Timolol
(WLRMANUAADYWEA-NWASOUNVSA-N)
Structure
- SMILES
- O[C@H](COc1nsnc1N1CCOCC1)CNC(C)(C)C.OC(=O)/C=C\C(=O)O
- Molecular Formula:
- C17H28N4O7S
- Molecular Weight:
- 432.492
- Log P:
- 0.6702
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 182.58
- CAS Number(s):
- 26921-17-5; 60469-65-0
Synonym(s)
1.
Timolol
2.
(S)-1-((1,1-Dimethylethyl)amino)-3-((4-(4-morpholinyl)-1,2,5-thiadazol-3-yl)oxy)-2-propanol
3.
2-Propanol, 1-((1,1-dimethylethyl)amino)-3-((4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl)oxy)-, (S)-
4.
Blocadren
5.
L-714,465
6.
MK-950
7.
Optimol
8.
Timacar
9.
Timolol Hemihydrate
10.
Timolol Maleate
11.
Timolol Maleate, (1:1) Salt
12.
Timoptic
13.
Timoptol
14.
L 714,465
15.
L714,465
16.
MK 950
17.
MK950
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 42 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 32 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Eye pain | FAERS: 23 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 4 | Visual Impairment | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Bradycardia | FAERS: 11 | US FAERS | |
| 6 | Hypersensitivity | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Product substitution issue | FAERS: 10 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 8 | Fatigue | FAERS: 8 | US FAERS | |
| 9 | Product quality issue | FAERS: 8 | US FAERS | |
| 10 | Asthenia | FAERS: 7 | US FAERS | |
| 11 | Dizziness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Hypotension | FAERS: 7 | US FAERS | |
| 13 | Deafness | FAERS: 6 | US FAERS | |
| 14 | Atrioventricular Block | FAERS: 5 | US FAERS | |
| 15 | Blindness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Eye inflammation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Headache | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Metabolic acidosis | FAERS: 5 | US FAERS | |
| 19 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 20 | Product container issue | FAERS: 5 | US FAERS | |
| 21 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 22 | Alopecia | FAERS: 4 | US FAERS | |
| 23 | Asthma | FAERS: 4 | US FAERS | |
| 24 | Chest Pain | FAERS: 4 | US FAERS | |
| 25 | Glaucoma | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Hypoxia | FAERS: 4 | US FAERS | |
| 27 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 28 | Pneumonia | FAERS: 4 | US FAERS | |
| 29 | Product storage error | FAERS: 4 | US FAERS | |
| 30 | Sinus bradycardia | FAERS: 4 | US FAERS | |
| 31 | Swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Tremor | FAERS: 4 | US FAERS | |
| 33 | Wheezing | FAERS: 4 | US FAERS | |
| 34 | Burning sensation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Cataract | FAERS: 3 | US FAERS | |
| 36 | Conjunctivitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 38 | Erythema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Eye Infection | FAERS: 3 | US FAERS | |
| 40 | Lethargy | FAERS: 3 | US FAERS | |
| 41 | No adverse event | FAERS: 3 | US FAERS | |
| 42 | Pain | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Presyncope | FAERS: 3 | US FAERS | |
| 44 | Product contamination | FAERS: 3 | US FAERS | |
| 45 | Pruritus | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Syncope | FAERS: 3 | US FAERS | |
| 47 | Therapeutic response unexpected with drug substitution | FAERS: 3 | US FAERS | |
| 48 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 49 | Asthenopia | FAERS: 2 | US FAERS | |
| 50 | Bronchospasm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Choroidal Detachment | FAERS: 2 | US FAERS | |
| 52 | Corneal Opacity | FAERS: 2 | US FAERS | |
| 53 | Corneal Scar | FAERS: 2 | US FAERS | |
| 54 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 55 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 56 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 57 | Instillation site irritation | FAERS: 2 | US FAERS | |
| 58 | Instillation site pain | FAERS: 2 | US FAERS | |
| 59 | Joint swelling | FAERS: 2 | US FAERS | |
| 60 | Keratitis | FAERS: 2 | US FAERS | |
| 61 | Liquid product physical issue | FAERS: 2 | US FAERS | |
| 62 | Medication Error | FAERS: 2 | US FAERS | |
| 63 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 64 | Photophobia | FAERS: 2 | US FAERS | |
| 65 | Product dose omission | FAERS: 2 | US FAERS | |
| 66 | Product label issue | FAERS: 2 | US FAERS | |
| 67 | Product outer packaging issue | FAERS: 2 | US FAERS | |
| 68 | Scab | FAERS: 2 | US FAERS | |
| 69 | Skin irritation | FAERS: 2 | US FAERS | |
| 70 | Somnolence | FAERS: 2 | US FAERS | |
| 71 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 72 | Throat irritation | FAERS: 2 | US FAERS | |
| 73 | Vomiting | FAERS: 2 | US FAERS | |
| 74 | Weight decreased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 76 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 77 | Accidental exposure | FAERS: 1 | US FAERS | |
| 78 | Acne | FAERS: 1 | US FAERS | |
| 79 | Adverse event | FAERS: 1 | US FAERS | |
| 80 | Ageusia | FAERS: 1 | US FAERS | |
| 81 | Anosmia | FAERS: 1 | US FAERS | |
| 82 | Aphasia | FAERS: 1 | US FAERS | |
| 83 | Arthralgia | FAERS: 1 | US FAERS | |
| 84 | Astigmatism | FAERS: 1 | US FAERS | |
| 85 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 86 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 87 | Blepharitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 88 | Blepharospasm | FAERS: 1 | US FAERS | |
| 89 | Blood cholesterol increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 90 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 91 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 92 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 93 | Bronchitis | FAERS: 1 | US FAERS | |
| 94 | Calcinosis | FAERS: 1 | US FAERS | |
| 95 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 96 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 97 | Chest discomfort | FAERS: 1 | US FAERS | |
| 98 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 99 | Delirium | FAERS: 1 | US FAERS | |
| 100 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 101 | Discomfort | FAERS: 1 | US FAERS | |
| 102 | Disease Progression | FAERS: 1 | US FAERS | |
| 103 | Drug dose omission | FAERS: 1 | US FAERS | |
| 104 | Dry skin | FAERS: 1 | US FAERS | |
| 105 | Dysphonia | FAERS: 1 | US FAERS | |
| 106 | Eczema | FAERS: 1 | US FAERS | |
| 107 | Escherichia infection | FAERS: 1 | US FAERS | |
| 108 | Expired product administered | FAERS: 1 | US FAERS | |
| 109 | Eye Burns | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 110 | Eye Redness | FAERS: 1 | US FAERS | |
| 111 | Eye allergy | FAERS: 1 | US FAERS | |
| 112 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 113 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 114 | Gastritis | FAERS: 1 | US FAERS | |
| 115 | Gout | FAERS: 1 | US FAERS | |
| 116 | Hepatitis B | FAERS: 1 | US FAERS | |
| 117 | Heterochromia iridis | FAERS: 1 | US FAERS | |
| 118 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 119 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 120 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 121 | Inflammation | FAERS: 1 | US FAERS | |
| 122 | Instillation site erythema | FAERS: 1 | US FAERS | |
| 123 | Instillation site foreign body sensation | FAERS: 1 | US FAERS | |
| 124 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 125 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 126 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 127 | Lip swelling | FAERS: 1 | US FAERS | |
| 128 | Lordosis | FAERS: 1 | US FAERS | |
| 129 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 130 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 131 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 132 | Macule | FAERS: 1 | US FAERS | |
| 133 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 134 | Medication residue | FAERS: 1 | US FAERS | |
| 135 | Memory impairment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Mood swings | FAERS: 1 | US FAERS | |
| 137 | Myalgia | FAERS: 1 | US FAERS | |
| 138 | Myopia | FAERS: 1 | US FAERS | |
| 139 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 140 | Nausea | FAERS: 1 | US FAERS | |
| 141 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 142 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 143 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 144 | Pallor | FAERS: 1 | US FAERS | |
| 145 | Palpitations | FAERS: 1 | US FAERS | |
| 146 | Procedural complication | FAERS: 1 | US FAERS | |
| 147 | Product administration error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Product container seal issue | FAERS: 1 | US FAERS | |
| 149 | Product deposit | FAERS: 1 | US FAERS | |
| 150 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 151 | Product dropper issue | FAERS: 1 | US FAERS | |
| 152 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 153 | Product lot number issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 155 | Product prescribing error | FAERS: 1 | US FAERS | |
| 156 | Product use issue | FAERS: 1 | US FAERS | |
| 157 | Rash erythematous | FAERS: 1 | US FAERS | |
| 158 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 159 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 160 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 161 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 162 | Skin lesion | FAERS: 1 | US FAERS | |
| 163 | Skin tightness | FAERS: 1 | US FAERS | |
| 164 | Sleep Talking | FAERS: 1 | US FAERS | |
| 165 | Stomatitis | FAERS: 1 | US FAERS | |
| 166 | Suspected product quality issue | FAERS: 1 | US FAERS | |
| 167 | Tachycardia | FAERS: 1 | US FAERS | |
| 168 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 169 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 170 | Thrombosis | FAERS: 1 | US FAERS | |
| 171 | Toothache | FAERS: 1 | US FAERS | |
| 172 | Torticollis | FAERS: 1 | US FAERS | |
| 173 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 174 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 175 | Ulcer | FAERS: 1 | US FAERS | |
| 176 | Unevaluable event | FAERS: 1 | US FAERS | |
| 177 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 178 | Upper respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 179 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 180 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 181 | Urticaria | FAERS: 1 | US FAERS | |
| 182 | Vertigo | FAERS: 1 | US FAERS | |
| 183 | Visual disturbance | FAERS: 1 | US FAERS | |
| 184 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 185 | nervous system disorder | FAERS: 1 | US FAERS | |
| 186 | Anxiety | Canada Vigilance: 1 | Canada Vigilance | |
| 187 | Application site reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 188 | Arthropod sting | Canada Vigilance: 1 | Canada Vigilance | |
| 189 | Drug ineffective for unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 190 | Eyelids pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 191 | Product administered to patient of inappropriate age | Canada Vigilance: 1 | Canada Vigilance | |
| 192 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.