Ketoconazole
(XMAYWYJOQHXEEK-ZEQKJWHPSA-N)
Structure
- SMILES
- Clc1ccc(c(c1)Cl)[C@@]1(OC[C@H](O1)COc1ccc(cc1)N1CCN(CC1)C(=O)C)Cn1cncc1
- Type(s)
- Investigational
- Molecular Formula:
- C26H28Cl2N4O4
- Molecular Weight:
- 531.431
- Log P:
- 4.2087
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 0
- TPSA:
- 69.06
- CAS Number(s):
- 65277-42-1; 72093-26-6; 142128-57-2; 142128-59-4
Synonym(s)
1.
Ketoconazole
2.
Nizoral
3.
R-41400
4.
R41,400
5.
R41400
6.
R 41400
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use issue | FAERS: 258 | US FAERS | |
| 2 | Therapeutic response unexpected | FAERS: 224 | US FAERS | |
| 3 | Drug ineffective | FAERS: 198 | US FAERS | |
| 4 | Inappropriate schedule of drug administration | FAERS: 90 | US FAERS | |
| 5 | Alopecia | FAERS: 60 | US FAERS | |
| 6 | Pruritus | FAERS: 60 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 7 | Intentional product misuse | FAERS: 48 | US FAERS | |
| 8 | Product use in unapproved indication | FAERS: 43 | US FAERS | |
| 9 | Intentional product use issue | FAERS: 31 | US FAERS | |
| 10 | Drug exposure during pregnancy | FAERS: 30 | US FAERS | |
| 11 | Drug prescribing error | FAERS: 28 | US FAERS | |
| 12 | Expired product administered | FAERS: 27 | US FAERS | |
| 13 | Erythema | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Drug administered at inappropriate site | FAERS: 19 | US FAERS | |
| 15 | Dry skin | FAERS: 19 | US FAERS | |
| 16 | Burning sensation | FAERS: 14 | US FAERS | |
| 17 | Incorrect route of drug administration | FAERS: 14 | US FAERS | |
| 18 | Accidental exposure to product | FAERS: 12 | US FAERS | |
| 19 | Drug ineffective for unapproved indication | FAERS: 12 | US FAERS | |
| 20 | Skin irritation | FAERS: 12 | US FAERS | |
| 21 | Drug administration error | FAERS: 11 | US FAERS | |
| 22 | Nausea | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Headache | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 26 | Intentional drug misuse | FAERS: 9 | US FAERS | |
| 27 | Vomiting | FAERS: 9 | US FAERS | |
| 28 | Pain | FAERS: 8 | US FAERS | |
| 29 | Trichorrhexis | FAERS: 8 | US FAERS | |
| 30 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 31 | Application site pain | FAERS: 7 | US FAERS | |
| 32 | Application site pruritus | FAERS: 7 | US FAERS | |
| 33 | Eye irritation | FAERS: 7 | US FAERS | |
| 34 | Hepatitis | FAERS: 7 | US FAERS | |
| 35 | Product quality issue | FAERS: 7 | US FAERS | |
| 36 | Unintentional use for unapproved indication | FAERS: 7 | US FAERS | |
| 37 | jaundice | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Acne | FAERS: 6 | US FAERS | |
| 39 | Adverse event | FAERS: 6 | US FAERS | |
| 40 | Aspartate Aminotransferase Increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Pain of skin | FAERS: 6 | US FAERS | |
| 42 | Urticaria | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 44 | Application site rash | FAERS: 5 | US FAERS | |
| 45 | Dizziness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Product counterfeit | FAERS: 5 | US FAERS | |
| 47 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 48 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 49 | Asthenia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Chills | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Dermatitis | FAERS: 4 | US FAERS | |
| 52 | Malaise | FAERS: 4 | US FAERS | |
| 53 | Product label issue | FAERS: 4 | US FAERS | |
| 54 | Rash erythematous | FAERS: 4 | US FAERS | |
| 55 | Scab | FAERS: 4 | US FAERS | |
| 56 | Skin reaction | FAERS: 4 | US FAERS | |
| 57 | Suspected counterfeit product | FAERS: 4 | US FAERS | |
| 58 | Syncope | FAERS: 4 | US FAERS | |
| 59 | Angioedema | FAERS: 3 | US FAERS | |
| 60 | Application site erythema | FAERS: 3 | US FAERS | |
| 61 | Cholecystitis | FAERS: 3 | US FAERS | |
| 62 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 63 | Discomfort | FAERS: 3 | US FAERS | |
| 64 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 65 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 66 | Eczema | FAERS: 3 | US FAERS | |
| 67 | Gastritis | FAERS: 3 | US FAERS | |
| 68 | Hair injury | FAERS: 3 | US FAERS | |
| 69 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 70 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 71 | Myalgia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Ocular icterus | FAERS: 3 | US FAERS | |
| 73 | Overdose | FAERS: 3 | US FAERS | |
| 74 | Product formulation issue | FAERS: 3 | US FAERS | |
| 75 | Product packaging issue | FAERS: 3 | US FAERS | |
| 76 | Shock | FAERS: 3 | US FAERS | |
| 77 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 78 | Stress | FAERS: 3 | US FAERS | |
| 79 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 80 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 81 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 82 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 83 | Application site exfoliation | FAERS: 2 | US FAERS | |
| 84 | Application site vesicles | FAERS: 2 | US FAERS | |
| 85 | Asthma | FAERS: 2 | US FAERS | |
| 86 | Carcinoma | FAERS: 2 | US FAERS | |
| 87 | Choking sensation | FAERS: 2 | US FAERS | |
| 88 | Chromaturia | FAERS: 2 | US FAERS | |
| 89 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 90 | Cyanosis | FAERS: 2 | US FAERS | |
| 91 | Drug abuse | FAERS: 2 | US FAERS | |
| 92 | Drug dose omission | FAERS: 2 | US FAERS | |
| 93 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 94 | Erysipelas | FAERS: 2 | US FAERS | |
| 95 | Eye Burns | FAERS: 2 | US FAERS | |
| 96 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 97 | Hypersomnia | FAERS: 2 | US FAERS | |
| 98 | Hypokinesia | FAERS: 2 | US FAERS | |
| 99 | Inflammation | FAERS: 2 | US FAERS | |
| 100 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 101 | Lip swelling | FAERS: 2 | US FAERS | |
| 102 | Medication Error | FAERS: 2 | US FAERS | |
| 103 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 104 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 105 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 106 | Priapism | FAERS: 2 | US FAERS | |
| 107 | Product administered at inappropriate site | FAERS: 2 | US FAERS | |
| 108 | Product availability issue | FAERS: 2 | US FAERS | |
| 109 | Product dose omission | FAERS: 2 | US FAERS | |
| 110 | Product physical issue | FAERS: 2 | US FAERS | |
| 111 | Psoriasis | FAERS: 2 | US FAERS | |
| 112 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 113 | Rosacea | FAERS: 2 | US FAERS | |
| 114 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 115 | Skin lesion | FAERS: 2 | US FAERS | |
| 116 | Swelling | FAERS: 2 | US FAERS | |
| 117 | Thermal burn | FAERS: 2 | US FAERS | |
| 118 | Tremor | FAERS: 2 | US FAERS | |
| 119 | Unevaluable event | FAERS: 2 | US FAERS | |
| 120 | Weight decreased | FAERS: 2 | US FAERS | |
| 121 | Abnormal palmar/plantar creases | FAERS: 1 | US FAERS | |
| 122 | Accidental exposure | FAERS: 1 | US FAERS | |
| 123 | Accidental overdose | FAERS: 1 | US FAERS | |
| 124 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 125 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 126 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 127 | Aphonia | FAERS: 1 | US FAERS | |
| 128 | Application site alopecia | FAERS: 1 | US FAERS | |
| 129 | Application site burn | FAERS: 1 | US FAERS | |
| 130 | Application site coldness | FAERS: 1 | US FAERS | |
| 131 | Application site dryness | FAERS: 1 | US FAERS | |
| 132 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 133 | Application site scar | FAERS: 1 | US FAERS | |
| 134 | Ascites | FAERS: 1 | US FAERS | |
| 135 | Asphyxia | FAERS: 1 | US FAERS | |
| 136 | Benign congenital hypotonia | FAERS: 1 | US FAERS | |
| 137 | Blighted ovum | FAERS: 1 | US FAERS | |
| 138 | Blindness | FAERS: 1 | US FAERS | |
| 139 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 140 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 141 | Bone swelling | FAERS: 1 | US FAERS | |
| 142 | Bronchitis | FAERS: 1 | US FAERS | |
| 143 | Bronchospasm | FAERS: 1 | US FAERS | |
| 144 | Caustic injury | FAERS: 1 | US FAERS | |
| 145 | Cellulitis | FAERS: 1 | US FAERS | |
| 146 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 147 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 148 | Chest discomfort | FAERS: 1 | US FAERS | |
| 149 | Conjunctival irritation | FAERS: 1 | US FAERS | |
| 150 | Constipation | FAERS: 1 | US FAERS | |
| 151 | Corneal erosion | FAERS: 1 | US FAERS | |
| 152 | Crying | FAERS: 1 | US FAERS | |
| 153 | Dementia | FAERS: 1 | US FAERS | |
| 154 | Depressed mood | FAERS: 1 | US FAERS | |
| 155 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 156 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 157 | Drug toxicity | FAERS: 1 | US FAERS | |
| 158 | Dysgeusia | FAERS: 1 | US FAERS | |
| 159 | Dyspepsia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 161 | Eosinophilia | FAERS: 1 | US FAERS | |
| 162 | Epilepsy | FAERS: 1 | US FAERS | |
| 163 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 164 | Euphoric mood | FAERS: 1 | US FAERS | |
| 165 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 166 | Eye pain | FAERS: 1 | US FAERS | |
| 167 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 168 | Flushing | FAERS: 1 | US FAERS | |
| 169 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 170 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 171 | Hepatitis B core antibody positive | FAERS: 1 | US FAERS | |
| 172 | Hepatitis B e antibody positive | FAERS: 1 | US FAERS | |
| 173 | Hepatitis B surface antigen positive | FAERS: 1 | US FAERS | |
| 174 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 175 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 176 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 177 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 178 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 179 | Incontinence | FAERS: 1 | US FAERS | |
| 180 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 181 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 182 | Leukoderma | FAERS: 1 | US FAERS | |
| 183 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 184 | Low set ears | FAERS: 1 | US FAERS | |
| 185 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 186 | Mental impairment | FAERS: 1 | US FAERS | |
| 187 | Multiple Pregnancy | FAERS: 1 | US FAERS | |
| 188 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 189 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 190 | Neck Pain | FAERS: 1 | US FAERS | |
| 191 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 192 | Neuralgia | FAERS: 1 | US FAERS | |
| 193 | Nodule | FAERS: 1 | US FAERS | |
| 194 | Oliguria | FAERS: 1 | US FAERS | |
| 195 | Pallor | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Pancreatitis | FAERS: 1 | US FAERS | |
| 197 | Pancytopenia | FAERS: 1 | US FAERS | |
| 198 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 199 | Pharyngitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Physical product label issue | FAERS: 1 | US FAERS | |
| 201 | Pityriasis Rubra Pilaris | FAERS: 1 | US FAERS | |
| 202 | Pneumonia | FAERS: 1 | US FAERS | |
| 203 | Polydipsia | FAERS: 1 | US FAERS | |
| 204 | Product administration error | FAERS: 1 | US FAERS | |
| 205 | Product container issue | FAERS: 1 | US FAERS | |
| 206 | Product container seal issue | FAERS: 1 | US FAERS | |
| 207 | Product contamination | FAERS: 1 | US FAERS | |
| 208 | Product label confusion | FAERS: 1 | US FAERS | |
| 209 | Product leakage | FAERS: 1 | US FAERS | |
| 210 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 211 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 212 | Product size issue | FAERS: 1 | US FAERS | |
| 213 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 214 | Product storage error | FAERS: 1 | US FAERS | |
| 215 | Product tampering | FAERS: 1 | US FAERS | |
| 216 | Pseudobulbar Palsy | FAERS: 1 | US FAERS | |
| 217 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 218 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 219 | Regurgitation | FAERS: 1 | US FAERS | |
| 220 | Sepsis | FAERS: 1 | US FAERS | |
| 221 | Sinusitis | FAERS: 1 | US FAERS | |
| 222 | Skin discomfort | FAERS: 1 | US FAERS | |
| 223 | Skin laceration | FAERS: 1 | US FAERS | |
| 224 | Skin tightness | FAERS: 1 | US FAERS | |
| 225 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 226 | Sunburn | FAERS: 1 | US FAERS | |
| 227 | Superinfection | FAERS: 1 | US FAERS | |
| 228 | Tachycardia | FAERS: 1 | US FAERS | |
| 229 | Total bile acids increased | FAERS: 1 | US FAERS | |
| 230 | Transaminases increased | FAERS: 1 | US FAERS | |
| 231 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 232 | Ulcer | FAERS: 1 | US FAERS | |
| 233 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 234 | Vasculitis | FAERS: 1 | US FAERS | |
| 235 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 236 | Ventricular hypoplasia | FAERS: 1 | US FAERS | |
| 237 | Vertigo | FAERS: 1 | US FAERS | |
| 238 | Wheezing | FAERS: 1 | US FAERS | |
| 239 | Apathy | Canada Vigilance: 1 | Canada Vigilance | |
| 240 | Aphasia | Canada Vigilance: 1 | Canada Vigilance | |
| 241 | Arthralgia | Canada Vigilance: 1 | Canada Vigilance | |
| 242 | Chest Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 243 | Hepatomegaly | Canada Vigilance: 1 | Canada Vigilance | |
| 244 | Pericarditis | Canada Vigilance: 1 | Canada Vigilance | |
| 245 | Petechiae | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.