naloxegol
(XNKCCCKFOQNXKV-ZRSCBOBOSA-N)
Structure
- SMILES
- COCCOCCOCCOCCOCCOCCOCCO[C@H]1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC=C)ccc1O)O
- Type(s)
- Approved
- ATC code(s)
- A06AH03
- Molecular Formula:
- C34H53NO11
- Molecular Weight:
- 651.785
- Log P:
- 1.8014
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 2
- TPSA:
- 126.77
- CAS Number(s):
- 854601-70-0
Synonym(s)
1.
naloxegol
2.
Movantik
3.
NKTR-118
External Link(s)
| MeSH | C000589308 |
| PubChem Compound | 56959087 |
| ChEBI | 82975 |
| CHEMBL | CHEMBL2219418 |
| DrugBank | DB09049 |
| DrugCentral | 4832 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7539 |
| KEGG | dr:D10479 |
| Therapeutic Target Database | D07LCF |
| ZINC | 95564694 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 57 | US FAERS | |
| 3 | Pain | FAERS: 53 | US FAERS | |
| 4 | Constipation | FAERS: 52 | US FAERS | |
| 5 | Intentional product misuse | FAERS: 50 | US FAERS | |
| 6 | Drug withdrawal syndrome | FAERS: 47 | US FAERS | |
| 7 | Drug ineffective | FAERS: 45 | US FAERS | |
| 8 | Vomiting | FAERS: 32 | US FAERS | |
| 9 | Chills | FAERS: 31 | US FAERS | |
| 10 | Drug screen positive | FAERS: 29 | US FAERS | |
| 11 | Malaise | FAERS: 24 | US FAERS | |
| 12 | Tremor | FAERS: 22 | US FAERS | |
| 13 | Bowel movement irregularity | FAERS: 19 | US FAERS | |
| 14 | Feeling abnormal | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Flatulence | FAERS: 19 | US FAERS | |
| 16 | Anxiety | FAERS: 17 | US FAERS | |
| 17 | Dizziness | FAERS: 13 | US FAERS | |
| 18 | Infrequent bowel movements | FAERS: 12 | US FAERS | |
| 19 | Product use issue | FAERS: 12 | US FAERS | |
| 20 | Drug dose omission | FAERS: 10 | US FAERS | |
| 21 | Back Pain | FAERS: 9 | US FAERS | |
| 22 | Headache | FAERS: 9 | US FAERS | |
| 23 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 24 | Abdominal discomfort | FAERS: 8 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 25 | Dehydration | FAERS: 7 | US FAERS | |
| 26 | Asthenia | FAERS: 6 | US FAERS | |
| 27 | Somnolence | FAERS: 6 | US FAERS | |
| 28 | Weight decreased | FAERS: 6 | US FAERS | |
| 29 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 30 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 31 | Colitis | FAERS: 5 | US FAERS | |
| 32 | Fatigue | FAERS: 5 | US FAERS | |
| 33 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 34 | Adverse event | FAERS: 4 | US FAERS | |
| 35 | Chest Pain | FAERS: 4 | US FAERS | |
| 36 | Discomfort | FAERS: 4 | US FAERS | |
| 37 | Gastrointestinal Pain | FAERS: 4 | US FAERS | |
| 38 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 39 | Muscle strain | FAERS: 4 | US FAERS | |
| 40 | Nervousness | FAERS: 4 | US FAERS | |
| 41 | Abdominal symptom | FAERS: 3 | US FAERS | |
| 42 | Cold sweat | FAERS: 3 | US FAERS | |
| 43 | Crying | FAERS: 3 | US FAERS | |
| 44 | Drug administration error | FAERS: 3 | US FAERS | |
| 45 | Dysgeusia | FAERS: 3 | US FAERS | |
| 46 | Dyspepsia | FAERS: 3 | US FAERS | |
| 47 | Feeling jittery | FAERS: 3 | US FAERS | |
| 48 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 49 | Ileus | FAERS: 3 | US FAERS | |
| 50 | Joint swelling | FAERS: 3 | US FAERS | |
| 51 | Memory impairment | FAERS: 3 | US FAERS | |
| 52 | Myalgia | FAERS: 3 | US FAERS | |
| 53 | Palpitations | FAERS: 3 | US FAERS | |
| 54 | Urticaria | FAERS: 3 | US FAERS | |
| 55 | Agitation | FAERS: 2 | US FAERS | |
| 56 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 57 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 58 | Cluster Headache | FAERS: 2 | US FAERS | |
| 59 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 60 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 61 | Dysphonia | FAERS: 2 | US FAERS | |
| 62 | Eructation | FAERS: 2 | US FAERS | |
| 63 | Extra dose administered | FAERS: 2 | US FAERS | |
| 64 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 65 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 66 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 67 | Hypophagia | FAERS: 2 | US FAERS | |
| 68 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 69 | Infection | FAERS: 2 | US FAERS | |
| 70 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 71 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 72 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 73 | Limb discomfort | FAERS: 2 | US FAERS | |
| 74 | Lip swelling | FAERS: 2 | US FAERS | |
| 75 | Mouth swelling | FAERS: 2 | US FAERS | |
| 76 | Neck Pain | FAERS: 2 | US FAERS | |
| 77 | Night sweats | FAERS: 2 | US FAERS | |
| 78 | Opiates positive | FAERS: 2 | US FAERS | |
| 79 | Pancreatitis | FAERS: 2 | US FAERS | |
| 80 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 81 | Product dose omission | FAERS: 2 | US FAERS | |
| 82 | Retching | FAERS: 2 | US FAERS | |
| 83 | Swelling | FAERS: 2 | US FAERS | |
| 84 | Tachyphylaxis | FAERS: 2 | US FAERS | |
| 85 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 86 | Yawning | FAERS: 2 | US FAERS | |
| 87 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 88 | Alopecia | FAERS: 1 | US FAERS | |
| 89 | Amnesia | FAERS: 1 | US FAERS | |
| 90 | Anger | FAERS: 1 | US FAERS | |
| 91 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 92 | Anorgasmia | FAERS: 1 | US FAERS | |
| 93 | Arthralgia | FAERS: 1 | US FAERS | |
| 94 | Autonomic failure syndrome | FAERS: 1 | US FAERS | |
| 95 | Blood brain barrier defect | FAERS: 1 | US FAERS | |
| 96 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 97 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 98 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 99 | Blood urea increased | FAERS: 1 | US FAERS | |
| 100 | Blood urine present | FAERS: 1 | US FAERS | |
| 101 | Bone pain | FAERS: 1 | US FAERS | |
| 102 | Burning sensation | FAERS: 1 | US FAERS | |
| 103 | Cancer Pain | FAERS: 1 | US FAERS | |
| 104 | Carbohydrate intolerance | FAERS: 1 | US FAERS | |
| 105 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 106 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 107 | Dementia | FAERS: 1 | US FAERS | |
| 108 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 109 | Disorientation | FAERS: 1 | US FAERS | |
| 110 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 111 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 112 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 113 | Dystonia | FAERS: 1 | US FAERS | |
| 114 | Dysuria | FAERS: 1 | US FAERS | |
| 115 | Epilepsy | FAERS: 1 | US FAERS | |
| 116 | Epistaxis | FAERS: 1 | US FAERS | |
| 117 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 118 | Food Poisoning | FAERS: 1 | US FAERS | |
| 119 | Formication | FAERS: 1 | US FAERS | |
| 120 | Gastritis | FAERS: 1 | US FAERS | |
| 121 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 122 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 123 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 124 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 125 | Glaucoma | FAERS: 1 | US FAERS | |
| 126 | Hepatitis | FAERS: 1 | US FAERS | |
| 127 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 128 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 129 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 130 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 131 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 132 | Influenza | FAERS: 1 | US FAERS | |
| 133 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 134 | Intestinal Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 135 | Intussusception | FAERS: 1 | US FAERS | |
| 136 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 137 | Medication Error | FAERS: 1 | US FAERS | |
| 138 | Medication residue present | FAERS: 1 | US FAERS | |
| 139 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 140 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 141 | Moaning | FAERS: 1 | US FAERS | |
| 142 | Muscle tightness | FAERS: 1 | US FAERS | |
| 143 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 144 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 145 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 146 | Myoclonus | FAERS: 1 | US FAERS | |
| 147 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 148 | Negative thoughts | FAERS: 1 | US FAERS | |
| 149 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 150 | Neuralgia | FAERS: 1 | US FAERS | |
| 151 | No adverse event | FAERS: 1 | US FAERS | |
| 152 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 153 | Overdose | FAERS: 1 | US FAERS | |
| 154 | Pallor | FAERS: 1 | US FAERS | |
| 155 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 156 | Panic Disorder | FAERS: 1 | US FAERS | |
| 157 | Post procedural infection | FAERS: 1 | US FAERS | |
| 158 | Pruritus | FAERS: 1 | US FAERS | |
| 159 | Quadriplegia | FAERS: 1 | US FAERS | |
| 160 | Renal pain | FAERS: 1 | US FAERS | |
| 161 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 162 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 163 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 164 | Sinusitis | FAERS: 1 | US FAERS | |
| 165 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 166 | Tarsal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 167 | Therapy cessation | FAERS: 1 | US FAERS | |
| 168 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 169 | Throat irritation | FAERS: 1 | US FAERS | |
| 170 | Ulcer | FAERS: 1 | US FAERS | |
| 171 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 172 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 173 | Wrong dose | FAERS: 1 | US FAERS | |
| 174 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.