Fluvastatin
(ZGGHKIMDNBDHJB-NRFPMOEYSA-M)
Structure
- SMILES
- [O-]C(=O)C[C@@H](C[C@@H](/C=C/c1c(c2ccc(cc2)F)c2c(n1C(C)C)cccc2)O)O.[Na+]
- Molecular Formula:
- C24H25FNNaO4
- Molecular Weight:
- 433.448
- Log P:
- 3.2934
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 85.52
- CAS Number(s):
- 93957-55-2; 94061-80-0; 155229-75-7
Synonym(s)
1.
Fluvastatin
2.
7-(3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl)-3,5-dihydroxy-6-heptenoate
3.
Fluindostatin
4.
Fluvastatin Sodium
5.
Fluvastatin Sodium Salt
6.
Lescol
7.
XU 62-320
8.
XU 62320
9.
XU-62320
10.
XU 62 320
11.
XU62320
External Link(s)
| MeSH | D000077340 |
| PubChem Compound | 23663976 |
| ChEBI | 77602 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Alanine Aminotransferase Increased | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Myalgia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Aspartate Aminotransferase Increased | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Blood creatine phosphokinase increased | FAERS: 25 | US FAERS | |
| 5 | Gamma-Glutamyltransferase Increased | FAERS: 22 | US FAERS | |
| 6 | Malaise | FAERS: 16 | US FAERS | |
| 7 | Blood alkaline phosphatase increased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Rhabdomyolysis | FAERS: 14 | US FAERS | |
| 9 | jaundice | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Asthenia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Blood lactate dehydrogenase increased | FAERS: 11 | US FAERS | |
| 12 | Autoimmune hepatitis | FAERS: 10 | US FAERS | |
| 13 | Fatigue | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 15 | Chromaturia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Vomiting | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Asthma | FAERS: 7 | US FAERS | |
| 18 | Chest Pain | FAERS: 7 | US FAERS | |
| 19 | Cholelithiasis | FAERS: 7 | US FAERS | |
| 20 | Headache | FAERS: 7 | US FAERS | |
| 21 | Weight decreased | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Arthralgia | FAERS: 6 | US FAERS | |
| 23 | Back Pain | FAERS: 6 | US FAERS | |
| 24 | Blood immunoglobulin G increased | FAERS: 6 | US FAERS | |
| 25 | Hepatitis | FAERS: 6 | US FAERS | |
| 26 | Nausea | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Transaminases increased | FAERS: 6 | US FAERS | |
| 28 | Bilirubin conjugated increased | FAERS: 5 | US FAERS | |
| 29 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 30 | Dizziness | FAERS: 5 | US FAERS | |
| 31 | Dysgeusia | FAERS: 5 | US FAERS | |
| 32 | Dysuria | FAERS: 5 | US FAERS | |
| 33 | Eczema | FAERS: 5 | US FAERS | |
| 34 | Inflammation | FAERS: 5 | US FAERS | |
| 35 | Pneumonia | FAERS: 5 | US FAERS | |
| 36 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 37 | Hypersensitivity | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Muscle Cramp | FAERS: 4 | US FAERS | |
| 39 | Muscle strain | FAERS: 4 | US FAERS | |
| 40 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 41 | Pain | FAERS: 4 | US FAERS | |
| 42 | Pancytopenia | FAERS: 4 | US FAERS | |
| 43 | Syncope | FAERS: 4 | US FAERS | |
| 44 | Actinic keratosis | FAERS: 3 | US FAERS | |
| 45 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 46 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 47 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 48 | Cholangitis | FAERS: 3 | US FAERS | |
| 49 | Cholecystitis | FAERS: 3 | US FAERS | |
| 50 | Cholelithotomy | FAERS: 3 | US FAERS | |
| 51 | Dermatomyositis | FAERS: 3 | US FAERS | |
| 52 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 53 | Erythema | FAERS: 3 | US FAERS | |
| 54 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 55 | Injury asphyxiation | FAERS: 3 | US FAERS | |
| 56 | Musculoskeletal discomfort | FAERS: 3 | US FAERS | |
| 57 | Myelofibrosis | FAERS: 3 | US FAERS | |
| 58 | Myocardial necrosis marker increased | FAERS: 3 | US FAERS | |
| 59 | Pruritus | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 60 | Red blood cell morphology abnormal | FAERS: 3 | US FAERS | |
| 61 | Alopecia | FAERS: 2 | US FAERS | |
| 62 | Amnesia | FAERS: 2 | US FAERS | |
| 63 | Anorexia | FAERS: 2 | US FAERS | |
| 64 | Anuria | FAERS: 2 | US FAERS | |
| 65 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 66 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 67 | Blindness | FAERS: 2 | US FAERS | |
| 68 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 69 | Blood urine present | FAERS: 2 | US FAERS | |
| 70 | Bone pain | FAERS: 2 | US FAERS | |
| 71 | Cataract | FAERS: 2 | US FAERS | |
| 72 | Compression fracture | FAERS: 2 | US FAERS | |
| 73 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 74 | Constipation | FAERS: 2 | US FAERS | |
| 75 | Deafness | FAERS: 2 | US FAERS | |
| 76 | Discomfort | FAERS: 2 | US FAERS | |
| 77 | Dyspepsia | FAERS: 2 | US FAERS | |
| 78 | Eosinophilia | FAERS: 2 | US FAERS | |
| 79 | Fracture | FAERS: 2 | US FAERS | |
| 80 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 81 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 82 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 83 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 84 | Muscle necrosis | FAERS: 2 | US FAERS | |
| 85 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 86 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 87 | Myoglobin blood increased | FAERS: 2 | US FAERS | |
| 88 | Myoglobin urine present | FAERS: 2 | US FAERS | |
| 89 | Necrosis | FAERS: 2 | US FAERS | |
| 90 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 91 | Palpitations | FAERS: 2 | US FAERS | |
| 92 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 93 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 94 | Polymyositis | FAERS: 2 | US FAERS | |
| 95 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 96 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 97 | Retinal artery embolism | FAERS: 2 | US FAERS | |
| 98 | Shock | FAERS: 2 | US FAERS | |
| 99 | Stress | FAERS: 2 | US FAERS | |
| 100 | Thirst | FAERS: 2 | US FAERS | |
| 101 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 102 | Urobilin urine present | FAERS: 2 | US FAERS | |
| 103 | Urticaria | FAERS: 2 | US FAERS | |
| 104 | Vaginal erosion | FAERS: 2 | US FAERS | |
| 105 | Abasia | FAERS: 1 | US FAERS | |
| 106 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 107 | Agraphia | FAERS: 1 | US FAERS | |
| 108 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 109 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 110 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 111 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 112 | Angioedema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 114 | Anxiety | FAERS: 1 | US FAERS | |
| 115 | Apoptosis | FAERS: 1 | US FAERS | |
| 116 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 117 | Bedridden | FAERS: 1 | US FAERS | |
| 118 | Biliary Colic | FAERS: 1 | US FAERS | |
| 119 | Biopsy muscle abnormal | FAERS: 1 | US FAERS | |
| 120 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 121 | Blood acid phosphatase increased | FAERS: 1 | US FAERS | |
| 122 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 123 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 124 | Blood urea increased | FAERS: 1 | US FAERS | |
| 125 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 126 | Burning sensation | FAERS: 1 | US FAERS | |
| 127 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 128 | Cataract operation | FAERS: 1 | US FAERS | |
| 129 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 130 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 131 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 132 | Chest discomfort | FAERS: 1 | US FAERS | |
| 133 | Choking | FAERS: 1 | US FAERS | |
| 134 | Cholestasis | FAERS: 1 | US FAERS | |
| 135 | Chorea | FAERS: 1 | US FAERS | |
| 136 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 137 | Cystitis | FAERS: 1 | US FAERS | |
| 138 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 139 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 140 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 141 | Dilatation intrahepatic duct acquired | FAERS: 1 | US FAERS | |
| 142 | Disorientation | FAERS: 1 | US FAERS | |
| 143 | Diverticulum | FAERS: 1 | US FAERS | |
| 144 | Drug ineffective | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Dry skin | FAERS: 1 | US FAERS | |
| 146 | Dystonia | FAERS: 1 | US FAERS | |
| 147 | Epicondylitis | FAERS: 1 | US FAERS | |
| 148 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 149 | Expired product administered | FAERS: 1 | US FAERS | |
| 150 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 151 | Fear of falling | FAERS: 1 | US FAERS | |
| 152 | Feeling Cold | FAERS: 1 | US FAERS | |
| 153 | Flushing | FAERS: 1 | US FAERS | |
| 154 | Gastritis | FAERS: 1 | US FAERS | |
| 155 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 156 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 157 | Glaucoma | FAERS: 1 | US FAERS | |
| 158 | Hypotension | FAERS: 1 | US FAERS | |
| 159 | Infection | FAERS: 1 | US FAERS | |
| 160 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 161 | Ligament injury | FAERS: 1 | US FAERS | |
| 162 | Lip swelling | FAERS: 1 | US FAERS | |
| 163 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 164 | Memory impairment | FAERS: 1 | US FAERS | |
| 165 | Meningoradiculitis | FAERS: 1 | US FAERS | |
| 166 | Mental impairment | FAERS: 1 | US FAERS | |
| 167 | Metastasis | FAERS: 1 | US FAERS | |
| 168 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 169 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 170 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 171 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 172 | Myositis | FAERS: 1 | US FAERS | |
| 173 | Myringoplasty | FAERS: 1 | US FAERS | |
| 174 | Neuropathic ulcer | FAERS: 1 | US FAERS | |
| 175 | Neuropathy | FAERS: 1 | US FAERS | |
| 176 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 177 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 178 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 179 | Poikiloderma | FAERS: 1 | US FAERS | |
| 180 | Polydipsia | FAERS: 1 | US FAERS | |
| 181 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 182 | Polyuria | FAERS: 1 | US FAERS | |
| 183 | Protein urine present | FAERS: 1 | US FAERS | |
| 184 | Renal embolism | FAERS: 1 | US FAERS | |
| 185 | Renal mass | FAERS: 1 | US FAERS | |
| 186 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 187 | Sciatica | FAERS: 1 | US FAERS | |
| 188 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 189 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 190 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 191 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 192 | Ventricular failure | FAERS: 1 | US FAERS | |
| 193 | Visceral Pain | FAERS: 1 | US FAERS | |
| 194 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 195 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 196 | Myopathy | Canada Vigilance: 1 | Canada Vigilance | |
| 197 | Pancreatitis | Canada Vigilance: 2 | Canada Vigilance | |
| 198 | Somnolence | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.