Ivabradine
(ACRHBAYQBXXRTO-OAQYLSRUSA-N)
Structure
- SMILES
- COc1cc2C[C@@H](c2cc1OC)CN(CCCN1CCc2c(CC1=O)cc(c(c2)OC)OC)C
- Type(s)
- Approved
- ATC code(s)
- C01EB17; C07FX05; C07FX06
- Molecular Formula:
- C27H36N2O5
- Molecular Weight:
- 468.585
- Log P:
- 3.2479
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 0
- TPSA:
- 60.47
- CAS Number(s):
- 155974-00-8
Synonym(s)
1.
Ivabradine
2.
7,8-Dimethoxy-3-(3-(((4,5-dimethoxybenzocyclobutan-1-yl)methyl)methylamino)propyl)-1,3,4,5-tetrahydro-2H-benzazepin-2-one
3.
Corlanor
4.
S 16257
5.
S 16257-2
6.
S 16260-2
7.
S-16257
8.
S-16257-2
9.
S-16260-2
10.
S 16257 2
11.
S 162572
12.
S 16260 2
13.
S 162602
14.
S16257
15.
S162572
16.
S162602
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 46 | SIDER US FAERS | |
| 2 | Visual Impairment | FAERS: 30 | SIDER US FAERS | |
| 3 | Atrial Fibrillation | FAERS: 27 | SIDER US FAERS | |
| 4 | Fatigue | FAERS: 27 | SIDER US FAERS | |
| 5 | Bradycardia | FAERS: 26 | SIDER US FAERS | |
| 6 | Nausea | FAERS: 25 | SIDER US FAERS | |
| 7 | Feeling abnormal | FAERS: 23 | SIDER US FAERS | |
| 8 | Drug dose omission | FAERS: 21 | US FAERS | |
| 9 | Hypotension | FAERS: 18 | SIDER US FAERS | |
| 10 | Malaise | FAERS: 18 | SIDER US FAERS | |
| 11 | Palpitations | FAERS: 18 | SIDER US FAERS | |
| 12 | Headache | FAERS: 17 | SIDER US FAERS | |
| 13 | Chest Pain | FAERS: 14 | US FAERS | |
| 14 | Drug ineffective | FAERS: 12 | US FAERS | |
| 15 | Tachycardia | FAERS: 12 | US FAERS | |
| 16 | Asthenia | FAERS: 11 | SIDER US FAERS | |
| 17 | Unevaluable event | FAERS: 11 | US FAERS | |
| 18 | Intentional product misuse | FAERS: 9 | US FAERS | |
| 19 | Photophobia | FAERS: 9 | US FAERS | |
| 20 | Syncope | FAERS: 9 | SIDER US FAERS | |
| 21 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 22 | Urticaria | FAERS: 8 | SIDER US FAERS | |
| 23 | Adverse event | FAERS: 7 | US FAERS | |
| 24 | Pruritus | FAERS: 7 | SIDER US FAERS | |
| 25 | Sinus Tachycardia | FAERS: 7 | US FAERS | |
| 26 | Vomiting | FAERS: 7 | US FAERS | |
| 27 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 28 | Anxiety | FAERS: 5 | US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 30 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 31 | Tremor | FAERS: 5 | US FAERS | |
| 32 | Vertigo | FAERS: 5 | SIDER US FAERS | |
| 33 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 34 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 35 | Autonomic nervous system imbalance | FAERS: 4 | US FAERS | |
| 36 | Constipation | FAERS: 4 | SIDER US FAERS | |
| 37 | Dyspepsia | FAERS: 4 | US FAERS | |
| 38 | Erythema | FAERS: 4 | SIDER US FAERS | |
| 39 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 40 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 41 | Product use issue | FAERS: 4 | US FAERS | |
| 42 | Somnolence | FAERS: 4 | US FAERS | |
| 43 | Weight decreased | FAERS: 4 | US FAERS | |
| 44 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 45 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 46 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 47 | Burning sensation | FAERS: 3 | US FAERS | |
| 48 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 49 | Chest discomfort | FAERS: 3 | US FAERS | |
| 50 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 51 | Flatulence | FAERS: 3 | US FAERS | |
| 52 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 53 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 54 | Influenza | FAERS: 3 | US FAERS | |
| 55 | Lethargy | FAERS: 3 | US FAERS | |
| 56 | Myalgia | FAERS: 3 | US FAERS | |
| 57 | Overdose | FAERS: 3 | US FAERS | |
| 58 | Presyncope | FAERS: 3 | US FAERS | |
| 59 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 60 | Alopecia | FAERS: 2 | US FAERS | |
| 61 | Amnesia | FAERS: 2 | US FAERS | |
| 62 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 63 | Arthralgia | FAERS: 2 | US FAERS | |
| 64 | Bedridden | FAERS: 2 | US FAERS | |
| 65 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 66 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 67 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 68 | Cardiac ablation | FAERS: 2 | US FAERS | |
| 69 | Chills | FAERS: 2 | US FAERS | |
| 70 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 71 | Diplopia | FAERS: 2 | SIDER US FAERS | |
| 72 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 73 | Dry skin | FAERS: 2 | US FAERS | |
| 74 | Dysuria | FAERS: 2 | US FAERS | |
| 75 | Flushing | FAERS: 2 | US FAERS | |
| 76 | Impaired work ability | FAERS: 2 | US FAERS | |
| 77 | Leukopenia | FAERS: 2 | US FAERS | |
| 78 | Living in residential institution | FAERS: 2 | US FAERS | |
| 79 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 80 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 81 | Memory impairment | FAERS: 2 | US FAERS | |
| 82 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 83 | Neuralgia | FAERS: 2 | US FAERS | |
| 84 | Pain | FAERS: 2 | US FAERS | |
| 85 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 86 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 87 | Pneumonia | FAERS: 2 | US FAERS | |
| 88 | Pneumothorax | FAERS: 2 | US FAERS | |
| 89 | Post procedural complication | FAERS: 2 | US FAERS | |
| 90 | Postural Orthostatic Tachycardia Syndrome | FAERS: 2 | US FAERS | |
| 91 | Rebound effect | FAERS: 2 | US FAERS | |
| 92 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 93 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 94 | Stress | FAERS: 2 | US FAERS | |
| 95 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 96 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 97 | Swelling | FAERS: 2 | US FAERS | |
| 98 | Transaminases increased | FAERS: 2 | US FAERS | |
| 99 | Visual brightness | FAERS: 2 | US FAERS | |
| 100 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 101 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 102 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 103 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 104 | Agitation | FAERS: 1 | US FAERS | |
| 105 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 106 | Anger | FAERS: 1 | US FAERS | |
| 107 | Anuria | FAERS: 1 | US FAERS | |
| 108 | Artificial heart device user | FAERS: 1 | US FAERS | |
| 109 | Astigmatism | FAERS: 1 | US FAERS | |
| 110 | Aura | FAERS: 1 | US FAERS | |
| 111 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 112 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 113 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 114 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 115 | Blood urea increased | FAERS: 1 | US FAERS | |
| 116 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 117 | C-reactive protein decreased | FAERS: 1 | US FAERS | |
| 118 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 119 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 120 | Cardiac ventricular scarring | FAERS: 1 | US FAERS | |
| 121 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 122 | Catheter placement | FAERS: 1 | US FAERS | |
| 123 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 124 | Colon adenoma | FAERS: 1 | US FAERS | |
| 125 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 126 | Dementia | FAERS: 1 | US FAERS | |
| 127 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 128 | Drug Dependence | FAERS: 1 | US FAERS | |
| 129 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 130 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 131 | Dysarthria | FAERS: 1 | US FAERS | |
| 132 | Dysgeusia | FAERS: 1 | US FAERS | |
| 133 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 134 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 135 | Epilepsy | FAERS: 1 | US FAERS | |
| 136 | Epistaxis | FAERS: 1 | US FAERS | |
| 137 | Expired product administered | FAERS: 1 | US FAERS | |
| 138 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 139 | Gait inability | FAERS: 1 | US FAERS | |
| 140 | Gastrectomy | FAERS: 1 | US FAERS | |
| 141 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 142 | Gastrooesophageal sphincter insufficiency | FAERS: 1 | US FAERS | |
| 143 | Genital neoplasm malignant female | FAERS: 1 | US FAERS | |
| 144 | Hepatitis | FAERS: 1 | US FAERS | |
| 145 | Hypermobility syndrome | FAERS: 1 | US FAERS | |
| 146 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 147 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 148 | Infertility | FAERS: 1 | US FAERS | |
| 149 | Inflammation | FAERS: 1 | US FAERS | |
| 150 | Joint swelling | FAERS: 1 | US FAERS | |
| 151 | Medication Error | FAERS: 1 | US FAERS | |
| 152 | Menopause | FAERS: 1 | US FAERS | |
| 153 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 154 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 155 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 156 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 157 | Nervousness | FAERS: 1 | US FAERS | |
| 158 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 159 | Onychalgia | FAERS: 1 | US FAERS | |
| 160 | Onycholysis | FAERS: 1 | US FAERS | |
| 161 | Oral pain | FAERS: 1 | US FAERS | |
| 162 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 163 | Papule | FAERS: 1 | US FAERS | |
| 164 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 165 | Personality Change | FAERS: 1 | US FAERS | |
| 166 | Physical disability | FAERS: 1 | US FAERS | |
| 167 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 168 | Product prescribing error | FAERS: 1 | US FAERS | |
| 169 | Product supply issue | FAERS: 1 | US FAERS | |
| 170 | Productive Cough | FAERS: 1 | US FAERS | |
| 171 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 172 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 173 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 174 | Restlessness | FAERS: 1 | US FAERS | |
| 175 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 176 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 177 | Sinusitis | FAERS: 1 | US FAERS | |
| 178 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 179 | Suicide attempt | FAERS: 1 | US FAERS | |
| 180 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 181 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 182 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 183 | Thirst | FAERS: 1 | US FAERS | |
| 184 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 185 | Tinnitus | FAERS: 1 | US FAERS | |
| 186 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 187 | Tracheal pain | FAERS: 1 | US FAERS | |
| 188 | Troponin increased | FAERS: 1 | US FAERS | |
| 189 | Urinary Retention | FAERS: 1 | US FAERS | |
| 190 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 191 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 192 | Blood and lymphatic system disorders | SIDER | ||
| 193 | Blood creatinine increased | SIDER | ||
| 194 | Creatinine increased | SIDER | ||
| 195 | Dermatitis | SIDER | ||
| 196 | Discomfort | SIDER | ||
| 197 | Ear and labyrinth disorders | SIDER | ||
| 198 | Eosinophilia | SIDER | ||
| 199 | Malnutrition | SIDER | ||
| 200 | Shock | SIDER | ||
| 201 | Sick Sinus Syndrome | SIDER | ||
| 202 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.