levocetirizine
(ZKLPARSLTMPFCP-OAQYLSRUSA-N)
Structure
- SMILES
- OC(=O)COCCN1CCN(CC1)[C@@H](c1ccc(cc1)Cl)c1ccccc1
- Type(s)
- Approved
- ATC code(s)
- R06AE09
- Molecular Formula:
- C21H25ClN2O3
- Molecular Weight:
- 388.888
- Log P:
- 3.0240
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 53.01
- CAS Number(s):
- 130018-77-8
Synonym(s)
1.
levocetirizine
2.
(2-(4-((R)-(4-chlorophenyl)phenylmethyl)piperazin-1-yl)ethoxy)acetic acid dihydrochloride
3.
(2-(4-((R)-p-chloro-alpha-phenylbenzyl)-1-piperazinyl)ethoxy)acetic acid
4.
UCB-28556
5.
Xusal
6.
Xyzal
7.
acetic acid, (2-(4-((R)-(4-chlorophenyl)phenylmethyl)-1-piperazinyl)ethoxy)-
8.
acetic acid, (2-(4-((R)-(4-chlorophenyl)phenylmethyl)-1-piperazinyl)ethoxy)-, dihydrochloride
9.
cetirizine (R)-form dihydrochloride
10.
levocetirizine dihydrochloride
11.
levocetirizine hydrochloride
12.
levocetrizine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Somnolence | FAERS: 139 | US FAERS | |
| 2 | Drug ineffective | FAERS: 137 | US FAERS | |
| 3 | Fatigue | FAERS: 58 | US FAERS | |
| 4 | Dizziness | FAERS: 23 | US FAERS | |
| 5 | Feeling abnormal | FAERS: 19 | US FAERS | |
| 6 | Headache | FAERS: 19 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 17 | US FAERS | |
| 8 | Nausea | FAERS: 17 | US FAERS | |
| 9 | Palpitations | FAERS: 17 | US FAERS | |
| 10 | Pruritus | FAERS: 17 | US FAERS | |
| 11 | Unevaluable event | FAERS: 17 | US FAERS | |
| 12 | Urticaria | FAERS: 16 | US FAERS | |
| 13 | Asthenia | FAERS: 15 | US FAERS | |
| 14 | Malaise | FAERS: 14 | US FAERS | |
| 15 | Epistaxis | FAERS: 13 | US FAERS | |
| 16 | Overdose | FAERS: 12 | US FAERS | |
| 17 | Dehydration | FAERS: 9 | US FAERS | |
| 18 | Depressed Level of Consciousness | FAERS: 9 | US FAERS | |
| 19 | Urinary Retention | FAERS: 9 | US FAERS | |
| 20 | Anaphylactic shock | FAERS: 8 | US FAERS | |
| 21 | Anxiety | FAERS: 8 | US FAERS | |
| 22 | Syncope | FAERS: 8 | US FAERS | |
| 23 | Vomiting | FAERS: 8 | US FAERS | |
| 24 | Crying | FAERS: 6 | US FAERS | |
| 25 | Erythema Multiforme | FAERS: 6 | US FAERS | |
| 26 | Erythema | FAERS: 6 | US FAERS | |
| 27 | Hypersomnia | FAERS: 6 | US FAERS | |
| 28 | Prescribed overdose | FAERS: 6 | US FAERS | |
| 29 | Product substitution issue | FAERS: 6 | US FAERS | |
| 30 | Therapeutic product effect incomplete | FAERS: 6 | US FAERS | |
| 31 | Tremor | FAERS: 6 | US FAERS | |
| 32 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 33 | Angioedema | FAERS: 5 | US FAERS | |
| 34 | Chest discomfort | FAERS: 5 | US FAERS | |
| 35 | Deafness | FAERS: 5 | US FAERS | |
| 36 | Dementia | FAERS: 5 | US FAERS | |
| 37 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 38 | Obsessive thoughts | FAERS: 5 | US FAERS | |
| 39 | Pregnancy | FAERS: 5 | US FAERS | |
| 40 | Sneezing | FAERS: 5 | US FAERS | |
| 41 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 42 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 43 | Accidental overdose | FAERS: 4 | US FAERS | |
| 44 | Anuria | FAERS: 4 | US FAERS | |
| 45 | Arthralgia | FAERS: 4 | US FAERS | |
| 46 | Asthma | FAERS: 4 | US FAERS | |
| 47 | Diplopia | FAERS: 4 | US FAERS | |
| 48 | Eczema | FAERS: 4 | US FAERS | |
| 49 | Epilepsy | FAERS: 4 | US FAERS | |
| 50 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 51 | Lethargy | FAERS: 4 | US FAERS | |
| 52 | Lip swelling | FAERS: 4 | US FAERS | |
| 53 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 54 | Medication Error | FAERS: 4 | US FAERS | |
| 55 | Myalgia | FAERS: 4 | US FAERS | |
| 56 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 57 | Pain | FAERS: 4 | US FAERS | |
| 58 | Pneumonia | FAERS: 4 | US FAERS | |
| 59 | Sluggishness | FAERS: 4 | US FAERS | |
| 60 | Tachycardia | FAERS: 4 | US FAERS | |
| 61 | jaundice | FAERS: 4 | US FAERS | |
| 62 | Abasia | FAERS: 3 | US FAERS | |
| 63 | Adverse event | FAERS: 3 | US FAERS | |
| 64 | Agitation | FAERS: 3 | US FAERS | |
| 65 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 66 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 67 | Amnesia | FAERS: 3 | US FAERS | |
| 68 | Anger | FAERS: 3 | US FAERS | |
| 69 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 70 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 71 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 72 | Back Pain | FAERS: 3 | US FAERS | |
| 73 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 74 | Bradycardia | FAERS: 3 | US FAERS | |
| 75 | Cataract | FAERS: 3 | US FAERS | |
| 76 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 77 | Chest Pain | FAERS: 3 | US FAERS | |
| 78 | Constipation | FAERS: 3 | US FAERS | |
| 79 | Depressed mood | FAERS: 3 | US FAERS | |
| 80 | Expired product administered | FAERS: 3 | US FAERS | |
| 81 | Hallucinations, mixed | FAERS: 3 | US FAERS | |
| 82 | Hypotension | FAERS: 3 | US FAERS | |
| 83 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 84 | Joint swelling | FAERS: 3 | US FAERS | |
| 85 | Metrorrhagia | FAERS: 3 | US FAERS | |
| 86 | Precocious Puberty | FAERS: 3 | US FAERS | |
| 87 | Product quality issue | FAERS: 3 | US FAERS | |
| 88 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 89 | Restlessness | FAERS: 3 | US FAERS | |
| 90 | Swelling | FAERS: 3 | US FAERS | |
| 91 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 92 | Anal Fistula | FAERS: 2 | US FAERS | |
| 93 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 94 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 95 | Bruxism | FAERS: 2 | US FAERS | |
| 96 | Burning sensation | FAERS: 2 | US FAERS | |
| 97 | Cellulitis | FAERS: 2 | US FAERS | |
| 98 | Cold sweat | FAERS: 2 | US FAERS | |
| 99 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 100 | Drug Dependence | FAERS: 2 | US FAERS | |
| 101 | Drug dose omission | FAERS: 2 | US FAERS | |
| 102 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 103 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 104 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 105 | Dysarthria | FAERS: 2 | US FAERS | |
| 106 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 107 | Flushing | FAERS: 2 | US FAERS | |
| 108 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 109 | Genital swelling | FAERS: 2 | US FAERS | |
| 110 | Gout | FAERS: 2 | US FAERS | |
| 111 | Hyperemesis Gravidarum | FAERS: 2 | US FAERS | |
| 112 | Hypokinesia | FAERS: 2 | US FAERS | |
| 113 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 114 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 115 | Infection | FAERS: 2 | US FAERS | |
| 116 | Menorrhagia | FAERS: 2 | US FAERS | |
| 117 | Mood swings | FAERS: 2 | US FAERS | |
| 118 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 119 | Neck Pain | FAERS: 2 | US FAERS | |
| 120 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 121 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 122 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 123 | Product complaint | FAERS: 2 | US FAERS | |
| 124 | Productive Cough | FAERS: 2 | US FAERS | |
| 125 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 126 | Purpura | FAERS: 2 | US FAERS | |
| 127 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 128 | Shock | FAERS: 2 | US FAERS | |
| 129 | Sinus headache | FAERS: 2 | US FAERS | |
| 130 | Sinusitis | FAERS: 2 | US FAERS | |
| 131 | Somnambulism | FAERS: 2 | US FAERS | |
| 132 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 133 | Stress | FAERS: 2 | US FAERS | |
| 134 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 135 | Suicide attempt | FAERS: 2 | US FAERS | |
| 136 | Thirst | FAERS: 2 | US FAERS | |
| 137 | Throat irritation | FAERS: 2 | US FAERS | |
| 138 | Tinnitus | FAERS: 2 | US FAERS | |
| 139 | Vasculitis | FAERS: 2 | US FAERS | |
| 140 | Wheezing | FAERS: 2 | US FAERS | |
| 141 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 142 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 143 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 144 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 145 | Allergy test positive | FAERS: 1 | US FAERS | |
| 146 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 147 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 1 | US FAERS | |
| 148 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 149 | Arthropathy | FAERS: 1 | US FAERS | |
| 150 | Ascites | FAERS: 1 | US FAERS | |
| 151 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 152 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 153 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 154 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 155 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 156 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 157 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 158 | Bronchospasm | FAERS: 1 | US FAERS | |
| 159 | Bursitis | FAERS: 1 | US FAERS | |
| 160 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 161 | Chills | FAERS: 1 | US FAERS | |
| 162 | Cholangitis | FAERS: 1 | US FAERS | |
| 163 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 164 | Cyanosis | FAERS: 1 | US FAERS | |
| 165 | Deposit eye | FAERS: 1 | US FAERS | |
| 166 | Disease Progression | FAERS: 1 | US FAERS | |
| 167 | Disease recurrence | FAERS: 1 | US FAERS | |
| 168 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 169 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 170 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 171 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 172 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 173 | Dry skin | FAERS: 1 | US FAERS | |
| 174 | Dyspepsia | FAERS: 1 | US FAERS | |
| 175 | Dysphonia | FAERS: 1 | US FAERS | |
| 176 | Dysuria | FAERS: 1 | US FAERS | |
| 177 | Ear discomfort | FAERS: 1 | US FAERS | |
| 178 | Economic problem | FAERS: 1 | US FAERS | |
| 179 | Enterocolitis viral | FAERS: 1 | US FAERS | |
| 180 | Enuresis | FAERS: 1 | US FAERS | |
| 181 | Eosinophilia | FAERS: 1 | US FAERS | |
| 182 | Euphoric mood | FAERS: 1 | US FAERS | |
| 183 | Extra dose administered | FAERS: 1 | US FAERS | |
| 184 | Eye inflammation | FAERS: 1 | US FAERS | |
| 185 | Eye irritation | FAERS: 1 | US FAERS | |
| 186 | Feeling Cold | FAERS: 1 | US FAERS | |
| 187 | Formication | FAERS: 1 | US FAERS | |
| 188 | Fracture | FAERS: 1 | US FAERS | |
| 189 | Glaucoma | FAERS: 1 | US FAERS | |
| 190 | Hepatitis | FAERS: 1 | US FAERS | |
| 191 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 192 | Hunger | FAERS: 1 | US FAERS | |
| 193 | Hypoxia | FAERS: 1 | US FAERS | |
| 194 | Impaired work ability | FAERS: 1 | US FAERS | |
| 195 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 196 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 197 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 198 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 199 | Low set ears | FAERS: 1 | US FAERS | |
| 200 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 201 | Macular degeneration | FAERS: 1 | US FAERS | |
| 202 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 203 | Mental impairment | FAERS: 1 | US FAERS | |
| 204 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 205 | Monoplegia | FAERS: 1 | US FAERS | |
| 206 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 207 | Mycoplasma test | FAERS: 1 | US FAERS | |
| 208 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 209 | Negative thoughts | FAERS: 1 | US FAERS | |
| 210 | Nerve injury | FAERS: 1 | US FAERS | |
| 211 | Nervousness | FAERS: 1 | US FAERS | |
| 212 | Night sweats | FAERS: 1 | US FAERS | |
| 213 | No adverse event | FAERS: 1 | US FAERS | |
| 214 | Nocturia | FAERS: 1 | US FAERS | |
| 215 | Nystagmus | FAERS: 1 | US FAERS | |
| 216 | Ocular icterus | FAERS: 1 | US FAERS | |
| 217 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 218 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 219 | Otitis Media | FAERS: 1 | US FAERS | |
| 220 | Pancreatitis | FAERS: 1 | US FAERS | |
| 221 | Pancytopenia | FAERS: 1 | US FAERS | |
| 222 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 223 | Performance status decreased | FAERS: 1 | US FAERS | |
| 224 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 225 | Personality Change | FAERS: 1 | US FAERS | |
| 226 | Petechiae | FAERS: 1 | US FAERS | |
| 227 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 228 | Photophobia | FAERS: 1 | US FAERS | |
| 229 | Post procedural complication | FAERS: 1 | US FAERS | |
| 230 | Presyncope | FAERS: 1 | US FAERS | |
| 231 | Product container issue | FAERS: 1 | US FAERS | |
| 232 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 233 | Product use issue | FAERS: 1 | US FAERS | |
| 234 | Proteinuria | FAERS: 1 | US FAERS | |
| 235 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 236 | Rash erythematous | FAERS: 1 | US FAERS | |
| 237 | Renal pain | FAERS: 1 | US FAERS | |
| 238 | Respiratory distress | FAERS: 1 | US FAERS | |
| 239 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 240 | Scab | FAERS: 1 | US FAERS | |
| 241 | Sedation complication | FAERS: 1 | US FAERS | |
| 242 | Sinus pain | FAERS: 1 | US FAERS | |
| 243 | Skin irritation | FAERS: 1 | US FAERS | |
| 244 | Skin reaction | FAERS: 1 | US FAERS | |
| 245 | Skin toxicity | FAERS: 1 | US FAERS | |
| 246 | Sleep Talking | FAERS: 1 | US FAERS | |
| 247 | Sopor | FAERS: 1 | US FAERS | |
| 248 | Talipes | FAERS: 1 | US FAERS | |
| 249 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 250 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 251 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 252 | Therapy cessation | FAERS: 1 | US FAERS | |
| 253 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 254 | Thrombosis | FAERS: 1 | US FAERS | |
| 255 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 256 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 257 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 258 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 259 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 260 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 261 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 262 | Verbigeration | FAERS: 1 | US FAERS | |
| 263 | Vertigo | FAERS: 1 | US FAERS | |
| 264 | Visual Impairment | FAERS: 1 | US FAERS | |
| 265 | Visual disturbance | FAERS: 1 | US FAERS | |
| 266 | Weight decreased | FAERS: 1 | US FAERS | |
| 267 | White blood cell count decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.