Berberine
(YBHILYKTIRIUTE-UHFFFAOYSA-N)
Structure
- SMILES
- COc1c(OC)ccc2c1c[n+]1CCc3c(c1c2)cc1c(c3)OCO1
- Type(s)
- Approved; Investigational
- Molecular Formula:
- C20H18NO4+
- Molecular Weight:
- 336.361
- Log P:
- 3.0963
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 40.8
- CAS Number(s):
- 633-65-8; 2086-83-1
Synonym(s)
1.
Berberine
2.
Umbellatine
External Link(s)
| MeSH | D001599 |
| PubChem Compound | 2353 |
| BindingDB | 50203126 50358080 |
| ChEBI | 16118 |
| CHEMBL | CHEMBL295124 |
| DrugBank | DB04115 |
| KEGG | cpd:C00757 |
| Therapeutic Target Database | D0W8WB |
| ZINC | 3779067 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Amnesia | 9268086 | CTD | |
| 2 | Bone Resorption | 9881647 | CTD | |
| 3 | Chemical and Drug Induced Liver Injury | 24751971 | CTD | |
| 4 | Cystitis | 11393582 | CTD | |
| 5 | Diabetes Mellitus, Experimental | 20229011 | CTD | |
| 6 | Diabetes Mellitus | 22342832 | CTD | |
| 7 | Edema | 11393582 | CTD | |
| 8 | Fatty Liver, Alcoholic | 25455889 | CTD | |
| 9 | Hemorrhage | 11393582 | CTD | |
| 10 | Hepatomegaly | 30138605 | CTD | |
| 11 | Hypercholesterolemia | 22342832 | CTD | |
| 12 | Hyperglycemia | 22342832 | CTD | |
| 13 | Ileal Diseases | 21963898 | CTD | |
| 14 | Inflammation | 29408570 | CTD | |
| 15 | Insulin Resistance | 18563319 | CTD | |
| 16 | Intestinal Diseases | 20656010 21073932 | CTD | |
| 17 | Kidney Diseases | 24751971 | CTD | |
| 18 | Lung Injury | 23523906 | CTD | |
| 19 | Necrosis | 24751971 30138605 | CTD | |
| 20 | Neoplasms | 12415430 | CTD | |
| 21 | Nerve Degeneration | 23954465 | CTD | |
| 22 | Neuralgia | Canada Vigilance: 1 | Canada Vigilance | |
| 23 | Osteoporosis | 18501540 | CTD | |
| 24 | Product contamination | Canada Vigilance: 1 | Canada Vigilance | |
| 25 | Prostatic Neoplasms | 16505103 | CTD | |
| 26 | Pulmonary Fibrosis | 23523906 29408570 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.