iloperidone
(XMXHEBAFVSFQEX-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc(ccc1OCCCN1CCC(CC1)c1noc2c1ccc(c2)F)C(=O)C
- Type(s)
- Approved
- ATC code(s)
- N05AX14
- Molecular Formula:
- C24H27FN2O4
- Molecular Weight:
- 426.481
- Log P:
- 4.7645
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 0
- TPSA:
- 64.8
- CAS Number(s):
- 133454-47-4
Synonym(s)
1.
iloperidone
2.
Fanapt
3.
HP 873
4.
HP-873
5.
Zomaril
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 52 | SIDER US FAERS | |
| 2 | Nausea | FAERS: 34 | SIDER US FAERS | |
| 3 | Vomiting | FAERS: 27 | US FAERS | |
| 4 | Tachycardia | FAERS: 25 | SIDER US FAERS | |
| 5 | Retrograde ejaculation | FAERS: 16 | SIDER US FAERS | |
| 6 | Headache | FAERS: 15 | US FAERS | |
| 7 | Somnolence | FAERS: 15 | SIDER US FAERS | |
| 8 | Syncope | FAERS: 15 | US FAERS | |
| 9 | Palpitations | FAERS: 13 | SIDER US FAERS | |
| 10 | Hypotension | FAERS: 12 | SIDER US FAERS | |
| 11 | Drug administered to patient of inappropriate age | FAERS: 11 | US FAERS | |
| 12 | Priapism | FAERS: 11 | US FAERS | |
| 13 | Sexual Dysfunction | FAERS: 11 | US FAERS | |
| 14 | Fatigue | FAERS: 10 | SIDER US FAERS | |
| 15 | Feeling abnormal | FAERS: 10 | SIDER US FAERS | |
| 16 | Akathisia | FAERS: 9 | SIDER US FAERS | |
| 17 | Anxiety | FAERS: 9 | US FAERS | |
| 18 | Chest discomfort | FAERS: 9 | US FAERS | |
| 19 | Drug ineffective | FAERS: 9 | US FAERS | |
| 20 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 21 | Malaise | FAERS: 8 | US FAERS | |
| 22 | Tardive Dyskinesia | FAERS: 8 | US FAERS | |
| 23 | Chest Pain | FAERS: 7 | US FAERS | |
| 24 | Enuresis | FAERS: 7 | SIDER US FAERS | |
| 25 | Restlessness | FAERS: 7 | US FAERS | |
| 26 | Tremor | FAERS: 7 | SIDER US FAERS | |
| 27 | Muscle Rigidity | FAERS: 6 | US FAERS | |
| 28 | Completed Suicide | FAERS: 5 | US FAERS | |
| 29 | Overdose | FAERS: 5 | US FAERS | |
| 30 | Agitation | FAERS: 4 | SIDER US FAERS | |
| 31 | Asthenia | FAERS: 4 | SIDER US FAERS | |
| 32 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 33 | Constipation | FAERS: 4 | US FAERS | |
| 34 | Dystonia | FAERS: 4 | US FAERS | |
| 35 | Hunger | FAERS: 4 | US FAERS | |
| 36 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 37 | Nervousness | FAERS: 4 | US FAERS | |
| 38 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 39 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 40 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 41 | Alopecia | FAERS: 3 | US FAERS | |
| 42 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 43 | Dehydration | FAERS: 3 | SIDER US FAERS | |
| 44 | Disorientation | FAERS: 3 | US FAERS | |
| 45 | Dysarthria | FAERS: 3 | US FAERS | |
| 46 | Dysphonia | FAERS: 3 | US FAERS | |
| 47 | Erection increased | FAERS: 3 | US FAERS | |
| 48 | Memory impairment | FAERS: 3 | US FAERS | |
| 49 | Musculoskeletal stiffness | FAERS: 3 | SIDER US FAERS | |
| 50 | Neuroleptic Malignant Syndrome | FAERS: 3 | US FAERS | |
| 51 | Orthostatic hypertension | FAERS: 3 | US FAERS | |
| 52 | Product administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 53 | Swelling | FAERS: 3 | US FAERS | |
| 54 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 55 | Urinary Incontinence | FAERS: 3 | SIDER US FAERS | |
| 56 | Urticaria | FAERS: 3 | US FAERS | |
| 57 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 58 | Abasia | FAERS: 2 | US FAERS | |
| 59 | Abdominal discomfort | FAERS: 2 | SIDER US FAERS | |
| 60 | Amnesia | FAERS: 2 | SIDER US FAERS | |
| 61 | Anger | FAERS: 2 | US FAERS | |
| 62 | Anorgasmia | FAERS: 2 | SIDER US FAERS | |
| 63 | Apathy | FAERS: 2 | US FAERS | |
| 64 | Back Pain | FAERS: 2 | US FAERS | |
| 65 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 66 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 67 | Blood prolactin increased | FAERS: 2 | US FAERS | |
| 68 | Catatonia | FAERS: 2 | SIDER US FAERS | |
| 69 | Dysgeusia | FAERS: 2 | US FAERS | |
| 70 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 71 | Emotional disorder | FAERS: 2 | US FAERS | |
| 72 | Epilepsy | FAERS: 2 | US FAERS | |
| 73 | Epistaxis | FAERS: 2 | SIDER US FAERS | |
| 74 | Erectile dysfunction | FAERS: 2 | SIDER US FAERS | |
| 75 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 76 | Incontinence | FAERS: 2 | US FAERS | |
| 77 | Lethargy | FAERS: 2 | SIDER US FAERS | |
| 78 | Limb discomfort | FAERS: 2 | US FAERS | |
| 79 | Lip swelling | FAERS: 2 | US FAERS | |
| 80 | Muscle tightness | FAERS: 2 | US FAERS | |
| 81 | Mutism | FAERS: 2 | US FAERS | |
| 82 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 83 | Night sweats | FAERS: 2 | US FAERS | |
| 84 | No adverse event | FAERS: 2 | US FAERS | |
| 85 | Nodule | FAERS: 2 | US FAERS | |
| 86 | Obsessive-Compulsive Disorder | FAERS: 2 | SIDER US FAERS | |
| 87 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 88 | Product label confusion | FAERS: 2 | US FAERS | |
| 89 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 90 | Somnambulism | FAERS: 2 | US FAERS | |
| 91 | Suicide attempt | FAERS: 2 | US FAERS | |
| 92 | Thirst | FAERS: 2 | SIDER US FAERS | |
| 93 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 94 | Vertigo | FAERS: 2 | SIDER US FAERS | |
| 95 | Visual Impairment | FAERS: 2 | US FAERS | |
| 96 | Wheezing | FAERS: 2 | US FAERS | |
| 97 | Accidental overdose | FAERS: 1 | US FAERS | |
| 98 | Acne | FAERS: 1 | US FAERS | |
| 99 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 100 | Amblyopia | FAERS: 1 | US FAERS | |
| 101 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 102 | Angioedema | FAERS: 1 | US FAERS | |
| 103 | Apparent death | FAERS: 1 | US FAERS | |
| 104 | Arthralgia | FAERS: 1 | SIDER US FAERS | |
| 105 | Aspermia | FAERS: 1 | US FAERS | |
| 106 | Ataxia | FAERS: 1 | US FAERS | |
| 107 | Blepharospasm | FAERS: 1 | US FAERS | |
| 108 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 109 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 110 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 111 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 112 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 113 | Bradycardia | FAERS: 1 | US FAERS | |
| 114 | Breast tenderness | FAERS: 1 | US FAERS | |
| 115 | Candidiasis | FAERS: 1 | US FAERS | |
| 116 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 117 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 118 | Chills | FAERS: 1 | US FAERS | |
| 119 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 120 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 121 | Diplopia | FAERS: 1 | US FAERS | |
| 122 | Discomfort | FAERS: 1 | US FAERS | |
| 123 | Disease Progression | FAERS: 1 | US FAERS | |
| 124 | Drooling | FAERS: 1 | US FAERS | |
| 125 | Drug dose omission | FAERS: 1 | US FAERS | |
| 126 | Drug effect variable | FAERS: 1 | US FAERS | |
| 127 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 128 | Drug level increased | FAERS: 1 | US FAERS | |
| 129 | Drug screen positive | FAERS: 1 | US FAERS | |
| 130 | Dry skin | FAERS: 1 | US FAERS | |
| 131 | Dysphemia | FAERS: 1 | US FAERS | |
| 132 | Dysuria | FAERS: 1 | SIDER US FAERS | |
| 133 | Ear congestion | FAERS: 1 | US FAERS | |
| 134 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 135 | Essential Tremor | FAERS: 1 | US FAERS | |
| 136 | Expired product administered | FAERS: 1 | US FAERS | |
| 137 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 138 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 139 | Head discomfort | FAERS: 1 | US FAERS | |
| 140 | Hyperacusis | FAERS: 1 | US FAERS | |
| 141 | Hyperphagia | FAERS: 1 | US FAERS | |
| 142 | Hyperventilation | FAERS: 1 | US FAERS | |
| 143 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 144 | Joint swelling | FAERS: 1 | US FAERS | |
| 145 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 146 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 147 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 148 | Medication Error | FAERS: 1 | US FAERS | |
| 149 | Menorrhagia | FAERS: 1 | SIDER US FAERS | |
| 150 | Mental impairment | FAERS: 1 | US FAERS | |
| 151 | Mental status changes | FAERS: 1 | US FAERS | |
| 152 | Mouth swelling | FAERS: 1 | US FAERS | |
| 153 | Myalgia | FAERS: 1 | SIDER US FAERS | |
| 154 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 155 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 156 | Neck Pain | FAERS: 1 | US FAERS | |
| 157 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 158 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 159 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 160 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 161 | Pallor | FAERS: 1 | US FAERS | |
| 162 | Pancytopenia | FAERS: 1 | US FAERS | |
| 163 | Paranoia | FAERS: 1 | SIDER US FAERS | |
| 164 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 165 | Pneumonia | FAERS: 1 | US FAERS | |
| 166 | Polyuria | FAERS: 1 | US FAERS | |
| 167 | Pregnancy | FAERS: 1 | US FAERS | |
| 168 | Product dispensing error | FAERS: 1 | US FAERS | |
| 169 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 170 | Product use issue | FAERS: 1 | US FAERS | |
| 171 | Pruritus | FAERS: 1 | US FAERS | |
| 172 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 173 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 174 | Schizophrenia | FAERS: 1 | US FAERS | |
| 175 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 176 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 177 | Sudden death | FAERS: 1 | US FAERS | |
| 178 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 179 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 180 | Therapy cessation | FAERS: 1 | US FAERS | |
| 181 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 182 | Tinnitus | FAERS: 1 | SIDER US FAERS | |
| 183 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 184 | Unevaluable event | FAERS: 1 | US FAERS | |
| 185 | Visual brightness | FAERS: 1 | US FAERS | |
| 186 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 187 | heart rate | FAERS: 1 | US FAERS | |
| 188 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 189 | prostatitis | FAERS: 1 | SIDER US FAERS | |
| 190 | treatment failure | FAERS: 1 | US FAERS | |
| 191 | Aphthous Stomatitis | SIDER | ||
| 192 | Asthma | SIDER | ||
| 193 | Blepharitis | SIDER | ||
| 194 | Bradykinesia | SIDER | ||
| 195 | Bulimia Nervosa | SIDER | ||
| 196 | Cataract | SIDER | ||
| 197 | Cheilitis | SIDER | ||
| 198 | Cholelithiasis | SIDER | ||
| 199 | Conjunctivitis | SIDER | ||
| 200 | Delirium | SIDER | ||
| 201 | Dermatitis | SIDER | ||
| 202 | Disturbance in sexual arousal | SIDER | ||
| 203 | Duodenal Ulcer | SIDER | ||
| 204 | Ear and labyrinth disorders | SIDER | ||
| 205 | Gastric pH decreased | SIDER | ||
| 206 | Gastritis | SIDER | ||
| 207 | Hostility | SIDER | ||
| 208 | Hyperchlorhydria | SIDER | ||
| 209 | Hypothyroidism | SIDER | ||
| 210 | Infection | SIDER | ||
| 211 | Malnutrition | SIDER | ||
| 212 | Metrorrhagia | SIDER | ||
| 213 | Mood swings | SIDER | ||
| 214 | Musculoskeletal discomfort | SIDER | ||
| 215 | Nephrolithiasis | SIDER | ||
| 216 | Nystagmus | SIDER | ||
| 217 | Restless Legs Syndrome | SIDER | ||
| 218 | Stomatitis | SIDER | ||
| 219 | Torticollis | SIDER | ||
| 220 | Urinary Retention | SIDER | ||
| 221 | Weight decreased | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.