Ertapenem
(ZXNAQFZBWUNWJM-HRXMHBOMSA-M)
Structure
- SMILES
- O=C([C@H]1NC[C@H](C1)SC1=C(C(=O)O)N2[C@H]([C@H]1C)[C@H](C2=O)[C@H](O)C)Nc1cccc(c1)C(=O)[O-].[Na+]
- Molecular Formula:
- C22H24N3NaO7S
- Molecular Weight:
- 497.497
- Log P:
- -0.0543
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 4
- TPSA:
- 184.4
- CAS Number(s):
- 153773-82-1; 153832-38-3
Synonym(s)
1.
Ertapenem
2.
Ertapenem Sodium
3.
Invanoz
4.
Invanz
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 53 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | No adverse event | FAERS: 52 | US FAERS | |
| 3 | Adverse event | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Dizziness | FAERS: 24 | US FAERS | |
| 5 | Delirium | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Asthenia | FAERS: 21 | US FAERS | |
| 7 | Product quality issue | FAERS: 21 | US FAERS | |
| 8 | Mental status changes | FAERS: 20 | US FAERS | |
| 9 | Sepsis | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Disorientation | FAERS: 18 | US FAERS | |
| 11 | Nausea | FAERS: 18 | US FAERS | |
| 12 | Overdose | FAERS: 17 | US FAERS | |
| 13 | Drug dose omission | FAERS: 15 | US FAERS | |
| 14 | Epilepsy | FAERS: 14 | US FAERS | |
| 15 | Tremor | FAERS: 14 | US FAERS | |
| 16 | Urticaria | FAERS: 14 | US FAERS | |
| 17 | Inappropriate schedule of drug administration | FAERS: 13 | US FAERS | |
| 18 | Pain | FAERS: 13 | US FAERS | |
| 19 | treatment failure | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Fatigue | FAERS: 12 | US FAERS | |
| 21 | Incorrect product storage | FAERS: 12 | US FAERS | |
| 22 | Agitation | FAERS: 11 | US FAERS | |
| 23 | Status Epilepticus | FAERS: 11 | US FAERS | |
| 24 | Pneumonia | FAERS: 10 | US FAERS | |
| 25 | Somnolence | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Stevens-Johnson Syndrome | FAERS: 10 | US FAERS | |
| 27 | Vomiting | FAERS: 10 | US FAERS | |
| 28 | Blood creatinine increased | FAERS: 8 | US FAERS | |
| 29 | Drug administration error | FAERS: 8 | US FAERS | |
| 30 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 31 | Pathogen resistance | FAERS: 8 | US FAERS | |
| 32 | Product use in unapproved indication | FAERS: 8 | US FAERS | |
| 33 | Product use issue | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Pruritus | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Dementia | FAERS: 7 | US FAERS | |
| 36 | Headache | FAERS: 7 | US FAERS | |
| 37 | Hypotension | FAERS: 7 | US FAERS | |
| 38 | Incorrect route of drug administration | FAERS: 7 | US FAERS | |
| 39 | Neutropenia | FAERS: 7 | US FAERS | |
| 40 | Product preparation error | FAERS: 7 | US FAERS | |
| 41 | Tachycardia | FAERS: 7 | US FAERS | |
| 42 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 43 | Alopecia | FAERS: 6 | US FAERS | |
| 44 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 45 | Dysarthria | FAERS: 6 | US FAERS | |
| 46 | Incorrect storage of drug | FAERS: 6 | US FAERS | |
| 47 | Laceration | FAERS: 6 | US FAERS | |
| 48 | Medication Error | FAERS: 6 | US FAERS | |
| 49 | Memory impairment | FAERS: 6 | US FAERS | |
| 50 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 51 | Myoclonus | FAERS: 6 | US FAERS | |
| 52 | Osteomyelitis | FAERS: 6 | US FAERS | |
| 53 | Product label issue | FAERS: 6 | US FAERS | |
| 54 | Septic Shock | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Abasia | FAERS: 5 | US FAERS | |
| 56 | Alanine Aminotransferase Increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Anxiety | FAERS: 5 | US FAERS | |
| 58 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 59 | Clostridium difficile infection | FAERS: 5 | US FAERS | |
| 60 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 61 | Grip strength decreased | FAERS: 5 | US FAERS | |
| 62 | Hallucinations, mixed | FAERS: 5 | US FAERS | |
| 63 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 64 | Infection | FAERS: 5 | US FAERS | |
| 65 | Limb injury | FAERS: 5 | US FAERS | |
| 66 | Neck Pain | FAERS: 5 | US FAERS | |
| 67 | Syncope | FAERS: 5 | US FAERS | |
| 68 | Temperature intolerance | FAERS: 5 | US FAERS | |
| 69 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 70 | muscle injury | FAERS: 5 | US FAERS | |
| 71 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 72 | Abscess | FAERS: 4 | US FAERS | |
| 73 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 74 | Belligerence | FAERS: 4 | US FAERS | |
| 75 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 76 | Carpal Tunnel Syndrome | FAERS: 4 | US FAERS | |
| 77 | Chromaturia | FAERS: 4 | US FAERS | |
| 78 | Clostridium difficile colitis | FAERS: 4 | US FAERS | |
| 79 | Creatinine renal clearance decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Deafness | FAERS: 4 | US FAERS | |
| 81 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 82 | Drug resistance | FAERS: 4 | US FAERS | |
| 83 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 84 | Stress at work | FAERS: 4 | US FAERS | |
| 85 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 86 | Abdominal Abscess | FAERS: 3 | US FAERS | |
| 87 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 88 | Accidental exposure | FAERS: 3 | US FAERS | |
| 89 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 90 | Anaphylactic shock | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 92 | Back Pain | FAERS: 3 | US FAERS | |
| 93 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 94 | Blood urea increased | FAERS: 3 | US FAERS | |
| 95 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 96 | Cholestasis | FAERS: 3 | US FAERS | |
| 97 | Clostridium colitis | FAERS: 3 | US FAERS | |
| 98 | Crying | FAERS: 3 | US FAERS | |
| 99 | Dehydration | FAERS: 3 | US FAERS | |
| 100 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 101 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 102 | Erythema | FAERS: 3 | US FAERS | |
| 103 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 104 | Hepatitis | FAERS: 3 | US FAERS | |
| 105 | Lethargy | FAERS: 3 | US FAERS | |
| 106 | Leukopenia | FAERS: 3 | US FAERS | |
| 107 | Malaise | FAERS: 3 | US FAERS | |
| 108 | Myalgia | FAERS: 3 | US FAERS | |
| 109 | Oral candidiasis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 110 | Pallor | FAERS: 3 | US FAERS | |
| 111 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 112 | Rash erythematous | FAERS: 3 | US FAERS | |
| 113 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 114 | Skin laceration | FAERS: 3 | US FAERS | |
| 115 | Transaminases increased | FAERS: 3 | US FAERS | |
| 116 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 117 | Vertigo | FAERS: 3 | US FAERS | |
| 118 | Weight decreased | FAERS: 3 | US FAERS | |
| 119 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 120 | prostatitis | FAERS: 3 | US FAERS | |
| 121 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 122 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 123 | Amnesia | FAERS: 2 | US FAERS | |
| 124 | Aphasia | FAERS: 2 | US FAERS | |
| 125 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 126 | Biliary Fistula | FAERS: 2 | US FAERS | |
| 127 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 128 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 129 | Cellulitis | FAERS: 2 | US FAERS | |
| 130 | Chest Pain | FAERS: 2 | US FAERS | |
| 131 | Chest discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Chills | FAERS: 2 | US FAERS | |
| 133 | Complex partial seizures | FAERS: 2 | US FAERS | |
| 134 | Constipation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 136 | Diabetic foot infection | FAERS: 2 | US FAERS | |
| 137 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 138 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 139 | Encephalitis | FAERS: 2 | US FAERS | |
| 140 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 141 | Extravasation | FAERS: 2 | US FAERS | |
| 142 | Facial Paresis | FAERS: 2 | US FAERS | |
| 143 | Flushing | FAERS: 2 | US FAERS | |
| 144 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 145 | Gaze palsy | FAERS: 2 | US FAERS | |
| 146 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 147 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 148 | Impatience | FAERS: 2 | US FAERS | |
| 149 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 150 | Inflammation | FAERS: 2 | US FAERS | |
| 151 | Laryngospasm | FAERS: 2 | US FAERS | |
| 152 | Leukocytosis | FAERS: 2 | US FAERS | |
| 153 | Lip swelling | FAERS: 2 | US FAERS | |
| 154 | Liver Abscess | FAERS: 2 | US FAERS | |
| 155 | Mental disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 156 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 157 | Myoclonic Epilepsy | FAERS: 2 | US FAERS | |
| 158 | Nervousness | FAERS: 2 | US FAERS | |
| 159 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 160 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 161 | Pancytopenia | FAERS: 2 | US FAERS | |
| 162 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 163 | Peritonitis | FAERS: 2 | US FAERS | |
| 164 | Petechiae | FAERS: 2 | US FAERS | |
| 165 | Pneumonitis | FAERS: 2 | US FAERS | |
| 166 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 167 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 168 | Product label confusion | FAERS: 2 | US FAERS | |
| 169 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 170 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 171 | Skin necrosis | FAERS: 2 | US FAERS | |
| 172 | Thrombosis | FAERS: 2 | US FAERS | |
| 173 | Tinnitus | FAERS: 2 | US FAERS | |
| 174 | Wheezing | FAERS: 2 | US FAERS | |
| 175 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 176 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 177 | nervous system disorder | FAERS: 2 | US FAERS | |
| 178 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 179 | Abdominal hernia obstructive | FAERS: 1 | US FAERS | |
| 180 | Accidental overdose | FAERS: 1 | US FAERS | |
| 181 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 182 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 183 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 184 | Application site necrosis | FAERS: 1 | US FAERS | |
| 185 | Arthralgia | FAERS: 1 | US FAERS | |
| 186 | Arthritis | FAERS: 1 | US FAERS | |
| 187 | Arthropathy | FAERS: 1 | US FAERS | |
| 188 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 189 | Biliary sepsis | FAERS: 1 | US FAERS | |
| 190 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 191 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 192 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 193 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 194 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 195 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 196 | Bradycardia | FAERS: 1 | US FAERS | |
| 197 | Brain Contusion | FAERS: 1 | US FAERS | |
| 198 | Bronchospasm | FAERS: 1 | US FAERS | |
| 199 | Cachexia | FAERS: 1 | US FAERS | |
| 200 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 201 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 202 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 203 | Colitis | FAERS: 1 | US FAERS | |
| 204 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 205 | Culture negative | FAERS: 1 | US FAERS | |
| 206 | Culture positive | FAERS: 1 | US FAERS | |
| 207 | Debridement | FAERS: 1 | US FAERS | |
| 208 | Dermatitis | FAERS: 1 | US FAERS | |
| 209 | Device leakage | FAERS: 1 | US FAERS | |
| 210 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 211 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 212 | Drug label confusion | FAERS: 1 | US FAERS | |
| 213 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 214 | Dysgeusia | FAERS: 1 | US FAERS | |
| 215 | Dyspepsia | FAERS: 1 | US FAERS | |
| 216 | Dystonia | FAERS: 1 | US FAERS | |
| 217 | Dysuria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Embolism | FAERS: 1 | US FAERS | |
| 219 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 220 | Excoriation | FAERS: 1 | US FAERS | |
| 221 | Expired product administered | FAERS: 1 | US FAERS | |
| 222 | Facial paralysis | FAERS: 1 | US FAERS | |
| 223 | Factor V inhibition | FAERS: 1 | US FAERS | |
| 224 | Feeling jittery | FAERS: 1 | US FAERS | |
| 225 | Gangrene | FAERS: 1 | US FAERS | |
| 226 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 227 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 228 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 229 | Hemiparesis | FAERS: 1 | US FAERS | |
| 230 | Hepatitis C positive | FAERS: 1 | US FAERS | |
| 231 | Hepatitis C | FAERS: 1 | US FAERS | |
| 232 | Hostility | FAERS: 1 | US FAERS | |
| 233 | Hypersomnia | FAERS: 1 | US FAERS | |
| 234 | Hypokinesia | FAERS: 1 | US FAERS | |
| 235 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 236 | Immobile | FAERS: 1 | US FAERS | |
| 237 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 238 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 239 | Incoherent | FAERS: 1 | US FAERS | |
| 240 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 241 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 242 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 243 | Injection site erythema | FAERS: 1 | US FAERS | |
| 244 | Injection site mass | FAERS: 1 | US FAERS | |
| 245 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 246 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 247 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 248 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 249 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 250 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 251 | Lithotripsy | FAERS: 1 | US FAERS | |
| 252 | Malnutrition | FAERS: 1 | US FAERS | |
| 253 | Mastication disorder | FAERS: 1 | US FAERS | |
| 254 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 255 | Medical device complication | FAERS: 1 | US FAERS | |
| 256 | Monoplegia | FAERS: 1 | US FAERS | |
| 257 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 258 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 259 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 260 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 261 | Neuralgia | FAERS: 1 | US FAERS | |
| 262 | No adverse effect | FAERS: 1 | US FAERS | |
| 263 | Nystagmus | FAERS: 1 | US FAERS | |
| 264 | Obstruction | FAERS: 1 | US FAERS | |
| 265 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 266 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 267 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 268 | Pain of skin | FAERS: 1 | US FAERS | |
| 269 | Pancreatitis | FAERS: 1 | US FAERS | |
| 270 | Personality Change | FAERS: 1 | US FAERS | |
| 271 | Physical product label issue | FAERS: 1 | US FAERS | |
| 272 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 273 | Pneumothorax | FAERS: 1 | US FAERS | |
| 274 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 275 | Post procedural complication | FAERS: 1 | US FAERS | |
| 276 | Post procedural infection | FAERS: 1 | US FAERS | |
| 277 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 278 | Product container issue | FAERS: 1 | US FAERS | |
| 279 | Product contamination physical | FAERS: 1 | US FAERS | |
| 280 | Product leakage | FAERS: 1 | US FAERS | |
| 281 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 282 | Product physical issue | FAERS: 1 | US FAERS | |
| 283 | Product reconstitution quality issue | FAERS: 1 | US FAERS | |
| 284 | Product storage error | FAERS: 1 | US FAERS | |
| 285 | Productive Cough | FAERS: 1 | US FAERS | |
| 286 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 287 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 288 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 289 | Recurarisation | FAERS: 1 | US FAERS | |
| 290 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 291 | Respiratory distress | FAERS: 1 | US FAERS | |
| 292 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 293 | Restlessness | FAERS: 1 | US FAERS | |
| 294 | Shock | FAERS: 1 | US FAERS | |
| 295 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 296 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 297 | Skin reaction | FAERS: 1 | US FAERS | |
| 298 | Somnambulism | FAERS: 1 | US FAERS | |
| 299 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 300 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 301 | Swelling | FAERS: 1 | US FAERS | |
| 302 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 303 | Therapy cessation | FAERS: 1 | US FAERS | |
| 304 | Throat irritation | FAERS: 1 | US FAERS | |
| 305 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 306 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 307 | Tuberculosis | FAERS: 1 | US FAERS | |
| 308 | Urinary tract discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Urinary tract infection fungal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Uterine Rupture | FAERS: 1 | US FAERS | |
| 311 | Vasculitis | FAERS: 1 | US FAERS | |
| 312 | Visual Impairment | FAERS: 1 | US FAERS | |
| 313 | Visual disturbance | FAERS: 1 | US FAERS | |
| 314 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 315 | jaundice | FAERS: 1 | US FAERS | |
| 316 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 317 | Incorrect product administration duration | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.