Mitoxantrone
(ZAHQPTJLOCWVPG-UHFFFAOYSA-N)
Structure
- SMILES
- OCCNCCNc1ccc(c2c1C(=O)c1c(C2=O)c(O)ccc1O)NCCNCCO.Cl.Cl
- Molecular Formula:
- C22H30Cl2N4O6
- Molecular Weight:
- 517.403
- Log P:
- 2.3926
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 10
- TPSA:
- 163.18
- CAS Number(s):
- 70476-82-3
Synonym(s)
1.
Mitoxantrone
2.
Mitozantrone
3.
CL-232325
4.
DHAQ
5.
Mitoxantrone Acetate
6.
Mitoxantrone Hydrochloride
7.
Mitroxone
8.
NSC-279836
9.
NSC-287836
10.
NSC-299195
11.
NSC-301739
12.
NSC-301739D
13.
Novantron
14.
Novantrone
15.
Onkotrone
16.
Pralifan
17.
Ralenova
18.
Acetate, Mitoxantrone
19.
CL 232325
20.
CL232325
21.
Hydrochloride, Mitoxantrone
22.
NSC 279836
23.
NSC 287836
24.
NSC 299195
25.
NSC 301739
26.
NSC 301739D
27.
NSC279836
28.
NSC287836
29.
NSC299195
30.
NSC301739
31.
NSC301739D
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Ejection Fraction Decreased | FAERS: 85 | US FAERS | |
| 2 | Myocardial Infarction | FAERS: 21 | US FAERS | |
| 3 | White blood cell count decreased | FAERS: 14 | US FAERS | |
| 4 | Deep Vein Thrombosis | FAERS: 12 | US FAERS | |
| 5 | Cardiotoxicity | FAERS: 11 | US FAERS | |
| 6 | Pericardial effusion | FAERS: 9 | US FAERS | |
| 7 | Fatigue | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Infection | FAERS: 8 | US FAERS | |
| 9 | Multiple Sclerosis | FAERS: 8 | US FAERS | |
| 10 | Nausea | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Hypotension | FAERS: 6 | US FAERS | |
| 12 | Neutropenia | FAERS: 6 | US FAERS | |
| 13 | Pancytopenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Alopecia | FAERS: 5 | US FAERS | |
| 15 | Bone pain | FAERS: 5 | US FAERS | |
| 16 | Chest Pain | FAERS: 5 | US FAERS | |
| 17 | Diastolic dysfunction | FAERS: 5 | US FAERS | |
| 18 | Multiple sclerosis relapse | FAERS: 5 | US FAERS | |
| 19 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 20 | Vomiting | FAERS: 5 | US FAERS | |
| 21 | Accidental exposure | FAERS: 4 | US FAERS | |
| 22 | Asthenia | FAERS: 4 | US FAERS | |
| 23 | Dehydration | FAERS: 4 | US FAERS | |
| 24 | Drug toxicity | FAERS: 4 | US FAERS | |
| 25 | Dysarthria | FAERS: 4 | US FAERS | |
| 26 | Medication Error | FAERS: 4 | US FAERS | |
| 27 | Pneumonia | FAERS: 4 | US FAERS | |
| 28 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 29 | Squamous cell carcinoma | FAERS: 4 | US FAERS | |
| 30 | Syncope | FAERS: 4 | US FAERS | |
| 31 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 32 | Ataxia | FAERS: 3 | US FAERS | |
| 33 | Cardiac function test abnormal | FAERS: 3 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 35 | Cyanosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Ejection fraction abnormal | FAERS: 3 | US FAERS | |
| 37 | Extravasation | FAERS: 3 | US FAERS | |
| 38 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 39 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 40 | Leukopenia | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Mental impairment | FAERS: 3 | US FAERS | |
| 42 | Multiple gated acquisition scan abnormal | FAERS: 3 | US FAERS | |
| 43 | Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 45 | Septic Shock | FAERS: 3 | US FAERS | |
| 46 | Tachycardia | FAERS: 3 | US FAERS | |
| 47 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 48 | Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 49 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 50 | jaundice | FAERS: 3 | US FAERS | |
| 51 | Aspiration bone marrow abnormal | FAERS: 2 | US FAERS | |
| 52 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 53 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 54 | Cellulitis | FAERS: 2 | US FAERS | |
| 55 | Chest discomfort | FAERS: 2 | US FAERS | |
| 56 | Chromaturia | FAERS: 2 | US FAERS | |
| 57 | Corneal epithelium defect | FAERS: 2 | US FAERS | |
| 58 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 59 | Dizziness | FAERS: 2 | US FAERS | |
| 60 | Drug ineffective | FAERS: 2 | US FAERS | |
| 61 | Dyspepsia | FAERS: 2 | US FAERS | |
| 62 | Echocardiogram abnormal | FAERS: 2 | US FAERS | |
| 63 | Endocarditis | FAERS: 2 | US FAERS | |
| 64 | Hemiparesis | FAERS: 2 | US FAERS | |
| 65 | Infusion site pain | FAERS: 2 | US FAERS | |
| 66 | Injection site pain | FAERS: 2 | US FAERS | |
| 67 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 68 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 69 | Meningitis | FAERS: 2 | US FAERS | |
| 70 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 71 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 72 | Open wound | FAERS: 2 | US FAERS | |
| 73 | Pallor | FAERS: 2 | US FAERS | |
| 74 | Phlebitis | FAERS: 2 | US FAERS | |
| 75 | Post procedural complication | FAERS: 2 | US FAERS | |
| 76 | Premature Menopause | FAERS: 2 | US FAERS | |
| 77 | Sepsis | FAERS: 2 | US FAERS | |
| 78 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 79 | Thrombosis | FAERS: 2 | US FAERS | |
| 80 | Treatment related secondary malignancy | FAERS: 2 | US FAERS | |
| 81 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 82 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 83 | Weight decreased | FAERS: 2 | US FAERS | |
| 84 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 85 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 86 | Administration site reaction | FAERS: 1 | US FAERS | |
| 87 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 88 | Allogenic bone marrow transplantation therapy | FAERS: 1 | US FAERS | |
| 89 | Amnesia | FAERS: 1 | US FAERS | |
| 90 | Angiogram abnormal | FAERS: 1 | US FAERS | |
| 91 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 92 | Anorexia | FAERS: 1 | US FAERS | |
| 93 | Anuria | FAERS: 1 | US FAERS | |
| 94 | Aphasia | FAERS: 1 | US FAERS | |
| 95 | Application site atrophy | FAERS: 1 | US FAERS | |
| 96 | Arterial Injury | FAERS: 1 | US FAERS | |
| 97 | Arthralgia | FAERS: 1 | US FAERS | |
| 98 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 99 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 100 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 101 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 102 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 103 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 104 | Bradycardia | FAERS: 1 | US FAERS | |
| 105 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 106 | Burning sensation | FAERS: 1 | US FAERS | |
| 107 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 108 | Cardiac imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 109 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 110 | Catheter related infection | FAERS: 1 | US FAERS | |
| 111 | Central line infection | FAERS: 1 | US FAERS | |
| 112 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 113 | Constipation | FAERS: 1 | US FAERS | |
| 114 | Contracted bladder | FAERS: 1 | US FAERS | |
| 115 | Corneal defect | FAERS: 1 | US FAERS | |
| 116 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 117 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 118 | Dental caries | FAERS: 1 | US FAERS | |
| 119 | Device Failure | FAERS: 1 | US FAERS | |
| 120 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 121 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 122 | Disease Progression | FAERS: 1 | US FAERS | |
| 123 | Disease recurrence | FAERS: 1 | US FAERS | |
| 124 | Disorientation | FAERS: 1 | US FAERS | |
| 125 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 126 | Drug resistance | FAERS: 1 | US FAERS | |
| 127 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 128 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 129 | Encephalitis | FAERS: 1 | US FAERS | |
| 130 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 131 | Epiglottitis | FAERS: 1 | US FAERS | |
| 132 | Excitability | FAERS: 1 | US FAERS | |
| 133 | Eye operation complication | FAERS: 1 | US FAERS | |
| 134 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 135 | Gastritis | FAERS: 1 | US FAERS | |
| 136 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 137 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 138 | Headache | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 140 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 141 | Hypercapnic encephalopathy | FAERS: 1 | US FAERS | |
| 142 | Hypoxia | FAERS: 1 | US FAERS | |
| 143 | Incoherent | FAERS: 1 | US FAERS | |
| 144 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 145 | Inflammation | FAERS: 1 | US FAERS | |
| 146 | Infusion site bruising | FAERS: 1 | US FAERS | |
| 147 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 148 | Infusion site phlebitis | FAERS: 1 | US FAERS | |
| 149 | Infusion site pruritus | FAERS: 1 | US FAERS | |
| 150 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 151 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 152 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 153 | Injection site thrombosis | FAERS: 1 | US FAERS | |
| 154 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 155 | Lethargy | FAERS: 1 | US FAERS | |
| 156 | Leukocytosis | FAERS: 1 | US FAERS | |
| 157 | Limb injury | FAERS: 1 | US FAERS | |
| 158 | Lower respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 159 | Lymphoma | FAERS: 1 | US FAERS | |
| 160 | Malaise | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Medical device complication | FAERS: 1 | US FAERS | |
| 162 | Mental status changes | FAERS: 1 | US FAERS | |
| 163 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 164 | Neck Pain | FAERS: 1 | US FAERS | |
| 165 | No adverse event | FAERS: 1 | US FAERS | |
| 166 | Ovarian failure | FAERS: 1 | US FAERS | |
| 167 | Papilloma | FAERS: 1 | US FAERS | |
| 168 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 169 | Pericarditis | FAERS: 1 | US FAERS | |
| 170 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 171 | Pneumonitis | FAERS: 1 | US FAERS | |
| 172 | Procedural complication | FAERS: 1 | US FAERS | |
| 173 | Product use in unapproved indication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Productive Cough | FAERS: 1 | US FAERS | |
| 175 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 176 | Rash erythematous | FAERS: 1 | US FAERS | |
| 177 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 178 | Reticulocytosis | FAERS: 1 | US FAERS | |
| 179 | Sudden death | FAERS: 1 | US FAERS | |
| 180 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 181 | Swelling | FAERS: 1 | US FAERS | |
| 182 | Tremor | FAERS: 1 | US FAERS | |
| 183 | Trisomy 11 | FAERS: 1 | US FAERS | |
| 184 | Ulcer | FAERS: 1 | US FAERS | |
| 185 | Urticaria | FAERS: 1 | US FAERS | |
| 186 | Venous stasis | FAERS: 1 | US FAERS | |
| 187 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 188 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 189 | Ventricular internal diameter abnormal | FAERS: 1 | US FAERS | |
| 190 | Angioedema | Canada Vigilance: 1 | Canada Vigilance | |
| 191 | Chills | Canada Vigilance: 2 | Canada Vigilance | |
| 192 | Flushing | Canada Vigilance: 1 | Canada Vigilance | |
| 193 | Hyperventilation | Canada Vigilance: 1 | Canada Vigilance | |
| 194 | Injection Site Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 195 | Overdose | Canada Vigilance: 1 | Canada Vigilance | |
| 196 | Pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 197 | Purpura | Canada Vigilance: 1 | Canada Vigilance | |
| 198 | Ventricular arrhythmia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.