hydrochlorothiazide-triamterene
(XZRKEDHJXXLVSK-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.Nc1nc(N)c2c(n1)nc(c(n2)c1ccccc1)N
- Molecular Formula:
- C19H19ClN10O4S2
- Molecular Weight:
- 551.002
- Log P:
- 5.5544
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 6
- TPSA:
- 264.74
- CAS Number(s):
- 14124-50-6
Synonym(s)
1.
hydrochlorothiazide-triamterene
2.
Dyazide
3.
Maxzide
4.
Slimin
5.
Triampur
6.
Triampur (combination)
7.
Triampur compositum
8.
hydrochlorathiazide-triamterene
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 31 | US FAERS | |
| 2 | Dizziness | FAERS: 20 | US FAERS | |
| 3 | Headache | FAERS: 12 | US FAERS | |
| 4 | Hypotension | FAERS: 12 | US FAERS | |
| 5 | Nausea | FAERS: 10 | US FAERS | |
| 6 | Product substitution issue | FAERS: 10 | US FAERS | |
| 7 | Pruritus | FAERS: 10 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 9 | Peripheral swelling | FAERS: 9 | US FAERS | |
| 10 | Fatigue | FAERS: 8 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 12 | Product quality issue | FAERS: 8 | US FAERS | |
| 13 | Asthenia | FAERS: 7 | US FAERS | |
| 14 | Joint swelling | FAERS: 7 | US FAERS | |
| 15 | Reaction to drug excipients | FAERS: 6 | US FAERS | |
| 16 | Back Pain | FAERS: 5 | US FAERS | |
| 17 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 18 | Lethargy | FAERS: 5 | US FAERS | |
| 19 | Malaise | FAERS: 5 | US FAERS | |
| 20 | Palpitations | FAERS: 5 | US FAERS | |
| 21 | Renal tubular necrosis | FAERS: 5 | US FAERS | |
| 22 | Therapeutic response unexpected with drug substitution | FAERS: 5 | US FAERS | |
| 23 | Alopecia | FAERS: 4 | US FAERS | |
| 24 | Arthralgia | FAERS: 4 | US FAERS | |
| 25 | Blood creatinine increased | FAERS: 4 | US FAERS | |
| 26 | Burning sensation | FAERS: 4 | US FAERS | |
| 27 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 28 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 29 | Dysuria | FAERS: 4 | US FAERS | |
| 30 | Hypoxia | FAERS: 4 | US FAERS | |
| 31 | Lip swelling | FAERS: 4 | US FAERS | |
| 32 | Medication Error | FAERS: 4 | US FAERS | |
| 33 | Myalgia | FAERS: 4 | US FAERS | |
| 34 | Oliguria | FAERS: 4 | US FAERS | |
| 35 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 36 | Swelling | FAERS: 4 | US FAERS | |
| 37 | Vomiting | FAERS: 4 | US FAERS | |
| 38 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 39 | Anorexia | FAERS: 3 | US FAERS | |
| 40 | Dehydration | FAERS: 3 | US FAERS | |
| 41 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 42 | Erythema | FAERS: 3 | US FAERS | |
| 43 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 44 | Pain | FAERS: 3 | US FAERS | |
| 45 | Presyncope | FAERS: 3 | US FAERS | |
| 46 | Rash erythematous | FAERS: 3 | US FAERS | |
| 47 | Urinary Retention | FAERS: 3 | US FAERS | |
| 48 | Urticaria | FAERS: 3 | US FAERS | |
| 49 | Vertigo | FAERS: 3 | US FAERS | |
| 50 | Adverse event | FAERS: 2 | US FAERS | |
| 51 | Anxiety | FAERS: 2 | US FAERS | |
| 52 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 53 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 54 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 55 | Blood urea increased | FAERS: 2 | US FAERS | |
| 56 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 57 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 58 | Cellulitis | FAERS: 2 | US FAERS | |
| 59 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 60 | Chest Pain | FAERS: 2 | US FAERS | |
| 61 | Chills | FAERS: 2 | US FAERS | |
| 62 | Dysarthria | FAERS: 2 | US FAERS | |
| 63 | Dysgeusia | FAERS: 2 | US FAERS | |
| 64 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 65 | Eye pain | FAERS: 2 | US FAERS | |
| 66 | Flatulence | FAERS: 2 | US FAERS | |
| 67 | Flushing | FAERS: 2 | US FAERS | |
| 68 | Genital pain | FAERS: 2 | US FAERS | |
| 69 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 70 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 71 | Memory impairment | FAERS: 2 | US FAERS | |
| 72 | Mental status changes | FAERS: 2 | US FAERS | |
| 73 | Oral pain | FAERS: 2 | US FAERS | |
| 74 | Polyuria | FAERS: 2 | US FAERS | |
| 75 | Rectal Stenosis | FAERS: 2 | US FAERS | |
| 76 | Somnolence | FAERS: 2 | US FAERS | |
| 77 | Sunburn | FAERS: 2 | US FAERS | |
| 78 | Syncope | FAERS: 2 | US FAERS | |
| 79 | Urethral Stenosis | FAERS: 2 | US FAERS | |
| 80 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 81 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 82 | Androgenetic Alopecia | FAERS: 1 | US FAERS | |
| 83 | Aphasia | FAERS: 1 | US FAERS | |
| 84 | Arthropathy | FAERS: 1 | US FAERS | |
| 85 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 86 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 87 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 88 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 89 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 90 | Bone pain | FAERS: 1 | US FAERS | |
| 91 | Bradycardia | FAERS: 1 | US FAERS | |
| 92 | Cold sweat | FAERS: 1 | US FAERS | |
| 93 | Constipation | FAERS: 1 | US FAERS | |
| 94 | Disorientation | FAERS: 1 | US FAERS | |
| 95 | Drug dose omission | FAERS: 1 | US FAERS | |
| 96 | Dry skin | FAERS: 1 | US FAERS | |
| 97 | Dyspepsia | FAERS: 1 | US FAERS | |
| 98 | Dysphonia | FAERS: 1 | US FAERS | |
| 99 | Ear congestion | FAERS: 1 | US FAERS | |
| 100 | Ecchymosis | FAERS: 1 | US FAERS | |
| 101 | Economic problem | FAERS: 1 | US FAERS | |
| 102 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 103 | Epistaxis | FAERS: 1 | US FAERS | |
| 104 | Expired product administered | FAERS: 1 | US FAERS | |
| 105 | Flank Pain | FAERS: 1 | US FAERS | |
| 106 | Gout | FAERS: 1 | US FAERS | |
| 107 | Head titubation | FAERS: 1 | US FAERS | |
| 108 | Hemiplegia | FAERS: 1 | US FAERS | |
| 109 | Hunger | FAERS: 1 | US FAERS | |
| 110 | Immobile | FAERS: 1 | US FAERS | |
| 111 | Immune-mediated adverse reaction | FAERS: 1 | US FAERS | |
| 112 | Incoherent | FAERS: 1 | US FAERS | |
| 113 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 114 | Infection | FAERS: 1 | US FAERS | |
| 115 | Inflammation | FAERS: 1 | US FAERS | |
| 116 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 117 | Leukocytosis | FAERS: 1 | US FAERS | |
| 118 | Leukopenia | FAERS: 1 | US FAERS | |
| 119 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 120 | Mood swings | FAERS: 1 | US FAERS | |
| 121 | Multiple allergies | FAERS: 1 | US FAERS | |
| 122 | Muscle tightness | FAERS: 1 | US FAERS | |
| 123 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 124 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 125 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 126 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 127 | No adverse event | FAERS: 1 | US FAERS | |
| 128 | Nocturia | FAERS: 1 | US FAERS | |
| 129 | Ocular icterus | FAERS: 1 | US FAERS | |
| 130 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 131 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 132 | Pallor | FAERS: 1 | US FAERS | |
| 133 | Petechiae | FAERS: 1 | US FAERS | |
| 134 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 135 | Poisoning | FAERS: 1 | US FAERS | |
| 136 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 137 | Product formulation issue | FAERS: 1 | US FAERS | |
| 138 | Product shape issue | FAERS: 1 | US FAERS | |
| 139 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 140 | Recalled product administered | FAERS: 1 | US FAERS | |
| 141 | Restlessness | FAERS: 1 | US FAERS | |
| 142 | Salt craving | FAERS: 1 | US FAERS | |
| 143 | Shock | FAERS: 1 | US FAERS | |
| 144 | Skin irritation | FAERS: 1 | US FAERS | |
| 145 | Skin reaction | FAERS: 1 | US FAERS | |
| 146 | Stress at work | FAERS: 1 | US FAERS | |
| 147 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 148 | Tremor | FAERS: 1 | US FAERS | |
| 149 | Unevaluable event | FAERS: 1 | US FAERS | |
| 150 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 151 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 152 | Urine sodium abnormal | FAERS: 1 | US FAERS | |
| 153 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 154 | Weight decreased | FAERS: 1 | US FAERS | |
| 155 | Wheezing | FAERS: 1 | US FAERS | |
| 156 | Acute kidney injury | CTD | ||
| 157 | Confusion | 6847447 | CTD | |
| 158 | Edema | 4740567 6847447 | CTD | |
| 159 | Hallucinations | 6847447 | CTD | |
| 160 | Kidney Calculi | 7120618 7431573 | CTD | |
| 161 | Nephritis, Interstitial | 6339355 7446559 | CTD | |
| 162 | Nephrosclerosis | 7579049 | CTD | |
| 163 | Renal Colic | 4740567 | CTD | |
| 164 | Renal Insufficiency | 6339355 7446559 | CTD | |
| 165 | Urolithiasis | 7248862 | CTD | |
| 166 | Urologic Diseases | 2861527 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.