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 13 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 14 | Headache | FAERS: 3 | US FAERS | |
| 15 | Pneumonia | FAERS: 3 | US FAERS | |
| 16 | Dysgeusia | FAERS: 2 | US FAERS | |
| 17 | Dysphonia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Febrile Neutropenia | FAERS: 2 | US FAERS | |
| 19 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 20 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 21 | Hypotension | FAERS: 2 | US FAERS | |
| 22 | Ileal ulcer | FAERS: 2 | US FAERS | |
| 23 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 24 | Intussusception | FAERS: 2 | US FAERS | |
| 25 | Mental status changes | FAERS: 2 | US FAERS | |
| 26 | Nausea | FAERS: 2 | US FAERS | |
| 27 | Occult blood positive | FAERS: 2 | US FAERS | |
| 28 | Pain | FAERS: 2 | US FAERS | |
| 29 | Paraplegia | FAERS: 2 | US FAERS | |
| 30 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 31 | Product label confusion | FAERS: 2 | US FAERS | |
| 32 | Shock | FAERS: 2 | US FAERS | |
| 33 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 34 | nervous system disorder | FAERS: 2 | US FAERS | |
| 35 | Abasia | FAERS: 1 | US FAERS | |
| 36 | Abdominal mass | FAERS: 1 | US FAERS | |
| 37 | Abscess | FAERS: 1 | US FAERS | |
| 38 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 39 | Accidental exposure | FAERS: 1 | US FAERS | |
| 40 | Accidental overdose | FAERS: 1 | US FAERS | |
| 41 | Acute Motor Axonal Neuropathy | FAERS: 1 | US FAERS | |
| 42 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 43 | Aphasia | FAERS: 1 | US FAERS | |
| 44 | Arthralgia | FAERS: 1 | US FAERS | |
| 45 | Ascites | FAERS: 1 | US FAERS | |
| 46 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 47 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 48 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 49 | Bone scan abnormal | FAERS: 1 | US FAERS | |
| 50 | Brain Death | FAERS: 1 | US FAERS | |
| 51 | Candida test positive | FAERS: 1 | US FAERS | |
| 52 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 53 | Chest Pain | FAERS: 1 | US FAERS | |
| 54 | Chylothorax | FAERS: 1 | US FAERS | |
| 55 | Colitis | FAERS: 1 | US FAERS | |
| 56 | Cortical laminar necrosis | FAERS: 1 | US FAERS | |
| 57 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 58 | Device occlusion | FAERS: 1 | US FAERS | |
| 59 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 60 | Diplopia | FAERS: 1 | US FAERS | |
| 61 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 62 | Drug administration error | FAERS: 1 | US FAERS | |
| 63 | Drug toxicity | FAERS: 1 | US FAERS | |
| 64 | Dysuria | FAERS: 1 | US FAERS | |
| 65 | Erythema | FAERS: 1 | US FAERS | |
| 66 | Escherichia infection | FAERS: 1 | US FAERS | |
| 67 | Fatigue | FAERS: 1 | US FAERS | |
| 68 | Febrile bone marrow aplasia | FAERS: 1 | US FAERS | |
| 69 | Flushing | FAERS: 1 | US FAERS | |
| 70 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 71 | Human metapneumovirus test positive | FAERS: 1 | US FAERS | |
| 72 | Hypophagia | FAERS: 1 | US FAERS | |
| 73 | Hypoxia | FAERS: 1 | US FAERS | |
| 74 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 75 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 76 | Influenza | FAERS: 1 | US FAERS | |
| 77 | Injury associated with device | FAERS: 1 | US FAERS | |
| 78 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 79 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 80 | Laryngeal nerve dysfunction | FAERS: 1 | US FAERS | |
| 81 | Lymphangioma | FAERS: 1 | US FAERS | |
| 82 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 83 | Lymphoma | FAERS: 1 | US FAERS | |
| 84 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 85 | Malaise | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Malignant ascites | FAERS: 1 | US FAERS | |
| 87 | Mastication disorder | FAERS: 1 | US FAERS | |
| 88 | Megacolon | FAERS: 1 | US FAERS | |
| 89 | Meningism | FAERS: 1 | US FAERS | |
| 90 | Monocyte percentage decreased | FAERS: 1 | US FAERS | |
| 91 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 92 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 93 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 94 | Night sweats | FAERS: 1 | US FAERS | |
| 95 | Nocturia | FAERS: 1 | US FAERS | |
| 96 | Oliguria | FAERS: 1 | US FAERS | |
| 97 | Overdose | FAERS: 1 | US FAERS | |
| 98 | Pancytopenia | FAERS: 1 | US FAERS | |
| 99 | Paraparesis | FAERS: 1 | US FAERS | |
| 100 | Pneumothorax | FAERS: 1 | US FAERS | |
| 101 | Poisoning | FAERS: 1 | US FAERS | |
| 102 | Post procedural complication | FAERS: 1 | US FAERS | |
| 103 | Product label issue | FAERS: 1 | US FAERS | |
| 104 | Product quality issue | FAERS: 1 | US FAERS | |
| 105 | Protein total decreased | FAERS: 1 | US FAERS | |
| 106 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 107 | Rales | FAERS: 1 | US FAERS | |
| 108 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 109 | Sepsis | FAERS: 1 | US FAERS | |
| 110 | Septic Shock | FAERS: 1 | US FAERS | |
| 111 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 112 | Subileus | FAERS: 1 | US FAERS | |
| 113 | Tachycardia | FAERS: 1 | US FAERS | |
| 114 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 115 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 116 | Transaminases increased | FAERS: 1 | US FAERS | |
| 117 | Troponin increased | FAERS: 1 | US FAERS | |
| 118 | Venoocclusive disease | FAERS: 1 | US FAERS | |
| 119 | Visual Impairment | FAERS: 1 | US FAERS | |
| 120 | Walking aid user | FAERS: 1 | US FAERS | |
| 121 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 122 | Alopecia | Canada Vigilance: 2 | Canada Vigilance | |
| 123 | Ewing's sarcoma recurrent | Canada Vigilance: 1 | Canada Vigilance | |
| 124 | Gastric Dilatation | Canada Vigilance: 1 | Canada Vigilance | |
| 125 | Neuralgia | Canada Vigilance: 1 | Canada Vigilance | |
| 126 | Neuritis | Canada Vigilance: 1 | Canada Vigilance | |
| 127 | Oropharyngeal pain | Canada Vigilance: 2 | Canada Vigilance | |
| 128 | Product use in unapproved indication | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.